Category: flavor and fragrance agents
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
Food Chemicals Codex Listed: | No |
Shelf Life: | 36.00 month(s) or longer if stored properly. |
Storage: | store in cool, dry place in tightly sealed containers, protected from heat and light. |
Soluble in: |
| alcohol |
Insoluble in: |
| water |
Organoleptic Properties:
|
Odor Type: woody |
|
Odor Strength: | medium |
|
Substantivity: | 400 hour(s) at 100.00 % |
|
| woody woody old wood dry earthy weedy balsamic spicy minty |
Odor Description: at 100.00 %. | woody old wood dry earthy weedy balsamic spicy minty |
|
|
Flavor Type: woody |
|
| patchouli |
Taste Description:
| patchouli |
|
Odor and/or flavor descriptions from others (if found). |
|
Firmenich |
PATCHOULI COEUR SFE for fragrance |
Odor Description: | Woody, balsamic, earthy, camphor PATCHOULI HEART SFE can be used in masculine and
feminine compositions up to 10%.
The SFE process preserves all the facets and the natural
profile identity to guarantee a high purity extract. |
Taste Description: | patchouli |
|
|
Cosmetic Information:
Suppliers:
Diffusions Aromatiques |
PATCHOULI COEUR SFE
|
Ernesto Ventós |
PATCHOULI HEART SFE FIRMENICH 970929
|
Firmenich |
PATCHOULI COEUR SFE
for fragrance Odor: Woody, balsamic, earthy, camphor Use: PATCHOULI HEART SFE can be used in masculine and
feminine compositions up to 10%.
The SFE process preserves all the facets and the natural
profile identity to guarantee a high purity extract. |
Hermitage Oils |
Patchouli HEART CO2 (SELECT)
Odor: characteristic Use: Honestly Patchouli HEART CO2 (SELECT) is so good, beautifully balanced; all notes are clean, well-polished, and smooth. Everything about this aroma works in harmony. I still think no material displays the heart notes of Patchouli as well as the absolute and would say this aroma is the middle ground of the molecular distilled essential oil and the absolute offerings. This material contains 54% of the desired Patchoulol with 0.5% of norpatchoulenol. Patchouli C02 is produced by super fluid extraction of the fractionation patchouli material. The colour is pale yellow and it is of a thin and pourable viscosity. |
The Perfumery |
Patchouli CO2 Select, India
Odor: characteristic Use: Patchouli CO2 Select has a very intense, woody, fresh, smoky aroma. This CO2 is a great addition to Patchouli and Frankincense blends to add an extra layer of freshness and power. It also blends well Clove, Bergamot, Cinnamon, Black Pepper, and Cedarwood oils. |
Safety Information:
European information : |
Most important hazard(s): | Xi - Irritant |
R 36/38 - Irritating to skin and eyes.
|
|
Hazards identification |
|
Classification of the substance or mixture |
GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
None found. |
GHS Label elements, including precautionary statements |
|
Pictogram | |
|
Hazard statement(s) |
None found. |
Precautionary statement(s) |
None found. |
Oral/Parenteral Toxicity: |
oral-rat LD50 > 5000 mg/kg Food and Chemical Toxicology. Vol. 20, Pg. 791, 1982.
|
Dermal Toxicity: |
skin-rabbit LD50 > 5000 mg/kg Food and Chemical Toxicology. Vol. 20, Pg. 791, 1982.
|
Inhalation Toxicity: |
Not determined
|
Safety in Use Information:
Category: | flavor and fragrance agents |
RIFM Fragrance Material Safety Assessment: Search |
IFRA Code of Practice Notification of the 49th Amendment to the IFRA Code of Practice |
Recommendation for patchouli oil CO2 extract usage levels up to: | | 10.0000 % in the fragrance concentrate.
