|
For Odor |
No odor group found for these |
| arnica montana flower extract | FL/FR |
| tagete oil rwanda | |
aldehydic |
| agrumen nitrile | FR |
animal |
iso | butyl quinoline | FR |
anise |
sweet | fennel seed oil | FL/FR |
anisic |
| estragole | FL/FR |
bitter | fennel seed oil spain | FR |
| ocimum basilicum leaf oil america | FL/FR |
balsamic |
laevo- | borneol | FL/FR |
dextro,laevo- | borneol | FL/FR |
dextro,laevo-iso | borneol | FL/FR |
iso | bornyl acetate | FL/FR |
iso | bornyl isobutyrate | FL/FR |
iso | bornyl methyl ether | FL/FR |
| cinnamyl formate | FL/FR |
| copaiba balsam oil | FL/FR |
| frankincense absolute | FL/FR |
christmas | pine fragrance | FR |
camphoreous |
dextro- | bornyl acetate | |
| bornyl ethyl ether | |
| camphor tree bark oil | FL/FR |
2,6- | dimethyl-3-oxatricyclo(4.2.1.0*2,4*)nonane | FR |
laevo- | fenchone | FL/FR |
| herbal ethanone | FR |
caramellic |
2-iso | butyl-3-methyl pyrazine | FL/FR |
cheesy |
2- | heptanone | FL/FR |
chocolate |
1,3,3,4,5,6- | hexamethyl(2.2.2)bicyclooct-5-en-2-ol | |
citrus |
| citronella oil ceylon | FL/FR |
iso | decyl acetate | FR |
| dipentene | FL/FR |
| lemon balm fragrance | FR |
| melissa oil replacer | FR |
| ocimene quintoxide | FL/FR |
earthy |
| bornyl methyl ether | |
(-)-alpha- | fenchol | FL/FR |
| geosmin | FL/FR |
3- | octen-2-one | FL/FR |
(S)-1- | octen-3-ol | FL/FR |
ethereal |
| ethyl 4-pentenoate | FL/FR |
fatty |
2- | octenal | FL/FR |
(E)-2- | octenal | FL/FR |
| perillaldehyde propylene glycol acetal | FL/FR |
floral |
| bois de rose oil peru | FL/FR |
| cassie specialty (acacia farnesiana) | FR |
| cassis oxime 10% | FR |
| cilantro herb oil egypt | FL/FR |
| coriander seed oil | FL/FR |
| cymbopogon validus leaf oil | FR |
| dictamnus hispanicus oil | FR |
| dihydrocitronellyl ethyl ether | FR |
| dihydrorose oxide | FR |
| dimethyl benzyl carbinyl butyrate | FL/FR |
2,4- | dimethyl-3-cyclohexene-1-methanol | FR |
2,4- | dimethyl-alpha-allyl-3-cyclohexene methanol | |
4,6- | dimethyl-alpha-allyl-3-cyclohexene methanol | |
| geranium oil africa | FL/FR |
| geranium oil egypt | FL/FR |
| heather fragrance | FR |
| ho leaf oil | FR |
(Z)- | jasmone | FL/FR |
| lavender absolute replacer | FR |
| linalool oxide (furanoid) | FL/FR |
| linden flower absolute | FR |
| linden flower absolute replacer | FR |
| melaleuca ericifolia leaf oil | FR |
para- | methyl benzyl acetate | FL/FR |
| neryl formate | FL/FR |
3- | nonanone | FL/FR |
2- | pentyl cyclopentanone | FR |
iso | phytol | FL/FR |
| prenyl salicylate | FL/FR |
| reseda absolute | FR |
(Z)- | rose oxide | FL/FR |
| rose pyran | FR |
| terpinyl isobutyrate | FL/FR |
5- | tricyclodecenyl acetate | FR |
fruity |
3- | allyl oxy-1,4-dimethyl bicyclo(3.2.1)octane | FR |
3- | butyl bicyclo[3.2.1]-6-octen-2-one | FR |
1,4- | diethyl-6,8-dioxabicyclo(3.2.1)octane | FR |
| ethyl 2-ethyl acetoacetate | FL/FR |
1- | ethyl-2-methyl propyl chrysanthemumate | |
| green acetate | FR |
| herbanate (Givaudan) | FR |
