Name: | sassafras albidum (nuttall) nees oil |
CAS Number: | 8006-80-2 |
|
FDA UNII: | 78ZX2PFG2Z |
MDL: | MFCD00148252 |
Category: flavor and fragrance agents
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
Appearance: | yellowish brown clear liquid (est) |
Food Chemicals Codex Listed: | No |
Specific Gravity: | 1.07900 to 1.09800 @ 25.00 °C.
|
Pounds per Gallon - (est).: | 8.978 to 9.136
|
Refractive Index: | 1.53300 to 1.53700 @ 20.00 °C.
|
Boiling Point: | 236.00 °C. @ 760.00 mm Hg
|
Flash Point: | 225.00 °F. TCC ( 107.22 °C. )
|
Soluble in: |
| water, 75.98 mg/L @ 25 °C (est) |
Organoleptic Properties:
|
Odor Type: spicy |
|
Odor Strength: | medium , recommend smelling in a 1.00 % solution or less |
|
Substantivity: | 144 hour(s) at 100.00 % |
|
| sweet spicy fresh camphoreous woody floral root beer sarsaparilla |
Odor Description: at 1.00 % in dipropylene glycol. | sweet spicy fresh camphor woody floral rootbeer Luebke, William tgsc, (1983) |
|
Odor and/or flavor descriptions from others (if found). |
|
|
Cosmetic Information:
Suppliers:
Safety Information:
European information : |
Most important hazard(s): | T - Toxic. |
R 22 - Harmful if swallowed. R 45 - May cause cancer. R 68 - Possible risk of irreversible effects. S 01/02 - Keep locked up and out of the reach of children. S 20/21 - When using do not eat, drink or smoke. S 23 - Do not breath vapour. S 24/25 - Avoid contact with skin and eyes. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 36/37/39 - Wear suitable clothing, gloves and eye/face protection. S 45 - In case of accident or if you feel unwell seek medical advice immediately. S 53 - Avoid exposure - obtain special instructions before use.
|
|
Hazards identification |
|
Classification of the substance or mixture |
GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
None found. |
GHS Label elements, including precautionary statements |
|
Pictogram | |
|
Hazard statement(s) |
None found. |
Precautionary statement(s) |
None found. |
Oral/Parenteral Toxicity: |
oral-rat LD50 1900 mg/kg Food and Chemical Toxicology. Vol. 20, Pg. 825, 1982.
oral-man LDLo 83 mg/kg SENSE ORGANS AND SPECIAL SENSES: MYDRIASIS (PUPILLARY DILATION): EYE
LUNGS, THORAX, OR RESPIRATION: OTHER CHANGES
GASTROINTESTINAL: NAUSEA OR VOMITING Archives of Disease in Childhood. Vol. 28, Pg. 475, 1953.
|
Dermal Toxicity: |
skin-rabbit LD50 > 5000 mg/kg Food and Chemical Toxicology. Vol. 20, Pg. 825, 1982.
|
Inhalation Toxicity: |
Not determined
|
Safety in Use Information:
Category: | flavor and fragrance agents |
RIFM Fragrance Material Safety Assessment: Search |
IFRA Code of Practice Notification of the 49th Amendment to the IFRA Code of Practice |
IFRA fragrance material specification: | | Safrole as such should not be used as a fragrance ingredient; essential oils containing safrole should not be used at a level such that the total concentration of safrole exceeds 0.01% in consumer products. Examples of essential oils with a high safrole content are Sassafras oil (Sassafras officinale Nees& Eberm.), Ocotea Cymbarum oil (Ocotea pretiosa Metz) and certain qualities of Camphor oils.
