Category: flavor and fragrance agents
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
Appearance: | colorless crystals (est) |
Assay: | 80.00 to 100.00 %
|
Food Chemicals Codex Listed: | No |
Optical Rotation: | -20.00 to 0.00
|
Melting Point: | 206.00 to 208.00 °C. @ 760.00 mm Hg
|
Boiling Point: | 210.00 to 212.00 °C. @ 779.00 mm Hg
|
Boiling Point: | 203.00 to 204.00 °C. @ 760.00 mm Hg
|
Vapor Pressure: | 0.040000 mmHg @ 25.00 °C. (est) |
Vapor Density: | 5.3 ( Air = 1 ) |
Flash Point: | 150.00 °F. TCC ( 65.56 °C. )
|
logP (o/w): | 3.010 |
Shelf Life: | 24.00 month(s) or longer if stored properly. |
Storage: | store in cool, dry place in tightly sealed containers, protected from heat and light. |
Soluble in: |
| alcohol | | dipropylene glycol | | propylene glycol | | water, 1186 mg/L @ 25 °C (est) |
Insoluble in: |
| water |
Stability: |
| bath foam | | cream | | detergent | | lotion | | non-discoloring in most media | | shampoo |
Organoleptic Properties:
|
Odor Type: balsamic |
|
Odor Strength: | medium , recommend smelling in a 10.00 % solution or less |
|
Substantivity: | 16 hour(s) at 100.00 % |
|
| pine woody camphoreous peppery |
Odor Description: at 10.00 % in dipropylene glycol. | pine woody camphor Luebke, William tgsc, (1989) |
|
|
Flavor Type: camphoreous |
|
| earthy minty camphoreous herbal woody musty |
Taste Description:
| earthy minty camphoreous herbal woody musty Luebke, William tgsc, (1989) |
|
Odor and/or flavor descriptions from others (if found). |
|
|
Cosmetic Information:
Suppliers:
Safety Information:
Preferred SDS: View |
European information : |
Most important hazard(s): | Xn - Harmful. |
R 22 - Harmful if swallowed. R 43 - May cause sensitisation by skin contact. S 02 - Keep out of the reach of children. S 22 - Do not breath dust. S 36/39 - Wear suitable clothing and eye/face protection.
|
|
Hazards identification |
|
Classification of the substance or mixture |
GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
None found. |
GHS Label elements, including precautionary statements |
|
Pictogram | |
|
Hazard statement(s) |
None found. |
Precautionary statement(s) |
None found. |
Human Experience: |
20 % solution: no irritation or sensitization. |
Oral/Parenteral Toxicity: |
oral-rat LD50 5800 mg/kg Food and Cosmetics Toxicology. Vol. 16, Pg. 655, 1978.
|
Dermal Toxicity: |
Not determined
|
Inhalation Toxicity: |
Not determined
|
Safety in Use Information:
Category: | flavor and fragrance agents |
RIFM Fragrance Material Safety Assessment: Search |
IFRA Code of Practice Notification of the 49th Amendment to the IFRA Code of Practice |
Recommendation for laevo-borneol usage levels up to: | | 8.0000 % in the fragrance concentrate.
