Fragrance Demo Formulas |
2,4-dimethylcyclohex-3-ene-1-carbaldehyde (Click)
IUPAC Name: 2,4-dimethylcyclohex-3-ene-1-carbaldehyde
Std.InChI: InChI=1S/C9H14O/c1-7-3-4-9(6-10)8(2)5-7/h5-6,8-9H,3-4H2,1-2H3
InChI: InChI=1/C9H14O/c1-7-3-4-9(6-10)8(2)5-7/h5-6,8-9H,3-4H2,1-2H3
Std.InChIKey: MZZRKEIUNOYYDF-UHFFFAOYSA-N
InChIKey: MZZRKEIUNOYYDF-UHFFFAOYAZ
SMILES: CC1C=C(CCC1C=O)C
|
CAS Number: | 68039-49-6 144046-32-2 |
ECHA EINECS - REACH Pre-Reg: | 268-264-1 |
FDA UNII: | 452GFV2AFS |
Nikkaji Web: | J24.534H |
MDL: | MFCD00221550 |
XlogP3-AA: | 1.40 (est) |
Molecular Weight: | 138.20978000 |
Formula: | C9 H14 O |
NMR Predictor: | Predict (works with chrome or firefox) |
Also(can) Contains: | dimethyl tetrahydrobenzaldehyde |
Category: | flavor and fragrance agents |
|
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information: |
Google Scholar: | Search |
Google Books: | Search |
Google Scholar: with word "volatile" | Search |
Google Scholar: with word "flavor" | Search |
Google Scholar: with word "odor" | Search |
Perfumer and Flavorist: | Search |
Google Patents: | Search |
US Patents: | Search |
EU Patents: | Search |
IBM Patents: | Obtain |
Pubchem Patents: | Search |
FEMA Number: | 4505 (Z,E)-2,4-dimethyl-3-cyclohexenecarboxaldehyde |
FDA Mainterm: | (2,4)- AND (3,5)- AND (3,6)-DIMETHYL-3-CYCLOHEXENYLCARBALDEHYDE |
Physical Properties:
Appearance: | colorless to pale yellow clear liquid (est) |
Assay: | 97.00 to 100.00 % sum of isomers
|
Food Chemicals Codex Listed: | No |
Specific Gravity: | 0.93200 to 0.94000 @ 25.00 °C.
|
Pounds per Gallon - (est).: | 7.755 to 7.822
|
Specific Gravity: | 0.93300 to 0.94100 @ 20.00 °C.
|
Pounds per Gallon - est.: | 7.773 to 7.839
|
Refractive Index: | 1.46900 to 1.47500 @ 20.00 °C.
|
Boiling Point: | 196.00 °C. @ 760.00 mm Hg
|
Acid Value: | 5.00 max. KOH/g
|
Vapor Pressure: | 0.578000 mm/Hg @ 25.00 °C. (est) |
Flash Point: | 151.00 °F. TCC ( 66.11 °C. )
|
logP (o/w): | 2.340 |
Shelf Life: | 12.00 month(s) or longer if stored properly. |
Storage: | store in cool, dry place in tightly sealed containers, protected from heat and light. store under nitrogen. |
Storage: | store under nitrogen. |
Organoleptic Properties:
Odor Type: | green |
Odor Strength: | high , recommend smelling in a 10.00 % solution or less |
| green aldehydic leafy cortex tart floral peely |
Odor Description: at 10.00 % in dipropylene glycol. | green aldehydic leafy cortex tart floral peely Luebke, William tgsc, (1995) |
Substantivity: | 24 hour(s) at 100.00 % |
| |
Cosmetic Information:
Suppliers:
A.C.S. International |
Cyclogreenal
Odor: green, leafy, aldehydic, tart, floral |
Operational Capabilities |
Advanced Biotech |
TRIPLAL SYNTHETIC
Odor: Citrus, Herbal |
Apple Flavor & Fragrance |
Ligustral
|
Azelis |
CYCLAL C
|
Services |
Beijing Lys Chemicals |
2,4-Dimethylcyclohex-3-ene-1-carbaldehyde
|
Berjé |
Carboxaldehyde (Triplal™Type)
|
Specialties |
Carbosynth |
For experimental / research use only. |
2,4-Dimethyl-3-cyclohexenecarboxaldehyde
|
CG Herbals |
Cyclal C
Odor: Green, Leafy, Floral, Powerful Use: Cyclal C is a key product in many modern compositions. It has an extremely natural green character which blends beautifully with fruity, citrus, agrestic, floral compositions where it imparts its unique vibrant quality. It is also used to enrich and reinforce classic green notes. |
CG Herbals |
Ligustral
|
Creatingperfume.com |
TRIPLAL® (IFF)
Odor: Powerful, green, grass |
Ernesto Ventós |
DIMETHYLTETRAHYDROBENZALDEHYDE
Odor: GREEN, CITRIC, FRESH |
Ernesto Ventós |
TRIPLAL IFF
Odor: GREEN, CITRUS, HERBAL, ALDEHYDIC |
Ernesto Ventós |
TRIVERTAL PCAS
Odor: GREEN, CITRIC, FRESH |
Foreverest Resources |
Ligustral 99%
Odor: characteristic Use: Ligustral is a mixture of isomer, appears as liquid, has a powerful green odor with the fresh cucumber and citrus. Ligustral is applied in the formula of fragrance, especially as the ingredients for household cleaners, soaps and personal cares. |
Givaudan |
Cyclal C
Odor: Green, Leafy, Floral, Powerful Use: Cyclal C is a key product in many modern compositions. It has an extremely natural green character which blends beautifully with fruity, citrus, agrestic, floral compositions where it imparts its unique vibrant quality. It is also used to enrich and reinforce classic green notes. |
Givaudan |
Ligustral
Odor: Green, Herbal, Citrus Use: Ligustral has a green and powerful note with the impression of newly mown lawns and fresh cucumber. It gives a fresh, green character to floral fragrances and an interesting citrus peel effect, especially in lime directions. |
Global Essence |
Trivertal
|
Hermitage Oils |
Triplal
Odor: characteristic Use: Triplal is a powerful green odorant that is widely used. It blends well with natural citrus as well as other green notes contributing a sharp freshness. It is manufactured by IFF who describe it: “Powerful, green, grass odor that connotes the concentrated refreshing tartness of lemon and bergamot peels” |
