Name: | thymus capitatus l. hoffmanns & link herb oil |
CAS Number: | 8007-11-2 |
|
FDA UNII: | Search |
MDL: | MFCD00131768 |
Category: flavor and fragrance agents
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
Appearance: | amber clear liquid (est) |
Food Chemicals Codex Listed: | No |
Boiling Point: | 239.00 °C. @ 760.00 mm Hg
|
Flash Point: | 145.00 °F. TCC ( 62.78 °C. )
|
Soluble in: |
| alcohol | | water, 301.1 mg/L @ 25 °C (est) |
Insoluble in: |
| water |
Stability: |
| non-discoloring in most media |
Organoleptic Properties:
|
Odor Type: herbal |
|
Odor Strength: | high , recommend smelling in a 1.00 % solution or less |
|
Substantivity: | 72 hour(s) at 100.00 % |
|
| thyme green herbal camphoreous woody |
Odor Description: at 1.00 % in propylene glycol. | thyme green herbal camphor woody |
|
|
Flavor Type: herbal |
|
| origanum |
Taste Description:
| origanum |
|
Odor and/or flavor descriptions from others (if found). |
|
|
Cosmetic Information:
Suppliers:
Safety Information:
European information : |
Most important hazard(s): | T - Toxic. |
R 22 - Harmful if swallowed. R 24 - Toxic in contact with skin. R 36/37/38 - Irritating to eyes, respiratory system, and skin. S 02 - Keep out of the reach of children. S 20/21 - When using do not eat, drink or smoke. S 24/25 - Avoid contact with skin and eyes. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 27 - Take off immediately all contaminated clothing. S 36/37/39 - Wear suitable clothing, gloves and eye/face protection.
|
|
Hazards identification |
|
Classification of the substance or mixture |
GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
None found. |
GHS Label elements, including precautionary statements |
|
Pictogram | |
|
Hazard statement(s) |
None found. |
Precautionary statement(s) |
None found. |
Oral/Parenteral Toxicity: |
oral-rat LD50 1850 mg/kg Food and Cosmetics Toxicology. Vol. 12, Pg. 945, 1974.
|
Dermal Toxicity: |
skin-rabbit LD50 320 mg/kg Food and Cosmetics Toxicology. Vol. 12, Pg. 945, 1974.
|
Inhalation Toxicity: |
Not determined
|
Safety in Use Information:
Category: | flavor and fragrance agents |
RIFM Fragrance Material Safety Assessment: Search |
IFRA Code of Practice Notification of the 49th Amendment to the IFRA Code of Practice |
contains the following IFRA (Annex) restricted components: (non-analysis max. level reference only) |
(E)-2-hexen-1-al | Max. Found: trace to <0.10 % and Reason: Sensitization |
L-carvone | Max. Found: 0.2 % and Reason: Sensitization |
citral | Max. Found: 0.3 % and Reason: Sensitization |
|
Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). |
The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA Flavor Ingredient Library |
publication number: 3 |
Click here to view publication 3 |
| average usual ppm | average maximum ppm |
baked goods: | 0.60000 | 33.00000 |
beverages(nonalcoholic): | - | 0.50000 |
beverages(alcoholic): | - | - |
breakfast cereal: | - | - |
cheese: | - | - |
chewing gum: | - | - |
condiments / relishes: | - | 30.00000 |
confectionery froastings: | - | - |
egg products: | - | - |
fats / oils: | - | - |
fish products: | - | - |
frozen dairy: | - | 0.50000 |
fruit ices: | - | 0.50000 |
