Fragrance Demo Formulas |
2-benzylideneheptanal (Click)
IUPAC Name: 2-benzylideneheptanal
Std.InChI: InChI=1S/C14H18O/c1-2-3-5-10-14(12-15)11-13-8-6-4-7-9-13/h4,6-9,11-12H,2-3,5,10H2,1H3
InChI: InChI=1/C14H18O/c1-2-3-5-10-14(12-15)11-13-8-6-4-7-9-13/h4,6-9,11-12H,2-3,5,10H2,1H3
Std.InChIKey: HMKKIXGYKWDQSV-UHFFFAOYSA-N
InChIKey: HMKKIXGYKWDQSV-UHFFFAOYAT
SMILES: CCCCCC(=CC1=CC=CC=C1)C=O
|
CAS Number: | 122-40-7 |
|
ECHA EINECS - REACH Pre-Reg: | 204-541-5 |
FDA UNII: | WC51CA3418 |
Beilstein Number: | 0511292 |
MDL: | MFCD00006988 |
CoE Number: | 128 |
XlogP3-AA: | 4.20 (est) |
Molecular Weight: | 202.29666000 |
Formula: | C14 H18 O |
NMR Predictor: | Predict (works with chrome or firefox) |
Also(can) Contains: | (E)-alpha-amyl cinnamaldehyde |
| (Z)-alpha-amyl cinnamaldehyde |
Category: flavor and fragrance agents
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
Appearance: | pale yellow to yellow clear liquid (est) |
Assay: | 97.00 to 100.00 % sum of isomers
|
Halogens: | Chlorine free |
Food Chemicals Codex Listed: | Yes |
Specific Gravity: | 0.96300 to 0.97100 @ 25.00 °C.
|
Pounds per Gallon - (est).: | 8.013 to 8.080
|
Specific Gravity: | 0.96400 to 0.97200 @ 20.00 °C.
|
Pounds per Gallon - est.: | 8.031 to 8.097
|
Refractive Index: | 1.55500 to 1.55900 @ 20.00 °C.
|
Melting Point: | 80.00 °C. @ 760.00 mm Hg
|
Boiling Point: | 287.00 to 290.00 °C. @ 760.00 mm Hg
|
Acid Value: | 5.00 max. KOH/g
|
Vapor Pressure: | 0.002000 mm/Hg @ 25.00 °C. (est) |
Flash Point: | > 212.00 °F. TCC ( > 100.00 °C. )
|
logP (o/w): | 4.357 (est) |
Shelf Life: | 12.00 month(s) or longer if stored properly. |
Storage: | store under nitrogen. |
Storage: | refrigerate in tightly sealed containers. store under nitrogen. |
Soluble in: |
| ethyl alcohol, 4 vol. of 80% alcohol | | fixed oils | | kerosene | | paraffin oil | | water, 8.545 mg/L @ 25 °C (est) |
Insoluble in: |
| water | | glycerin | | propylene glycol |
Stability: |
| alcoholic lotion | | alkalis | | antiperspirant | | deo stick | | detergent perborate | | fabric softener | | hair spray | | hard surface cleaner | | shampoo | | soap |
Similar Items: note |
alpha-butyl cinnamaldehyde |
alpha-heptyl cinnamaldehyde |
alpha-hexyl cinnamaldehyde |
alpha-methyl cinnamaldehyde |
Organoleptic Properties:
Odor Type: | floral |
Odor Strength: | medium |
| sweet floral oily fruity herbal jasmin |
Odor Description: at 100.00 %. | sweet floral oily fruity herbal jasmin Luebke, William tgsc, (1981) |
| sweet floral fruity tropical green powdery |
Odor Description:
| Sweet, floral, fruity, tropical and green with a powdery nuance Mosciano, Gerard P&F 22, No. 6, 41, (1997) |
| tropical waxy floral rose honey fruity |
Taste Description: at 2.50 ppm. | Tropical, waxy, floral, rosy and honey-like with a fruity nuance and body Mosciano, Gerard P&F 22, No. 6, 41, (1997) |
