Category: flavor and fragrance agents
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
Appearance: | brownish orange reddish clear oily liquid (est) |
Food Chemicals Codex Listed: | No |
Specific Gravity: | 0.95000 to 0.97500 @ 25.00 °C.
|
Pounds per Gallon - (est).: | 7.905 to 8.113
|
Specific Gravity: | 0.95300 to 0.97800 @ 20.00 °C.
|
Pounds per Gallon - est.: | 7.939 to 8.147
|
Refractive Index: | 1.49900 to 1.51500 @ 20.00 °C.
|
Optical Rotation: | -48.00 to -65.00
|
Boiling Point: | 287.00 °C. @ 760.00 mm Hg
|
Flash Point: | 190.00 °F. TCC ( 87.78 °C. )
|
Shelf Life: | 36.00 month(s) or longer if stored properly. |
Storage: | store in cool, dry place in tightly sealed containers, protected from heat and light. |
Soluble in: |
| alcohol | | water, 42.87 mg/L @ 25 °C (est) |
Insoluble in: |
| water |
Organoleptic Properties:
|
Odor Type: woody |
|
Odor Strength: | medium |
|
Substantivity: | 400 hour(s) at 100.00 % |
|
| patchouli |
Odor Description: at 100.00 %. | patchouli |
|
|
Flavor Type: woody |
|
| woody earthy weedy balsamic spicy camphoreous |
Taste Description:
| woody earthy weedy balsamic spicy camphoreous |
|
Odor and/or flavor descriptions from others (if found). |
|
Pell Wall Perfumes |
Patchouli Ultra Light (65% Patchoulol) |
Odor Description: | patchouli, earthy, amber. Diffusive This form of molecular distilled patchouli contains a full 65% patchoulol (patchouli alcohol) and as a result has a very high impact on the diffusion and sillage of a fragrance witout introducing an overwhelming patchouli character. |
Taste Description: | patchouli |
|
Hermitage Oils |
Patchouli Molecular Distilled |
Odor Description: | characteristic Adam Michael has this to say “This material is created as follows, the dark patchouli is sent from Indonesia to France. It is then re-distilled using a molecular still that results in all the components breaking down. Within this molecular still we have a plate and all the non-volatile parts such as residual waxes will stick to the plate. All the volatile vapours are collected and run through a condensing column and turned back into molecular distilled patchouli. It is golden yellow in colour and the smell is very clean and pleasant. |
Taste Description: | patchouli |
|
Perfumery Laboratory |
Patchouli OIL MD Biolandes |
Odor Description: | Rich, deep, woody, amber-earthy aroma with a touch of powdery |
Taste Description: | patchouli |
|
Van Aroma |
PATCHOULI OIL SUMATRA MOLECULAR DISTILLED MIN 32% PA |
Odor Description: | Sweet-herbaceous, aromatic-spicy and woody-balsamic |
Taste Description: | woody earthy weedy balsamic spicy camphoreous |
|
IFF |
Patchouli Oil Indonesia MD |
Odor Description: | Woody with an earthy mint humidity, moss effect with a chocolate leather touch |
Taste Description: | woody earthy weedy balsamic spicy camphoreous |
|
|
Cosmetic Information:
Suppliers:
Berjé |
Patchouli Oil Molecular Distilled
|
Media |
Bontoux |
PATCHOULI MD ESSENTIAL OIL
|
Charabot |
Patchouli indo molecular oil
100% Pure & Natural, Kosher Odor: Woody, earthy |
Ernesto Ventós |
PATCHOULI MD, 30%
|
Ernesto Ventós |
PATCHOULI OIL MD 45% PATCHOULOL
|
Ernesto Ventós |
PATCHOULI OIL MD 65% PATCHOULOL
|
Ernesto Ventós |
PATCHOULI OIL MD 80% PATCHOULOL
|
Ernesto Ventós |
PATCHOULI OIL MD 865 INDESSO
|
Ernesto Ventós |
PATCHOULI OIL MD
|
Fine Fragrances Pvt Ltd |
Patchouli Oil Indonesia MD LMR
|
Global Essence |
Patchouli Oil MD
|
Hermitage Oils |
Patchouli Molecular Distilled (65% Patchoulol)