gelatins / puddings: | - | - |
granulated sugar: | - | - |
gravies: | - | - |
hard candy: | - | 0.50000 |
imitation dairy: | - | - |
instant coffee / tea: | - | - |
jams / jellies: | - | - |
meat products: | - | 37.00000 |
milk products: | - | - |
nut products: | - | - |
other grains: | - | - |
poultry: | - | - |
processed fruits: | - | - |
processed vegetables: | - | - |
reconstituted vegetables: | - | - |
seasonings / flavors: | - | - |
snack foods: | - | - |
soft candy: | - | - |
soups: | - | - |
sugar substitutes: | - | - |
sweet sauces: | - | - |
Safety References:
References:
| thymus capitatus l. hoffmanns & link herb oil |
Canada Domestic Sub. List: | 8007-11-2 |
Pubchem (sid): | 135332943 |
Other Information:
Potential Blenders and core components note
|
For Odor |
No odor group found for these |
| tagete oil rwanda | |
aldehydic |
| agrumen nitrile | FR |
animal |
iso | butyl quinoline | FR |
anisic |
| estragole | FL/FR |
| ocimum basilicum leaf oil america | FL/FR |
balsamic |
laevo- | borneol | FL/FR |
dextro,laevo-iso | borneol | FL/FR |
dextro,laevo- | borneol | FL/FR |
iso | bornyl acetate | FL/FR |
iso | bornyl methyl ether | FL/FR |
| cinnamyl formate | FL/FR |
christmas | pine fragrance | FR |
camphoreous |
dextro- | bornyl acetate | |
| bornyl ethyl ether | |
| camphor tree bark oil | FL/FR |
2,6- | dimethyl-3-oxatricyclo(4.2.1.0*2,4*)nonane | FR |
laevo- | fenchone | FL/FR |
| herbal ethanone | FR |
caramellic |
2-iso | butyl-3-methyl pyrazine | FL/FR |
chocolate |
1,3,3,4,5,6- | hexamethyl(2.2.2)bicyclooct-5-en-2-ol | |
citrus |
| citronella oil ceylon | FL/FR |
iso | decyl acetate | FR |
| dipentene | FL/FR |
| ocimene quintoxide | FL/FR |
earthy |
| bornyl methyl ether | |
(-)-alpha- | fenchol | FL/FR |
| geosmin | FL/FR |
(S)-1- | octen-3-ol | FL/FR |
ethereal |
| ethyl 4-pentenoate | FL/FR |
fatty |
(E)-2- | octenal | FL/FR |
2- | octenal | FL/FR |
floral |
| bois de rose oil peru | FL/FR |
| cassis oxime 10% | FR |
| cilantro herb oil egypt | FL/FR |
| cymbopogon validus leaf oil | FR |
| dictamnus hispanicus oil | FR |
| dihydrocitronellyl ethyl ether | FR |
| dihydrorose oxide | FR |
| dimethyl benzyl carbinyl butyrate | FL/FR |
2,4- | dimethyl-3-cyclohexene-1-methanol | FR |
2,4- | dimethyl-alpha-allyl-3-cyclohexene methanol | |
4,6- | dimethyl-alpha-allyl-3-cyclohexene methanol | |
| geranium oil africa | FL/FR |
| geranium oil egypt | FL/FR |
| ho leaf oil | FR |
| linalool oxide (furanoid) | FL/FR |
| linden flower absolute | FR |
| melaleuca ericifolia leaf oil | FR |
para- | methyl benzyl acetate | FL/FR |
| neryl formate | FL/FR |
3- | nonanone | FL/FR |
2- | pentyl cyclopentanone | FR |
iso | phytol | FL/FR |
| prenyl salicylate | FL/FR |
| reseda absolute | FR |
| rose pyran | FR |
5- | tricyclodecenyl acetate | FR |
fruity |
3- | allyl oxy-1,4-dimethyl bicyclo(3.2.1)octane | FR |
3- | butyl bicyclo[3.2.1]-6-octen-2-one | FR |
| ethyl 2-ethyl acetoacetate | FL/FR |
1- | ethyl-2-methyl propyl chrysanthemumate | |
1,3,3,5- | tetramethyl-7 and 8-acetyl bicyclo(2.2.2)oct-5-ene | |
| tropical indene | FR |
garlic |
4- | methyl-2-[2-(methyl thio)ethyl]-1,3-oxathiane | |
green |