Substantivity: | 256 hour(s) at 100.00 % |
| |
Cosmetic Information:
Suppliers:
Advanced Biotech |
AMYL CINNAMIC ALDEHYDE NATURAL
93.5% min. (mixed isomers) |
Alfrebro |
alpha-AMYL CINNAMALDEHYDE NATURAL
Odor: Apple, Apricot, Peach, Spice |
Associate Allied Chemicals |
alpha-Amyl Cinnamic Aldehyde
|
About |
Augustus Oils |
Amyl Cinnamic Aldehyde
|
Services |
Aurochemicals |
AMYL CINNAMIC ALDEHYDE C & T, Natural
|
Berjé |
alpha-Amyl Cinnamic Aldehyde
|
Happening at Berje |
CG Herbals |
alpha-Amyl Cinnamic Aldehyde
Odor: Sweet Floral Oily Fruity Herbal Jasmine |
Charkit Chemical |
AMYL CINNAMIC ALDEHYDE
|
Creatingperfume.com |
alpha-Amyl Cinnamic Aldehyde
Odor: Floral, Jasmin, Waxy |
Diffusions Aromatiques |
ALDEHYDE AMYL CINNAMIQUE (JASMONAL A)
|
ECSA Chemicals |
alpha-Amyl Cinnamic Aldehyde
|
Company Profile |
Elan Inc. |
alpha-amyl cinnamaldehyde
(natural), Kosher |
Emerald Kalama Chemical |
Amyl Cinnamic Aldehyde (ACA)
Odor: Jasmine, floral, cocoa |
Ernesto Ventós |
AMYL CINNAMIC ALDEHYDE ALPHA
Odor: FLORAL WITH JASMIN CHARACTER |
Ernesto Ventós |
AMYL CINNAMIC ALDEHYDE KAO
Odor: FLORAL WITH JASMIN CHARACTER |
Global Essence |
alpha-Amyl Cinnamaldehyde
|
Indukern F&F |
ALPHA AMYL CINNAMALDEHYDE NATURAL
Odor: FLORAL, SWEET, FRUITY, HERBAL |
CROP CALENDAR |
Indukern F&F |
ALPHA AMYL CINNAMIC ALDEHYDE
Odor: FLORAL, SWEET, FRUITY, HERBAL |
Inoue Perfumery |
2-AMYL CINNAMALDEHYDE
|
Kao Corporation |
AMYL CINNAMIC ALDEHYDE
Odor: Floral with Jasmine character |
Keva |
AMYL CINNAMIC ALDEHYDE ALPHA
|
Lluch Essence |
alpha-AMYL CINNAMALDEHYDE NATURAL
|
Lluch Essence |
alpha-AMYL CINNAMIC ALDEHYDE
Odor: SWEET, FLORAL, FATTY |
M&U International |
NAT. AMYL CINNAMIC ALDEHYDE
|
Moellhausen |
alpha-AMYLCINNAMIC ALDEHYDE
Odor: aromatic, floreal Flavor: sweet, fruity |
Nagar Haveli Perfumes & Aromatics |
Amyl Cinnamic Aldehyde
Natural Odor: Sweet, floral, fruity, tropical and green with a powdery nuance |
Pell Wall Perfumes |
Amyl Cinnamic Aldehyde
Odor: soft-floral, fresh, jasmine, slight spice Use: Arctander has quite a bit to say about the material: “Very mild oily-herbaceous and somewhat floral odor, reminiscent of many types of natural flowers, but mostly of Jasmin, Gardenia and Tuberose. Introduces Jasmin-like floralness when accompanied by more volatile chemicals of floral character. Blends excellently and assists in fixation of the fragrance (ACA is quite tenacious) �
ACA is very susceptible to oxidation unless properly treated with an antioxidant (conventionally added by most manufacturers). Old or oxidized ACA has [an] objectionable, rancid-fatty odor. Lower grades of ACA may show by-odor of Benzaldehyde, Heptaldehyde or Amyl nonenal, sometimes called Di-heptenal. |
Penta International |
a-AMYL CINNAMIC ALDEHYDE, Kosher
|
Penta International |
AMYL CINNAMIC ALDEHYDE, NATURAL, Kosher