Odor: characteristic Use: Adam Michael has this to say about Patchouli Molecular Distilled (65% Patchoulol) “The appearance of this material resembles that of rose otto on a cold morning, very crystalised. As such this material needs a good 4-6 minutes of warmth before you can work with it. To my nose the aroma is comparable to patchouli light, displaying more of the cleaner, fresher, watery facets I detect within patchouli light following with camphoraceous and woody undertones. Steam distilled material which is then molecular distilled. The patchoulol content is a mind blowing 65%.” |
Hermitage Oils |
Patchouli Molecular Distilled
Odor: characteristic Use: Adam Michael has this to say “This material is created as follows, the dark patchouli is sent from Indonesia to France. It is then re-distilled using a molecular still that results in all the components breaking down. Within this molecular still we have a plate and all the non-volatile parts such as residual waxes will stick to the plate. All the volatile vapours are collected and run through a condensing column and turned back into molecular distilled patchouli. It is golden yellow in colour and the smell is very clean and pleasant. |
IFF |
Patchouli Oil Indonesia MD
Odor: Woody with an earthy mint humidity, moss effect with a chocolate leather touch |
Indukern F&F |
PATCHOULI OIL MD
Odor: WOODY, SWEET, BALSAMIC |
Kanta Enterprises |
Patchouli Molecular Distillation Oil
|
Lluch Essence |
PATCHOULI DM SULAWESI OIL (29% PATCHOULOL/IRON FREE)
|
Moellhausen |
PATCHOULY EO MD 30% PA
|
Moellhausen |
PATCHOULY OIL MD
|
OQEMA |
Patchouli Oil MD
|
Payand Betrand |
Patchouly Oil Molecular distillation France
For fragrance use |
Pell Wall Perfumes |
Patchouli Ultra Light (65% Patchoulol)
Odor: patchouli, earthy, amber. Diffusive Use: This form of molecular distilled patchouli contains a full 65% patchoulol (patchouli alcohol) and as a result has a very high impact on the diffusion and sillage of a fragrance witout introducing an overwhelming patchouli character. |
Penta International |
PATCHOULY OIL MD COLORLESS
|
Perfumer Supply House |
Patchouli Oil MD 65% Patchoulol (Ventos)
Odor: A deep woody, odor which is earthy, and camphoraceous and somewhat powdery |
Perfumery Laboratory |
Patchouli OIL MD Biolandes
Odor: Rich, deep, woody, amber-earthy aroma with a touch of powdery |
Phoenix Aromas & Essential Oils |
Patchouli Oil Md
|
Prodasynth |
PATCHOULI OIL 65%
(PATCHOULOL > 65%) Odor: CAMPHORACEOUS AND WOODY UNDERTONES |
Prodasynth |
PATCHOULI OIL MD
(PATCHOULOL > 32%) Odor: CAMPHORACEOUS AND WOODY UNDERTONES |
PT Mitra Ayu Adi Pratama |
Patchouli MD PA 40+
|
PT Mitra Ayu Adi Pratama |
Patchouli MD PA 60+
|
R C Treatt & Co Ltd |
Patchouli Oil Decolourised M.D.
|
Robertet |
Patchouli indo molecular oil
100% Pure & Natural, Kosher Odor: Woody, earthy |
Seasons and Harvest / Crop calendar |
SRS Aromatics |
PATCHOULI OIL INDONESIAN MD
|
The Lebermuth Company |
Patchouli M.D.
Odor: Camphoraceous, woody |
Spring/Summer 2022 Fragrance Trends |
Ultra International |
Patchouli Oil MD Indonesia
|
Crop Calendar |
Ungerer & Company |
Patchouli Oil MD
|
Van Aroma |
PATCHOULI OIL SULAWESI MOLECULAR DISTILLED MIN 30% PA
|
maps.vanaroma.com |
Van Aroma |
PATCHOULI OIL SUMATRA MOLECULAR DISTILLED MIN 30% PA
|
Van Aroma |
PATCHOULI OIL SUMATRA MOLECULAR DISTILLED MIN 32% PA
Odor: Sweet-herbaceous, aromatic-spicy and woody-balsamic |
Van Aroma |
PATCHOULI OIL SUMATRA MOLECULAR DISTILLED MIN 34% PA
|
Vigon International |
Patchouli Oil Molecular Distilled
|
Safety Information:
|
Hazards identification |
|
Classification of the substance or mixture |
GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
None found. |
GHS Label elements, including precautionary statements |
|
Pictogram | |
|
Hazard statement(s) |
None found. |
Precautionary statement(s) |
None found. |
Oral/Parenteral Toxicity: |
oral-rat LD50 > 5000 mg/kg Food and Chemical Toxicology. Vol. 20, Pg. 791, 1982.
|
Dermal Toxicity: |
skin-rabbit LD50 > 5000 mg/kg Food and Chemical Toxicology. Vol. 20, Pg. 791, 1982.