The total concentration of safrole, isosafrole and dihydrosafrole should not exceed 0.01% in consumer products. |
contains the following IFRA (Annex) restricted components: (non-analysis max. level reference only) |
safrole | Max. Found: 92.00 % and Reason: Carcinogenicity |
Recommendation for white sassafras oil usage levels up to: | | 4.0000 % in the fragrance concentrate.
|
|
Safety References:
References:
| sassafras albidum (nuttall) nees oil |
Canada Domestic Sub. List: | 8006-80-2 |
Pubchem (sid): | 135355615 |
Other Information:
Potential Blenders and core components note
|
For Odor |
No odor group found for these |
4- | methyl-2-(2-methyl propyl)-1,3-oxathiane | |
aldehydic |
2,6- | dimethyl-2,18-nonadecadien-8-one | |
anisic |
| dihydroanethol | FL/FR |
| estragole | FL/FR |
bitter | fennel seed oil spain | FR |
| ocotea cymbarum oil | |
| sassafras acetate | FL/FR |
balsamic |
laevo- | borneol | FL/FR |
dextro,laevo- | borneol | FL/FR |
iso | bornyl methyl ether | FL/FR |
| guaiacyl phenyl acetate | FL/FR |
berry |
sec- | butyl ethyl ether | FL/FR |
camphoreous |
| bornyl ethyl ether | |
2,6- | dimethyl-3-oxatricyclo(4.2.1.0*2,4*)nonane | FR |
chocolate |
1,3,3,4,5,6- | hexamethyl(2.2.2)bicyclooct-5-en-2-ol | |
citrus |
| citrus woody floral fragrance | FR |
| myrcenyl acetate | FL/FR |
earthy |
(-)-alpha- | fenchol | FL/FR |
(Z)- | linalool oxide (furanoid) | FL/FR |
floral |
| amyl cyclopentenone | CS |
| bois de rose oil peru | FL/FR |
| cassie absolute | FL/FR |
delta- | damascone | FL/FR |
| dihydro-alpha-ionone | FL/FR |
2',4'- | dimethyl acetophenone | FL/FR |
2,4- | dimethyl cyclohexyl methyl acetate | FR |
4- | dimethyl ionone | FR |
| elder flower wood specialty | FR |
| epoxylinalyl acetate | |
| ho leaf oil | FR |
(E)-beta- | ionone | FL/FR |
alpha- | ionone | FL/FR |
alpha- | ionyl acetate | FR |
| lavandula angustifolia flower oil | FL/FR |
| lavender oil france | FL/FR |
| lavender oil greece | FL/FR |
laevo- | linalool | FL/FR |
| linalool oxide | FL/FR |
| melaleuca ericifolia leaf oil | FR |
alpha-iso | methyl ionone (60% min.) | FL/FR |
alpha-iso | methyl ionone (70% min.) | FL/FR |
alpha-iso | methyl ionone (80% min.) | FL/FR |
2- | methyl naphthalene | FL/FR |
| mimosa concrete france | FL/FR |
| mimosa tenuiflora leaf extract | FL/FR |
bitter | orangeflower concrete | FR |
| orris rhizome absolute replacer | FR |
| petitgrain cedrat oil | FL/FR |
| petitgrain oil terpenes | FR |
| phenethyl hexanoate | FL/FR |
| rose concrete (rosa centifolia) | FR |
| styralyl formate | FL/FR |
| vetiver pentanone | FR |
fruity |
3- | allyl oxy-1,4-dimethyl bicyclo(3.2.1)octane | FR |
1,4- | diisopropyl-6,8-dioxabicyclo(3.2.1)octane | FR |
2- | ethyl butyl 2-butenoate | |
| linalool oxide acetates | FL/FR |
| octyl propionate | FL/FR |
1,3,3,5- | tetramethyl-7 and 8-acetyl bicyclo(2.2.2)oct-5-ene | |
| tropical ionone | FL/FR |
green |
iso | green methanoindene | FR |
(E)-2- | hexen-1-yl salicylate | FR |
para- | methyl hydratropaldehyde | FL/FR |
herbal |
1- | allyl-2,2,7,7-tetramethyl cycloheptanol | FR |
