Category: flavor and fragrance agents
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
Appearance: | colorless clear liquid (est) |
Assay: | 97.00 to 100.00 %
|
Food Chemicals Codex Listed: | No |
Specific Gravity: | 0.91900 to 0.93000 @ 25.00 °C.
|
Pounds per Gallon - (est).: | 7.647 to 7.739
|
Refractive Index: | 1.46300 @ 20.00 °C.
|
Boiling Point: | 70.00 °C. @ 10.00 mm Hg
|
Vapor Pressure: | 1.000000 mmHg @ 20.00 °C. |
Vapor Density: | 5.8 ( Air = 1 ) |
Flash Point: | 142.00 °F. TCC ( 61.11 °C. )
|
logP (o/w): | 3.340 |
Soluble in: |
| alcohol | | water, 58.15 mg/L @ 25 °C (est) |
Insoluble in: |
| water |
Organoleptic Properties:
|
Odor Type: balsamic |
|
Odor Strength: | medium |
|
Substantivity: | > 2 hour(s) at 100.00 % |
|
| pine woody camphoreous balsamic |
Odor Description: at 100.00 %. | pine woody camphor borneol Luebke, William tgsc, (1987) |
|
Odor and/or flavor descriptions from others (if found). |
|
Takasago |
Isobornyl Methyl Ether Biobased 90% |
Odor Description: | Pine Can be used in herbal, pine, and woody fragrances. |
|
Moellhausen |
isoBORNYL METHYLETHER |
Odor Description: | fresh, camphoraceous, pine |
Taste Description: | camphoraceous, green |
|
|
Cosmetic Information:
Suppliers:
Safety Information:
Preferred SDS: View |
European information : |
Most important hazard(s): | Xi - Irritant |
R 36/38 - Irritating to skin and eyes. S 02 - Keep out of the reach of children. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 36/37/39 - Wear suitable clothing, gloves and eye/face protection.
|
|
Hazards identification |
|
Classification of the substance or mixture |
GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
None found. |
GHS Label elements, including precautionary statements |
|
Pictogram | |
|
Hazard statement(s) |
None found. |
Precautionary statement(s) |
None found. |
Human Experience: |
Undiluted liquid reported to be a skin irritant. |
Oral/Parenteral Toxicity: |
oral-rat LDLo 5000 mg/kg Food and Chemical Toxicology. Vol. 30, Pg. 53S, 1992.
|
Dermal Toxicity: |
skin-rabbit LD50 > 5000 mg/kg Food and Chemical Toxicology. Vol. 30, Pg. 53S, 1992.
|
Inhalation Toxicity: |
Not determined
|
Safety in Use Information:
Safety References:
EPI System: | View |
AIDS Citations: | Search |
Cancer Citations: | Search |
Toxicology Citations: | Search |
EPA Substance Registry Services (TSCA): | 5331-32-8 |
EPA ACToR: | Toxicology Data |
EPA Substance Registry Services (SRS): | Registry |
Laboratory Chemical Safety Summary : | 95330 |
National Institute of Allergy and Infectious Diseases: | Data |
WISER: | UN 1993 |
WGK Germany: | 2 |
| 6-methoxy-1,7,7-trimethylbicyclo[2.2.1]heptane |
Chemidplus: | 0005331328 |
RTECS: | DT5078000 for cas# 5331-32-8 |
| (1S,4R,6S)-6-methoxy-1,7,7-trimethylbicyclo[2.2.1]heptane |
References:
| 6-methoxy-1,7,7-trimethylbicyclo[2.2.1]heptane |
NIST Chemistry WebBook: | Search Inchi |
Canada Domestic Sub. List: | 5331-32-8 |
Pubchem (cid): | 95330 |
Pubchem (sid): | 135054724 |
| (1S,4R,6S)-6-methoxy-1,7,7-trimethylbicyclo[2.2.1]heptane |
NIST Chemistry WebBook: | Search Inchi |
Canada Domestic Sub. List: | 5331-32-8 |
Pubchem (cid): | 220050 |
Pubchem (sid): | 68957 |
Other Information:
Potential Blenders and core components note
|
For Odor |
balsamic |
| abies alba cone oil | FR |
| abies alba leaf extract | FR |
| abies alba needle oil | FL/FR |
dextro- | borneol | FL/FR |
dextro,laevo- | borneol | FL/FR |
laevo- | borneol | FL/FR |
| bornyl acetate | FL/FR |
laevo- | bornyl acetate | FL/FR |
iso | bornyl propionate | FL/FR |
dextro- | fenchone | FL/FR |
| fir balsam absolute | FR |
| fir balsam fragrance | FR |
| gurjun balsam | FR |
camphoreous |
| bornyl ethyl ether | |
2,6- | dimethyl-3-oxatricyclo(4.2.1.0*2,4*)nonane | FR |
| fenchol | FL/FR |
laevo- | fenchone | FL/FR |
| hinoki leaf oil | FR |
chocolate |
1,3,3,4,5,6- | hexamethyl(2.2.2)bicyclooct-5-en-2-ol | |
citrus |
| ocimene quintoxide | FL/FR |
earthy |
(-)-alpha- | fenchol | FL/FR |
scotch | pine needle oil | FL/FR |
scotch | pine needle oil estonia | FL/FR |
scotch | pine needle oil yugoslavia | FL/FR |
floral |
| bois de rose oil peru | FL/FR |
| ho leaf oil | FR |
| verdyl acetate | FR |
fruity |
3- | allyl oxy-1,4-dimethyl bicyclo(3.2.1)octane | FR |
iso | butyl furyl propionate | FL/FR |
1,3,3,5- | tetramethyl-7 and 8-acetyl bicyclo(2.2.2)oct-5-ene | |
herbal |
1- | allyl-2,2,7,7-tetramethyl cycloheptanol | FR |
| barosma betulina leaf oil | FL/FR |
| dimethyl cyclormol (IFF) | FR |
| geranic oxide | FL/FR |
| herbal dioxane | FR |
| herbal specialty | FR |
6- | hydroxydihydrotheaspirane (mixture of isomers) | FL/FR |
| hyssop oil | FL/FR |
| lavandin concrete | FL/FR |
| methyl cyclogeranate (Firmenich) | FR |
| myrtenol | FL/FR |
| nopyl acetate | FR |
| origanum oil | FL/FR |
| origanum oil greece | FL/FR |
| pine hexanol | FR |
laevo-beta- | pinene | FL/FR |
alpha- | pinene | FL/FR |
| pinocarveol | FL/FR |
| rosemary absolute | FL/FR |
| rosemary oil | FL/FR |
| rosemary oil africa | FL/FR |
| rosemary oil morocco | FL/FR |
| rosemary oil replacer | FR |
| rosemary oil spain | FL/FR |
| rosemary oil tunisia | FL/FR |
| terpineols (unspec.) (mixed isomers) | FL/FR |
| terpinolene | FL/FR |
| peppermint cyclohexanone | FL/FR |
minty |
5- and 6-iso | propyl-1,3,3-trimethyl bicyclo(2.2.2)-5,7-octadien-2-one | |
pine |
| cypress oil replacer | FR |
| evergreen fragrance | FR |
white | pine bark oil | FL/FR |
spicy |
| ayou wood oil | FR |
| carvacrol | FL/FR |
| ginger fragrance | FR |
| ginger root oil china | FL/FR |
| ginger root oil replacer | FR |
| ginger specialty | FR |
| outdoors specialty | FR |
white | sassafras oil | FL/FR |
terpenic |
| cypress leaf oil | FR |
D-(+)-beta- | pinene | FL/FR |
thujonic |
| cedarleaf oil terpeneless | FR |
woody |
iso | bornyl isovalerate | FL/FR |
2-tert- | butyl cyclohexanone | FR |
| cedarwood oil port orford | FR |
3,7- | dimethyl-1-octene | |
(E+Z)-4,8- | dimethyl-3,7-nonadien-2-ol | FL/FR |
1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
1,3,3,4,5,6- | hexamethyl bicyclo(2.2.2)oct-5-en-2-one | |
| hinoki root oil | FR |
| juniper berry oil terpenes | FR |
para- | menth-3-en-1-ol | FL/FR |
6- | methoxy-1,6,7-trimethyl octahydro-4,7-methanoindene + 5-methoxy-2,4,5-trimethyl octahydro-4,7-methan | |
| myoporum crassifolium wood oil | FR |
(-)- | myrtenol | |
| myrtenyl formate | FL/FR |
| myrtenyl isobutyrate | |