| agrumen aldehyde | FR |
| birch leaf specialty | FR |
iso | butyl heptanoate | FL/FR |
iso | butyl methyl ketone | FL/FR |
2-sec- | butyl thiazole | FL/FR |
S-sec- | butyl thioisovalerate | FL/FR |
| carrot leaf oil (daucus carota ssp.maximus) | FR |
| chrysanthemum carbaldehyde | FR |
| heptanal (aldehyde C-7) | FL/FR |
1- | heptanol | FL/FR |
| heptyl benzoate | FL/FR |
(E)-4- | hexen-1-ol | |
(Z)-4- | hexen-1-ol | FL/FR |
3- | hexenyl 2-methyl butyrate | FL/FR |
| hexyl hexanoate | FL/FR |
english | ivy leaf absolute | FR |
| marigold pot absolute | FL/FR |
6- | methyl-3-hepten-2-one | FL/FR |
3- | propyl bicyclo(3.2.1)-6-octen-2-one | FR |
| seaweed absolute (fucus vesiculosus et serratus) | FL/FR |
| terpinyl propionate | FL/FR |
| triplal / ethyl anthranilate schiff's base | FR |
herbal |
6- | acetoxydihydrotheaspirane | FL/FR |
9- | acetyl-5-methyl-tricyclo[6.2.1.0.sup.2,7 ]undec-4-ene | |
| ajowan seed oil | FL/FR |
1- | allyl-2,2,7,7-tetramethyl cycloheptanol | FR |
alpha- | amyl cinnamyl formate | FL/FR |
| anethum graveolens herb oil | FL/FR |
| anethum graveolens herb tincture | FL/FR |
| anthemis nobilis flower extract | FL/FR |
| anthemis nobilis flower oil roman | FL/FR |
| apium graveolens seed oil | FL/FR |
| apium graveolens seed oil india | FL/FR |
| artemisia alba oil | FR |
sweet | basil absolute | FL/FR |
delta- | cadinene | |
(+)-alpha- | campholenic aldehyde | FL/FR |
| chamomile oil morocco | FR |
| chrysanthemum ketone | FR |
1,8- | cineole | FL/FR |
| coriander oleoresin | FL/FR |
| dill weed oil cuba | FL/FR |
| dill weed oil reunion | FL/FR |
| dimethyl benzyl carbinyl formate | FL/FR |
| dimethyl cyclormol (IFF) | FR |
2-(2,4- | dimethyl-3-cyclohexene-1-yl)-4,4-dimethyl-1,3-oxathiane | FR |
2,10- | epoxypinane | FR |
| eucalyptus globulus oil | FL/FR |
| eucalyptus radiata leaf/stem oil | FR |
| geranic oxide | FL/FR |
| herbal carene | FR |
cis- | herbal cyclohexane | FR |
| herbal dioxane | FR |
| herbal heptane | FR |
| hop absolute | FL/FR |
| hop oil | FL/FR |
| hyssopus officinalis extract | FL/FR |
| hyssopus officinalis leaf tincture | FL/FR |
| lantana camara flower oil | FR |
| laurel bark oil | |
| laurel stem oil | |
| lavandin absolute | FL/FR |
| lavandin absolute decolorized | FL/FR |
| lavandin concrete | FL/FR |
abrialis | lavandin oil | FL/FR |
spike | lavender absolute | FL/FR |
| lavender absolute bulgaria | FL/FR |
| lavender absolute france | FL/FR |
spike | lavender oil | FL/FR |
| linalyl formate | FL/FR |
| linalyl octanoate | FL/FR |
| marigold oil mexico | FL/FR |
| melaleuca leucadendron var. cajuputi leaf oil | FL/FR |
1-(2- | methyl allyl oxy) heptane | FR |
| methyl cyclogeranate (Firmenich) | FR |
(E)-6- | methyl-3-hepten-2-one | FL/FR |
| mistletoe absolute | |
| monarda fistulosa oil | FR |
| niaouli oil | FR |
| nonisyl formate | FR |
(E,Z)-3,5- | octadien-2-one | |
1- | octen-3-yl acetate | FL/FR |
| oregano flower/leaf/stem water | FR |
| oregano leaf | |
| oregano oil mexico | FL/FR |
| oregano oil replacer | FR |
| oregano specialty | FR |
| origanum oil | FL/FR |
| origanum oil terpenes | FR |
| perilla leaf oil | FL/FR |
| perillaldehyde | FL/FR |