The Vault |
IFF |
Triplal®
Odor: Powerful, green, grass odor that connotes the concentrated refreshing tartness of lemon and bergamot peels |
Indenta Group |
Triplal
|
Indukern F&F |
LIGUSTRAL - TRIPLAL
Odor: CITRUS, HERBAL |
CROP CALENDAR |
Kun Shan P&A |
Triplal
|
Lansdowne Chemicals |
Citrulan
|
Lluch Essence |
LIGUSTRAL
|
M&U International |
LANTRAL/TRIPLAL, Kosher
|
Moellhausen |
VERTOCITRAL C
Artificial Odor: citrus (lemon) and green Flavor: fresh, citrus |
O'Laughlin Industries |
TRIGUSTRAL
|
PCAS |
Trivertal, Kosher
|
PCW France |
Trital
|
Steps to a fragranced product |
Pearlchem Corporation |
PEARL-3P (Tripal)
|
Penta International |
CYCLAL C TYPE G
|
Penta International |
TRIPLAL, Kosher
|
PerfumersWorld |
Triplal 10% in DPG
|
PerfumersWorld |
Triplal
Odor: herbal harsh leafy green |
Perfumery Laboratory |
TRIPLAL® IFF 10% in DPG
Odor: Bright, juicy aroma of green tomato leaves |
Phoenix Aromas & Essential Oils |
Ligustral (Triplal)
|
Santa Cruz Biotechnology |
For experimental / research use only. |
2,4-Dimethyl-3-cyclohexenecarboxaldehyde
|
Symrise |
Vertocitral C
Odor: very strong green note with a clear, somewhat sharp minty-earthy sidenote |
Symrise |
Vertocitral
Odor: extremely strong and fresh, accentuated grassy-green note, citric, somewhat herbal-camphor-like Use: Stable in: body lotion (good), shampoo (good), soap (good), ap roll-on (poor), powder (poor), cleaner citric (poor), cleaner apc (very good), bleach (poor). |
Taytonn |
Triplal®
Odor: Citrus, Green, Herbal/ Herbaceous |
The John D. Walsh Company |
Ligustral
|
The John D. Walsh Company |
Triplal
|
The Lermond Company |
Triplal
|
The Perfumers Apprentice |
Cyclal C ( Triplal )
Odor: Powerful, green, citrus odor reminiscent of the refreshing tartness of lemon and bergamot peels |
Vigon International |
Cyclal C
Odor: Green, Leafy, Floral, Powerful |
Vigon International |
Trivertal
|
Xiamen Doingcom Chemical |
For experimental / research use only. |
2,4-Dimethyl-3-Cycplohexenecarboxaldehyde
|
Safety Information:
Preferred SDS: View |
European information : |
Most important hazard(s): | Xi N - Irritant, Dangerous for the environment. |
R 36/38 - Irritating to skin and eyes. R 43 - May cause sensitisation by skin contact. R 52/53 - Harmful to qauatic organisms, may cause long-term adverse effects in the aquatic environment. S 02 - Keep out of the reach of children. S 24 - Avoid contact with skin. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 37 - Wear suitable gloves. S 61 - Avoid release to the environment. Refer to special instructions/safety data sheet.
|
|
Hazards identification |
|
Classification of the substance or mixture |
GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
Flammable liquids (Category 4), H227 Acute toxicity, Oral (Category 5), H303 Acute toxicity, dermal (Category 5), H313 Skin irritation (Category 2), H315 Skin sensitisation (Category 1), H317 Eye irritation (Category 2A), H319 Serious eye damage/eye irritation (Category 2A), H320 Acute aquatic toxicity (Category 2), H401 Chronic aquatic toxicity (Category 2), H411
|
GHS Label elements, including precautionary statements |
|
Pictogram |   |
|
Signal word | Warning |
Hazard statement(s) |
H227 - Combustible liquid H303 - May be harmfulif swallowed H313 - May be harmful in contact with skin H315 - Causes skin irritation H317 - May cause an allergic skin reaction H319 - Causes serious eye irritation H320 - Causes eye irritation H401 - Toxic to aquatic life H411 - Toxic to aquatic life with long lasting effects
|
Precautionary statement(s) |
P210 - Keep away from heat/sparks/open flames/hot surfaces. — No smoking. P261 - Avoid breathing dust/fume/gas/mist/vapours/spray. P264 - Wash skin thouroughly after handling. P272 - Contaminated work clothing should not be allowed out of the workplace. P273 - Avoid release to the environment. P280 - Wear protective gloves/protective clothing/eye protection/face protection. P302 + P352 - IF ON SKIN: wash with plenty of soap and water. P305 + P351 + P338 - IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. P312 - Call a POISON CENTER or doctor/physician if you feel unwell. P333 + P313 - IF SKIN irritation or rash occurs: Get medical advice/attention. P337 + P313 - IF eye irritation persists: Get medical advice/attention. P362 - Take off contaminated clothing and wash before reuse. P370 + P378 - In case of fire: Use appropriate media to extinguish. P391 - Collect spillage. Hazardous to the aquatic environment P403 + P235 - Store in a well-ventilated place. Keep cool. P501 - Dispose of contents/container in accordance with local/regional/national/international regulations.