|
|
Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). |
The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA Flavor Ingredient Library |
publication number: 3 |
Click here to view publication 3 |
| average usual ppm | average maximum ppm |
baked goods: | - | 10.00000 |
beverages(nonalcoholic): | - | 0.88000 |
beverages(alcoholic): | - | - |
breakfast cereal: | - | - |
cheese: | - | - |
chewing gum: | 43.00000 | 220.00000 |
condiments / relishes: | - | - |
confectionery froastings: | - | - |
egg products: | - | - |
fats / oils: | - | - |
fish products: | - | - |
frozen dairy: | - | 1.10000 |
fruit ices: | - | 1.10000 |
gelatins / puddings: | - | - |
granulated sugar: | - | - |
gravies: | - | - |
hard candy: | - | 6.30000 |
imitation dairy: | - | - |
instant coffee / tea: | - | - |
jams / jellies: | - | - |
meat products: | - | - |
milk products: | - | - |
nut products: | - | - |
other grains: | - | - |
poultry: | - | - |
processed fruits: | - | - |
processed vegetables: | - | - |
reconstituted vegetables: | - | - |
seasonings / flavors: | - | - |
snack foods: | - | - |
soft candy: | - | - |
soups: | - | - |
sugar substitutes: | - | - |
sweet sauces: | - | - |
Safety References:
References:
| pogostemon cablin oil CO2 extract |
Canada Domestic Sub. List: | 8014-09-3 |
Pubchem (sid): | 135316842 |
Other Information:
Potential Blenders and core components note
|
For Odor |
amber |
| amber acetate | FR |
| amber cyclohexanol | FR |
| amber spirolene | FR |
| ambergris tincture | FL/FR |
| ambrette seed absolute | FL/FR |
| cistus ladaniferus resinoid | FL/FR |
| labdanum oil | FL/FR |
| labdanum oil replacer | FR |
| labdanum resinoid replacer | FR |
animal |
| ambergris tincture replacer | FR |
balsamic |
1- | benzoyl acetone | FL/FR |
| copaiba balsam oil | FL/FR |
| gurjun balsam | FR |
bitter |
| gentian absolute | FL/FR |
camphoreous |
| fenchol | FL/FR |
citrus |
2- | cyclohexyl-4-methyl-1,3-oxathiane | |
bitter | orange peel oil | FL/FR |
earthy |
| cabralea cangerana root bark oil | FR |
2- | ethyl fenchol | FL/FR |
2- | octanone | FL/FR |
| patchouli cyclohexanol | FR |
scotch | pine needle oil | FL/FR |
scotch | pine needle oil estonia | FL/FR |
scotch | pine needle oil yugoslavia | FL/FR |
| pogostemon cablin leaf extract | FR |
floral |
| floral undecenone | FR |
iso | jasmone | FL/FR |
| primrose fragrance | FR |
fruity |
1-(3,3- | dimethyl bicyclo(2.2.1)hept-2-yl)-2-methyl cyclohex-3-ene carbaldehyde | FR |
alpha- | ionyl ethyl ether | |
| valeriana officinalis root extract | FL/FR |
green |
iso | amyl formate | FL/FR |
| fragaria vesca leaf absolute | FR |
| galbascone (IFF) | FR |
| methyl cyclocitrone (IFF) | FR |
| oakmoss oil | FR |
2- | propenyl-para-cymene | FR |
| seaweed absolute (fucus vesiculosus et serratus) | FL/FR |
herbal |
1- | allyl-2,2,7,7-tetramethyl cycloheptanol | FR |
delta- | cadinene | |
| camphene carbinol | FR |
| camphene carbinyl acetate | FR |
| clary specialty | FR |
| dimethyl cyclormol (IFF) | FR |
| herbal carene | FR |
| lavandin water absolute | FL/FR |
| pine hexanol | FR |
beta- | pinene | FL/FR |
laevo-beta- | pinene | FL/FR |
mossy |
| treemoss absolute | FR |
| treemoss absolute replacer | FR |
musk |
| dehydro beta-linalool | FL/FR |
oily |
| mcp acetate | FR |
powdery |
| midnight passion fragrance | FR |
resinous |
| mastic absolute | FL/FR |
spicy |
beta- | caryophyllene | FL/FR |
terpenic |
| frankincense oil | FL/FR |
| frankincense oil CO2 extract | FL/FR |
woody |
| amber pentadecane | FR |
| briar wood fragrance | FR |
para-tert- | butyl cyclohexanone | FR |
| cadinene | FL/FR |
| calarene epoxide | |
beta- | caryophyllene alcohol acetate | FL/FR |
atlas | cedarwood absolute | FR |
atlas | cedarwood oil | FR |
| cedarwood oil alcohols | FL/FR |
| cedrela wood oil | FR |
| cedrelopsis grevei bark oil | FR |
alpha- | cedrene epoxide | FR |
| cedrenyl acetate | FR |
| cedrol methyl ether | FR |
| cistus ladaniferus gum | FR |
| cistus twig/leaf oil molecular distilled | FL/FR |
| cypriol oil (cyperus scariosus) | FR |
2- | decalinyl formate | FR |
| dogwood fragrance | FR |
| dogwood specialty | FR |