| calendula officinalis flower oil CO2 extract | FR |
| dimethyl cyclormol (IFF) | FR |
| freesia heptanol | FL/FR |
| geranic oxide | FL/FR |
| herbal dioxane | FR |
| immortelle flower oil | FL/FR |
| laurel bark oil | |
| laurel stem oil | |
| laurus nobilis leaf oil | FL/FR |
| marigold pot flower oil | FL/FR |
| methyl cyclogeranate (Firmenich) | FR |
| origanum oil | FL/FR |
| origanum oil greece | FL/FR |
| rosemary absolute | FL/FR |
| rosemary oil | FL/FR |
| rosemary oil africa | FL/FR |
| rosemary oil morocco | FL/FR |
| rosemary oil spain | FL/FR |
| rosemary oil tunisia | FL/FR |
| rosmarinus officinalis extract | FL/FR |
| thymol | FL/FR |
licorice |
bitter | fennel seed oil CO2 extract | FR |
| peppermint cyclohexanone | FL/FR |
minty |
| pennyroyal oil | FL/FR |
5- and 6-iso | propyl-1,3,3-trimethyl bicyclo(2.2.2)-5,7-octadien-2-one | |
mossy |
| moss specialty | FR |
musk |
| amyris specialty | FR |
| ethylene brassylate | FL/FR |
powdery |
(E)-alpha- | methyl ionone (44-50%) | FL/FR |
rummy |
| rum extract | FL/FR |
spicy |
2,4- | dimethyl-alpha-isopropyl-3-cyclohexene-1-methanol | |
| elettaria cardamomum seed oil | FL/FR |
| elettaria cardamomum seed oil guatemala | FL/FR |
iso | eugenol | FL/FR |
| galangal root oil | FL/FR |
| laurus nobilis fruit oil | FL/FR |
| marjoram absolute spain | |
| safrole | CS |
iso | safrole | |
| sassafras albidum bark tincture (safrol free) | FL/FR |
| sassafras albidum leaf (safrole-free) | |
| sassafras fragrance | FR |
| spicy carbonate | FR |
| zvoulimba leaf oil | FR |
terpenic |
alpha- | terpineol | FL/FR |
thujonic |
| cedarleaf oil terpeneless | FR |
woody |
| anthocephalus cadamba oil | FR |
| bois de rose leaf oil brazil | FL/FR |
| bornyl valerate | FL/FR |
2-tert- | butyl cyclohexanone | FR |
| cabreuva wood oil | FR |
| chloranthus spicatus absolute | FR |
| convolvulus scoparius wood oil | FR |
2- | decalinyl acetate | FR |
| dihydro-beta-ionol | FL/FR |
3',4'- | dimethoxyacetophenone | |
10-epi-gamma- | eudesmol | |
| hedychium spicatum root oil | FR |
1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| hinoki root oil | FR |
| homalomena rubescens root oil | FR |
| juniper berry oil terpenes | FR |
3- | methyl pentyl angelate | FR |
| sandal octanol | FR |
| santalyl acetate | FL/FR |
1,3,3,5- | tetramethyl-7 and 8-cyanobicyclo(2.2.2)oct-5-ene | |
| zdravetz absolute | FR |
| zdravetz oil | FL/FR |
| zedoary bark oil | FL/FR |
|
For Flavor |
|
No flavor group found for these |
dextro,laevo- | borneol | FL/FR |
iso | bornyl methyl ether | FL/FR |
sec- | butyl ethyl ether | FL/FR |
alpha- | campholene acetate | FL |
| dihydro-beta-ionol | FL/FR |
2',4'- | dimethyl acetophenone | FL/FR |
2,6- | dimethyl-2,18-nonadecadien-8-one | |
| epoxylinalyl acetate | |
2- | ethyl butyl 2-butenoate | |
10-epi-gamma- | eudesmol | |
1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
1,3,3,4,5,6- | hexamethyl(2.2.2)bicyclooct-5-en-2-ol | |
| laurel bark oil | |
| laurel stem oil | |
| laurus nobilis fruit oil | FL/FR |
(Z)- | linalool oxide (furanoid) | FL/FR |
| linalool oxide acetates | FL/FR |
