Category: flavor and fragrance agents
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
Food Chemicals Codex Listed: | No |
Shelf Life: | 24.00 month(s) or longer if stored properly. |
Storage: | store in cool, dry place in tightly sealed containers, protected from heat and light. |
Soluble in: |
| alcohol |
Insoluble in: |
| water |
Organoleptic Properties:
|
Odor Type: woody |
|
| woody earthy spicy |
Odor Description: at 100.00 %. | woody earthy |
|
|
Flavor Type: woody |
|
| patchouli |
Taste Description:
| patchouli |
|
Odor and/or flavor descriptions from others (if found). |
|
IFF |
Healingwood |
Odor Description: | The very heart of patchouli. Powerful woody, reminiscent of a humid cellar and moldy cork |
Taste Description: | patchouli |
|
|
Cosmetic Information:
Suppliers:
Safety Information:
|
Hazards identification |
|
Classification of the substance or mixture |
GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
None found. |
GHS Label elements, including precautionary statements |
|
Pictogram | |
|
Hazard statement(s) |
None found. |
Precautionary statement(s) |
None found. |
Oral/Parenteral Toxicity: |
Not determined
|
Dermal Toxicity: |
Not determined
|
Inhalation Toxicity: |
Not determined
|
Safety in Use Information:
Safety References:
EPA Substance Registry Services (TSCA): | 73049-67-9 |
EPA ACToR: | Toxicology Data |
EPA Substance Registry Services (SRS): | Registry |
National Institute of Allergy and Infectious Diseases: | Data |
| pogostemon cablin oil terpeneless |
Chemidplus: | 0073049679 |
References:
| pogostemon cablin oil terpeneless |
Canada Domestic Sub. List: | 73049-67-9 |
Pubchem (sid): | 135280607 |
Other Information:
Potential Blenders and core components note
|
For Odor |
anise |
| fennel fragrance | FR |
balsamic |
iso | bornyl formate | FL/FR |
iso | bornyl isobutyrate | FL/FR |
| copaiba balsam oil | FL/FR |
dextro- | fenchone | FL/FR |
| fir needle oil siberia | FL/FR |
| gurjun balsam | FR |
camphoreous |
| fenchol | FL/FR |
laevo- | fenchone | FL/FR |
citrus |
(E+Z)-4,8- | dimethyl-3,7-nonadien-2-yl acetate | FL/FR |
earthy |
2- | ethyl fenchol | FL/FR |
3- | octen-2-one | FL/FR |
| orris specialty | FR |
| patchouli cyclohexanol | FR |
| pogostemon cablin leaf extract | FR |
floral |
| bois de rose oil terpeneless | FL/FR |
| geranium dihydropyran | FR |
| orris fragrance | FR |
| orris rhizome absolute replacer | FR |
| ylang ylang flower oil III | FL/FR |
green |
iso | cyclocitral (IFF) | FL/FR |
| decahydrocyclododecaoxazole | FR |
| galbanum absolute | FL/FR |
| lawsonia inermis leaf oil CO2 extract | FR |
| oakmoss oil | FR |
herbal |
1- | allyl-2,2,7,7-tetramethyl cycloheptanol | FR |
| arnica flower absolute | FR |
| camphene carbinol | FR |
| camphene carbinyl acetate | FR |
| chrysanthemum fragrance | FR |
| dimethyl cyclormol (IFF) | FR |
| fir needle oil replacer | FR |
| guava leaf oil cuba | FR |
| pine hexanol | FR |
| rain forest specialty | FR |
mossy |
| oakmoss absolute color reduced | FL/FR |
oily |
| mcp acetate | FR |
pine |
| cypress oil replacer | FR |
spicy |
4- | carvomenthenol | FL/FR |
beta- | caryophyllene alcohol | FL/FR |
alpha- | caryophyllene alcohol | FL/FR |
| ginger oleoresin | FL/FR |
| ginger root oil china | FL/FR |
terpenic |
| angelica seed oil | FL/FR |
tropical |
| patchwood | FR |
woody |
| briar wood fragrance | FR |
para-tert- | butyl cyclohexanone | FR |
| cadinene | FL/FR |
| calarene epoxide | |
alpha- | cedrene epoxide | FR |
| cyperus root oil (cyperus scariosus) | FR |
| cypriol oil (cyperus scariosus) | FR |
| dihydro-beta-ionone | FL/FR |
| dihydro-gamma-ionone | FL/FR |
3(or 2),4- | dimethyl-5-vinyl octahydro-4,7-methanoinden-5-ol | |
| dogwood fragrance | FR |
| dogwood specialty | FR |
| dryopteris filix-mas oleoresin | FR |
| germacrene B | |
| gurjun balsam oil | FR |
1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| herbal norbornane | FR |