| petroselinum crispum seed oil CO2 extract | FL/FR |
| phenyl acetaldehyde diisoamyl acetal | FR |
| pinocarveol | FL/FR |
| prenyl senecioate | FL/FR |
| rosemary absolute | FL/FR |
| rosemary oil | FL/FR |
| rosemary oil africa | FL/FR |
| rosemary oil morocco | FL/FR |
| rosemary oil spain | FL/FR |
| rosemary oil tunisia | FL/FR |
| rosmarinus officinalis extract | FL/FR |
| rosmarinus officinalis tincture | FL/FR |
| sage absolute spain | FL/FR |
| tagete oil CO2 extract | FL/FR |
| tagete oil south africa | FL/FR |
| theaspirane | FL/FR |
| thyme absolute | FL/FR |
white | thyme oil | FL/FR |
| thyme oil (thymus zygis gracillis) spain | FL/FR |
| thyme oil (thymus zygis spp. sylvestris) spain | FR |
| thyme oil CO2 extract | FL/FR |
| thyme oil CO2 extract spain | FL/FR |
red | thyme oil india | FL/FR |
red | thyme oil spain | FL/FR |
| thyme oil wild or creeping canada | FL/FR |
| thyme oil wild or creeping pakistan | FL/FR |
| thyme undecane | FR |
| thymol | FL/FR |
| thymyl methyl ether | FL/FR |
| tricyclodecyl acetate | FR |
| viridiflorol | FL/FR |
| wormwood oil america | FL/FR |
| wormwood oil italy | FL/FR |
| wormwood oil poland | FL/FR |
medicinal |
summer | savory oil | FL/FR |
| peppermint cyclohexanone | FL/FR |
minty |
| artemisia deserti krasch. oil iran | FR |
| dihydrocarveol | FL/FR |
(R)-(+)- | menthofuran | |
(-)- | menthone | FL/FR |
5- and 6-iso | propyl-1,3,3-trimethyl bicyclo(2.2.2)-5,7-octadien-2-one | |
(-)-iso | pulegol | FL/FR |
(R)-(+)- | pulegone | FR |
mossy |
| oakmoss absolute | FL/FR |
| treemoss absolute | FR |
pine |
| dipentene terpene hydrocarbon byproducts | FR |
| plectranthus glandulosus hook f. leaf oil cameroon | FR |
soapy |
| methyl anthranilate / hexyl cinnamaldehyde schiff's base | FR |
spicy |
iso | butyl angelate | FL/FR |
| carvacrol | FL/FR |
(-)- | cubenol | FL/FR |
| cuminaldehyde | FL/FR |
iso | cyclogeraniol (IFF) | FR |
| origanum majorana oil | FL/FR |
| origanum majorana oil CO2 extract | FL/FR |
| origanum majorana oil cuba | FL/FR |
| outdoors specialty | FR |
white | sassafras oil | FL/FR |
| spicy carbonate | FR |
| sugandha kokila berry oil | FR |
para- | cymene | FL/FR |
thujonic |
| cedarleaf oil terpeneless | FR |
| sage oil (salvia lavandulifolia vahl.) spain | FL/FR |
woody |
2-tert- | butyl cyclohexanone | FR |
| cinnamyl tiglate | FL/FR |
| dalbergia sissoo leaf oil | FR |
alpha- | farnesene | FL/FR |
alpha- | farnesene isomer | FL/FR |
1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| hinoki root oil | FR |
(1R,4S)-1- | hydroxy-1,4-dimethyl spiro(4.6)undecan-2-one | |
| juniper berry oil terpenes | FR |
| longifolene | FL/FR |
| origanum vulgare ssp. vulgare oil himalaya | |
1,3,3,5- | tetramethyl-7 and 8-cyanobicyclo(2.2.2)oct-5-ene | |
alpha- | thujene | |
| thyme oil portuguese | FR |
| verdoxan | FR |
|
For Flavor |
|
No flavor group found for these |
6- | acetoxydihydrotheaspirane | FL/FR |
4- | acetyl-2-isopropenyl pyridine | FL |
9- | acetyl-5-methyl-tricyclo[6.2.1.0.sup.2,7 ]undec-4-ene | |
alpha- | amyl cinnamyl formate | FL/FR |
dextro,laevo- | borneol | FL/FR |
dextro- | bornyl acetate | |
iso | bornyl methyl ether | FL/FR |
iso | butyl heptanoate | FL/FR |