|
Inhalation Toxicity: |
Not determined
|
Safety in Use Information:
Category: | flavor and fragrance agents |
RIFM Fragrance Material Safety Assessment: Search |
IFRA Code of Practice Notification of the 49th Amendment to the IFRA Code of Practice |
Recommendation for patchouli oil molecular distilled usage levels up to: | | 10.0000 % in the fragrance concentrate.
|
|
Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). |
The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA Flavor Ingredient Library |
publication number: 3 |
Click here to view publication 3 |
| average usual ppm | average maximum ppm |
baked goods: | - | 10.00000 |
beverages(nonalcoholic): | - | 0.88000 |
beverages(alcoholic): | - | - |
breakfast cereal: | - | - |
cheese: | - | - |
chewing gum: | 43.00000 | 220.00000 |
condiments / relishes: | - | - |
confectionery froastings: | - | - |
egg products: | - | - |
fats / oils: | - | - |
fish products: | - | - |
frozen dairy: | - | 1.10000 |
fruit ices: | - | 1.10000 |
gelatins / puddings: | - | - |
granulated sugar: | - | - |
gravies: | - | - |
hard candy: | - | 6.30000 |
imitation dairy: | - | - |
instant coffee / tea: | - | - |
jams / jellies: | - | - |
meat products: | - | - |
milk products: | - | - |
nut products: | - | - |
other grains: | - | - |
poultry: | - | - |
processed fruits: | - | - |
processed vegetables: | - | - |
reconstituted vegetables: | - | - |
seasonings / flavors: | - | - |
snack foods: | - | - |
soft candy: | - | - |
soups: | - | - |
sugar substitutes: | - | - |
sweet sauces: | - | - |
Safety References:
References:
Other Information:
Potential Blenders and core components note
|
For Odor |
No odor group found for these |
2- | methyl-3-isobutyl quinoxaline | |
|
(E)- | sabinene hydrate | FL/FR |
aldehydic |
| dodecanal (aldehyde C-12 lauric) | FL/FR |
amber |
| amber acetate | FR |
| amber cyclohexanol | FR |
| amber oxepin | FR |
| amber spirolene | FR |
| ambergris tincture | FL/FR |
| ambrette seed absolute | FL/FR |
| ambrette seed oil | FL/FR |
alpha- | ambrinol | FL/FR |
| angelica root oil | FL/FR |
| cistus ladaniferus resinoid | FL/FR |
| labdanum oil | FL/FR |
| labdanum oil replacer | FR |
| labdanum resinoid replacer | FR |
animal |
| ambergris tincture replacer | FR |
| animal carbolactone | FR |
| costus valerolactone | FR |
| indole | FL/FR |
anisic |
para- | anisaldehyde | FL/FR |
para- | anisyl phenyl acetate | FL/FR |
balsamic |
iso | amyl benzoate | FL/FR |
| amyris wood oil | FL/FR |
siam | benzoin absolute | FL/FR |
sumatra | benzoin absolute | FL/FR |
| benzoin absolute replacer | FL/FR |
siam | benzoin resin | FL/FR |
sumatra | benzoin resinoid | FL/FR |
siam | benzoin resinoid | FL/FR |
1- | benzoyl acetone | FL/FR |
| benzyl benzoate | FL/FR |
| benzyl salicylate | FL/FR |
(E)- | benzyl tiglate | FL/FR |
dextro,laevo- | borneol | FL/FR |
dextro,laevo-iso | borneol | FL/FR |
iso | bornyl acetate | FL/FR |
laevo- | bornyl acetate | FL/FR |
iso | bornyl formate | FL/FR |
iso | bornyl isobutyrate | FL/FR |
| brachyleana hutchinsii wood oil | FR |
iso | butyl cinnamate | FL/FR |
| cinnamyl alcohol | FL/FR |
| cinnamyl formate | FL/FR |
| conifer acetate | FR |
| copaiba balsam oil | FL/FR |
| ethyl cinnamate | FL/FR |
dextro- | fenchone | FL/FR |
| fir balsam absolute | FR |
| fir needle oil canada | FL/FR |