|
Oral/Parenteral Toxicity: |
oral-rat LD50 > 2000 mg/kg Dispose of contents/container in accordance with local/regional/national/international regulations.
|
Dermal Toxicity: |
skin-rabbit LD50 > 2000 mg/kg Dispose of contents/container in accordance with local/regional/national/international regulations.
|
Inhalation Toxicity: |
Not determined
|
Safety in Use Information:
Category: | flavor and fragrance agents |
IFRA Critical Effect: | Sensitization |
IFRA: | View Standard |
Fragrance usage is IFRA RESTRICTED. View Standard for complete information. |
Please review all IFRA documents for complete information. |
IFRA categories: limits in the finished product: (For a description of the categories, refer to the IFRA QRA Information Booklet.) |
Category 1: See Note (1) | 0.17 % (1) |
Category 2: | 0.22 % |
Category 3: | 0.89 % |
Category 4: | 2.70 % |
Category 5: | 1.40 % |
Category 6: | 4.30 % (1) |
Category 7: | 0.45 % |
Category 8: | 2.00 % |
Category 9: | 5.00 % |
Category 10: | 2.50 % |
Category 11: | See Note (2) |
| Notes: |
| (1) IFRA would recommend that any material used to impart perfume or flavour in products intended for human ingestion should consist of ingredients that are in compliance with appropriate regulations for foods and food flavourings in the countries of planned distribution and, where these are lacking, with the recommendations laid down in the Code of Practice of IOFI (International Organisation of the Flavor Industry). Further information about IOFI can be found on its website (www.iofi.org). |
| (2) Category 11 includes all non-skin contact or incidental skin contact products. Due to the negligible skin contact from these types of products there is no justification for a restriction of the concentration of this fragrance ingredient in the finished product. |
|
Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). |
The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA Flavor Ingredient Library |
publication number: 24 |
Click here to view publication 24 |
| average usual ppm | average maximum ppm |
baked goods: | 0.20000 | 4.00000 |
beverages(nonalcoholic): | 0.50000 | 5.00000 |
beverages(alcoholic): | - | - |
breakfast cereal: | - | - |
cheese: | - | - |
chewing gum: | 5.00000 | 50.00000 |
condiments / relishes: | - | - |
confectionery froastings: | - | - |
egg products: | - | - |
fats / oils: | 0.50000 | 4.00000 |
fish products: | - | - |
frozen dairy: | 0.50000 | 10.00000 |
fruit ices: | 0.50000 | 10.00000 |
gelatins / puddings: | - | - |
granulated sugar: | - | - |
gravies: | - | - |
hard candy: | 0.20000 | 5.00000 |
imitation dairy: | - | - |
instant coffee / tea: | - | - |
jams / jellies: | - | - |
meat products: | - | - |
milk products: | - | - |
nut products: | - | - |
other grains: | - | - |
poultry: | - | - |
processed fruits: | - | - |
processed vegetables: | - | - |
reconstituted vegetables: | - | - |
seasonings / flavors: | - | - |
snack foods: | - | - |
soft candy: | - | - |
soups: | - | - |
sugar substitutes: | - | - |
sweet sauces: | - | - |
Safety References:
References:
Other Information:
Potential Blenders and core components note
|
For Odor |
No odor group found for these |
(E)- | tiglaldehyde | FL/FR |
acidic |
2- | methyl-2-pentenoic acid | FL/FR |
aldehydic |
10- | undecenal (aldehyde C-11 undecylenic) | FL/FR |
| citrus carbaldehyde | FR |
| octane nitrile | FR |
| mandarine undecenal | FL/FR |
9- | decenal | FL/FR |
| adoxal (Givaudan) | FL/FR |
| fresh carbaldehyde | FR |
| muguet undecadienal | FR |
| geranyl oxyacetaldehyde | FR |
| citronellyl oxyacetaldehyde | FL/FR |
| decanal (aldehyde C-10) | FL/FR |
2- | methyl undecanal (aldehyde C-12 mna) | FL/FR |
| nonanal (aldehyde C-9) | FL/FR |
2- | methyl undecanal dimethyl acetal | FR |
| octanal (aldehyde C-8) | FL/FR |
| green hexanal | FL/FR |
amber |
| amber carane | FR |
| amber furan | FR |
| angelica root oil | FL/FR |
animal |
1-oxa | spiro-4,7-dodecane | FR |
para- | cresyl isobutyrate | FL/FR |
aromatic |
| damascone carboxylate | FR |
balsamic |
| clover nitrile | FR |