4- | butyl thiazole | FL |
2-sec- | butyl thiazole | FL/FR |
S-sec- | butyl thioisovalerate | FL/FR |
delta- | cadinene | |
| cinnamyl tiglate | FL/FR |
| dimethyl benzyl carbinyl formate | FL/FR |
| dipentene | FL/FR |
| ethyl 4-pentenoate | FL/FR |
1- | ethyl-2-methyl propyl chrysanthemumate | |
| fig leaf absolute | FL |
1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| heptyl benzoate | FL/FR |
(E,E)-2,4- | hexadien-1-ol | FL |
1,3,3,4,5,6- | hexamethyl(2.2.2)bicyclooct-5-en-2-ol | |
(1R,4S)-1- | hydroxy-1,4-dimethyl spiro(4.6)undecan-2-one | |
| laurel bark oil | |
| laurel stem oil | |
| lavandin absolute decolorized | FL/FR |
| linalool oxide (furanoid) | FL/FR |
| linalyl formate | FL/FR |
| melaleuca leucadendron var. cajuputi leaf oil | FL/FR |
(R)-(+)- | menthofuran | |
4- | methyl-2-[2-(methyl thio)ethyl]-1,3-oxathiane | |
(E)-6- | methyl-3-hepten-2-one | FL/FR |
6- | methyl-3-hepten-2-one | FL/FR |
| mistletoe absolute | |
(E,Z)-3,5- | octadien-2-one | |
(S)-1- | octen-3-ol | FL/FR |
2- | octenal | FL/FR |
3- | octyl butyrate | FL |
| origanum vulgare ssp. vulgare oil himalaya | |
| perilla leaf oil | FL/FR |
(Z,Z)- | photocitral A | FL |
| prenyl senecioate | FL/FR |
2- | propyl thiazole | FL |
5- and 6-iso | propyl-1,3,3-trimethyl bicyclo(2.2.2)-5,7-octadien-2-one | |
white | sassafras oil | FL/FR |
| seaweed absolute (fucus vesiculosus et serratus) | FL/FR |
| tagete oil rwanda | |
1,3,3,5- | tetramethyl-7 and 8-acetyl bicyclo(2.2.2)oct-5-ene | |
1,3,3,5- | tetramethyl-7 and 8-cyanobicyclo(2.2.2)oct-5-ene | |
alpha- | thujene | |
ortho- | vinyl anisole | FL |
| viridiflorol | FL/FR |
camphoreous |
laevo- | borneol | FL/FR |
dextro,laevo-iso | borneol | FL/FR |
| bornyl ethyl ether | |
| camphor tree bark oil | FL/FR |
(-)-alpha- | fenchol | FL/FR |
laevo- | fenchone | FL/FR |
| geranic oxide | FL/FR |
| pinocarveol | FL/FR |
| rosemary oil tunisia | FL/FR |
citrus |
| citronella oil ceylon | FL/FR |
cooling |
spike | lavender oil | FL/FR |
iso | menthol | FL |
| theaspirane | FL/FR |
earthy |
| geosmin | FL/FR |
fatty |
(E)-2- | octenal | FL/FR |
floral |
| bois de rose oil peru | FL/FR |
| dimethyl benzyl carbinyl butyrate | FL/FR |
2,4- | dimethyl-alpha-allyl-3-cyclohexene methanol | |
4,6- | dimethyl-alpha-allyl-3-cyclohexene methanol | |
| geranium oil africa | FL/FR |
| geranium oil egypt | FL/FR |
fruity |
| ethyl 2-ethyl acetoacetate | FL/FR |
| hexyl hexanoate | FL/FR |
| linalyl octanoate | FL/FR |
para- | methyl benzyl acetate | FL/FR |
| neryl formate | FL/FR |
| tagete oil CO2 extract | FL/FR |
| tagete oil south africa | FL/FR |
green |
| anethum graveolens herb tincture | FL/FR |
iso | butyl angelate | FL/FR |
iso | butyl methyl ketone | FL/FR |
2-iso | butyl-3-methyl pyrazine | FL/FR |
(+)-alpha- | campholenic aldehyde | FL/FR |
| celery distillates | FL |
| dihydrocarveol | FL/FR |
alpha- | farnesene | FL/FR |
alpha- | farnesene isomer | FL/FR |
| heptanal (aldehyde C-7) | FL/FR |
(E)-4- | hexen-1-ol | |
(Z)-4- | hexen-1-ol | FL/FR |
3- | hexenyl 2-methyl butyrate | FL/FR |
| marigold pot absolute | FL/FR |
3- | nonanone | FL/FR |
| oakmoss absolute | FL/FR |
| ocimene quintoxide | FL/FR |