|
|
Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). |
The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA Flavor Ingredient Library |
publication number: 3 |
Click here to view publication 3 |
| average usual ppm | average maximum ppm |
baked goods: | - | 5.10000 |
beverages(nonalcoholic): | 0.25000 | 1.40000 |
beverages(alcoholic): | - | - |
breakfast cereal: | - | - |
cheese: | - | - |
chewing gum: | - | 0.30000 |
condiments / relishes: | - | - |
confectionery froastings: | - | - |
egg products: | - | - |
fats / oils: | - | - |
fish products: | - | - |
frozen dairy: | - | 1.40000 |
fruit ices: | - | 1.40000 |
gelatins / puddings: | - | - |
granulated sugar: | - | - |
gravies: | - | - |
hard candy: | - | 3.70000 |
imitation dairy: | - | - |
instant coffee / tea: | - | - |
jams / jellies: | - | - |
meat products: | - | - |
milk products: | - | - |
nut products: | - | - |
other grains: | - | - |
poultry: | - | - |
processed fruits: | - | - |
processed vegetables: | - | - |
reconstituted vegetables: | - | - |
seasonings / flavors: | - | - |
snack foods: | - | - |
soft candy: | - | - |
soups: | - | - |
sugar substitutes: | - | - |
sweet sauces: | - | - |
Safety References:
Flavor & Extract Manufacturers Association (FEMA) reference(s): |
The FEMA GRAS assessment of alicyclic substances used as flavor ingredients. View pdf |
EPI System: | View |
AIDS Citations: | Search |
Cancer Citations: | Search |
Toxicology Citations: | Search |
EPA GENetic TOXicology: | Search |
EPA Substance Registry Services (TSCA): | 464-45-9 |
EPA ACToR: | Toxicology Data |
EPA Substance Registry Services (SRS): | Registry |
Laboratory Chemical Safety Summary : | 10049 |
National Institute of Allergy and Infectious Diseases: | Data |
WISER: | UN 1312 |
WGK Germany: | 2 |
| (1S,4R,6R)-1,7,7-trimethylbicyclo[2.2.1]heptan-6-ol |
Chemidplus: | 0000464459 |
RTECS: | DT5095000 for cas# 464-45-9 |
References:
Other Information:
Potential Blenders and core components note
|
For Odor |
alcoholic |
alcoholic |
iso | propyl alcohol | FL/FR |
aldehydic |
| agrumen nitrile | FR |
| dodecanal (aldehyde C-12 lauric) | FL/FR |
2- | methyl undecanal (aldehyde C-12 mna) | FL/FR |
amber |
| amber naphthofuran | FL/FR |
| ambrette seed oil | FL/FR |
| angelica root oil | FL/FR |
| cistus ladaniferus resinoid | FL/FR |
animal |
| costus valerolactone | FR |
balsamic |
| amyris wood oil | FL/FR |
siam | benzoin resinoid | FL/FR |
| benzyl salicylate | FL/FR |
dextro,laevo-iso | borneol | FL/FR |
dextro- | borneol | FL/FR |
dextro,laevo- | borneol | FL/FR |
| bornyl acetate | FL/FR |
iso | bornyl acetate | FL/FR |
iso | bornyl formate | FL/FR |
iso | bornyl isobutyrate | FL/FR |
iso | bornyl methyl ether | FL/FR |
iso | bornyl propionate | FL/FR |
| brachyleana hutchinsii wood oil | FR |
| fir balsam absolute | FR |
| myrrh oil | FL/FR |
| opoponax resinoid replacer | FR |
| valerian rhizome absolute | FL/FR |
camphoreous |
| bornyl ethyl ether | |
2,6- | dimethyl-3-oxatricyclo(4.2.1.0*2,4*)nonane | FR |
| fenchol | FL/FR |
laevo- | fenchone | FL/FR |
chocolate |
1,3,3,4,5,6- | hexamethyl(2.2.2)bicyclooct-5-en-2-ol | |
citrus |
| myrcenyl acetate | FL/FR |
coconut |
(S)-gamma- | hexalactone | |
earthy |
2- | ethyl fenchol | FL/FR |
(-)-alpha- | fenchol | FL/FR |
(Z)- | linalool oxide (furanoid) | FL/FR |
floral |
| acetophenone | FL/FR |
alpha- | amyl cinnamaldehyde | FL/FR |
| bois de rose oil peru | FL/FR |