| frankincense gum | FL/FR |
| frankincense oil replacer | FR |
| guaiene | FL/FR |
| gurjun balsam oil | FR |
1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| herbal norbornane | FR |
5,5a,6,7,8,8a- | hexahydro-6,6,7,8,8-pentamethyl-4H-indeno[5,4-D]isoxazole | |
| hinoki root oil | FR |
(1R,4S,5S,9R)-1- | hydroxy-1,4,7,7,9-pentamethyl spiro(4.5)decan-2-one | |
8- | hydroxy-5-isopropyl-8-methyl-non-6-en-2-one | |
| labdanum concrete | FR |
| labdanum ethanone | FR |
| laminaria absolute | FR |
iso | longifolene ketone | FR |
| louro brasileiro wood oil | FR |
| manevoro oil | FR |
para- | menth-3-en-1-ol | FL/FR |
2- | methoxy-4-vinyl phenol | FL/FR |
delta- | methyl ionone | FL/FR |
| methyl vetivate | FR |
2- | methyl-1-(5',5',6'-trimethyl bicyclo(2.2.1)hept-2'-yl) propan-2-ol | FR |
| moss naphthaleneol | FR |
| octahydro-3(or 2),4-dimethyl-4,7-methanoinden-5-ol | |
| olibanum specialty | FR |
| patchouli absolute | FR |
| patchouli alcohol | FR |
| patchouli essence | FL/FR |
| patchouli ethanol | FR |
| patchouli ethanone | FR |
| patchouli extract acetylated | FR |
| patchouli fractions | FR |
| patchouli fragrance | FR |
| patchouli hexanol | FR |
| patchouli leaf water | FR |
| patchouli oil | FL/FR |
terpeneless | patchouli oil | FL/FR |
| patchouli oil china | FL/FR |
| patchouli oil decolorized | FL/FR |
| patchouli oil molecular distilled | FL/FR |
| patchouli oil replacer | FR |
| patchouli residues | FR |
| patchouli specialty | FR |
| patchouli woody amber fragrance | FR |
| pinacol | FR |
| pogostemon cablin leaf oil | FR |
| sandalwood oil west australia (santalum spicatum) | FR |
2,6,10,10- | tetramethyl-1-oxa-spiro[4.5]dec-3-ene-6-ol | |
| thujopsis dolabrata wood oil | FR |
3(or 2),4,5- | trimethyl octahydro-4,7-methanoinden-5-ol | FR |
| woody dodecane | FR |
| woody epoxide | FR |
| woody ether | FR |
| woody propanol | FR |
|
For Flavor |
|
No flavor group found for these |
| ambergris tincture | FL/FR |
1- | benzoyl acetone | FL/FR |
delta- | cadinene | |
| calarene epoxide | |
beta- | caryophyllene alcohol acetate | FL/FR |
| cedarwood oil alcohols | FL/FR |
| cistus ladaniferus resinoid | FL/FR |
2- | cyclohexyl-4-methyl-1,3-oxathiane | |
| dehydro beta-linalool | FL/FR |
| gentian absolute | FL/FR |
1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
5,5a,6,7,8,8a- | hexahydro-6,6,7,8,8-pentamethyl-4H-indeno[5,4-D]isoxazole | |
(1R,4S,5S,9R)-1- | hydroxy-1,4,7,7,9-pentamethyl spiro(4.5)decan-2-one | |
8- | hydroxy-5-isopropyl-8-methyl-non-6-en-2-one | |
alpha- | ionyl ethyl ether | |
para- | menth-3-en-1-ol | FL/FR |
delta- | methyl ionone | FL/FR |
| octahydro-3(or 2),4-dimethyl-4,7-methanoinden-5-ol | |
scotch | pine needle oil | FL/FR |
scotch | pine needle oil estonia | FL/FR |
scotch | pine needle oil yugoslavia | FL/FR |
laevo-beta- | pinene | FL/FR |
| seaweed absolute (fucus vesiculosus et serratus) | FL/FR |
2,6,10,10- | tetramethyl-1-oxa-spiro[4.5]dec-3-ene-6-ol | |
amber |
| labdanum oil | FL/FR |
balsamic |
| copaiba balsam oil | FL/FR |
camphoreous |
| fenchol | FL/FR |
citrus |
bitter | orange peel oil | FL/FR |
dairy |
2- | octanone | FL/FR |
earthy |
2- | ethyl fenchol | FL/FR |
| valeriana officinalis root extract | FL/FR |
green |
iso | amyl formate | FL/FR |
iso | jasmone | FL/FR |
| lavandin water absolute | FL/FR |
phenolic |
2- | hydroxyisophorone | FL |
pine |
beta- | pinene | FL/FR |
resinous |
| mastic absolute | FL/FR |
smoky |
2- | methoxy-4-vinyl phenol | FL/FR |
spicy |
beta- | caryophyllene | FL/FR |
woody |
| ambrette seed absolute | FL/FR |
| cadinene | FL/FR |
| cistus twig/leaf oil molecular distilled | FL/FR |
| frankincense gum | FL/FR |
| frankincense oil | FL/FR |
| frankincense oil CO2 extract | FL/FR |
| guaiene | FL/FR |
| patchouli essence | FL/FR |
terpeneless | patchouli oil | FL/FR |
| patchouli oil | FL/FR |
| patchouli oil china | FL/FR |
| patchouli oil decolorized | FL/FR |
| patchouli oil molecular distilled | FL/FR |
|
Potential Uses:
Occurrence (nature, food, other): note
Synonyms:
| pogostemon cablin oil CO2 extract | | pogostemon patchouli oil CO2 extract | | tilam wangi oil CO2 extract |
Articles:
|