|
PerfumersWorld |
ACA Amyl Cinnamic Aldehyde
Odor: jasmin oily aromatic mild oily-herbaceous oxidised rancid cinnamic benzaldehyde |
Phoenix Aromas & Essential Oils |
Amyl Cinnamic Aldehyde
|
Prinova |
Amyl Cinnamic Aldehyde
|
Reincke & Fichtner |
alpha-Amylcinnamaldehyde
|
Santa Cruz Biotechnology |
For experimental / research use only. |
a-Amylcinnamaldehyde
|
Sigma-Aldrich |
a-Amylcinnamaldehyde, mixture of cis and trans, ≥97%, stabilized, FG
Odor: jasmine; lily; sweet |
Certified Food Grade Products |
Taytonn |
alpha-Amyl Cinnamic Aldehyde
Odor: Floral, Herbal/ Herbaceous, Oily, Tuberose |
TCI AMERICA |
For experimental / research use only. |
a-Amylcinnamaldehyde >90.0%(GC)
|
The Good Scents Company |
alpha-amyl cinnamaldehyde
Odor: sweet floral oily fruity herbal jasmin |
The John D. Walsh Company |
Amyl Cinnamic Aldehyde
|
The Lermond Company |
Amyl Cinnamic Aldehyde
|
Treatt |
Amyl Cinnamic Aldehyde
|
Vigon International |
Amyl Cinnamic Aldehyde Natural
|
Vigon International |
Amyl Cinnamic Aldehyde
Odor: STRONG, FLORAL, LIKE JASMINE ON DILUTION, SPICY |
Safety Information:
Preferred SDS: View |
European information : |
Most important hazard(s): | Xi - Irritant |
R 36/37/38 - Irritating to eyes, respiratory system, and skin. R 43 - May cause sensitisation by skin contact. S 02 - Keep out of the reach of children. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 37/39 - Wear suitable gloves and eye/face protection.
|
|
Hazards identification |
|
Classification of the substance or mixture |
GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
Skin sensitisation (Category 1), H317 Acute aquatic toxicity (Category 2), H401 Chronic aquatic toxicity (Category 2), H411
|
GHS Label elements, including precautionary statements |
|
Pictogram |   |
|
Signal word | Warning |
Hazard statement(s) |
H317 - May cause an allergic skin reaction H401 - Toxic to aquatic life H411 - Toxic to aquatic life with long lasting effects
|
Precautionary statement(s) |
P261 - Avoid breathing dust/fume/gas/mist/vapours/spray. P272 - Contaminated work clothing should not be allowed out of the workplace. P273 - Avoid release to the environment. P280 - Wear protective gloves/protective clothing/eye protection/face protection. P302 + P352 - IF ON SKIN: wash with plenty of soap and water. P333 + P313 - IF SKIN irritation or rash occurs: Get medical advice/attention. P363 - Wash contaminated clothing before reuse. P391 - Collect spillage. Hazardous to the aquatic environment P501 - Dispose of contents/ container to an approved waste disposal plant.
|
Oral/Parenteral Toxicity: |
oral-rat LD50 3730 mg/kg SENSE ORGANS AND SPECIAL SENSES: OTHER CHANGES: OLFACTION
BEHAVIORAL: SOMNOLENCE (GENERAL DEPRESSED ACTIVITY)
SENSE ORGANS AND SPECIAL SENSES: OTHER: EYE Food and Cosmetics Toxicology. Vol. 2, Pg. 327, 1964.
