Category: flavor and fragrance agents
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
Appearance: | brownish orange reddish clear liquid (est) |
Food Chemicals Codex Listed: | No |
Specific Gravity: | 0.95000 to 0.97500 @ 25.00 °C.
|
Pounds per Gallon - (est).: | 7.905 to 8.113
|
Specific Gravity: | 0.95300 to 0.97800 @ 20.00 °C.
|
Pounds per Gallon - est.: | 7.939 to 8.147
|
Refractive Index: | 1.49900 to 1.51500 @ 20.00 °C.
|
Optical Rotation: | -48.00 to -65.00
|
Boiling Point: | 287.00 °C. @ 760.00 mm Hg
|
Flash Point: | 190.00 °F. TCC ( 87.78 °C. )
|
Shelf Life: | 36.00 month(s) or longer if stored properly. |
Soluble in: |
| alcohol | | water, 42.87 mg/L @ 25 °C (est) |
Insoluble in: |
| water |
Organoleptic Properties:
|
Odor Type: woody |
|
Odor Strength: | medium |
|
Substantivity: | 400 hour(s) at 100.00 % |
|
| woody earthy |
Odor Description: at 100.00 %. | woody earthy |
|
|
Flavor Type: woody |
|
| patchouli |
Taste Description:
| patchouli |
|
Odor and/or flavor descriptions from others (if found). |
|
|
Cosmetic Information:
Suppliers:
Safety Information:
European information : |
Most important hazard(s): | Xi - Irritant |
R 36/38 - Irritating to skin and eyes. S 02 - Keep out of the reach of children. S 24/25 - Avoid contact with skin and eyes. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 36 - Wear suitable protective clothing.
|
|
Hazards identification |
|
Classification of the substance or mixture |
GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
None found. |
GHS Label elements, including precautionary statements |
|
Pictogram | |
|
Hazard statement(s) |
None found. |
Precautionary statement(s) |
None found. |
Oral/Parenteral Toxicity: |
oral-rat LD50 > 5000 mg/kg Food and Chemical Toxicology. Vol. 20, Pg. 791, 1982.
|
Dermal Toxicity: |
skin-rabbit LD50 > 5000 mg/kg Food and Chemical Toxicology. Vol. 20, Pg. 791, 1982.
|
Inhalation Toxicity: |
Not determined
|
Safety in Use Information:
Category: | flavor and fragrance agents |
IFRA Code of Practice Notification of the 49th Amendment to the IFRA Code of Practice |
Recommendation for patchouli oil china usage levels up to: | | 10.0000 % in the fragrance concentrate.
|
|
Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). |
The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA Flavor Ingredient Library |
publication number: 3 |
Click here to view publication 3 |
| average usual ppm | average maximum ppm |
baked goods: | - | 10.00000 |
beverages(nonalcoholic): | - | 0.88000 |
beverages(alcoholic): | - | - |
breakfast cereal: | - | - |
cheese: | - | - |
chewing gum: | 43.00000 | 220.00000 |
condiments / relishes: | - | - |
confectionery froastings: | - | - |
egg products: | - | - |
fats / oils: | - | - |
fish products: | - | - |
frozen dairy: | - | 1.10000 |
fruit ices: | - | 1.10000 |
gelatins / puddings: | - | - |
granulated sugar: | - | - |
gravies: | - | - |
hard candy: | - | 6.30000 |
imitation dairy: | - | - |
instant coffee / tea: | - | - |
jams / jellies: | - | - |
meat products: | - | - |
milk products: | - | - |
nut products: | - | - |
other grains: | - | - |
poultry: | - | - |
processed fruits: | - | - |
processed vegetables: | - | - |
reconstituted vegetables: | - | - |
seasonings / flavors: | - | - |
snack foods: | - | - |
soft candy: | - | - |
soups: | - | - |
sugar substitutes: | - | - |
sweet sauces: | - | - |
Safety References:
References:
Other Information:
Potential Blenders and core components note