2- | phenyl propyl butyrate | FL/FR |
1,3,3,5- | tetramethyl-7 and 8-acetyl bicyclo(2.2.2)oct-5-ene | |
| tropical indene | FR |
garlic |
4- | methyl-2-[2-(methyl thio)ethyl]-1,3-oxathiane | |
green |
| agrumen aldehyde | FR |
| aloe vera fragrance | FR |
| birch leaf specialty | FR |
iso | butyl heptanoate | FL/FR |
iso | butyl methyl ketone | FL/FR |
2-sec- | butyl thiazole | FL/FR |
S-sec- | butyl thioisovalerate | FL/FR |
sec- | butyl-3-methyl but-2-ene thioate | FL/FR |
| carrot leaf oil (daucus carota ssp.maximus) | FR |
| chrysanthemum carbaldehyde | FR |
black | currant bud absolute replacer | FL/FR |
| heptanal (aldehyde C-7) | FL/FR |
1- | heptanol | FL/FR |
| heptyl benzoate | FL/FR |
(E)-4- | hexen-1-ol | |
(Z)-4- | hexen-1-ol | FL/FR |
3- | hexenyl 2-methyl butyrate | FL/FR |
| hexyl hexanoate | FL/FR |
english | ivy leaf absolute | FR |
| marigold pot absolute | FL/FR |
6- | methyl-3-hepten-2-one | FL/FR |
| privet dioxane | FR |
3- | propyl bicyclo(3.2.1)-6-octen-2-one | FR |
| seaweed absolute (fucus vesiculosus et serratus) | FL/FR |
| terpinyl propionate | FL/FR |
| triplal / ethyl anthranilate schiff's base | FR |
herbal |
6- | acetoxydihydrotheaspirane | FL/FR |
9- | acetyl-5-methyl-tricyclo[6.2.1.0.sup.2,7 ]undec-4-ene | |
| agate fragrance | FR |
| ajowan seed oil | FL/FR |
1- | allyl-2,2,7,7-tetramethyl cycloheptanol | FR |
alpha- | amyl cinnamyl formate | FL/FR |
| anethum graveolens herb oil | FL/FR |
| anethum graveolens herb tincture | FL/FR |
| anthemis nobilis flower extract | FL/FR |
| anthemis nobilis flower oil roman | FL/FR |
| apium graveolens seed oil | FL/FR |
| apium graveolens seed oil india | FL/FR |
| artemisia alba oil | FR |
sweet | basil absolute | FL/FR |
| blue grass fragrance | FR |
delta- | cadinene | |
(+)-alpha- | campholenic aldehyde | FL/FR |
| carrot seed oil (daucus carota ssp. maximus (desf.) ball) | FR |
| carum carvi fruit oil | FL/FR |
| carvacryl methyl ether | FL/FR |
| celery ketone | FL/FR |
| celery specialty | FR |
| chamomile oil morocco | FR |
| chamomile oil replacer | FR |
| chrysanthemum ketone | FR |
| chrysanthemum specialty | FR |
1,8- | cineole | FL/FR |
| coriander oleoresin | FL/FR |
| coriander seed concrete | FR |
| dehydroxylinalool oxide | FL/FR |
| dill weed oil cuba | FL/FR |
| dill weed oil reunion | FL/FR |
| dimethyl benzyl carbinyl formate | FL/FR |
| dimethyl cyclormol (IFF) | FR |
2-(2,4- | dimethyl-3-cyclohexene-1-yl)-4,4-dimethyl-1,3-oxathiane | FR |
| elder flower absolute (sambucus canadensis and s. nigra) | FR |
2,10- | epoxypinane | FR |
| eucalyptus globulus oil | FL/FR |
| eucalyptus radiata leaf/stem oil | FR |
| fougere herbal fragrance | FR |
| geranic oxide | FL/FR |
| herbal acetal | FR |
| herbal carene | FR |
cis- | herbal cyclohexane | FR |
| herbal dioxane | FR |
| herbal heptane | FR |
| hop absolute | FL/FR |
| hop oil | FL/FR |
| hyssopus officinalis extract | FL/FR |
| hyssopus officinalis leaf tincture | FL/FR |