| tetrahydrofurfuryl cinnamate | FL/FR |
| fir balsam absolute | FR |
| hexyl benzoate | FL/FR |
| fir needle oil siberia | FL/FR |
iso | bornyl acetate | FL/FR |
| benzyl benzoate | FL/FR |
| benzyl salicylate | FL/FR |
| ethyl cinnamate | FL/FR |
| fir carboxylate | FR |
2- | acetyl furan | FL/FR |
laevo- | bornyl acetate | FL/FR |
iso | amyl benzoate | FL/FR |
3- | phenyl propyl alcohol | FL/FR |
| cinnamyl alcohol | FL/FR |
camphoreous |
| herbal ethanone | FR |
caramellic |
| fenugreek absolute | FL/FR |
chemical |
| propyl propionate | FL/FR |
citrus |
sweet | orange peel oil c.p. brazil | FL/FR |
(E)-4- | decenal | FL/FR |
1- | methyl cyclohexene | |
| litsea cubeba fruit oil | FL/FR |
(±)-2,4,8- | trimethyl-7-nonen-2-ol | FL/FR |
| rhubafuran | FR |
| citronellyl nitrile | FR |
| citronellal / methyl anthranilate schiff's base | FR |
| aldehydic nitrile | FR |
| tangerine oil america | FL/FR |
| trimethyl cyclohexene | FR |
| lemon hexadiene | FL/FR |
| citral | FL/FR |
| octanal glycol acetal | FR |
| grapefruit oil c.p. california | FL/FR |
| dihydromyrcenol | FL/FR |
| neroli ketone | FR |
| lemon oil c.p. california | FL/FR |
| myrmac aldehyde | FR |
| grapefruit pentanol | FR |
blood | orange oil italy | FL/FR |
| bergamot oil | FL/FR |
| lemongrass oil (cymbopogon pendulus praman) | |
| tetrahydromyrcenol | FR |
| methyl heptenone | FL/FR |
alpha- | methylene citronellal | FR |
| acetaldehyde citronellyl methyl acetal | FR |
| citronella oil ceylon | FL/FR |
| myrcenyl acetate | FL/FR |
| lemongrass oil | FL/FR |
| tetrahydrocitral | FL/FR |
| lime oil distilled mexico | FL/FR |
| tangerine acetate | FR |
(E+Z)-4,8- | dimethyl-3,7-nonadien-2-yl acetate | FL/FR |
| dodecane nitrile | FR |
| lemongrass oil (cymbopogon khasianus x c. pendulus) | |
earthy |
| methyl undecylenate | FL/FR |
| muscogene | FR |
ethereal |
iso | valeraldehyde propylene glycol acetal | FL/FR |
fatty |
(E)-2- | nonenal | FL/FR |
| neryl acetone | FL/FR |
5- | methyl-5-hexen-2-one | FL/FR |
fermented |
| ethyl crotonate | FL/FR |
floral |
| tetrahydrolinalool | FL/FR |
| benzyl isobutyrate | FL/FR |
| ho leaf oil | FR |
| decanal / methyl anthranilate schiff's base | FR |
| benzyl alcohol | FL/FR |
(E)-2,5,9- | trimethyl-4,9-decadien-1-al | FR |
| geranyl acetate | FL/FR |
beta- | ocimene | FL/FR |
| phenyl propyl phenyl acetate | FR |
| styralyl propionate | FL/FR |
| rose pyran | FR |
| hyacinth ether | FR |
alpha- | hexyl cinnamaldehyde | FL/FR |
| gardenia amide | FR |
| cumin carbinol | FR |
| ethyl linalyl acetal | FR |
| cyclohexyl ethyl alcohol | FL/FR |
| dihydro-alpha-ionone | FL/FR |
| tea acetate | FR |
| mimosa absolute france | FL/FR |
| muguet butanol | FR |
| magnolia decadienal | FR |
laevo- | linalool | FL/FR |
| violet methyl carbonate | FR |
| muguet butanal | FR |
| muguet octadienol | FR |
| lily propanol | FR |
| citronellyl ethoxalate | FR |
| gardenia decalone | FR |
| muguet carboxaldehyde | FR |
| nerol | FL/FR |
| orris pyridine 25% IPM | FR |
| phenethyl acetate | FL/FR |
| muguet nitrile | FR |
| geranyl acetone | FL/FR |
| floral butanal | FR |
| farnesol | FL/FR |
| floral pyranol | FR |
| geraniol | FL/FR |
| heliotropyl diethyl acetal | FR |
| ethyl linalool | FR |
| gardenia oxide | FR |
| citronellyl ethyl ether | FR |
| dimethyl benzyl carbinol | FL/FR |
laevo- | rose oxide | FL/FR |
| linalool oxide | FL/FR |
| neryl acetate | FL/FR |
| myrcenol | FL/FR |
| methyl dihydrojasmonate | FL/FR |
| benzyl acetate | FL/FR |
| undecanal dimethyl acetal | FR |
| narcissus acetate | FL/FR |
iso | amyl salicylate | FL/FR |
2- | phenyl propionaldehyde dimethyl acetal | FL/FR |
| citronellyl acetate | FL/FR |
| cinnamyl phenyl acetate | FL/FR |
| cyclamen homoaldehyde | FR |
| rhodinol | FL/FR |
| dihydrorose oxide | FR |
| leerall | FR |
| magnolia cyclohexanol | FR |
| boronia butenal | FR |
alpha- | amyl cinnamaldehyde dimethyl acetal | FL/FR |
(Z)-3- | hexen-1-yl salicylate | FL/FR |
| rose butanoate | FL/FR |
| ocean propanal | FL/FR |
| peony alcohol | FR |