|
For Odor |
No odor group found for these |
(E)- | sabinene hydrate | FL/FR |
aldehydic |
| dodecanal (aldehyde C-12 lauric) | FL/FR |
amber |
| amber oxepin | FR |
| ambrette seed oil | FL/FR |
| angelica root oil | FL/FR |
| cistus ladaniferus resinoid | FL/FR |
animal |
| animal carbolactone | FR |
| costus valerolactone | FR |
| indole | FL/FR |
anisic |
para- | anisaldehyde | FL/FR |
para- | anisyl phenyl acetate | FL/FR |
balsamic |
iso | amyl benzoate | FL/FR |
| amyris wood oil | FL/FR |
siam | benzoin absolute | FL/FR |
siam | benzoin resinoid | FL/FR |
1- | benzoyl acetone | FL/FR |
| benzyl benzoate | FL/FR |
| benzyl salicylate | FL/FR |
dextro,laevo- | borneol | FL/FR |
iso | bornyl acetate | FL/FR |
laevo- | bornyl acetate | FL/FR |
iso | bornyl formate | FL/FR |
iso | bornyl isobutyrate | FL/FR |
| brachyleana hutchinsii wood oil | FR |
iso | butyl cinnamate | FL/FR |
| cinnamyl alcohol | FL/FR |
| conifer acetate | FR |
| ethyl cinnamate | FL/FR |
dextro- | fenchone | FL/FR |
| fir balsam absolute | FR |
| fir needle oil canada | FL/FR |
| fir needle oil siberia | FL/FR |
| fir needle oil terpeneless canada | FL/FR |
| guaiacyl phenyl acetate | FL/FR |
| guaiyl butyrate | FR |
| gurjun balsam | FR |
| hemlock western oil (tsuga heterophylla) canada | FR |
| juniper berry absolute | FL/FR |
| methyl cinnamate | FL/FR |
| myrrh absolute | FL/FR |
| myrrh oil | FL/FR |
| myrrh resinoid | FR |
| opoponax oil (balsamodendron kafal) | FL/FR |
3- | phenyl propyl alcohol | FL/FR |
| tolu balsam absolute | FL/FR |
| tolu balsam resinoid | FL/FR |
berry |
| raspberry ketone methyl ether | FL/FR |
camphoreous |
| fenchol | FL/FR |
laevo- | fenchone | FL/FR |
caramellic |
| immortelle absolute | FL/FR |
citrus |
| bergamot oil | FL/FR |
(E+Z)-4,8- | dimethyl-3,7-nonadien-2-yl acetate | FL/FR |
coconut |
gamma- | heptalactone | FL/FR |
gamma- | nonalactone (aldehyde C-18 (so-called)) | FL/FR |
earthy |
2- | ethyl fenchol | FL/FR |
(-)-alpha- | fenchol | FL/FR |
| pogostemon cablin leaf extract | FR |
floral |
alpha- | amyl cinnamaldehyde | FL/FR |
| bois de rose oil terpeneless | FL/FR |
| cyclohexyl ethyl alcohol | FL/FR |
| dihydro-alpha-ionone | FL/FR |
| dihydrojasmone | FL/FR |
| floral pyranol | FR |
| heliotropin | FL/FR |
| heliotropyl acetone | FL/FR |
alpha- | hexyl cinnamaldehyde | FL/FR |
| ho leaf oil | FR |
| hydroxycitronellal | FL/FR |
laevo- | linalool | FL/FR |
| linalool oxide | FL/FR |
para- | methyl acetophenone | FL/FR |
| methyl dihydrojasmonate | FL/FR |
| nerolidol | FL/FR |
| orris pyridine 25% IPM | FR |
| orris rhizome absolute (iris pallida) | FL/FR |
| palmarosa oil | FL/FR |
| phenethyl alcohol | FL/FR |
| phenethyl phenyl acetate | FL/FR |
| phenethyl salicylate | FL/FR |
| rose absolute (rosa centifolia) morocco | FL/FR |
| rose absolute (rosa damascena) bulgaria | FL/FR |
| rose carboxylate | FR |
green |
iso | cyclocitral (IFF) | FL/FR |
| fern absolute | |
| galbanum absolute | FL/FR |
| galbanum oil | FL/FR |
| galbanum oleoresin | FL/FR |
| galbanum resinoid | FL/FR |
| lawsonia inermis leaf oil CO2 extract | FR |
| oakmoss oil | FR |
| valerian rhizome oil CO2 extract china | FL/FR |
| violet leaf absolute | FL/FR |
hay |
| hay absolute | FR |
herbal |
1- | allyl-2,2,7,7-tetramethyl cycloheptanol | FR |
| arnica flower absolute | FR |
| camphene carbinol | FR |
| camphene carbinyl acetate | FR |
| canarium luzonicum gum | FL/FR |
| clary sage oil france | FL/FR |