|
Dermal Toxicity: |
Not determined
|
Inhalation Toxicity: |
Not determined
|
Safety in Use Information:
Category: | flavor and fragrance agents |
IFRA Critical Effect: | Sensitization |
IFRA: | View Standard |
Fragrance usage is IFRA RESTRICTED. View Standard for complete information. |
Please review all IFRA documents for complete information. |
IFRA categories: limits in the finished product: (For a description of the categories, refer to the IFRA QRA Information Booklet.) |
Category 1: See Note (1) | 0.70 % (1) |
Category 2: | 0.90 % |
Category 3: | 3.60 % |
Category 4: | 10.70 % |
Category 5: | 5.60 % |
Category 6: See Note (1) | 17.10 % (1) |
Category 7: | 1.80 % |
Category 8: | 2.00 % |
Category 9: | 5.00 % |
Category 10: | 2.50 % |
Category 11: | See Note (2) |
| Notes: |
| (1) IFRA would recommend that any material used to impart perfume or flavour in products intended for human ingestion should consist of ingredients that are in compliance with appropriate regulations for foods and food flavourings in the countries of planned distribution and, where these are lacking, with the recommendations laid down in the Code of Practice of IOFI (International Organisation of the Flavor Industry). Further information about IOFI can be found on its website (www.iofi.org). |
| (2) Category 11 includes all non-skin contact or incidental skin contact products. Due to the negligible skin contact from these types of products there is no justification for a restriction of the concentration of this fragrance ingredient in the finished product. |
|
Maximised Survey-derived Daily Intakes (MSDI-EU): | 22.00 (μg/capita/day) |
Maximised Survey-derived Daily Intakes (MSDI-USA): | 23.00 (μg/capita/day) |
Structure Class: | II |
Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). |
The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA Flavor Ingredient Library |
publication number: 3 |
Click here to view publication 3 |
| average usual ppm | average maximum ppm |
baked goods: | - | 4.50000 |
beverages(nonalcoholic): | - | 1.30000 |
beverages(alcoholic): | - | - |
breakfast cereal: | - | - |
cheese: | - | - |
chewing gum: | - | 15.00000 |
condiments / relishes: | - | - |
confectionery froastings: | - | - |
egg products: | - | - |
fats / oils: | - | - |
fish products: | - | - |
frozen dairy: | - | 1.50000 |
fruit ices: | - | 1.50000 |
gelatins / puddings: | 0.03000 | 0.05000 |
granulated sugar: | - | - |
gravies: | - | - |
hard candy: | - | 4.00000 |
imitation dairy: | - | - |
instant coffee / tea: | - | - |
jams / jellies: | - | - |
meat products: | - | - |
milk products: | - | - |
nut products: | - | - |
other grains: | - | - |
poultry: | - | - |
processed fruits: | - | - |
processed vegetables: | - | - |
reconstituted vegetables: | - | - |
seasonings / flavors: | - | - |
snack foods: | - | - |
soft candy: | - | - |
soups: | - | - |
sugar substitutes: | - | - |
sweet sauces: | - | - |
Safety References:
References:
Other Information:
Potential Blenders and core components note
|
For Odor |
No odor group found for these |
(E+Z)-4,8- | dimethyl-3,7-nonadien-2-one | FL/FR |
aldehydic |
| nonanal (aldehyde C-9) | FL/FR |
10- | undecenal (aldehyde C-11 undecylenic) | FL/FR |
amber |
| cistus ladaniferus resinoid | FR |
animal |