| coriander seed oil | FL/FR |
| lilac pentanol | FL/FR |
| linalool | FL/FR |
| petitgrain lemon oil | FL/FR |
| nerolidol | FL/FR |
2,4- | dimethyl-3-cyclohexene-1-methanol | FR |
| bois de rose oil brazil | FL/FR |
| reseda acetal | FR |
| ethyl safranate | FR |
| cyclamen aldehyde | FL/FR |
iso | butyl salicylate | FL/FR |
| anisyl propanal / methyl anthranilate schiff's base | FR |
| phenethyl alcohol | FL/FR |
| petitgrain oil paraguay | FL/FR |
fruity |
| allyl amyl glycolate | FR |
| rhubarb undecane | FR |
| benzyl propionate | FL/FR |
| linalyl isobutyrate | FL/FR |
| benzaldehyde | FL/FR |
iso | amyl acetate | FL/FR |
| apple ketal | FL/FR |
| tropical indene | FR |
| rhubarb pyran | FR |
| allyl cyclohexyl propionate | FL/FR |
| hexyl acetate | FL/FR |
| methyl 2-methyl valerate | FL/FR |
| vanilla carboxylate | FL/FR |
| allyl hexanoate | FL/FR |
iso | propyl isobutyrate | FL/FR |
| heptanal cyclic ethylene acetal | FR |
| ethyl 3-hexenoate | FL/FR |
| ethyl levulinate | FL/FR |
gamma- | undecalactone (aldehyde C-14 (so-called)) | FL/FR |
| green acetate | FR |
| tropical trithiane | FL/FR |
| strawberry glycidate 1 (aldehyde C-16 (so-called)) | FL/FR |
(Z)-3- | hexen-1-yl isobutyrate | FL/FR |
2- | pentyl furan | FL/FR |
| prenyl ethyl ether | FL/FR |
| diethyl malonate | FL/FR |
fungal |
| hydroxymethyl hexyl ethyl ketone | FL/FR |
green |
| hexyl hexanoate | FL/FR |
| green dioxolane | FR |
| diphenyl oxide | FL/FR |
| styralyl acetate | FL/FR |
| coriander heptenol | FL/FR |
iso | cyclocitral (IFF) | FL/FR |
| green carboxylate | FR |
| phenyl acetaldehyde | FL/FR |
| chrysanthemum oxide | FL/FR |
2-sec- | butyl thiazole | FL/FR |
| citrus carbaldehyde / methyl anthranilate schiff's base | FR |
| fern absolute | |
| green carbaldehyde | FR |
3,5,6-neo | cyclocitral | FR |
| acetaldehyde butyl phenethyl acetal | FL/FR |
| heptanal dimethyl acetal | FL/FR |
| phenyl acetaldehyde ethylene glycol acetal | FR |
sec- | butyl-3-methyl but-2-ene thioate | FL/FR |
| violet nitrile | FR |
(E,Z)-3,6- | nonadien-1-yl acetate | FL/FR |
| phenyl acetaldehyde dimethyl acetal | FL/FR |
| geranium absolute | FL/FR |
| hexyl tiglate | FL/FR |
(Z)-3- | hexen-1-yl (E)-crotonate | FL/FR |
2-sec- | butyl-3-methoxypyrazine | FL/FR |
(E)-2- | hexen-1-yl acetate | FL/FR |
| hexyl 2-methyl butyrate | FL/FR |
| methyl octine carbonate | FL/FR |
| heptyl benzoate | FL/FR |
homo | cuminic aldehyde | FR |
| acetaldehyde ethyl phenethyl acetal | FL/FR |
| acetaldehyde dipropyl acetal | FL/FR |
iso | propyl quinoline | FR |
3- | phenyl propionaldehyde | FL/FR |
(E,Z)-2,6- | nonadien-1-ol | FL/FR |
4-iso | propyl quinoline | FL/FR |
(Z)-3- | hexen-1-yl benzoate | FL/FR |
| violet decenol | FR |
(E)-2- | octen-1-yl acetate | FL/FR |
| octanal dimethyl acetal | FL/FR |
| cumin acetaldehyde | FL/FR |
(E,Z)-2,6- | nonadienal | FL/FR |
2- | pentenal | FL/FR |
| melon nonenoate | FL/FR |
| melon heptenal propylene glycol acetal | FL/FR |
(Z)-3- | hexen-1-yl tiglate | FL/FR |
| nerol oxide | FL/FR |
| hyacinth butanal | FR |
| phenethyl acetal | FR |
alpha- | hexyl cinnamaldehyde dimethyl acetal | FR |
| methyl heptine carbonate | FL/FR |
2-iso | butyl-3-methoxypyrazine | FL/FR |
(Z)- | leaf acetal | FL/FR |
| cilantro leaf oil | FL/FR |
2- | phenyl propionaldehyde | FL/FR |
| violet leaf absolute | FL/FR |
iso | propyl phenyl propionaldehyde | FR |
| leafy oxime | FR |
(E,Z)-3,6- | nonadien-1-ol | FL/FR |
| leafy acetal | FL/FR |
(Z)-3- | hexen-1-yl formate | FL/FR |
2-iso | butyl thiazole | FL/FR |
| green ether | FL/FR |
| butyl heptanoate | FL/FR |
| chrysanthemum carbaldehyde | FR |
english | ivy leaf absolute | FR |
| galbanum oil | FL/FR |
| violet dienyne | FR |
| bark carbaldehyde | FR |
(Z)-3- | hexen-1-ol | FL/FR |
| lilac acetaldehyde | FL/FR |
3,5,5- | trimethyl hexanol | FL/FR |
(Z)-3- | hexen-1-yl acetate | FL/FR |
herbal |
curled | parsley leaf oil | FL/FR |
2- | cyclohexyl cyclohexanone | FR |
| linalyl acetate | FL/FR |
| eucalyptus globulus oil | FL/FR |
| daucus carota fruit oil | FL/FR |