| lantana camara flower oil | FR |
| laurel bark oil | |
| laurel stem oil | |
| lavandin absolute | FL/FR |
| lavandin absolute decolorized | FL/FR |
| lavandin concrete | FL/FR |
abrialis | lavandin oil | FL/FR |
spike | lavender absolute | FL/FR |
| lavender absolute bulgaria | FL/FR |
| lavender absolute france | FL/FR |
spike | lavender oil | FL/FR |
| linalyl formate | FL/FR |
| linalyl octanoate | FL/FR |
| marigold absolute (tagetes patula) | FR |
| marigold oil mexico | FL/FR |
| melaleuca leucadendron var. cajuputi leaf oil | FL/FR |
1-para- | menthen-9-yl acetate | FL/FR |
1-(2- | methyl allyl oxy) heptane | FR |
| methyl cyclogeranate (Firmenich) | FR |
(E)-6- | methyl-3-hepten-2-one | FL/FR |
| mistletoe absolute | |
| mistletoe fragrance | FR |
| monarda fistulosa oil | FR |
T- | muurolol | FL/FR |
| myrtenol | FL/FR |
| niaouli oil | FR |
3- | nonanol | FL/FR |
| nonisyl formate | FR |
(E,Z)-3,5- | octadien-2-one | |
3- | octanon-1-ol | FL/FR |
1- | octen-3-yl acetate | FL/FR |
| oregano flower/leaf/stem water | FR |
| oregano leaf | |
| oregano oil mexico | FL/FR |
| oregano oil replacer | FR |
| oregano specialty | FR |
| origanum oil greece | FL/FR |
| origanum oil terpenes | FR |
curled | parsley leaf oil | FL/FR |
| perilla leaf oil | FL/FR |
| perillaldehyde | FL/FR |
| petroselinum crispum seed oil CO2 extract | FL/FR |
| phenyl acetaldehyde diisoamyl acetal | FR |
alpha- | pinene | FL/FR |
| pinocarveol | FL/FR |
| prenyl senecioate | FL/FR |
| rain forest specialty | FR |
| rosemary absolute | FL/FR |
| rosemary oil | FL/FR |
| rosemary oil africa | FL/FR |
| rosemary oil morocco | FL/FR |
| rosemary oil spain | FL/FR |
| rosemary oil tunisia | FL/FR |
| rosmarinus officinalis extract | FL/FR |
| rosmarinus officinalis tincture | FL/FR |
| sage absolute spain | FL/FR |
| tagete oil CO2 extract | FL/FR |
| tagete oil south africa | FL/FR |
| theaspirane | FL/FR |
| thyme absolute | FL/FR |
white | thyme oil | FL/FR |
| thyme oil (thymus zygis gracillis) spain | FL/FR |
| thyme oil (thymus zygis spp. sylvestris) spain | FR |
| thyme oil CO2 extract | FL/FR |
| thyme oil CO2 extract spain | FL/FR |
red | thyme oil india | FL/FR |
red | thyme oil spain | FL/FR |
| thyme oil wild or creeping canada | FL/FR |
| thyme oil wild or creeping pakistan | FL/FR |
| thyme undecane | FR |
| thymol | FL/FR |
| thymyl methyl ether | FL/FR |
| tricyclodecyl acetate | FR |
| viridiflorol | FL/FR |
| wormwood oil america | FL/FR |
| wormwood oil italy | FL/FR |
| wormwood oil poland | FL/FR |
| wormwood oil replacer | FR |
licorice |
bitter | fennel seed oil CO2 extract | FR |
medicinal |
summer | savory oil | FL/FR |
| peppermint cyclohexanone | FL/FR |
iso | pulegyl acetate | FL/FR |
minty |
| artemisia deserti krasch. oil iran | FR |
| betula lenta bark oil america | FL/FR |
| dihydrocarveol | FL/FR |
(R)-(+)- | menthofuran | |
(-)- | menthone | FL/FR |
homo | menthyl acetate | FL/FR |
| methyl salicylate | FL/FR |
| peppermint oil special fractions | FL/FR |