| costus valerolactone | FR |
| methyl (E)-2-octenoate | FL/FR |
anisic |
| amyl furoate | FL/FR |
para- | anisaldehyde | FL/FR |
balsamic |
| amyris wood oil | FL/FR |
siam | benzoin resinoid | FL/FR |
| benzyl cinnamate | FL/FR |
| benzyl salicylate | FL/FR |
| cinnamyl formate | FL/FR |
| copaiba balsam oil | FL/FR |
| ethyl cinnamate | FL/FR |
| fir balsam absolute | FR |
| guaiacyl phenyl acetate | FL/FR |
| guaiyl acetate | FL/FR |
berry |
| raspberry ketone methyl ether | FL/FR |
caramellic |
| diethyl malate | FL/FR |
| maltyl isobutyrate | FL/FR |
chocolate |
iso | amyl phenyl acetate | FL/FR |
iso | butyl phenyl acetate | FL/FR |
citrus |
| bergamot oil bergaptene reduced italy | FL/FR |
beta- | bisabolol | FL/FR |
2- | ethyl-1-hexanol | FL/FR |
2- | heptanol | FL/FR |
| lemongrass oil | FL/FR |
| tetrahydromyrcenol | FR |
| verbena absolute france | FL/FR |
coconut |
| tetrahydrojasmone | FR |
earthy |
| octyl phenyl acetate | FL/FR |
| spathulenol | |
ethereal |
| ethyl 4-pentenoate | FL/FR |
iso | valeraldehyde propylene glycol acetal | FL/FR |
fatty |
| butyl undecylenate | FL/FR |
| coconut absolute | FL/FR |
| decanol | FL/FR |
4- | ethyl octanoic acid | FL/FR |
(E,Z,Z)-2,4,7- | tridecatrienal | FL/FR |
fermented |
| methyl decanoate | FL/FR |
floral |
| acetal 318 | FR |
iso | amyl angelate | FL/FR |
alpha- | amyl cinnamyl acetate | FL/FR |
iso | amyl salicylate | FL/FR |
| benzyl acetate | FL/FR |
| benzyl acetoacetate | FL/FR |
| benzyl acetone | FL/FR |
| benzyl formate | FL/FR |
| benzyl phenyl acetate | FL/FR |
| bois de rose oil brazil | FL/FR |
| butyl tiglate | FR |
| cassie absolute | FL/FR |
| cassis cyclohexene | FR |
| champaca absolute | FR |
| citronellol | FL/FR |
| citronellyl acetate | FL/FR |
| citronellyl butyrate | FL/FR |
| citronellyl hexanoate | FL/FR |
| citronellyl phenyl acetate | FL/FR |
| citronellyl propionate | FL/FR |
(E)- | citronellyl tiglate | FL/FR |
| coranol (Firmenich) | FR |
para- | cresyl laurate | FL/FR |
| cyclamen aldehyde | FL/FR |
| dihydroisojasmonate methyl ester | FR |
| dihydrojasmone | FL/FR |
| dihydrolinalool | FL/FR |
| dimethyl anthranilate | FL/FR |
| dimethyl benzyl carbinyl acetate | FL/FR |
| dimethyl benzyl carbinyl butyrate | FL/FR |
| dimethyl benzyl carbinyl propionate | FR |
| dimethyl octanol | FL/FR |
2,4- | dimethyl-3-cyclohexene-1-methanol | FR |
3,6- | dimethyl-3-octanol | FL/FR |
| ethyl linalool | FR |
| ethyl linalyl acetal | FR |
| ethyl linalyl acetate | FR |
| ethyl linalyl ether | FL/FR |
| ethyl phenyl acetate | FL/FR |
| floral pyranol | FR |
| gelsone (IFF) | FL/FR |
| geraniol | FL/FR |
| geranyl acetone | FL/FR |
(E)- | geranyl acetone | FL/FR |
| geranyl formate | FL/FR |
| geranyl hexanoate | FL/FR |
| geranyl phenyl acetate | FL/FR |
| geranyl propionate | FL/FR |
| geranyl tiglate | FL/FR |
| heliotropyl acetone | FL/FR |
| herbal pyran | FR |
| hexahydrofarnesyl acetone | FL/FR |
| hexenyl cyclopentanone | FR |
alpha- | hexyl cinnamaldehyde | FL/FR |
| ho leaf oil | FR |
| ho wood oil | FR |
| honeysuckle absolute | FR |
| hydroxycitronellal | FL/FR |
| hydroxycitronellal dimethyl acetal | FL/FR |
| jasmin absolute (from pommade) | FL/FR |
| jasmin absolute egypt (from concrete) | FL/FR |
| jasmin absolute india (from concrete) | FL/FR |