5,5a,6,7,8,8a- | hexahydro-6,6,7,8,8-pentamethyl-4H-indeno[5,4-D]isoxazole | |
(1R,4S,5S,9R)-1- | hydroxy-1,4,7,7,9-pentamethyl spiro(4.5)decan-2-one | |
iso | longifolene ketone | FR |
| manevoro oil | FR |
delta- | methyl ionone | FL/FR |
2- | methyl-1-(5',5',6'-trimethyl bicyclo(2.2.1)hept-2'-yl) propan-2-ol | FR |
| moss naphthaleneol | FR |
| octahydro-3(or 2),4-dimethyl-4,7-methanoinden-5-ol | |
| octahydro-3(or 2),4-dimethyl-4,7-methanoinden-5-one | |
| orris hexanone | FR |
| patchouli absolute | FR |
| patchouli alcohol | FR |
| patchouli essence | FL/FR |
| patchouli ethanol | FR |
| patchouli extract acetylated | FR |
| patchouli fractions | FR |
| patchouli fragrance | FR |
| patchouli hexanol | FR |
| patchouli leaf water | FR |
| patchouli oil | FL/FR |
| patchouli oil china | FL/FR |
| patchouli oil CO2 extract | FL/FR |
| patchouli oil decolorized | FL/FR |
| patchouli oil molecular distilled | FL/FR |
| patchouli oil replacer | FR |
| patchouli residues | FR |
| patchouli specialty | FR |
| patchouli woody amber fragrance | FR |
| pelargonium radula oil | FR |
| pinacol | FR |
| pogostemon cablin leaf oil | FR |
beta- | terpineol | FL/FR |
2,6,10,10- | tetramethyl-1-oxa-spiro[4.5]dec-3-ene-6-ol | |
3(or 2),4,5- | trimethyl octahydro-4,7-methanoinden-5-ol | FR |
3(or 2),4,5- | trimethyl-3a,4,5,6,7,7a-hexahydro-4,7-methanoinden-5-ol | |
1,3,5,7- | undecatetraene | FL/FR |
| vetiver oil CO2 extract | FL/FR |
| vetiver oil fractions | FR |
| vetiver oil haiti | FL/FR |
| vetiver oil haiti MD | FL/FR |
| vetiveria zizanioides root oil | FL/FR |
| woody dodecane | FR |
| woody epoxide | FR |
| woody ether | FR |
|
For Flavor |
|
No flavor group found for these |
| calarene epoxide | |
beta- | caryophyllene alcohol | FL/FR |
alpha- | caryophyllene alcohol | FL/FR |
| dihydro-gamma-ionone | FL/FR |
(E+Z)-4,8- | dimethyl-3,7-nonadien-2-yl acetate | FL/FR |
3(or 2),4- | dimethyl-5-vinyl octahydro-4,7-methanoinden-5-ol | |
| germacrene B | |
1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
5,5a,6,7,8,8a- | hexahydro-6,6,7,8,8-pentamethyl-4H-indeno[5,4-D]isoxazole | |
(1R,4S,5S,9R)-1- | hydroxy-1,4,7,7,9-pentamethyl spiro(4.5)decan-2-one | |
delta- | methyl ionone | FL/FR |
| octahydro-3(or 2),4-dimethyl-4,7-methanoinden-5-ol | |
| octahydro-3(or 2),4-dimethyl-4,7-methanoinden-5-one | |
3- | propyl pyridine | FL |
beta- | terpineol | FL/FR |
2,6,10,10- | tetramethyl-1-oxa-spiro[4.5]dec-3-ene-6-ol | |
3(or 2),4,5- | trimethyl-3a,4,5,6,7,7a-hexahydro-4,7-methanoinden-5-ol | |
1,3,5,7- | undecatetraene | FL/FR |
| vitispirane | FL |
amber |
| angelica seed oil | FL/FR |
balsamic |
iso | bornyl isobutyrate | FL/FR |
| copaiba balsam oil | FL/FR |
| fir needle oil siberia | FL/FR |
camphoreous |
| fenchol | FL/FR |
laevo- | fenchone | FL/FR |
cooling |
4- | carvomenthenol | FL/FR |
dextro- | fenchone | FL/FR |
creamy |
3- | octen-2-one | FL/FR |
earthy |
2- | ethyl fenchol | FL/FR |
floral |
| bois de rose oil terpeneless | FL/FR |
| ylang ylang flower oil III | FL/FR |
green |
iso | cyclocitral (IFF) | FL/FR |
| galbanum absolute | FL/FR |
herbal |
| oregano oleoresin | FL |
mossy |
| oakmoss absolute color reduced | FL/FR |
spicy |
| ginger oleoresin | FL/FR |
| ginger root oil china | FL/FR |
| turmeric oleoresin | FL |
woody |
iso | bornyl formate | FL/FR |
| cadinene | FL/FR |
| dihydro-beta-ionone | FL/FR |
| patchouli essence | FL/FR |
| patchouli oil | FL/FR |
| patchouli oil china | FL/FR |
| patchouli oil CO2 extract | FL/FR |
| patchouli oil decolorized | FL/FR |
| patchouli oil molecular distilled | FL/FR |
| vetiver oil CO2 extract | FL/FR |
| vetiver oil haiti | FL/FR |
| vetiver oil haiti MD | FL/FR |
| vetiveria zizanioides root oil | FL/FR |
|
Potential Uses:
Occurrence (nature, food, other): note
Synonyms:
| healing wood (IFF) | | healingwood (IFF) | | patchouli oil terpeneless | | pogostemon cablin oil terpeneless | | pogostemon patchouli oil terpeneless |
Articles:
|