| dimethyl cyclormol (IFF) | FR |
| guava leaf oil cuba | FR |
6- | hydroxydihydrotheaspirane (mixture of isomers) | FL/FR |
abrialis | lavandin oil | FL/FR |
| lavender absolute bulgaria | FL/FR |
| nopyl acetate | FR |
| pine hexanol | FR |
alpha- | pinene | FL/FR |
| rosemary absolute | FL/FR |
| rosemary oil morocco | FL/FR |
| rosemary oil spain | FL/FR |
| valerian rhizome oil | FL/FR |
| valerian rhizome oil china | FL/FR |
melon |
| watermelon ketone | FR |
minty |
| methyl salicylate | FL/FR |
mossy |
| oakmoss absolute | FL/FR |
naphthyl |
para- | methyl anisole | FL/FR |
oily |
| mcp acetate | FR |
powdery |
para- | anisyl alcohol | FL/FR |
spicy |
| benzyl isoeugenol | FL/FR |
4- | carvomenthenol | FL/FR |
alpha- | caryophyllene alcohol | FL/FR |
beta- | caryophyllene alcohol | FL/FR |
| cassia bark oil china | FL/FR |
| clove bud oil | FL/FR |
| elettaria cardamomum seed oil | FL/FR |
| eugenol | FL/FR |
iso | eugenyl acetate | FL/FR |
| ginger root oil brazil | FL/FR |
| ginger root oil china | FL/FR |
| ginger root oil cochin | FL/FR |
alpha- | methyl cinnamaldehyde | FL/FR |
| nutmeg absolute | FL/FR |
| nutmeg oil | FL/FR |
black | pepper oil | FL/FR |
terpenic |
| cypress leaf oil | FR |
| elemi resinoid | FL/FR |
| frankincense oil | FL/FR |
| juniperus communis fruit oil | FL/FR |
| pine needle oil dwarf | FL/FR |
gamma- | terpinene | FL/FR |
alpha- | terpineol | FL/FR |
thujonic |
| armoise oil | FR |
tonka |
| coumarin | FR |
| tonka bean absolute | FR |
tropical |
| patchwood | FR |
vanilla |
| ethyl vanillin | FL/FR |
| vanilla bean absolute (vanilla planifolia) | FL/FR |
| vanillyl acetate | FL/FR |
waxy |
| decyl acetate | FL/FR |
1- | dodecanol | FL/FR |
| ethyl laurate | FL/FR |
woody |
para-tert- | butyl cyclohexanone | FR |
| calarene epoxide | |
alpha- | cedrene epoxide | FR |
| cedryl methyl ether | FR |
| cistus twig/leaf oil | FL/FR |
| copaiba balsam | FL/FR |
| cyperus root oil (cyperus scariosus) | FR |
| cypriol oil (cyperus scariosus) | FR |
| dihydro-beta-ionone | FL/FR |
| dihydro-gamma-ionone | FL/FR |
3(or 2),4- | dimethyl-5-vinyl octahydro-4,7-methanoinden-5-ol | |
| dryopteris filix-mas oleoresin | FR |
| germacrene B | |
| guaiacwood oil | FL/FR |
alpha- | guaiene | FL/FR |
| gurjun balsam oil | FR |
alpha- | gurjunene | FR |
1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| herbal norbornane | FR |
5,5a,6,7,8,8a- | hexahydro-6,6,7,8,8-pentamethyl-4H-indeno[5,4-D]isoxazole | |
(1R,4S,5S,9R)-1- | hydroxy-1,4,7,7,9-pentamethyl spiro(4.5)decan-2-one | |
4- | hydroxybenzaldehyde | FL/FR |
iso | longifolene ketone | FR |
| manevoro oil | FR |
| methyl cedryl ketone | FL/FR |
delta- | methyl ionone | FL/FR |
2- | methyl-1-(5',5',6'-trimethyl bicyclo(2.2.1)hept-2'-yl) propan-2-ol | FR |
| moss naphthaleneol | FR |
| octahydro-3(or 2),4-dimethyl-4,7-methanoinden-5-ol | |
| octahydro-3(or 2),4-dimethyl-4,7-methanoinden-5-one | |
| orris hexanone | FR |
| patchouli absolute | FR |
| patchouli alcohol | FR |
| patchouli essence | FL/FR |
| patchouli ethanol | FR |
| patchouli ethanone | FR |
| patchouli extract acetylated | FR |
| patchouli fractions | FR |
| patchouli fragrance | FR |
| patchouli hexanol | FR |
| patchouli leaf water | FR |
terpeneless | patchouli oil | FL/FR |
| patchouli oil | FL/FR |
| patchouli oil CO2 extract | FL/FR |
| patchouli oil decolorized | FL/FR |
| patchouli oil molecular distilled | FL/FR |
| patchouli oil replacer | FR |