| fir needle oil siberia | FL/FR |
| fir needle oil terpeneless canada | FL/FR |
| guaiacyl phenyl acetate | FL/FR |
| guaiyl butyrate | FR |
| gurjun balsam | FR |
| hemlock western oil (tsuga heterophylla) canada | FR |
| juniper berry absolute | FL/FR |
| juniper berry oil terpeneless | FL/FR |
| methyl cinnamate | FL/FR |
| myrrh absolute | FL/FR |
| myrrh oil | FL/FR |
| myrrh resinoid | FR |
| opoponax oil (balsamodendron kafal) | FL/FR |
3- | phenyl propyl alcohol | FL/FR |
| tolu balsam absolute | FL/FR |
| tolu balsam resinoid | FL/FR |
berry |
| raspberry ketone methyl ether | FL/FR |
bitter |
| gentian absolute | FL/FR |
camphoreous |
| fenchol | FL/FR |
caramellic |
| immortelle absolute | FL/FR |
citrus |
| bergamot oil | FL/FR |
2- | cyclohexyl-4-methyl-1,3-oxathiane | |
(E+Z)-4,8- | dimethyl-3,7-nonadien-2-yl acetate | FL/FR |
bitter | orange peel oil | FL/FR |
coconut |
gamma- | heptalactone | FL/FR |
gamma- | nonalactone (aldehyde C-18 (so-called)) | FL/FR |
earthy |
| cabralea cangerana root bark oil | FR |
2- | ethyl fenchol | FL/FR |
(-)-alpha- | fenchol | FL/FR |
2- | octanone | FL/FR |
scotch | pine needle oil | FL/FR |
scotch | pine needle oil estonia | FL/FR |
scotch | pine needle oil yugoslavia | FL/FR |
| pogostemon cablin leaf extract | FR |
floral |
alpha- | amyl cinnamaldehyde | FL/FR |
| cananga oil | FL/FR |
| cyclohexyl ethyl alcohol | FL/FR |
| dihydro-alpha-ionone | FL/FR |
| dihydrojasmone | FL/FR |
| floral pyranol | FR |
| floral undecenone | FR |
| heliotropin | FL/FR |
| heliotropyl acetone | FL/FR |
alpha- | hexyl cinnamaldehyde | FL/FR |
| ho leaf oil | FR |
| hydroxycitronellal | FL/FR |
iso | jasmone | FL/FR |
laevo- | linalool | FL/FR |
| linalool oxide | FL/FR |
para- | methyl acetophenone | FL/FR |
| methyl dihydrojasmonate | FL/FR |
| nerolidol | FL/FR |
| orris pyridine 25% IPM | FR |
| orris rhizome absolute (iris pallida) | FL/FR |
| palmarosa oil | FL/FR |
| phenethyl alcohol | FL/FR |
| phenethyl phenyl acetate | FL/FR |
| phenethyl salicylate | FL/FR |
| primrose fragrance | FR |
| rose absolute (rosa centifolia) morocco | FL/FR |
| rose absolute (rosa damascena) bulgaria | FL/FR |
| rose carboxylate | FR |
| tuberose absolute chassis | FL/FR |
fruity |
| allyl cinnamate | FL/FR |
1-(3,3- | dimethyl bicyclo(2.2.1)hept-2-yl)-2-methyl cyclohex-3-ene carbaldehyde | FR |
alpha- | ionyl ethyl ether | |
| valeriana officinalis root extract | FL/FR |
green |
iso | amyl formate | FL/FR |
iso | cyclocitral (IFF) | FL/FR |
| fern absolute | |
| galbanum absolute | FL/FR |
| galbanum oil | FL/FR |
| galbanum oleoresin | FL/FR |
| galbanum resinoid | FL/FR |
| galbascone (IFF) | FR |
| methyl cyclocitrone (IFF) | FR |
| oakmoss oil | FR |
2- | propenyl-para-cymene | FR |
| seaweed absolute (fucus vesiculosus et serratus) | FL/FR |
| valerian rhizome oil CO2 extract china | FL/FR |
| violet leaf absolute | FL/FR |
hay |
| hay absolute | FR |
herbal |
1- | allyl-2,2,7,7-tetramethyl cycloheptanol | FR |
| camphene carbinol | FR |
| camphene carbinyl acetate | FR |
| canarium luzonicum gum | FL/FR |
| cardamom oleoresin | FL/FR |
| clary sage oil france | FL/FR |
| clary specialty | FR |
| dimethyl cyclormol (IFF) | FR |
| herbal carene | FR |
6- | hydroxydihydrotheaspirane (mixture of isomers) | FL/FR |