laevo- | piperitone | FL/FR |
5- and 6-iso | propyl-1,3,3-trimethyl bicyclo(2.2.2)-5,7-octadien-2-one | |
(-)-iso | pulegol | FL/FR |
(R)-(+)- | pulegone | FR |
mossy |
| oakmoss absolute | FL/FR |
| treemoss absolute | FR |
naphthyl |
ortho- | methyl anisole | FL/FR |
peppery |
1,5- | dimethyl-3-n-propyl-2-oxabicyclo(2.2.2)octane | |
pine |
| dipentene terpene hydrocarbon byproducts | FR |
| plectranthus glandulosus hook f. leaf oil cameroon | FR |
soapy |
| methyl anthranilate / hexyl cinnamaldehyde schiff's base | FR |
iso | butyl angelate | FL/FR |
| cardamom oil replacer | FR |
| carrot weed oil | FL/FR |
| carvacrol | FL/FR |
| carvacryl ethyl ether | FL/FR |
| caryophyllene | FL/FR |
| cubeb oil | FL/FR |
(-)- | cubenol | FL/FR |
| cuminaldehyde | FL/FR |
| cuminyl alcohol | FL/FR |
black | currant bud absolute | FL/FR |
iso | cyclogeraniol (IFF) | FR |
1,5- | dimethyl-3-n-pentyl-2-oxabicyclo(2.2.2)octane | |
| elettaria cardamomum seed oil | FL/FR |
| elettaria cardamomum seed oil guatemala | FL/FR |
| galangal root oil | FL/FR |
| ginger root absolute | FL/FR |
(R)-gamma- | heptalactone | |
| laurus nobilis fruit oil | FL/FR |
| maja fragrance | FR |
| marjoram absolute spain | |
sweet | marjoram oil (origanum majorana var. tenuifolium weston) cyprus | |
| ocimum gratissimum herb oil india | FR |
2- | octanol | FL/FR |
| origanum majorana oil | FL/FR |
| origanum majorana oil CO2 extract | FL/FR |
| origanum majorana oil cuba | FL/FR |
| outdoors specialty | FR |
black | pepper absolute | FL/FR |
white | pepper oil | FL/FR |
black | pepper oil CO2 extract | FL/FR |
black | pepper oleoresin | FL/FR |
| saffron oil CO2 extract | FL/FR |
white | sassafras oil | FL/FR |
| spicy carbonate | FR |
| sugandha kokila berry oil | FR |
| zvoulimba leaf oil | FR |
para- | cymene | FL/FR |
thujonic |
| cedarleaf oil terpeneless | FR |
| sage oil (salvia lavandulifolia vahl.) spain | FL/FR |
woody |
ar- | abietatriene | |
| bornyl valerate | FL/FR |
2-tert- | butyl cyclohexanone | FR |
| cedarwood oil himalaya | FR |
| cinnamyl tiglate | FL/FR |
| cistus twig/leaf oil | FL/FR |
| dalbergia sissoo leaf oil | FR |
alpha- | farnesene | FL/FR |
alpha- | farnesene isomer | FL/FR |
| fougere woody fragrance | FR |
| guaiacwood oil | FL/FR |
| hedychium spicatum root oil | FR |
1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| hinoki root oil | FR |
(1R,4S)-1- | hydroxy-1,4-dimethyl spiro(4.6)undecan-2-one | |
| juniper berry oil terpenes | FR |
| longifolene | FL/FR |
| origanum vulgare ssp. vulgare oil himalaya | |
| patchouli absolute | FR |
| sandalwood oil | FL/FR |
(±)- | tetrahydronootkatone | FL/FR |
1,3,3,5- | tetramethyl-7 and 8-cyanobicyclo(2.2.2)oct-5-ene | |
alpha- | thujene | |
| thyme oil portuguese | FR |
| verdoxan | FR |
| zedoary bark oil | FL/FR |
|
For Flavor |
|
No flavor group found for these |
ar- | abietatriene | |
6- | acetoxydihydrotheaspirane | FL/FR |
4- | acetyl-2-isopropenyl pyridine | FL |