| anthemis nobilis flower oil roman | FL/FR |
1- | allyl-2,2,7,7-tetramethyl cycloheptanol | FR |
(E)-6- | methyl-3-hepten-2-one | FL/FR |
| ocimene oxirane | FR |
| origanum oil greece | FL/FR |
| tagete oil south africa | FL/FR |
| cuminyl acetate | FL/FR |
| clary sage oil france | FL/FR |
(E)-2- | dodecenal | FL/FR |
| nopyl acetate | FR |
| herbal heptane | FR |
| linalyl isovalerate | FL/FR |
| herbal undecanone | FR |
cis- | herbal cyclohexane | FR |
| herbal ketone | FR |
3- | octyl acetate | FL/FR |
| lavender absolute bulgaria | FL/FR |
| reseda absolute | FR |
| linalyl formate | FL/FR |
| celery undecene | FR |
| tagette carboxylate | FR |
alpha- | terpinyl acetate | FL/FR |
| theaspirane | FL/FR |
marine |
| marine pyridine | FR |
| ozone propanal | FR |
| ocean carboxaldehyde | FR |
melon |
| melon heptenal | FL/FR |
| watermelon ketone | FR |
(Z)-6- | nonenal | FL/FR |
nutty |
2- | ethyl-4-methyl thiazole | FL/FR |
| shoyu pyrazine | FL/FR |
phenolic |
| methyl benzoate | FL/FR |
powdery |
para- | anisyl acetate | FL/FR |
pungent |
4- | methyl-2-pentanol | FL/FR |
| cuminyl nitrile | FR |
| cumin seed oil | FL/FR |
| cuminaldehyde | FL/FR |
sulfurous |
| cassis pentanone | FL/FR |
| mango thiol | FL/FR |
| passiflora acetate | FL/FR |
| buchu mercaptan | FL/FR |
| lychee mercaptan acetate | FL/FR |
terpenic |
| juniperus communis fruit oil | FL/FR |
alpha- | terpineol | FL/FR |
| frankincense oil | FL/FR |
thujonic |
| thuja occidentalis leaf oil | FL/FR |
tropical |
2- | tropical oxathiane | FL/FR |
cis- | galbanum oxathiane | FL/FR |
vegetable |
1- | furfuryl pyrrole | FL/FR |
waxy |
| waxy undecadienol | FR |
3- | decanone | FL/FR |
| ethyl laurate | FL/FR |
| decanal diethyl acetal | FL/FR |
| octanol | FL/FR |
woody |
| patchouli oil | FL/FR |
| orris hexanone | FR |
| patchouli ethanone | FR |
| vetiver oil haiti | FL/FR |
(Z)- | woody amylene | FR |
iso | longifolene epoxide | FR |
| sabinene | FL/FR |
| dihydro-alpha-terpinyl acetate | FR |
| cedarwood oil virginia | FR |
| camphene | FL/FR |
beta- | caryophyllene alcohol acetate | FL/FR |
| woody acetate | FR |
| woody cyclohexanone | FR |
| rhubarb oxirane | FR |
| spruce needle oil canada | FL/FR |
| polylimonene | FL/FR |
| woody propanol | FR |
| amber carbinol | FR |
|
For Flavor |
|
No flavor group found for these |
(E,E)-3,5- | octadien-2-one | FL |
| coriander heptenol | FL/FR |
| cyclohexyl ethyl alcohol | FL/FR |
| chrysanthemum oxide | FL/FR |
| fern absolute | |
| thuja occidentalis leaf oil | FL/FR |
(E)-6- | methyl-3-hepten-2-one | FL/FR |
5- | methyl-5-hexen-2-one | FL/FR |
| cinnamyl phenyl acetate | FL/FR |
2- | decyl furan | FL |
iso | cyclocitral (IFF) | FL/FR |
2-sec- | butyl thiazole | FL/FR |
beta- | caryophyllene alcohol acetate | FL/FR |
| myrcenyl acetate | FL/FR |
| adoxal (Givaudan) | FL/FR |
(E)- | tiglaldehyde | FL/FR |
| myrcenol | FL/FR |
4-iso | propyl quinoline | FL/FR |
(E)-2- | hexenal | FL |
1- | methyl cyclohexene | |
| melon heptenal propylene glycol acetal | FL/FR |
| lemongrass oil (cymbopogon khasianus x c. pendulus) | |
| lemongrass oil (cymbopogon pendulus praman) | |
sec- | butyl-3-methyl but-2-ene thioate | FL/FR |
| cyclamen aldehyde | FL/FR |
| tetrahydrocitral | FL/FR |
2- | tropical oxathiane | FL/FR |
2- | ethyl-2-heptenal | FL |
| green ether | FL/FR |
2,3- | epoxydecanal | FL |
| heptyl benzoate | FL/FR |
| nerol oxide | FL/FR |
laevo- | linalool | FL/FR |
| epoxy-2-decenal | FL |
| green hexanal | FL/FR |
| fig leaf absolute | FL |
(E+Z)-4,8- | dimethyl-3,7-nonadien-2-yl acetate | FL/FR |
(E)-4- | hexenal | FL |
2-sec- | butyl-3-methoxypyrazine | FL/FR |
3-( | methyl thio) hexanal | FL |
| mandarine undecenal | FL/FR |
| narcissus acetate | FL/FR |
| hexanal octane-1,3-diol acetal | FL |
2- | pentenal | FL/FR |
| linalyl formate | FL/FR |
| neryl acetone | FL/FR |
| cumin acetaldehyde | FL/FR |
| dimethyl benzyl carbinol | FL/FR |
5- | ethyl-2-thiophene carboxaldehyde | FL |
(Z)-3- | hexen-1-yl (E)-crotonate | FL/FR |
| methyl undecylenate | FL/FR |