| jasmin absolute italy (from concrete) | FL/FR |
| jasmin absolute sambac | FL/FR |
| jasmin acetate | FL/FR |
| jasmin concrete | FR |
| jasmin concrete morocco | FR |
| jasmin pyranol | FR |
iso | jasmone | FL/FR |
iso | jasmone | FL/FR |
para- | jasmone | FR |
| karo karounde absolute | FR |
abrialis | lavandin oil | FL/FR |
| lavender oil france | FL/FR |
| lavender oil greece | FL/FR |
| linalool | FL/FR |
dextro- | linalool | FL/FR |
laevo- | linalool | FL/FR |
| linalool oxide | FL/FR |
| linalyl anthranilate | FL/FR |
| menthadienyl formate | FR |
| methoxymelonal | FL/FR |
| methyl benzyl acetate (mixed ortho-,meta-,para-) | FL/FR |
| methyl citronellate | FL/FR |
| methyl dihydrojasmonate | FL/FR |
alpha-iso | methyl ionone (90% min.) | FL/FR |
| methyl ionyl acetate | FL/FR |
| methyl jasmonate | FL/FR |
| muguet carbinol | FL/FR |
| nerolidol | FL/FR |
| neryl acetate | FL/FR |
| nonan-3-yl acetate | FL/FR |
| nonanol | FL/FR |
3- | nonanon-1-yl acetate | FL/FR |
| nonyl nonanoate | |
| ocean propanal | FL/FR |
(Z)-beta- | ocimene | FL/FR |
| orange leaf absolute | FL/FR |
| orris rhizome concrete butter (iris pallida) | FL/FR |
| orris rhizome resinoid (iris pallida) | FL/FR |
| papaya isobutyrate | FL/FR |
| pentenyl cyclopentanone | FR |
| petitgrain lemon oil | FL/FR |
| petitgrain oil paraguay | FL/FR |
| phenethyl acetate | FL/FR |
| phenethyl hexanoate | FL/FR |
| phenethyl isobutyrate | FL/FR |
| phenethyl isovalerate | FL/FR |
1- | phenyl propyl butyrate | FL/FR |
2- | phenyl propyl isobutyrate | FL/FR |
4- | phenyl-3-buten-2-ol | FL/FR |
iso | phytol | FL/FR |
| prenyl salicylate | FL/FR |
iso | propyl benzoate | FL/FR |
| rhodinol | FL/FR |
| rose absolute (rosa centifolia) | FL/FR |
| rose absolute (rosa centifolia) morocco | FL/FR |
| rose butanoate | FL/FR |
| rose oil (rosa centifolia) egypt | FL/FR |
| rose oil (rosa damascena) iran | FL/FR |
| rose oil (rosa damascena) turkey | FL/FR |
| rose undecene | FR |
| styralyl isobutyrate | FL/FR |
| tea acetate | FR |
| terpinyl isobutyrate | FL/FR |
| terpinyl valerate | FL/FR |
| tetrahydroionyl acetate | FR |
| tetrahydrolinalool | FL/FR |
| ylang ylang flower oil | FL/FR |
fruity |
| allyl cyclohexyl propionate | FL/FR |
| allyl heptanoate | FL/FR |
iso | amyl isobutyrate | FL/FR |
iso | amyl nonanoate | FL/FR |
para- | anisyl propionate | FL/FR |
| balsam specialty | FR |
| benzaldehyde / methyl anthranilate schiff's base | FR |
| benzyl butyrate | FL/FR |
| benzyl propionate | FL/FR |
3- | benzyl-4-heptanone | FL/FR |
| berry hexanoate | FR |
iso | butyl anthranilate | FL/FR |
iso | butyl furyl propionate | FL/FR |
iso | butyl octanoate | FL/FR |
| citronellyl isobutyrate | FL/FR |
beta- | damascone | FL/FR |
(E)-beta- | damascone | FL/FR |
(Z)-beta- | damascone | FL/FR |
gamma- | decalactone | FL/FR |
| decyl butyrate | FL/FR |
| dodecyl isobutyrate | FL/FR |
| eriocephalus punctulatus flower oil | FR |
| ethyl (E)-2-decenoate | FL/FR |
| ethyl levulinate | FL/FR |
| geranyl methyl tiglate | |
| green acetate | FR |
(R)-(-)-2- | heptanol | FL/FR |
| heptyl butyrate | FL/FR |
| heptyl isobutyrate | FL/FR |
3- | hexanone | FL/FR |
(Z)-3- | hexen-1-yl 2-methyl-2-pentenoate | FR |
2- | hexenyl cyclopentanyl acetate | FR |
| hexyl valerate | FL/FR |