| patchouli residues | FR |
| patchouli specialty | FR |
| patchouli woody amber fragrance | FR |
| pelargonium radula oil | FR |
| pinacol | FR |
| pogostemon cablin leaf oil | FR |
| sabinene | FL/FR |
| sandalwood oil | FL/FR |
| sandalwood oil west australia (santalum spicatum) | FR |
| santall | FR |
| santalyl butyrate | FL/FR |
| spruce needle oil canada | FL/FR |
alpha- | terpinene | FL/FR |
beta- | terpineol | FL/FR |
2,6,10,10- | tetramethyl-1-oxa-spiro[4.5]dec-3-ene-6-ol | |
| tobacarol (IFF) | FR |
3(or 2),4,5- | trimethyl octahydro-4,7-methanoinden-5-ol | FR |
3(or 2),4,5- | trimethyl-3a,4,5,6,7,7a-hexahydro-4,7-methanoinden-5-ol | |
1,3,5,7- | undecatetraene | FL/FR |
| vetiver oil CO2 extract | FL/FR |
| vetiver oil fractions | FR |
| vetiver oil haiti | FL/FR |
| vetiveria zizanioides root oil | FL/FR |
| vetiverol | FL/FR |
| woody dodecane | FR |
| woody epoxide | FR |
| woody ether | FR |
|
For Flavor |
|
No flavor group found for these |
1- | benzoyl acetone | FL/FR |
dextro,laevo- | borneol | FL/FR |
| calarene epoxide | |
alpha- | caryophyllene alcohol | FL/FR |
beta- | caryophyllene alcohol | FL/FR |
| cistus ladaniferus resinoid | FL/FR |
| dihydro-gamma-ionone | FL/FR |
(E+Z)-4,8- | dimethyl-3,7-nonadien-2-yl acetate | FL/FR |
3(or 2),4- | dimethyl-5-vinyl octahydro-4,7-methanoinden-5-ol | |
| fern absolute | |
| fir needle oil canada | FL/FR |
| germacrene B | |
alpha- | guaiene | FL/FR |
1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
5,5a,6,7,8,8a- | hexahydro-6,6,7,8,8-pentamethyl-4H-indeno[5,4-D]isoxazole | |
(1R,4S,5S,9R)-1- | hydroxy-1,4,7,7,9-pentamethyl spiro(4.5)decan-2-one | |
delta- | methyl ionone | FL/FR |
| octahydro-3(or 2),4-dimethyl-4,7-methanoinden-5-ol | |
| octahydro-3(or 2),4-dimethyl-4,7-methanoinden-5-one | |
3- | propyl pyridine | FL |
(E)- | sabinene hydrate | FL/FR |
| santalyl butyrate | FL/FR |
beta- | terpineol | FL/FR |
2,6,10,10- | tetramethyl-1-oxa-spiro[4.5]dec-3-ene-6-ol | |
3(or 2),4,5- | trimethyl-3a,4,5,6,7,7a-hexahydro-4,7-methanoinden-5-ol | |
1,3,5,7- | undecatetraene | FL/FR |
| vitispirane | FL |
amber |
| ambrette seed oil | FL/FR |
animal |
| indole | FL/FR |
anisic |
para- | anisyl phenyl acetate | FL/FR |
balsamic |
siam | benzoin resinoid | FL/FR |
| benzyl benzoate | FL/FR |
| benzyl salicylate | FL/FR |
laevo- | bornyl acetate | FL/FR |
iso | bornyl isobutyrate | FL/FR |
iso | butyl cinnamate | FL/FR |
| ethyl cinnamate | FL/FR |
| fir needle oil siberia | FL/FR |
| fir needle oil terpeneless canada | FL/FR |
| juniper berry absolute | FL/FR |
| myrrh absolute | FL/FR |
| myrrh oil | FL/FR |
| opoponax oil (balsamodendron kafal) | FL/FR |
| peru balsam | FL |
| tolu balsam absolute | FL/FR |
| tolu balsam resinoid | FL/FR |
berry |
| dihydro-alpha-ionone | FL/FR |
| heliotropyl acetone | FL/FR |
| raspberry ketone methyl ether | FL/FR |
camphoreous |
| fenchol | FL/FR |
(-)-alpha- | fenchol | FL/FR |
laevo- | fenchone | FL/FR |
6- | hydroxydihydrotheaspirane (mixture of isomers) | FL/FR |
cherry |
| heliotropin | FL/FR |
citrus |
| bergamot oil | FL/FR |
laevo- | linalool | FL/FR |
alpha- | terpineol | FL/FR |
coconut |
gamma- | nonalactone (aldehyde C-18 (so-called)) | FL/FR |
cooling |
4- | carvomenthenol | FL/FR |
dextro- | fenchone | FL/FR |
creamy |
para- | anisaldehyde | FL/FR |
4- | hydroxybenzaldehyde | FL/FR |
para- | methyl acetophenone | FL/FR |
earthy |
2- | ethyl fenchol | FL/FR |
floral |