abrialis | lavandin oil | FL/FR |
| lavandin water absolute | FL/FR |
| lavender absolute bulgaria | FL/FR |
| nopyl acetate | FR |
| pine hexanol | FR |
beta- | pinene | FL/FR |
laevo-beta- | pinene | FL/FR |
alpha- | pinene | FL/FR |
| rosemary absolute | FL/FR |
| rosemary oil morocco | FL/FR |
| rosemary oil spain | FL/FR |
| safranal | FL/FR |
| valerian rhizome oil | FL/FR |
| valerian rhizome oil china | FL/FR |
melon |
| watermelon ketone | FR |
minty |
| methyl salicylate | FL/FR |
mossy |
| oakmoss absolute | FL/FR |
| oakmoss distillates | FL/FR |
| treemoss absolute | FR |
| veramoss (IFF) | FR |
musk |
| dehydro beta-linalool | FL/FR |
naphthyl |
para- | methyl anisole | FL/FR |
ortho- | methyl anisole | FL/FR |
nutty |
2,3,5,6- | tetramethyl pyrazine | FL/FR |
oily |
| mcp acetate | FR |
phenolic |
para-alpha- | dimethyl styrene | FL/FR |
powdery |
para- | anisyl alcohol | FL/FR |
| midnight passion fragrance | FR |
resinous |
| mastic absolute | FL/FR |
spicy |
| benzyl isoeugenol | FL/FR |
4- | carvomenthenol | FL/FR |
beta- | caryophyllene | FL/FR |
alpha- | caryophyllene alcohol | FL/FR |
beta- | caryophyllene alcohol | FL/FR |
| cassia bark oil china | FL/FR |
| clove bud oil | FL/FR |
| elettaria cardamomum seed oil | FL/FR |
| eugenol | FL/FR |
iso | eugenyl acetate | FL/FR |
| ginger root oil brazil | FL/FR |
| ginger root oil china | FL/FR |
| ginger root oil cochin | FL/FR |
2- | methoxy-4-vinyl phenol | FL/FR |
alpha- | methyl cinnamaldehyde | FL/FR |
| nutmeg absolute | FL/FR |
| nutmeg oil | FL/FR |
| nutmeg oil CO2 extract | FL/FR |
black | pepper oil | FL/FR |
| spicy acetoacetate | FL/FR |
terpenic |
| cypress leaf oil | FR |
| elemi resinoid | FL/FR |
| frankincense oil | FL/FR |
| frankincense oil CO2 extract | FL/FR |
| juniperus communis fruit oil | FL/FR |
| pine needle oil dwarf | FL/FR |
gamma- | terpinene | FL/FR |
alpha- | terpineol | FL/FR |
thujonic |
| armoise oil | FR |
tonka |
| coumarin | FR |
| tonka bean absolute | FR |
vanilla |
| ethyl vanillin | FL/FR |
| vanilla bean absolute (vanilla planifolia) | FL/FR |
| vanillyl acetate | FL/FR |
waxy |
| decyl acetate | FL/FR |
1- | dodecanol | FL/FR |
| ethyl laurate | FL/FR |
woody |
| agarwood oil | FR |
| amber pentadecane | FR |
| briar wood fragrance | FR |
para-tert- | butyl cyclohexanone | FR |
| cadinene | FL/FR |
| calarene epoxide | |
beta- | caryophyllene alcohol acetate | FL/FR |
atlas | cedarwood absolute | FR |
atlas | cedarwood oil | FR |
| cedarwood oil alcohols | FL/FR |
| cedrela wood oil | FR |
alpha- | cedrene epoxide | FR |
| cedrenyl acetate | FR |
| cedrol methyl ether | FR |
| cedryl methyl ether | FR |
| cistus ladaniferus gum | FR |
| cistus twig/leaf oil | FL/FR |
| cistus twig/leaf oil molecular distilled | FL/FR |
| copaiba balsam | FL/FR |
| cyperus root oil (cyperus scariosus) | FR |
| cypriol oil (cyperus scariosus) | FR |
2- | decalinyl formate | FR |
| dihydro-beta-ionone | FL/FR |
| dogwood fragrance | FR |
| dogwood specialty | FR |
| frankincense gum | FL/FR |
| frankincense oil replacer | FR |
| germacrene B | |
| guaiacwood oil | FL/FR |
| guaiene | FL/FR |
alpha- | guaiene | FL/FR |
| gurjun balsam oil | FR |
alpha- | gurjunene | FR |
1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| herbal norbornane | FR |