9- | acetyl-5-methyl-tricyclo[6.2.1.0.sup.2,7 ]undec-4-ene | |
alpha- | amyl cinnamyl formate | FL/FR |
| arnica montana flower extract | FL/FR |
dextro,laevo- | borneol | FL/FR |
dextro- | bornyl acetate | |
iso | bornyl methyl ether | FL/FR |
iso | butyl heptanoate | FL/FR |
4- | butyl thiazole | FL |
2-sec- | butyl thiazole | FL/FR |
S-sec- | butyl thioisovalerate | FL/FR |
sec- | butyl-3-methyl but-2-ene thioate | FL/FR |
delta- | cadinene | |
| carvacryl ethyl ether | FL/FR |
| carvacryl methyl ether | FL/FR |
| cinnamyl tiglate | FL/FR |
(±)-(cis+trans)-1,2- | dihydroperillaldehyde | FL |
| dimethyl benzyl carbinyl formate | FL/FR |
| dipentene | FL/FR |
| ethyl 4-pentenoate | FL/FR |
1- | ethyl-2-methyl propyl chrysanthemumate | |
| fig leaf absolute | FL |
| fleabane oil (erigeron canadensis) | FL |
(R)-gamma- | heptalactone | |
1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| heptyl benzoate | FL/FR |
2- | heptyl cyclopropane carboxylic acid | FL |
(E,E)-2,4- | hexadien-1-ol | FL |
1,3,3,4,5,6- | hexamethyl(2.2.2)bicyclooct-5-en-2-ol | |
(1R,4S)-1- | hydroxy-1,4-dimethyl spiro(4.6)undecan-2-one | |
| laurel bark oil | |
| laurel stem oil | |
| laurus nobilis fruit oil | FL/FR |
| lavandin absolute decolorized | FL/FR |
| linalool oxide (furanoid) | FL/FR |
| marjoram absolute spain | |
sweet | marjoram oil (origanum majorana var. tenuifolium weston) cyprus | |
| melaleuca leucadendron var. cajuputi leaf oil | FL/FR |
(R)-(+)- | menthofuran | |
4- | methyl-2-[2-(methyl thio)ethyl]-1,3-oxathiane | |
6- | methyl-3-hepten-2-one | FL/FR |
(E)-6- | methyl-3-hepten-2-one | FL/FR |
| mistletoe absolute | |
T- | muurolol | FL/FR |
3- | nonanol | FL/FR |
(E,Z)-3,5- | octadien-2-one | |
3- | octanon-1-ol | FL/FR |
(S)-1- | octen-3-ol | FL/FR |
2- | octenal | FL/FR |
3- | octyl butyrate | FL |
| origanum vulgare ssp. vulgare oil himalaya | |
| perilla leaf oil | FL/FR |
| perillaldehyde propylene glycol acetal | FL/FR |
(Z,Z)- | photocitral A | FL |
| prenyl senecioate | FL/FR |
2- | propyl thiazole | FL |
5- and 6-iso | propyl-1,3,3-trimethyl bicyclo(2.2.2)-5,7-octadien-2-one | |
white | sassafras oil | FL/FR |
| seaweed absolute (fucus vesiculosus et serratus) | FL/FR |
| tagete oil rwanda | |
| terpinyl isobutyrate | FL/FR |
(±)- | tetrahydronootkatone | FL/FR |
1,3,3,5- | tetramethyl-7 and 8-acetyl bicyclo(2.2.2)oct-5-ene | |
1,3,3,5- | tetramethyl-7 and 8-cyanobicyclo(2.2.2)oct-5-ene | |
alpha- | thujene | |
ortho- | vinyl anisole | FL |
| viridiflorol | FL/FR |
|
| catsup flavor | FL |
| hexyl 3-mercaptobutanoate | FL |
anise |
| fennel flavor | FL |
sweet | fennel seed oil | FL/FR |
balsamic |
iso | bornyl isobutyrate | FL/FR |
| copaiba balsam oil | FL/FR |
buttery |
| bovolide | FL |
camphoreous |
dextro,laevo-iso | borneol | FL/FR |
laevo- | borneol | FL/FR |
| bornyl ethyl ether | |
| camphor tree bark oil | FL/FR |
(-)-alpha- | fenchol | FL/FR |
laevo- | fenchone | FL/FR |
| geranic oxide | FL/FR |
ortho- | methyl anisole | FL/FR |