| bois de rose oil terpeneless | FL/FR |
| dihydrojasmone | FL/FR |
| methyl dihydrojasmonate | FL/FR |
| phenethyl alcohol | FL/FR |
| rose absolute (rosa centifolia) morocco | FL/FR |
| rose absolute (rosa damascena) bulgaria | FL/FR |
fruity |
iso | amyl benzoate | FL/FR |
para- | anisyl alcohol | FL/FR |
| valerian rhizome oil | FL/FR |
| valerian rhizome oil china | FL/FR |
| valerian rhizome oil CO2 extract china | FL/FR |
grassy |
| palmarosa oil | FL/FR |
green |
| angelica root oil | FL/FR |
| canarium luzonicum gum | FL/FR |
| cinnamyl alcohol | FL/FR |
iso | cyclocitral (IFF) | FL/FR |
| cyclohexyl ethyl alcohol | FL/FR |
| elemi resinoid | FL/FR |
| galbanum absolute | FL/FR |
| galbanum oil | FL/FR |
| galbanum oleoresin | FL/FR |
| galbanum resinoid | FL/FR |
| immortelle absolute | FL/FR |
| linalool oxide | FL/FR |
| nerolidol | FL/FR |
| oakmoss absolute | FL/FR |
| violet leaf absolute | FL/FR |
herbal |
| clary sage oil france | FL/FR |
abrialis | lavandin oil | FL/FR |
| lavender absolute bulgaria | FL/FR |
| rosemary absolute | FL/FR |
| rosemary oil morocco | FL/FR |
| rosemary oil spain | FL/FR |
honey |
| phenethyl phenyl acetate | FL/FR |
lactonic |
gamma- | heptalactone | FL/FR |
medicinal, |
| phenethyl salicylate | FL/FR |
minty |
| methyl salicylate | FL/FR |
naphthyl |
para- | methyl anisole | FL/FR |
orris |
| costus root oil | FL |
phenolic |
| guaiacyl phenyl acetate | FL/FR |
pine |
| pine needle oil dwarf | FL/FR |
soapy |
| dodecanal (aldehyde C-12 lauric) | FL/FR |
1- | dodecanol | FL/FR |
spicy |
siam | benzoin absolute | FL/FR |
| benzyl isoeugenol | FL/FR |
| cassia bark oil china | FL/FR |
| clove bud oil | FL/FR |
| elettaria cardamomum seed oil | FL/FR |
| eugenol | FL/FR |
iso | eugenyl acetate | FL/FR |
| galangal root oleoresin | FL |
| ginger root oil brazil | FL/FR |
| ginger root oil china | FL/FR |
| ginger root oil cochin | FL/FR |
alpha- | methyl cinnamaldehyde | FL/FR |
| methyl cinnamate | FL/FR |
| nutmeg absolute | FL/FR |
| nutmeg oil | FL/FR |
black | pepper oil | FL/FR |
3- | phenyl propyl alcohol | FL/FR |
| turmeric oleoresin | FL |
sweet |
| orris rhizome absolute (iris pallida) | FL/FR |
terpenic |
| juniperus communis fruit oil | FL/FR |
alpha- | terpinene | FL/FR |
gamma- | terpinene | FL/FR |
tropical |
alpha- | amyl cinnamaldehyde | FL/FR |
vanilla |
| ethyl vanillin | FL/FR |
| vanilla bean absolute (vanilla planifolia) | FL/FR |
| vanillyl acetate | FL/FR |
waxy |
| decyl acetate | FL/FR |
| ethyl laurate | FL/FR |
alpha- | hexyl cinnamaldehyde | FL/FR |
| hydroxycitronellal | FL/FR |
woody |
| amyris wood oil | FL/FR |
iso | bornyl acetate | FL/FR |
iso | bornyl formate | FL/FR |
| cistus twig/leaf oil | FL/FR |
| copaiba balsam | FL/FR |
| dihydro-beta-ionone | FL/FR |
| frankincense oil | FL/FR |
| guaiacwood oil | FL/FR |
| methyl cedryl ketone | FL/FR |
| patchouli essence | FL/FR |
terpeneless | patchouli oil | FL/FR |
| patchouli oil | FL/FR |
| patchouli oil CO2 extract | FL/FR |
| patchouli oil decolorized | FL/FR |
| patchouli oil molecular distilled | FL/FR |
alpha- | pinene | FL/FR |
| sabinene | FL/FR |
| sandalwood oil | FL/FR |
| spruce needle oil canada | FL/FR |
| vetiver oil CO2 extract | FL/FR |
| vetiver oil haiti | FL/FR |
| vetiveria zizanioides root oil | FL/FR |
| vetiverol | FL/FR |
|
Potential Uses:
Occurrence (nature, food, other): note
Synonyms:
| patchouli oil china | | pogostemon cablin oil china | | pogostemon patchouli oil china | | volatile oil obtained from the leaves of the patchouli, pogostemon cablin, labiatae china |
Articles:
PubMed: | A pharmacokinetic study of patchouli alcohol after a single oral administration of patchouli alcohol or patchouli oil in rats. |
PubMed: | Synergistic effect of fragrant herbs in Japanese scent sachets. |
PubMed: | Progressive regulation of sesquiterpene biosynthesis in Arabidopsis and Patchouli (Pogostemon cablin) by the miR156-targeted SPL transcription factors. |
PubMed: | A multiresidue method for simultaneous determination of 44 organophosphorous pesticides in Pogostemon cablin and related products using modified QuEChERS sample preparation procedure and GC-FPD. |
PubMed: | In vitro and in vivo antibacterial activity of Pogostone. |
PubMed: | Progressive Regulation of Sesquiterpene Biosynthesis in Arabidopsis and Patchouli (Pogostemon cablin) by the miR156-Targeted SPL Transcription Factors. |
PubMed: | Prevention of UV radiation-induced cutaneous photoaging in mice by topical administration of patchouli oil. |
PubMed: | Characterisation of the metabolism of pogostone in vitro and in vivo using liquid chromatography with mass spectrometry. |
PubMed: | Expression, purification and activity assay of a patchoulol synthase cDNA variant fused to thioredoxin in Escherichia coli. |
PubMed: | Evaluation of the antibacterial activity of patchouli oil. |
PubMed: | Antimicrobial and Herbal Drug Resistance in Enteric Bacteria Isolated from Faecal Droppings of Common House Lizard/Gecko (Hemidactylus frenatus). |
PubMed: | Development and structure of internal glands and external glandular trichomes in Pogostemon cablin. |
PubMed: | Screening of some essential oils against Trichosporon species. |
PubMed: | Insecticidal activity of pogostone against Spodoptera litura and Spodoptera exigua (Lepidoptera: Noctuidae). |
PubMed: | Antifungal effect of Allium tuberosum, Cinnamomum cassia, and Pogostemon cablin essential oils and their components against population of Aspergillus species. |
PubMed: | Insecticidal and repellence activity of the essential oil of Pogostemon cablin against urban ants species. |
PubMed: | Study on the grafting of chitosan-gelatin microcapsules onto cotton fabrics and its antibacterial effect. |
PubMed: | Patchouli alcohol, an essential oil of Pogostemon cablin, exhibits anti-tumorigenic activity in human colorectal cancer cells. |
PubMed: | Virtual screening of compounds from the patchouli oil of Pogostemon herba for COX-1 inhibition. |
PubMed: | [Extraction and analysis of the essential oil in Pogostemon cablin by enzymatic hydrolysis and inhibitory activity against Hela cell proliferation]. |
PubMed: | Quantitative and physical evaluation of patchouli essential oils obtained from different sources of Pogostemon cablin. |
PubMed: | Secondary metabolites and antioxidant capacities of Waldheimia glabra (Decne.) Regel from Nepal. |
PubMed: | Technology for efficient and successful delivery of vermicompost colonized bioinoculants in Pogostemon cablin (patchouli) Benth. |
PubMed: | Selective separation of patchouli alcohol from the essential oil of Cablin potchouli by inclusion crystalline method. |
PubMed: | Acaricidal activity of DHEMH, derived from patchouli oil, against house dust mite, Dermatophagoides farinae. |
PubMed: | Chemical constituents, antioxidant and antimocrobial activity of essential oil of Pogostemon paniculatus (Willd.). |