| marigold pot flower oil | FL/FR |
| marjoram absolute spain | |
(E)-alpha- | methyl ionone (44-50%) | FL/FR |
alpha-iso | methyl ionone (60% min.) | FL/FR |
4- | methyl-2-(2-methyl propyl)-1,3-oxathiane | |
| ocotea cymbarum oil | |
5- and 6-iso | propyl-1,3,3-trimethyl bicyclo(2.2.2)-5,7-octadien-2-one | |
iso | safrole | |
| styralyl formate | FL/FR |
1,3,3,5- | tetramethyl-7 and 8-acetyl bicyclo(2.2.2)oct-5-ene | |
1,3,3,5- | tetramethyl-7 and 8-cyanobicyclo(2.2.2)oct-5-ene | |
| zdravetz oil | FL/FR |
berry |
| dihydro-alpha-ionone | FL/FR |
camphoreous |
laevo- | borneol | FL/FR |
| bornyl ethyl ether | |
(-)-alpha- | fenchol | FL/FR |
| geranic oxide | FL/FR |
| rosemary oil tunisia | FL/FR |
citrus |
| freesia heptanol | FL/FR |
laevo- | linalool | FL/FR |
| myrcenyl acetate | FL/FR |
| petitgrain cedrat oil | FL/FR |
alpha- | terpineol | FL/FR |
cooling |
iso | menthol | FL |
estery |
| octyl propionate | FL/FR |
floral |
| bois de rose leaf oil brazil | FL/FR |
| bois de rose oil peru | FL/FR |
alpha- | ionone | FL/FR |
alpha-iso | methyl ionone (70% min.) | FL/FR |
alpha-iso | methyl ionone (80% min.) | FL/FR |
| mimosa concrete france | FL/FR |
| mimosa tenuiflora leaf extract | FL/FR |
| tropical ionone | FL/FR |
green |
| linalool oxide | FL/FR |
para- | methyl hydratropaldehyde | FL/FR |
herbal |
| dihydroanethol | FL/FR |
| immortelle flower oil | FL/FR |
| laurus nobilis leaf oil | FL/FR |
| lavandula angustifolia flower oil | FL/FR |
| lavender oil france | FL/FR |
| lavender oil greece | FL/FR |
| origanum oil | FL/FR |
| origanum oil greece | FL/FR |
| rosemary absolute | FL/FR |
| rosemary oil | FL/FR |
| rosemary oil africa | FL/FR |
| rosemary oil morocco | FL/FR |
| rosemary oil spain | FL/FR |
| rosmarinus officinalis extract | FL/FR |
licorice |
| estragole | FL/FR |
mentholic |
| peppermint cyclohexanone | FL/FR |
minty |
| pennyroyal oil | FL/FR |
musk |
| ethylene brassylate | FL/FR |
oily |
2- | methyl naphthalene | FL/FR |
phenolic |
| guaiacyl phenyl acetate | FL/FR |
| thymol | FL/FR |
rummy |
| rum extract | FL/FR |
spicy |
| cassie absolute | FL/FR |
2,4- | dimethyl-alpha-isopropyl-3-cyclohexene-1-methanol | |
| elettaria cardamomum seed oil | FL/FR |
| elettaria cardamomum seed oil guatemala | FL/FR |
iso | eugenol | FL/FR |
| galangal root oil | FL/FR |
| sassafras albidum bark extract (safrol free) | FL |
| sassafras albidum bark tincture (safrol free) | FL/FR |
| sassafras albidum extract (safrole-free) | FL |
| sassafras albidum leaf (safrole-free) | |
tarragon |
| sassafras acetate | FL/FR |
waxy |
| phenethyl hexanoate | FL/FR |
woody |
| bornyl valerate | FL/FR |
delta- | damascone | FL/FR |
3',4'- | dimethoxyacetophenone | |
(E)-beta- | ionone | FL/FR |
| santalyl acetate | FL/FR |
| zedoary bark oil | FL/FR |
|
Potential Uses:
Occurrence (nature, food, other): note
Synonyms:
| laurus albida oil | | laurus sassafras oil | | sassafras albidum oil | | sassafras albidum var. molle oil | | sassafras officinalis oil | | sassafras oil chinese | | sassafras sassafras oil | | sassafras variifolium oil |
Articles:
|