| cassie absolute | FL/FR |
| coriander seed oil | FL/FR |
| dihydrocarvyl acetate | FL/FR |
| dimethyl benzyl carbinol | FL/FR |
alpha- | hexyl cinnamaldehyde | FL/FR |
| ho leaf oil | FR |
beta- | ionone | FL/FR |
2- | methyl naphthalene | FL/FR |
| mimosa absolute morocco | FL/FR |
bitter | orangeflower concrete morocco | FR |
| petitgrain bigarade oil | FL/FR |
fruity |
3- | allyl oxy-1,4-dimethyl bicyclo(3.2.1)octane | FR |
(R)-gamma- | dodecalactone | FL/FR |
2- | ethyl butyl 2-butenoate | |
| menthyl isovalerate | FL/FR |
1,3,3,5- | tetramethyl-7 and 8-acetyl bicyclo(2.2.2)oct-5-ene | |
green |
| geranic acid | FL/FR |
iso | green methanoindene | FR |
| rose leaf absolute (rosa centifolia) | FL/FR |
3,5,5- | trimethyl hexanol | FL/FR |
herbal |
1- | allyl-2,2,7,7-tetramethyl cycloheptanol | FR |
| anethum graveolens herb oil | FL/FR |
| angelica archangelica seed extract | FL/FR |
| anthemis nobilis flower oil roman | FL/FR |
| barosma betulina leaf oil | FL/FR |
| camphene carbinyl acetate | FR |
| chamomile oil morocco | FR |
1,8- | cineole | FL/FR |
| daucus carota fruit oil | FL/FR |
iso | dihydrolavandulal | FL/FR |
| dimethyl cyclormol (IFF) | FR |
delta- | elemene | FL/FR |
| geranic oxide | FL/FR |
| herbal dioxane | FR |
6- | hydroxydihydrotheaspirane (mixture of isomers) | FL/FR |
| hyssopus officinalis extract | FL/FR |
| hyssopus officinalis leaf tincture | FL/FR |
spike | lavender oil | FL/FR |
| melaleuca leucadendron cajaputi oil | FL/FR |
| methyl cyclogeranate (Firmenich) | FR |
| myrtenol | FL/FR |
| origanum oil | FL/FR |
| origanum oil greece | FL/FR |
curled | parsley leaf oil | FL/FR |
| pine hexanol | FR |
beta- | pinene | FL/FR |
alpha- | pinene | FL/FR |
| rosemary absolute | FL/FR |
| rosemary oil | FL/FR |
| rosemary oil africa | FL/FR |
| rosemary oil morocco | FL/FR |
| rosemary oil replacer | FR |
| rosemary oil spain | FL/FR |
| rosemary oil tunisia | FL/FR |
| sabinene hydrate | FL/FR |
| tea leaf absolute | FL/FR |
| theaspirane | FL/FR |
| thymol | FL/FR |
| yerba mate absolute | FL/FR |
honey |
| methyl phenyl acetate | FL/FR |
mentholic |
(±)- | menthol | FL/FR |
laevo- | menthol | FL/FR |
| peppermint cyclohexanone | FL/FR |
iso | pulegyl acetate | FL/FR |
minty |
| agathosma crenulata leaf oil | FL/FR |
| peppermint oil idaho | FL/FR |
5- and 6-iso | propyl-1,3,3-trimethyl bicyclo(2.2.2)-5,7-octadien-2-one | |
mossy |
| oakmoss absolute | FL/FR |
| oakmoss distillates | FL/FR |
| veramoss (IFF) | FR |
musk |
| acetyl ethyl tetramethyl tetralin replacer | FR |
| musk decanolide | FR |
musty |
ketoiso | phorone | FL/FR |
nutty |
2- | ethyl pyrazine | FL/FR |
powdery |
para- | anisyl alcohol | FL/FR |
spicy |
| cassia bark oil china | FL/FR |
| clove bud oil | FL/FR |
black | currant bud absolute | FL/FR |
2,5- | dimethyl bicyclo(3.2.1)-2-octen-3-yl acetate + 1,4-dimethyl bicyclo(3.2.1)-2-octen-3-yl acetate | FR |
| elettaria cardamomum seed oil | FL/FR |
| ginger fragrance | FR |
| ginger root absolute | FL/FR |
| ginger root oil china | FL/FR |
| ginger root oil replacer | FR |
| ginger specialty | FR |
| grains of paradise oil | FL/FR |
| methyl heptadienone | FL/FR |
| origanum majorana oleoresin | FL/FR |
black | pepper oil CO2 extract | FL/FR |
| pimenta acris leaf oil | FL/FR |
white | sassafras oil | FL/FR |
terpenic |
| frankincense oil | FL/FR |
| juniperus communis fruit oil | FL/FR |
| pine needle oil dwarf | FL/FR |