| nopyl aldehyde | FR |
cis-2- | pinanol | FR |
1,3,3,5- | tetramethyl-7 and 8-cyanobicyclo(2.2.2)oct-5-ene | |
|
For Flavor |
|
No flavor group found for these |
dextro,laevo- | borneol | FL/FR |
dextro- | borneol | FL/FR |
3,7- | dimethyl-1-octene | |
(E+Z)-4,8- | dimethyl-3,7-nonadien-2-ol | FL/FR |
1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
1,3,3,4,5,6- | hexamethyl bicyclo(2.2.2)oct-5-en-2-one | |
1,3,3,4,5,6- | hexamethyl(2.2.2)bicyclooct-5-en-2-ol | |
para- | menth-3-en-1-ol | FL/FR |
6- | methoxy-1,6,7-trimethyl octahydro-4,7-methanoindene + 5-methoxy-2,4,5-trimethyl octahydro-4,7-methan | |
| myrtenyl formate | FL/FR |
| myrtenyl isobutyrate | |
white | pine bark oil | FL/FR |
scotch | pine needle oil | FL/FR |
scotch | pine needle oil estonia | FL/FR |
scotch | pine needle oil yugoslavia | FL/FR |
D-(+)-beta- | pinene | FL/FR |
laevo-beta- | pinene | FL/FR |
5- and 6-iso | propyl-1,3,3-trimethyl bicyclo(2.2.2)-5,7-octadien-2-one | |
white | sassafras oil | FL/FR |
| terpineols (unspec.) (mixed isomers) | FL/FR |
1,3,3,5- | tetramethyl-7 and 8-acetyl bicyclo(2.2.2)oct-5-ene | |
1,3,3,5- | tetramethyl-7 and 8-cyanobicyclo(2.2.2)oct-5-ene | |
|
iso | butyl furyl propionate | FL/FR |
balsamic |
laevo- | bornyl acetate | FL/FR |
iso | bornyl propionate | FL/FR |
camphoreous |
laevo- | borneol | FL/FR |
| bornyl acetate | FL/FR |
| bornyl ethyl ether | |
(-)-alpha- | fenchol | FL/FR |
| fenchol | FL/FR |
laevo- | fenchone | FL/FR |
| geranic oxide | FL/FR |
6- | hydroxydihydrotheaspirane (mixture of isomers) | FL/FR |
| pinocarveol | FL/FR |
| rosemary oil tunisia | FL/FR |
cooling |
dextro- | fenchone | FL/FR |
iso | menthol | FL |
floral |
| bois de rose oil peru | FL/FR |
green |
| ocimene quintoxide | FL/FR |
herbal |
| barosma betulina leaf oil | FL/FR |
| hyssop oil | FL/FR |
| lavandin concrete | FL/FR |
| origanum oil | FL/FR |
| origanum oil greece | FL/FR |
| rosemary absolute | FL/FR |
| rosemary oil | FL/FR |
| rosemary oil africa | FL/FR |
| rosemary oil morocco | FL/FR |
| rosemary oil spain | FL/FR |
mentholic |
| peppermint cyclohexanone | FL/FR |
minty |
(-)- | myrtenol | |
| myrtenol | FL/FR |
spicy |
| carvacrol | FL/FR |
| ginger root oil china | FL/FR |
white | pepper oleoresin | FL |
terpenic |
| abies alba needle oil | FL/FR |
para- | menthatriene | FL |
woody |
iso | bornyl isovalerate | FL/FR |
alpha- | pinene | FL/FR |
| terpinolene | FL/FR |
|
Potential Uses:
Occurrence (nature, food, other): note
Synonyms:
| bicyclo(2.2.1)heptane, 2-methoxy-1,7,7-trimethyl-, exo- | | bicyclo[2.2.1]heptane, 2-methoxy-1,7,7-trimethyl- | | bornane, 2-methoxy-, exo- | iso | borneol methyl ether | (±)-iso | bornyl methyl ether | iso | bornyl methylether | | ether, isobornyl methyl | (rel-2- | methoxy-1,7,7-trimethyl bicyclo(2.2.1)heptane | exo-2- | methoxy-1,7,7-trimethyl bicyclo(2.2.1)heptane | exo-2- | methoxy-1,7,7-trimethyl norbornane | exo-2- | methoxy-1,7,7-trimethylbicyclo(2.2.1)heptane | 2- | methoxy-1,7,7-trimethylbicyclo[2.2.1]heptane | 6- | methoxy-1,7,7-trimethylbicyclo[2.2.1]heptane | exo-2- | methoxy-1,7,7-trimethylbicyclo[2.2.1]heptane | | methoxy-1,7,7-trimethylnorbornane | exo-2- | methoxybornane |
Articles:
|