5,5a,6,7,8,8a- | hexahydro-6,6,7,8,8-pentamethyl-4H-indeno[5,4-D]isoxazole | |
| hinoki root oil | FR |
(1R,4S,5S,9R)-1- | hydroxy-1,4,7,7,9-pentamethyl spiro(4.5)decan-2-one | |
8- | hydroxy-5-isopropyl-8-methyl-non-6-en-2-one | |
4- | hydroxybenzaldehyde | FL/FR |
| labdanum concrete | FR |
| labdanum ethanone | FR |
iso | longifolene ketone | FR |
| louro brasileiro wood oil | FR |
| manevoro oil | FR |
para- | menth-3-en-1-ol | FL/FR |
| methyl cedryl ketone | FL/FR |
delta- | methyl ionone | FL/FR |
| methyl vetivate | FR |
2- | methyl-1-(5',5',6'-trimethyl bicyclo(2.2.1)hept-2'-yl) propan-2-ol | FR |
| moss naphthaleneol | FR |
| octahydro-3(or 2),4-dimethyl-4,7-methanoinden-5-ol | |
| olibanum specialty | FR |
| orris hexanone | FR |
| patchouli absolute | FR |
| patchouli alcohol | FR |
| patchouli essence | FL/FR |
| patchouli ethanol | FR |
| patchouli ethanone | FR |
| patchouli extract acetylated | FR |
| patchouli fractions | FR |
| patchouli fragrance | FR |
| patchouli hexanol | FR |
| patchouli leaf water | FR |
| patchouli oil | FL/FR |
terpeneless | patchouli oil | FL/FR |
| patchouli oil china | FL/FR |
| patchouli oil CO2 extract | FL/FR |
| patchouli oil decolorized | FL/FR |
| patchouli oil replacer | FR |
| patchouli residues | FR |
| patchouli specialty | FR |
| patchouli woody amber fragrance | FR |
| pinacol | FR |
| pogostemon cablin leaf oil | FR |
| sabinene | FL/FR |
| sandalwood oil | FL/FR |
| sandalwood oil west australia (santalum spicatum) | FR |
| santall | FR |
| santalyl butyrate | FL/FR |
| spruce needle oil canada | FL/FR |
alpha- | terpinene | FL/FR |
beta- | terpineol | FL/FR |
2,6,10,10- | tetramethyl-1-oxa-spiro[4.5]dec-3-ene-6-ol | |
| thuja occidentalis leaf oil | FL/FR |
| thujopsis dolabrata wood oil | FR |
| tobacarol (IFF) | FR |
3(or 2),4,5- | trimethyl octahydro-4,7-methanoinden-5-ol | FR |
| vetiver oil haiti | FL/FR |
| vetiverol | FL/FR |
| woody dodecane | FR |
| woody epoxide | FR |
| woody ether | FR |
| woody propanol | FR |
|
For Flavor |
|
No flavor group found for these |
| allyl cinnamate | FL/FR |
| ambergris tincture | FL/FR |
1- | benzoyl acetone | FL/FR |
dextro,laevo- | borneol | FL/FR |
delta- | cadinene | FL |
| calarene epoxide | |
beta- | caryophyllene alcohol | FL/FR |
alpha- | caryophyllene alcohol | FL/FR |
beta- | caryophyllene alcohol acetate | FL/FR |
| cedarwood oil alcohols | FL/FR |
| cistus ladaniferus resinoid | FL/FR |
2- | cyclohexyl-4-methyl-1,3-oxathiane | |
| dehydro beta-linalool | FL/FR |
(E+Z)-4,8- | dimethyl-3,7-nonadien-2-yl acetate | FL/FR |
| fern absolute | |
| fir needle oil canada | FL/FR |
| gentian absolute | FL/FR |
| germacrene B | |
alpha- | guaiene | FL/FR |
1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
5,5a,6,7,8,8a- | hexahydro-6,6,7,8,8-pentamethyl-4H-indeno[5,4-D]isoxazole | |
(1R,4S,5S,9R)-1- | hydroxy-1,4,7,7,9-pentamethyl spiro(4.5)decan-2-one | |
8- | hydroxy-5-isopropyl-8-methyl-non-6-en-2-one | |
alpha- | ionyl ethyl ether | |
para- | menth-3-en-1-ol | FL/FR |
delta- | methyl ionone | FL/FR |
| octahydro-3(or 2),4-dimethyl-4,7-methanoinden-5-ol | |
scotch | pine needle oil | FL/FR |
scotch | pine needle oil estonia | FL/FR |
scotch | pine needle oil yugoslavia | FL/FR |
laevo-beta- | pinene | FL/FR |
(E)- | sabinene hydrate | FL/FR |
| santalyl butyrate | FL/FR |