| apple ketal | FL/FR |
| linalyl isovalerate | FL/FR |
iso | propyl isobutyrate | FL/FR |
2- | ethyl-4,5-dimethyl oxazole | FL |
3- | methyl-3-pentanol | FL |
2,3- | epoxyheptanal | FL |
laevo- | bornyl acetate | FL/FR |
4- | methyl-2-pentanol | FL/FR |
| prenyl ethyl ether | FL/FR |
| dihydromyrcenol | FL/FR |
| polylimonene | FL/FR |
alpha- | amyl cinnamaldehyde dimethyl acetal | FL/FR |
| hydroxymethyl hexyl ethyl ketone | FL/FR |
(E,E,Z)-2,4,7- | decatrienal | FL |
| hexyl tiglate | FL/FR |
| acetaldehyde ethyl phenethyl acetal | FL/FR |
| cuminyl acetate | FL/FR |
3- | decanone | FL/FR |
9- | decenal | FL/FR |
| tetrahydrofurfuryl cinnamate | FL/FR |
aldehydic |
| octanal (aldehyde C-8) | FL/FR |
| nonanal (aldehyde C-9) | FL/FR |
aromatic |
para- | cresyl isobutyrate | FL/FR |
| leafy acetal | FL/FR |
balsamic |
| fir needle oil siberia | FL/FR |
| ethyl cinnamate | FL/FR |
| benzyl benzoate | FL/FR |
| benzyl salicylate | FL/FR |
burnt |
| methyl phenyl disulfide | FL |
camphoreous |
| camphene | FL/FR |
caramellic |
| fenugreek absolute | FL/FR |
citrus |
| grapefruit oil c.p. california | FL/FR |
(±)-2,4,8- | trimethyl-7-nonen-2-ol | FL/FR |
| petitgrain oil paraguay | FL/FR |
| styralyl propionate | FL/FR |
| petitgrain lemon oil | FL/FR |
| tangerine oil america | FL/FR |
| citral | FL/FR |
| citronella oil ceylon | FL/FR |
| citronellyl oxyacetaldehyde | FL/FR |
| lemon hexadiene | FL/FR |
| litsea cubeba fruit oil | FL/FR |
alpha- | terpineol | FL/FR |
sweet | orange peel oil c.p. brazil | FL/FR |
blood | orange oil italy | FL/FR |
| lemon oil c.p. california | FL/FR |
| linalool | FL/FR |
| lemongrass oil | FL/FR |
| lime oil distilled mexico | FL/FR |
| nerol | FL/FR |
| bergamot oil | FL/FR |
| cilantro leaf oil | FL/FR |
coconut |
| butyl heptanoate | FL/FR |
coffee |
2- | ethyl-4-methyl thiazole | FL/FR |
cooling |
| theaspirane | FL/FR |
iso | butyl salicylate | FL/FR |
creamy |
gamma- | undecalactone (aldehyde C-14 (so-called)) | FL/FR |
ethereal |
4- | hexen-3-one | FL |
fatty |
(E,E)-2,4- | dodecadienal | FL |
(E)-2- | dodecenal | FL/FR |
(Z)-3- | hexen-1-yl benzoate | FL/FR |
(E,E)-2,4- | heptadienal | FL |
10- | undecenal (aldehyde C-11 undecylenic) | FL/FR |
floral |
| geranyl acetone | FL/FR |
| linalyl acetate | FL/FR |
| citronellyl acetate | FL/FR |
| neryl acetate | FL/FR |
| phenethyl alcohol | FL/FR |
laevo- | rose oxide | FL/FR |
| rhodinol | FL/FR |
| geraniol | FL/FR |
| bois de rose oil brazil | FL/FR |
| linalyl isobutyrate | FL/FR |
| dihydro-alpha-ionone | FL/FR |
| farnesol | FL/FR |
| tetrahydrolinalool | FL/FR |
| methyl dihydrojasmonate | FL/FR |
| diphenyl oxide | FL/FR |
| ocean propanal | FL/FR |
fruity |
| ethyl 3-hexenoate | FL/FR |
| benzyl isobutyrate | FL/FR |
| benzyl alcohol | FL/FR |
| benzaldehyde | FL/FR |
| benzyl acetate | FL/FR |
| benzyl propionate | FL/FR |
| lilac pentanol | FL/FR |
2- | phenyl propionaldehyde dimethyl acetal | FL/FR |
| tropical trithiane | FL/FR |
| diethyl malonate | FL/FR |
| methyl 2-methyl valerate | FL/FR |
| allyl cyclohexyl propionate | FL/FR |
| lilac acetaldehyde | FL/FR |
para- | anisyl acetate | FL/FR |
| vanilla carboxylate | FL/FR |
iso | valeraldehyde propylene glycol acetal | FL/FR |
| tagete oil south africa | FL/FR |
iso | amyl acetate | FL/FR |
| ethyl levulinate | FL/FR |
| hexyl acetate | FL/FR |
(Z)-3- | hexen-1-yl isobutyrate | FL/FR |
| styralyl acetate | FL/FR |
| strawberry glycidate 1 (aldehyde C-16 (so-called)) | FL/FR |
| hexyl hexanoate | FL/FR |
| allyl hexanoate | FL/FR |
| rose butanoate | FL/FR |
iso | amyl benzoate | FL/FR |
green |
(E,Z)-2,6- | nonadienal | FL/FR |
| linalool oxide | FL/FR |
3- | phenyl propionaldehyde | FL/FR |
(E)-2- | nonenal | FL/FR |
| methyl heptenone | FL/FR |
| methyl octine carbonate | FL/FR |
(E,Z)-3,6- | nonadien-1-ol | FL/FR |
4- | methyl-2-pentenal | FL |
| melon heptenal | FL/FR |
3- | octyl acetate | FL/FR |
| galbanum oil | FL/FR |
cis- | galbanum oxathiane | FL/FR |
| heptanal dimethyl acetal | FL/FR |
| cinnamyl alcohol | FL/FR |