para- | menth-1-ene-9-ol | FL/FR |
3- | mercaptohexyl acetate | FL/FR |
| methyl (E,Z)-2,4-decadienoate | FL/FR |
| methyl (Z)-3-hexenoate | FL/FR |
2- | methyl butyl isovalerate | FL/FR |
| methyl isobutyrate | FL/FR |
(E)-7- | methyl-3-octen-2-one | FL/FR |
| neryl propionate | FL/FR |
(E)-2- | nonen-1-yl acetate | FL/FR |
| octyl octanoate | FL/FR |
sesqui | phellandrene | |
| phenoxyethyl propionate | FL/FR |
| prenyl acetate | FL/FR |
| propyl 2,4-decadienoate | FL/FR |
| propyl isobutyrate | FL/FR |
| rhubarb pyran | FR |
| strawberry glycidate 1 (aldehyde C-16 (so-called)) | FL/FR |
| styralyl butyrate | FL/FR |
(E,E)-5,6,7,7- | tetramethyl-2,5-octadien-4-one | FR |
4-(para- | tolyl)-2-butanone | FL/FR |
| tropical ionone | FL/FR |
gamma- | undecalactone (aldehyde C-14 (so-called)) | FL/FR |
green |
iso | amyl 3-(2-furan) propionate | FL/FR |
iso | butyl benzyl carbinol | FL/FR |
| butyl heptanoate | FL/FR |
iso | butyl heptanoate | FL/FR |
iso | butyl methyl ketone | FL/FR |
| dicyclopentadiene propionate | FR |
3,7- | dimethyl-6-octenoic acid | FL/FR |
| ethyl (E,Z)-2,4-decadienoate | FL/FR |
| ethyl (E)-4-decenoate | FL/FR |
| heptanal dimethyl acetal | FL/FR |
| heptyl formate | FL/FR |
| herbal cyclohexane | FR |
(E)-2- | hexen-1-yl acetate | FL/FR |
(Z)-3- | hexen-1-yl hexanoate | FL/FR |
(Z)-3- | hexen-1-yl isovalerate | FL/FR |
(Z)-3- | hexen-1-yl propionate | FL/FR |
| hexoxyacetaldehyde dimethyl acetal | FR |
| hexyl tiglate | FL/FR |
| magnolia flower oil | FL/FR |
| magnolia flower oil CO2 extract | FL/FR |
| privet dioxane | FR |
iso | propyl decanoate | FL/FR |
| violet leaf absolute | FL/FR |
herbal |
6- | acetoxydihydrotheaspirane | FL/FR |
iso | amyl heptanoate | FL/FR |
| anthemis nobilis flower oil roman | FL/FR |
| arnica flower oil | FR |
| artemisia ludoviciana oil | FR |
| buchu mercaptan acetate | FL/FR |
| butyl levulinate | FL/FR |
| carrot seed oil (daucus carota ssp. gummifer hook. fil.) spain | FR |
| chamomile isobutyrate | FR |
| chamomile propionate | FR |
| chamomile valerate | FR |
| clary propyl acetate | FR |
| clary sage absolute | FL/FR |
| clary sage oil france | FL/FR |
| cuminyl acetate | FL/FR |
| dimethyl benzyl carbinyl crotonate | FL/FR |
| geranium cyclohexane | FR |
| lavender absolute bulgaria | FL/FR |
| linalyl formate | FL/FR |
| linalyl octanoate | FL/FR |
1-para- | menthen-9-yl acetate | FL/FR |
| methyl cyclogeranate | FR |
5- | methyl-3-heptanone | FL/FR |
| myrtle oil | FL/FR |
3- | octanon-1-ol | FL/FR |
3- | octyl acetate | FL/FR |
beta-sesqui | phellandrene | |
| rue flower oil colombia | |
| rue oil | FL/FR |
| rue oil cuba | FL/FR |
| tagete oil CO2 extract | FL/FR |
| tagete oil egypt | FL/FR |
| tagete oil rwanda | FL/FR |
| tagete oil turkey | FL/FR |
| tagete oil zambia | FL/FR |
| tricyclodecenyl isobutyrate | FR |
| tricyclodecenyl propionate | FR |
| viridiflorol | FL/FR |
honey |
| butyl phenyl acetate | FL/FR |
licorice |
sweet | basil oleoresin | FL/FR |
mossy |
| veramoss (IFF) | FR |
musk |
| musk nonane | FR |
musty |
ketoiso | phorone | FL/FR |
oily |
| petal pyranone | FL/FR |
orris |
| orris capronate | FL/FR |
powdery |
| dibenzyl ketone | FL/FR |
alpha- | methyl ionone | FL/FR |
spicy |
alpha- | amyl cinnamyl alcohol | FL/FR |