PubMed: | Experimental study on anti-inflammatory activity of a TCM recipe consisting of the supercritical fluid CO2 extract of Chrysanthemum indicum, Patchouli Oil and Zedoary Turmeric Oil in vivo. |
PubMed: | Volatile oil composition of Pogostemon heyneanus and comparison of its composition with patchouli oil. |
PubMed: | [Identification method with significant specificity of volatile oil of Pogostemon cablin]. |
PubMed: | Evaluation of the toxicity of 17 essential oils against Choristoneura rosaceana (Lepidoptera: Tortricidae) and Trichoplusia ni (Lepidoptera: Noctuidae). |
PubMed: | Novel silicon-based patchouli odorants of the trialkyl(1-hydroxy-1-methylethyl)silane type: design, synthesis, and olfactory properties. |
PubMed: | [Protective effect of Pogostemon cablin on membrane fluidity of intestinal epithelia cell in ischemia/ reperfusion rats after ischemia/reperfusion]. |
PubMed: | [Effect of atractylodes rhizome oil and other volatile oils on percutaneous absorption of baicalin]. |
PubMed: | Insecticidal properties of several essential oils on the house fly (Musca domestica L.). |
PubMed: | Alpha-bulnesene, a PAF inhibitor isolated from the essential oil of Pogostemon cablin. |
PubMed: | The diverse sesquiterpene profile of patchouli, Pogostemon cablin, is correlated with a limited number of sesquiterpene synthases. |
PubMed: | GC-MS fingerprint of Pogostemon cablin in China. |
PubMed: | Comparative repellency of 38 essential oils against mosquito bites. |
PubMed: | Determination of patchoulic alcohol in Herba Pogostemonis by GC-MS-MS. |
PubMed: | [Investigation on the influential factors of the volatile oil and main constituent content in Pogostemon cablin]. |
PubMed: | [Study on purification technology of patchouly oil with molecular distillation]. |
PubMed: | [Pharmacokinetics of patchouli alcohol and patchouli alcohol in patchouli oil after iv administrated to rats]. |
PubMed: | Application of comprehensive two-dimensional gas chromatography-time-of-flight mass spectrometry in the analysis of volatile oil of traditional Chinese medicines. |
PubMed: | Toxicity and repellency of patchouli oil and patchouli alcohol against Formosan subterranean termites Coptotermes formosanus Shiraki (Isoptera: Rhinotermitidae). |
PubMed: | [Anti-Candida albicans activity of essential oils including Lemongrass (Cymbopogon citratus) oil and its component, citral]. |
PubMed: | [Two chemotypes of Pogostemon cablin and influence of region of cultivation and harvesting time on volatile oil composition]. |
PubMed: | [Constituents analysis on volatile oil of Pogostemon cablin from different collection time cultivated in Hainan]. |
PubMed: | [DNA profiling of Pogostemon cablin chemotypes differing in essential oil composition]. |
PubMed: | [GC-MS analysis of volatile oil of Herba Pogostemonis collected from Leizhou county]. |
PubMed: | [GC-MS analysis of volatile oil of herba Pogostemonis collected from Gaoyao county]. |
PubMed: | Effects of fragrance inhalation on sympathetic activity in normal adults. |
PubMed: | Production of patchouli mild mosaic virus resistant patchouli plants by genetic engineering of coat protein precursor gene. |
PubMed: | Regeneration of patchouli (Pogostemon cablin Benth.) plants from leaf and node callus, and evaluation after growth in the field. |
PubMed: | Biosynthesis of the sesquiterpene patchoulol from farnesyl pyrophosphate in leaf extracts of Pogostemon cablin (patchouli): mechanistic considerations. |
|