2-iso | butyl thiazole | FL/FR |
| cassis pentanone | FL/FR |
3,5,5- | trimethyl hexanol | FL/FR |
| angelica root oil | FL/FR |
| acetaldehyde dipropyl acetal | FL/FR |
| violet leaf absolute | FL/FR |
(Z)-3- | hexen-1-yl tiglate | FL/FR |
(Z)-6- | nonenal | FL/FR |
beta- | ocimene | FL/FR |
2- | pentyl furan | FL/FR |
(Z)- | leaf acetal | FL/FR |
iso | amyl salicylate | FL/FR |
| acetaldehyde butyl phenethyl acetal | FL/FR |
(E)-2- | hexen-1-yl acetate | FL/FR |
(Z)-3- | hexen-1-yl acetate | FL/FR |
| octanal dimethyl acetal | FL/FR |
| nerolidol | FL/FR |
2- | phenyl propionaldehyde | FL/FR |
| geranyl acetate | FL/FR |
| phenyl acetaldehyde dimethyl acetal | FL/FR |
| geranium absolute | FL/FR |
| melon nonenoate | FL/FR |
| hexyl 2-methyl butyrate | FL/FR |
| dihydroxyacetophenone (mixed isomers) | FL |
(Z)-3- | hexen-1-ol | FL/FR |
(E,Z)-3,6- | nonadien-1-yl acetate | FL/FR |
(Z)-3- | hexen-1-yl salicylate | FL/FR |
| methyl heptine carbonate | FL/FR |
(E)-2- | octen-1-yl acetate | FL/FR |
(E,Z)-2,6- | nonadien-1-ol | FL/FR |
2-iso | butyl-3-methoxypyrazine | FL/FR |
(Z)-3- | hexen-1-yl formate | FL/FR |
herbal |
| eucalyptus globulus oil | FL/FR |
| coriander seed oil | FL/FR |
| anthemis nobilis flower oil roman | FL/FR |
curled | parsley leaf oil | FL/FR |
| clary sage oil france | FL/FR |
| daucus carota fruit oil | FL/FR |
| lavender absolute bulgaria | FL/FR |
| origanum oil greece | FL/FR |
honey |
| phenethyl acetate | FL/FR |
| phenyl acetaldehyde | FL/FR |
juicy |
| lychee mercaptan acetate | FL/FR |
musty |
| shoyu pyrazine | FL/FR |
nutty |
2- | acetyl furan | FL/FR |
phenolic |
| methyl benzoate | FL/FR |
ripe |
(E)-4- | decenal | FL/FR |
rummy |
| ethyl crotonate | FL/FR |
sour |
2- | methyl-2-pentenoic acid | FL/FR |
spicy |
| cumin seed oil | FL/FR |
3- | phenyl propyl alcohol | FL/FR |
| cuminaldehyde | FL/FR |
sulfurous |
| buchu mercaptan | FL/FR |
| mango thiol | FL/FR |
sweet |
| hexyl benzoate | FL/FR |
terpenic |
| juniperus communis fruit oil | FL/FR |
tropical |
| propyl propionate | FL/FR |
| passiflora acetate | FL/FR |
vegetable |
1- | furfuryl pyrrole | FL/FR |
waxy |
2- | methyl undecanal (aldehyde C-12 mna) | FL/FR |
| octanol | FL/FR |
alpha- | hexyl cinnamaldehyde | FL/FR |
| decanal diethyl acetal | FL/FR |
| ethyl laurate | FL/FR |
| decanal (aldehyde C-10) | FL/FR |
| mimosa absolute france | FL/FR |
woody |
| vetiver oil haiti | FL/FR |
| frankincense oil | FL/FR |
| sabinene | FL/FR |
iso | bornyl acetate | FL/FR |
| patchouli oil | FL/FR |
| spruce needle oil canada | FL/FR |
alpha- | terpinyl acetate | FL/FR |
|
Potential Uses:
Natural Occurrence in: note
Synonyms:
| acroval | | ald AA triplal BHT | | citrulan | | cyclal C (Givaudan) | | cyclogreenal (A.C.S. International) | 3- | cyclohexene-1-carboxaldehyde, 2,4-dimethyl- | 3- | cyclohexenene-1-carboxaldehyde, 2,4-dimethyl | (Z,E)-2,4- | dimethyl cyclohex-3-ene-1-carbaldehyde | (Z,E)-2,4- | dimethyl-3-cyclohexene carbaldehyde | (Z,E)-2,4- | dimethyl-3-cyclohexene carboxaldehyde | 2,4- | dimethyl-3-cyclohexene carboxaldehyde | 2,4- | dimethyl-3-cyclohexene-1-carbaldehyde | (Z,E)-2,4- | dimethyl-3-cyclohexene-1-carboxaldehyde | (Z,E)-2,4- | dimethyl-3-cyclohexenecarboxaldehyde | 2,4- | dimethyl-3-cyclohexenecarboxaldehyde | 2,4- | dimethyl-3-cycplohexenecarboxaldehyde | 2,4- | dimethyl-cyclohex-3-enecarbaldehyde | 2,4- | dimethylcyclohex-3-ene-1-carbaldehyde | 2,4- | dimethylcyclohex-3-enecarbaldehyde | (Z,E)-4- | formyl-1,3-dimethyl cyclohex-1-ene | 4- | formyl-1,3-dimethylcyclohex-1-ene | | hivertal | 2,4- | ivy carbaldehyde | | lantral | | ligustral (Givaudan) | | tricyclal | | trigustral | | triplal (IFF) | | triplal synthetic | | trivertal | | vertocitral (Symrise) | | vertocitral C (Symrise) | | zestover |
Articles:
|
click on the picture(s) below to interact with the 3D model |
|
Soluble in: |
| alcohol | | dipropylene glycol | | water, 311.5 mg/L @ 25 °C (est) |
Stability: |
| alcoholic lotion | | antiperspirant | | deo stick | | fabric softener | | shampoo | | soap |
|