thujonic |
| armoise oil | FR |
| cedarleaf oil terpeneless | FR |
tonka |
| tonka bean absolute | FR |
tropical |
| genet absolute | FL/FR |
vanilla |
| vanillin | FL/FR |
waxy |
| ethyl laurate | FL/FR |
woody |
| agarwood oil (aetoxylon sympetalum) | FR |
2-tert- | butyl cyclohexanone | FR |
| cabreuva wood oil | FR |
atlas | cedarwood oil | FR |
| cistus twig/leaf oil | FL/FR |
| guaiacwood oil 20% in gurjun balsam oil | FR |
| gurjun balsam oil | FR |
1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| hinoki root oil | FR |
| homalomena rubescens root oil | FR |
| juniper berry oil terpenes | FR |
6- | methoxy-1,6,7-trimethyl octahydro-4,7-methanoindene + 5-methoxy-2,4,5-trimethyl octahydro-4,7-methan | |
| methyl cedryl ketone | FL/FR |
(-)- | myrtenol | |
| patchouli ethanone | FR |
| patchouli oil | FL/FR |
| sandalwood oil CO2 extract | FL/FR |
| santall | FR |
| spikenard oil CO2 extract | FL/FR |
1,3,3,5- | tetramethyl-7 and 8-cyanobicyclo(2.2.2)oct-5-ene | |
| thuja occidentalis leaf oil | FL/FR |
| woody acetate | FR |
|
For Flavor |
|
No flavor group found for these |
dextro- | borneol | FL/FR |
dextro,laevo- | borneol | FL/FR |
iso | bornyl methyl ether | FL/FR |
| cistus ladaniferus resinoid | FL/FR |
(R)-gamma- | dodecalactone | FL/FR |
delta- | elemene | FL/FR |
2- | ethyl butyl 2-butenoate | |
| grains of paradise oil | FL/FR |
1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
(S)-gamma- | hexalactone | |
1,3,3,4,5,6- | hexamethyl(2.2.2)bicyclooct-5-en-2-ol | |
(Z)- | linalool oxide (furanoid) | FL/FR |
6- | methoxy-1,6,7-trimethyl octahydro-4,7-methanoindene + 5-methoxy-2,4,5-trimethyl octahydro-4,7-methan | |
5- and 6-iso | propyl-1,3,3-trimethyl bicyclo(2.2.2)-5,7-octadien-2-one | |
white | sassafras oil | FL/FR |
| spikenard oil CO2 extract | FL/FR |
1,3,3,5- | tetramethyl-7 and 8-acetyl bicyclo(2.2.2)oct-5-ene | |
1,3,3,5- | tetramethyl-7 and 8-cyanobicyclo(2.2.2)oct-5-ene | |
alcoholic |
iso | propyl alcohol | FL/FR |
amber |
| amber naphthofuran | FL/FR |
| ambrette seed oil | FL/FR |
balsamic |
siam | benzoin resinoid | FL/FR |
| benzyl salicylate | FL/FR |
iso | bornyl isobutyrate | FL/FR |
iso | bornyl propionate | FL/FR |
| myrrh oil | FL/FR |
camphoreous |
dextro,laevo-iso | borneol | FL/FR |
| bornyl acetate | FL/FR |
| bornyl ethyl ether | |
(-)-alpha- | fenchol | FL/FR |
| fenchol | FL/FR |
laevo- | fenchone | FL/FR |
| geranic oxide | FL/FR |
6- | hydroxydihydrotheaspirane (mixture of isomers) | FL/FR |
| rosemary oil tunisia | FL/FR |
citrus |
| myrcenyl acetate | FL/FR |
| petitgrain bigarade oil | FL/FR |
ketoiso | phorone | FL/FR |
cooling |
spike | lavender oil | FL/FR |
iso | menthol | FL |
laevo- | menthol | FL/FR |
| sabinene hydrate | FL/FR |
| theaspirane | FL/FR |
| WS-3 | FL |
earthy |
2- | ethyl fenchol | FL/FR |
floral |
| bois de rose oil peru | FL/FR |
| dihydrocarvyl acetate | FL/FR |
| methyl phenyl acetate | FL/FR |
| mimosa absolute morocco | FL/FR |
fruity |
para- | anisyl alcohol | FL/FR |
| menthyl isovalerate | FL/FR |
| valerian rhizome absolute | FL/FR |
green |
| angelica root oil | FL/FR |
| geranic acid | FL/FR |
| methyl heptadienone | FL/FR |
| oakmoss absolute | FL/FR |
iso | phorone | FL |
| rose leaf absolute (rosa centifolia) | FL/FR |
3,5,5- | trimethyl hexanol | FL/FR |
hay |
| genet absolute | FL/FR |
herbal |
| anethum graveolens herb oil | FL/FR |
| angelica archangelica seed extract | FL/FR |