| seaweed absolute (fucus vesiculosus et serratus) | FL/FR |
beta- | terpineol | FL/FR |
2,6,10,10- | tetramethyl-1-oxa-spiro[4.5]dec-3-ene-6-ol | |
amber |
| ambrette seed oil | FL/FR |
alpha- | ambrinol | FL/FR |
| labdanum oil | FL/FR |
animal |
| indole | FL/FR |
anisic |
para- | anisyl phenyl acetate | FL/FR |
balsamic |
| benzoin absolute replacer | FL/FR |
siam | benzoin resin | FL/FR |
sumatra | benzoin resinoid | FL/FR |
siam | benzoin resinoid | FL/FR |
| benzyl benzoate | FL/FR |
| benzyl salicylate | FL/FR |
(E)- | benzyl tiglate | FL/FR |
laevo- | bornyl acetate | FL/FR |
iso | bornyl isobutyrate | FL/FR |
iso | butyl cinnamate | FL/FR |
| copaiba balsam oil | FL/FR |
| ethyl cinnamate | FL/FR |
| fir needle oil siberia | FL/FR |
| fir needle oil terpeneless canada | FL/FR |
| juniper berry absolute | FL/FR |
| myrrh absolute | FL/FR |
| myrrh oil | FL/FR |
| opoponax oil (balsamodendron kafal) | FL/FR |
| peru balsam | FL |
| tolu balsam absolute | FL/FR |
| tolu balsam resinoid | FL/FR |
berry |
| dihydro-alpha-ionone | FL/FR |
| heliotropyl acetone | FL/FR |
| raspberry ketone methyl ether | FL/FR |
bitter |
2- | methyl-3-isobutyl quinoxaline | |
camphoreous |
dextro,laevo-iso | borneol | FL/FR |
(-)-alpha- | fenchol | FL/FR |
| fenchol | FL/FR |
6- | hydroxydihydrotheaspirane (mixture of isomers) | FL/FR |
ortho- | methyl anisole | FL/FR |
cherry |
| heliotropin | FL/FR |
citrus |
| bergamot oil | FL/FR |
laevo- | linalool | FL/FR |
bitter | orange peel oil | FL/FR |
alpha- | terpineol | FL/FR |
coconut |
gamma- | nonalactone (aldehyde C-18 (so-called)) | FL/FR |
cooling |
4- | carvomenthenol | FL/FR |
dextro- | fenchone | FL/FR |
creamy |
para- | anisaldehyde | FL/FR |
4- | hydroxybenzaldehyde | FL/FR |
para- | methyl acetophenone | FL/FR |
dairy |
2- | octanone | FL/FR |
earthy |
2- | ethyl fenchol | FL/FR |
floral |
| cananga oil | FL/FR |
| dihydrojasmone | FL/FR |
| methyl dihydrojasmonate | FL/FR |
| phenethyl alcohol | FL/FR |
| rose absolute (rosa centifolia) morocco | FL/FR |
| rose absolute (rosa damascena) bulgaria | FL/FR |
| tuberose absolute chassis | FL/FR |
fruity |
iso | amyl benzoate | FL/FR |
para- | anisyl alcohol | FL/FR |
| cherry guarana flavor | FL |
| valerian rhizome oil | FL/FR |
| valerian rhizome oil china | FL/FR |
| valerian rhizome oil CO2 extract china | FL/FR |
| valeriana officinalis root extract | FL/FR |
grassy |
| palmarosa oil | FL/FR |
green |
iso | amyl formate | FL/FR |
| angelica root oil | FL/FR |
| canarium luzonicum gum | FL/FR |
| cinnamyl alcohol | FL/FR |
iso | cyclocitral (IFF) | FL/FR |
| cyclohexyl ethyl alcohol | FL/FR |
| elemi resinoid | FL/FR |
| galbanum absolute | FL/FR |
| galbanum oil | FL/FR |
| galbanum oleoresin | FL/FR |
| galbanum resinoid | FL/FR |
| immortelle absolute | FL/FR |
iso | jasmone | FL/FR |
| linalool oxide | FL/FR |
| nerolidol | FL/FR |
| oakmoss absolute | FL/FR |
| violet leaf absolute | FL/FR |
herbal |
| cardamom oleoresin | FL/FR |
| clary sage oil france | FL/FR |
abrialis | lavandin oil | FL/FR |
| lavandin water absolute | FL/FR |
| lavender absolute bulgaria | FL/FR |
| rosemary absolute | FL/FR |
| rosemary oil morocco | FL/FR |
| rosemary oil spain | FL/FR |
honey |
| phenethyl phenyl acetate | FL/FR |
lactonic |
gamma- | heptalactone | FL/FR |