1- | octen-3-yl acetate | FL/FR |
| terpinyl propionate | FL/FR |
herbal |
| ajowan seed oil | FL/FR |
| anethum graveolens herb oil | FL/FR |
| anthemis nobilis flower extract | FL/FR |
| anthemis nobilis flower oil roman | FL/FR |
| apium graveolens seed oil | FL/FR |
| apium graveolens seed oil india | FL/FR |
sweet | basil absolute | FL/FR |
| bornyl methyl ether | |
| celery seed oleoresin | FL |
| cilantro herb oil egypt | FL/FR |
| coriander oleoresin | FL/FR |
| dill weed oil cuba | FL/FR |
| dill weed oil reunion | FL/FR |
| eucalyptus globulus oil | FL/FR |
| hop absolute | FL/FR |
| hop oil | FL/FR |
| hyssopus officinalis extract | FL/FR |
| hyssopus officinalis leaf tincture | FL/FR |
| lavandin absolute | FL/FR |
| lavandin concrete | FL/FR |
abrialis | lavandin oil | FL/FR |
spike | lavender absolute | FL/FR |
| lavender absolute bulgaria | FL/FR |
| lavender absolute france | FL/FR |
| marigold oil mexico | FL/FR |
| ocimum basilicum leaf oil america | FL/FR |
| oregano distillates | FL |
| oregano essence | FL |
| oregano flavor | FL |
| oregano leaf | |
| oregano oil mexico | FL/FR |
| oregano oleoresin | FL |
| origanum majorana oil | FL/FR |
| origanum majorana oil CO2 extract | FL/FR |
| origanum oil | FL/FR |
| petroselinum crispum seed oil CO2 extract | FL/FR |
| prenyl salicylate | FL/FR |
| rosemary absolute | FL/FR |
| rosemary oil | FL/FR |
| rosemary oil africa | FL/FR |
| rosemary oil morocco | FL/FR |
| rosemary oil spain | FL/FR |
| rosmarinus officinalis extract | FL/FR |
| rosmarinus officinalis tincture | FL/FR |
| sage absolute spain | FL/FR |
| sage oil (salvia lavandulifolia vahl.) spain | FL/FR |
| thyme absolute | FL/FR |
white | thyme oil | FL/FR |
| thyme oil (thymus zygis gracillis) spain | FL/FR |
| thyme oil CO2 extract | FL/FR |
| thyme oil CO2 extract spain | FL/FR |
red | thyme oil india | FL/FR |
red | thyme oil spain | FL/FR |
| thyme oil wild or creeping canada | FL/FR |
| thyme oil wild or creeping pakistan | FL/FR |
| thyme oleoresin | FL |
| wormwood oil america | FL/FR |
| wormwood oil italy | FL/FR |
| wormwood oil poland | FL/FR |
licorice |
| estragole | FL/FR |
medicinal |
summer | savory oil | FL/FR |
mentholic |
| peppermint cyclohexanone | FL/FR |
minty |
1,8- | cineole | FL/FR |
(-)- | menthone | FL/FR |
(-)-iso | pulegol | FL/FR |
musty |
| thymyl methyl ether | FL/FR |
oily |
iso | phytol | FL/FR |
phenolic |
| thymol | FL/FR |
solvent |
1- | heptanol | FL/FR |
spicy |
| carvacrol | FL/FR |
| cinnamyl formate | FL/FR |
| cubeb oleoresin | FL |
(-)- | cubenol | FL/FR |
| cuminaldehyde | FL/FR |
| origanum majorana oil cuba | FL/FR |
| perillaldehyde | FL/FR |
winter | savory oil | FL |
terpenic |
para- | cymene | FL/FR |
woody |
iso | bornyl acetate | FL/FR |
| longifolene | FL/FR |
|
Potential Uses:
Occurrence (nature, food, other): note
Synonyms:
| essential oil obtained from the herbs of the spanish origanum, thymus capitatus, lamiaceae | | oregano oil (thymus capitatus hoffmanns & link) greece | | origanum oil (thymus capitatus l.) | | origanum oil greece | | origanum oil spanish FCC | | thymus capitatus hoffmanns & link herb oil greece |
Articles:
|