| pinocarveol | FL/FR |
| rosemary oil tunisia | FL/FR |
cheesy |
2- | heptanone | FL/FR |
citrus |
| citronella oil ceylon | FL/FR |
cooling |
spike | lavender oil | FL/FR |
iso | menthol | FL |
homo | menthyl acetate | FL/FR |
| theaspirane | FL/FR |
creamy |
3- | octen-2-one | FL/FR |
earthy |
| geosmin | FL/FR |
fatty |
(E)-2- | octenal | FL/FR |
floral |
| bois de rose oil peru | FL/FR |
| dimethyl benzyl carbinyl butyrate | FL/FR |
4,6- | dimethyl-alpha-allyl-3-cyclohexene methanol | |
2,4- | dimethyl-alpha-allyl-3-cyclohexene methanol | |
| geranium oil africa | FL/FR |
| geranium oil egypt | FL/FR |
fruity |
black | currant bud absolute replacer | FL/FR |
| ethyl 2-ethyl acetoacetate | FL/FR |
| hexyl hexanoate | FL/FR |
| linalyl octanoate | FL/FR |
1-para- | menthen-9-yl acetate | FL/FR |
para- | methyl benzyl acetate | FL/FR |
| neryl formate | FL/FR |
| tagete oil CO2 extract | FL/FR |
| tagete oil south africa | FL/FR |
green |
| anethum graveolens herb tincture | FL/FR |
iso | butyl angelate | FL/FR |
iso | butyl methyl ketone | FL/FR |
2-iso | butyl-3-methyl pyrazine | FL/FR |
(+)-alpha- | campholenic aldehyde | FL/FR |
| carrot weed oil | FL/FR |
| celery distillates | FL |
| celery ketone | FL/FR |
| dihydrocarveol | FL/FR |
alpha- | farnesene | FL/FR |
alpha- | farnesene isomer | FL/FR |
| heptanal (aldehyde C-7) | FL/FR |
(E)-4- | hexen-1-ol | |
(Z)-4- | hexen-1-ol | FL/FR |
3- | hexenyl 2-methyl butyrate | FL/FR |
| marigold pot absolute | FL/FR |
3- | nonanone | FL/FR |
| oakmoss absolute | FL/FR |
| ocimene quintoxide | FL/FR |
1- | octen-3-yl acetate | FL/FR |
(Z)- | rose oxide | FL/FR |
| terpinyl propionate | FL/FR |
herbal |
| ajowan seed oil | FL/FR |
| anethum graveolens herb oil | FL/FR |
| anthemis nobilis flower extract | FL/FR |
| anthemis nobilis flower oil roman | FL/FR |
| apium graveolens seed oil | FL/FR |
| apium graveolens seed oil india | FL/FR |
sweet | basil absolute | FL/FR |
| bornyl methyl ether | |
| caraway flavor | FL |
| cardamom distillates | FL |
| cardamom flavor | FL |
| carum carvi fruit oil | FL/FR |
| celery seed oleoresin | FL |
| cilantro herb oil egypt | FL/FR |
| coriander oleoresin | FL/FR |
| coriander seed oil | FL/FR |
| dill weed oil cuba | FL/FR |
| dill weed oil reunion | FL/FR |
| eucalyptus globulus oil | FL/FR |
| hop absolute | FL/FR |
| hop oil | FL/FR |
| hyssopus officinalis extract | FL/FR |
| hyssopus officinalis leaf tincture | FL/FR |
| lavandin absolute | FL/FR |
| lavandin concrete | FL/FR |
abrialis | lavandin oil | FL/FR |
spike | lavender absolute | FL/FR |
| lavender absolute bulgaria | FL/FR |
| lavender absolute france | FL/FR |
| lavender flavor | FL |
| linalyl formate | FL/FR |
| marigold oil mexico | FL/FR |
| ocimum basilicum leaf oil america | FL/FR |
| oregano distillates | FL |
| oregano essence | FL |
| oregano flavor | FL |
| oregano leaf | |
| oregano oil mexico | FL/FR |
| oregano oleoresin | FL |
| origanum majorana oil | FL/FR |