medicinal, |
| phenethyl salicylate | FL/FR |
minty |
| methyl salicylate | FL/FR |
mossy |
| oakmoss distillates | FL/FR |
naphthyl |
para- | methyl anisole | FL/FR |
nutty |
2,3,5,6- | tetramethyl pyrazine | FL/FR |
orris |
| costus root oil | FL |
phenolic |
| guaiacyl phenyl acetate | FL/FR |
2- | hydroxyisophorone | FL |
pine |
| pine needle oil dwarf | FL/FR |
beta- | pinene | FL/FR |
resinous |
| mastic absolute | FL/FR |
soapy |
| dodecanal (aldehyde C-12 lauric) | FL/FR |
1- | dodecanol | FL/FR |
spicy |
siam | benzoin absolute | FL/FR |
sumatra | benzoin absolute | FL/FR |
| benzyl isoeugenol | FL/FR |
beta- | caryophyllene | FL/FR |
| cassia bark oil china | FL/FR |
| cinnamyl formate | FL/FR |
| clove bud oil | FL/FR |
para-alpha- | dimethyl styrene | FL/FR |
| elettaria cardamomum seed oil | FL/FR |
| eugenol | FL/FR |
iso | eugenyl acetate | FL/FR |
| galanga flavor | FL |
| galangal root oleoresin | FL |
| ginger root oil brazil | FL/FR |
| ginger root oil china | FL/FR |
| ginger root oil cochin | FL/FR |
2- | methoxy-4-vinyl phenol | FL/FR |
alpha- | methyl cinnamaldehyde | FL/FR |
| methyl cinnamate | FL/FR |
| nutmeg absolute | FL/FR |
| nutmeg oil | FL/FR |
| nutmeg oil CO2 extract | FL/FR |
black | pepper oil | FL/FR |
3- | phenyl propyl alcohol | FL/FR |
| spicy acetoacetate | FL/FR |
| turmeric oleoresin | FL |
sweet |
| orris rhizome absolute (iris pallida) | FL/FR |
terpenic |
| juniperus communis fruit oil | FL/FR |
gamma- | terpinene | FL/FR |
alpha- | terpinene | FL/FR |
tropical |
alpha- | amyl cinnamaldehyde | FL/FR |
vanilla |
| ethyl vanillin | FL/FR |
| vanilla bean absolute (vanilla planifolia) | FL/FR |
| vanillyl acetate | FL/FR |
waxy |
| decyl acetate | FL/FR |
| ethyl laurate | FL/FR |
alpha- | hexyl cinnamaldehyde | FL/FR |
| hydroxycitronellal | FL/FR |
woody |
| ambrette seed absolute | FL/FR |
| amyris wood oil | FL/FR |
iso | bornyl acetate | FL/FR |
iso | bornyl formate | FL/FR |
| cadinene | FL/FR |
| cistus twig/leaf oil | FL/FR |
| cistus twig/leaf oil molecular distilled | FL/FR |
| copaiba balsam | FL/FR |
| dihydro-beta-ionone | FL/FR |
| frankincense gum | FL/FR |
| frankincense oil | FL/FR |
| frankincense oil CO2 extract | FL/FR |
| guaiacwood oil | FL/FR |
| guaiene | FL/FR |
| juniper berry oil terpeneless | FL/FR |
| methyl cedryl ketone | FL/FR |
| patchouli essence | FL/FR |
| patchouli oil | FL/FR |
terpeneless | patchouli oil | FL/FR |
| patchouli oil china | FL/FR |
| patchouli oil CO2 extract | FL/FR |
| patchouli oil decolorized | FL/FR |
alpha- | pinene | FL/FR |
| sabinene | FL/FR |
| safranal | FL/FR |
| sandalwood oil | FL/FR |
| spruce needle oil canada | FL/FR |
| thuja occidentalis leaf oil | FL/FR |
| vetiver oil haiti | FL/FR |
| vetiverol | FL/FR |
| yerba mate concentrate | FL |
|
Potential Uses:
Occurrence (nature, food, other): note
Synonyms:
| patchouli essential oil MD | | patchouli indo molecular EO | | patchouli MD essential oil | | patchouli oil decolourised M.D. | | patchouli oil indonesia MD | | patchouli oil m/d | | patchouli oil MD | | patchouli oil molecular distilled | | patchouly EO sumatra MD | | patchouly oil MD colorless | | pogostemon cablin oil molecular distilled | | pogostemon patchouli oil molecular distilled | | tilam wangi oil molecular distilled |
Articles:
|