| anthemis nobilis flower oil roman | FL/FR |
| barosma betulina leaf oil | FL/FR |
| cardamom distillates | FL |
| cardamom flavor | FL |
| coriander seed oil | FL/FR |
| daucus carota fruit oil | FL/FR |
iso | dihydrolavandulal | FL/FR |
| dill flavor | FL |
| eucalyptus flavor | FL |
| hyssopus officinalis extract | FL/FR |
| hyssopus officinalis leaf tincture | FL/FR |
| melaleuca leucadendron cajaputi oil | FL/FR |
| origanum oil | FL/FR |
| origanum oil greece | FL/FR |
| parsley flavor | FL |
curled | parsley leaf oil | FL/FR |
curled | parsley oleoresin | FL |
| rosemary absolute | FL/FR |
| rosemary oil | FL/FR |
| rosemary oil africa | FL/FR |
| rosemary oil morocco | FL/FR |
| rosemary oil spain | FL/FR |
| yerba mate absolute | FL/FR |
medicinal |
| dimethyl benzyl carbinol | FL/FR |
mentholic |
(±)- | menthol | FL/FR |
| peppermint cyclohexanone | FL/FR |
minty |
| agathosma crenulata leaf oil | FL/FR |
1,8- | cineole | FL/FR |
(-)- | myrtenol | |
| myrtenol | FL/FR |
| peppermint oil idaho | FL/FR |
mossy |
| oakmoss distillates | FL/FR |
nutty |
2- | ethyl pyrazine | FL/FR |
oily |
2- | methyl naphthalene | FL/FR |
phenolic |
| thymol | FL/FR |
pine |
| pine needle oil dwarf | FL/FR |
beta- | pinene | FL/FR |
powdery |
| acetophenone | FL/FR |
smoky |
dextro- | xylose | FL |
soapy |
| dodecanal (aldehyde C-12 lauric) | FL/FR |
spicy |
| cassia bark oil china | FL/FR |
| cassie absolute | FL/FR |
| clove bud oil | FL/FR |
black | currant bud absolute | FL/FR |
| elettaria cardamomum seed oil | FL/FR |
| ginger root absolute | FL/FR |
| ginger root oil china | FL/FR |
| origanum majorana oleoresin | FL/FR |
black | pepper oil CO2 extract | FL/FR |
| pimenta acris leaf oil | FL/FR |
tea |
| mate flavor | FL |
| tea leaf absolute | FL/FR |
| yerba mate flavor | FL |
terpenic |
| juniperus communis fruit oil | FL/FR |
para- | menthatriene | FL |
tropical |
alpha- | amyl cinnamaldehyde | FL/FR |
vanilla |
| vanillin | FL/FR |
waxy |
| ethyl laurate | FL/FR |
alpha- | hexyl cinnamaldehyde | FL/FR |
2- | methyl undecanal (aldehyde C-12 mna) | FL/FR |
woody |
| amyris wood oil | FL/FR |
iso | bornyl acetate | FL/FR |
iso | bornyl formate | FL/FR |
| cistus twig/leaf oil | FL/FR |
| frankincense oil | FL/FR |
beta- | ionone | FL/FR |
| methyl cedryl ketone | FL/FR |
| patchouli oil | FL/FR |
alpha- | pinene | FL/FR |
iso | pulegyl acetate | FL/FR |
| sandalwood oil CO2 extract | FL/FR |
| thuja occidentalis leaf oil | FL/FR |
|
Potential Uses:
Occurrence (nature, food, other): note
Synonyms:
| bicyclo[2.2.1]heptan-2-ol, 1,7,7-trimethyl-, (1S,2R,4R)- | L-2- | bornanol | L-endo-2- | bornanol | laevo-2- | bornanol | laevo-endo-2- | bornanol | ((1S)-endo)-(-)- | borneol | (1S,2R,4S)-(-)- | borneol | L- | borneol | L- | borneol crystals 80% | L- | borneol crystals 95% | laevo- | borneol crystals extra (80-20) | L- | borneol flakes | L- | borneol natural | L- | borneol pure | L-2- | camphanol | L-endo-2- | camphanol | laevo-2- | camphanol | laevo-endo-2- | camphanol | L- | camphol | laevo- | camphol | L-endo-2- | hydroxybornane | laevo-2- | hydroxybornane | laevo-endo-2- | hydroxycamphane | (1S-endo)-1,7,7- | trimethyl bicyclo(2.2.1)heptan-2-ol | L-1,7,7- | trimethyl bicyclo(2.2.1)heptan-2-ol | laevo-1,7,7- | trimethyl bicyclo(2.2.1)heptan-2-ol | (1S,2R,4R)-1,7,7- | trimethylbicyclo[2.2.1]heptan-2-ol | (1S,4R,6R)-1,7,7- | trimethylbicyclo[2.2.1]heptan-6-ol |
Articles:
|