| origanum majorana oil CO2 extract | FL/FR |
| origanum oil greece | FL/FR |
curled | parsley leaf oil | FL/FR |
| petroselinum crispum seed oil CO2 extract | FL/FR |
| prenyl salicylate | FL/FR |
| rosemary absolute | FL/FR |
| rosemary oil | FL/FR |
| rosemary oil africa | FL/FR |
| rosemary oil morocco | FL/FR |
| rosemary oil spain | FL/FR |
| rosmarinus officinalis extract | FL/FR |
| rosmarinus officinalis tincture | FL/FR |
| sage absolute spain | FL/FR |
| sage oil (salvia lavandulifolia vahl.) spain | FL/FR |
| tarragon oleoresin | FL |
| thyme absolute | FL/FR |
white | thyme oil | FL/FR |
| thyme oil (thymus zygis gracillis) spain | FL/FR |
| thyme oil CO2 extract | FL/FR |
| thyme oil CO2 extract spain | FL/FR |
red | thyme oil india | FL/FR |
red | thyme oil spain | FL/FR |
| thyme oil wild or creeping canada | FL/FR |
| thyme oil wild or creeping pakistan | FL/FR |
| thyme oleoresin | FL |
| wormwood oil america | FL/FR |
| wormwood oil italy | FL/FR |
| wormwood oil poland | FL/FR |
licorice |
| estragole | FL/FR |
medicinal |
| frankincense absolute | FL/FR |
summer | savory oil | FL/FR |
mentholic |
| peppermint cyclohexanone | FL/FR |
minty |
| betula lenta bark oil america | FL/FR |
1,8- | cineole | FL/FR |
(-)- | menthone | FL/FR |
| methyl salicylate | FL/FR |
(1R)-(-)- | myrtenal | FL |
| myrtenol | FL/FR |
| peppermint oil special fractions | FL/FR |
laevo- | piperitone | FL/FR |
(-)-iso | pulegol | FL/FR |
mustard |
| mustard flavor | FL |
musty |
| thymyl methyl ether | FL/FR |
oily |
iso | phytol | FL/FR |
peppery |
1,5- | dimethyl-3-n-propyl-2-oxabicyclo(2.2.2)octane | |
phenolic |
| thymol | FL/FR |
solvent |
1- | heptanol | FL/FR |
spicy |
sweet | bay oleoresin | FL |
| carvacrol | FL/FR |
| caryophyllene | FL/FR |
| chipotle chili distillates | FL |
| chipotle chili oleoresin | FL |
| cinnamyl formate | FL/FR |
| cubeb oil | FL/FR |
| cubeb oleoresin | FL |
(-)- | cubenol | FL/FR |
| cuminaldehyde | FL/FR |
| cuminyl alcohol | FL/FR |
black | currant bud absolute | FL/FR |
1,5- | dimethyl-3-n-pentyl-2-oxabicyclo(2.2.2)octane | |
| elettaria cardamomum seed oil | FL/FR |
| elettaria cardamomum seed oil guatemala | FL/FR |
| galangal root oil | FL/FR |
| geranium flavor | FL |
| ginger root absolute | FL/FR |
| jalapeno oleoresin | FL |
2- | octanol | FL/FR |
| origanum majorana oil cuba | FL/FR |
black | pepper absolute | FL/FR |
white | pepper oil | FL/FR |
black | pepper oil CO2 extract | FL/FR |
black | pepper oleoresin | FL/FR |
| perillaldehyde | FL/FR |
2- | phenyl propyl butyrate | FL/FR |
| saffron oil CO2 extract | FL/FR |
winter | savory oil | FL |
terpenic |
para- | cymene | FL/FR |
woody |
iso | bornyl acetate | FL/FR |
| bornyl valerate | FL/FR |
| cistus twig/leaf oil | FL/FR |
| dehydroxylinalool oxide | FL/FR |
| guaiacwood oil | FL/FR |
(Z)- | jasmone | FL/FR |
| longifolene | FL/FR |
alpha- | pinene | FL/FR |
iso | pulegyl acetate | FL/FR |
| sandalwood oil | FL/FR |
| zedoary bark oil | FL/FR |
|