para- | anisyl formate | FL/FR |
| cassia bark oil china | FL/FR |
| cinnamyl propionate | FL/FR |
| cubeb oil | FL/FR |
(-)- | cubenol | FL/FR |
iso | eugenol | FL/FR |
iso | eugenyl acetate | FL/FR |
| pimenta acris leaf oil | FL/FR |
| spicy acetoacetate | FL/FR |
sulfurous |
| buchu mercaptan | FL/FR |
| cassis pentanone | FL/FR |
| passiflora acetate | FL/FR |
sweet |
| vanilla bean absolute (vanilla planifolia) | FL/FR |
tonka |
| tonka bean absolute | FR |
tropical |
| genet absolute | FL/FR |
waxy |
| ethyl laurate | FL/FR |
| methyl butyl phenyl acetate | FL/FR |
woody |
| cyperus root oil (cyperus rotundus) | FR |
2- | decalinyl acetate | FR |
2- | decalinyl formate | FR |
| guaiacwood oil | FL/FR |
(-)- | guaiol | FR |
| gurjun balsam oil | FR |
| methyl cedryl ketone | FL/FR |
| patchouli absolute | FR |
| patchouli ethanone | FR |
| sandalrome | FR |
| santall | FR |
| vetiver oil haiti | FL/FR |
| woody acetate | FR |
|
For Flavor |
|
No flavor group found for these |
6- | acetoxydihydrotheaspirane | FL/FR |
1- | acetyl cyclohexyl acetate | FL |
| amyl angelate | FL |
iso | amyl angelate | FL/FR |
| amyl furoate | FL/FR |
para- | anisyl propionate | FL/FR |
| benzyl methyl tiglate | FL |
iso | butyl heptanoate | FL/FR |
iso | butyl octanoate | FL/FR |
2- | butyl thiophene | FL |
| cuminyl acetate | FL/FR |
(Z)-beta- | damascone | FL/FR |
| diethyl malate | FL/FR |
2,4- | difurfuryl furan | FL |
(±)-(cis+trans)-1,2- | dihydroperillaldehyde | FL |
| dimethyl benzyl carbinyl crotonate | FL/FR |
S-(2,5- | dimethyl-3-furyl) ethane thioate | FL |
(E+Z)-4,8- | dimethyl-3,7-nonadien-2-one | FL/FR |
| dodecyl isobutyrate | FL/FR |
| ethyl 4-pentenoate | FL/FR |
| ethyl linalyl ether | FL/FR |
| guaiyl acetate | FL/FR |
(R)-(-)-2- | heptanol | FL/FR |
| hexahydrofarnesyl acetone | FL/FR |
| hexyl valerate | FL/FR |
dextro- | linalool | FL/FR |
| linalyl formate | FL/FR |
| magnolia flower oil | FL/FR |
| magnolia flower oil CO2 extract | FL/FR |
| methyl (E,Z)-2,4-decadienoate | FL/FR |
| methyl benzyl acetate (mixed ortho-,meta-,para-) | FL/FR |
5- | methyl hexanoic acid | FL |
alpha-iso | methyl ionone (90% min.) | FL/FR |
| nonan-3-yl acetate | FL/FR |
(E)-2- | nonen-1-yl acetate | FL/FR |
| nonyl nonanoate | |
3- | octanon-1-ol | FL/FR |
| octyl octanoate | FL/FR |
| octyl phenyl acetate | FL/FR |
| petal pyranone | FL/FR |
sesqui | phellandrene | |
beta-sesqui | phellandrene | |
1- | phenethyl mercaptan | FL |
1- | phenyl propyl butyrate | FL/FR |
2- | phenyl propyl isobutyrate | FL/FR |
iso | propyl benzoate | FL/FR |
iso | propyl decanoate | FL/FR |
| rue flower oil colombia | |
| spathulenol | |
| styralyl isobutyrate | FL/FR |
| terpinyl isobutyrate | FL/FR |
| viridiflorol | FL/FR |
|
| althaea officinalis root tincture | FL |
iso | amyl 3-(2-furan) propionate | FL/FR |
| benzyl acetoacetate | FL/FR |
iso | butyl furyl propionate | FL/FR |
beta- | damascone | FL/FR |
| gelsone (IFF) | FL/FR |
acidic |
(E)-2- | hexenoic acid | FL |
aldehydic |
| nonanal (aldehyde C-9) | FL/FR |
| nonanol | FL/FR |
amber |
iso | butyl benzyl carbinol | FL/FR |
balsamic |
siam | benzoin resinoid | FL/FR |
| benzyl salicylate | FL/FR |
| copaiba balsam oil | FL/FR |
| ethyl cinnamate | FL/FR |
berry |
| heliotropyl acetone | FL/FR |
| heptyl isobutyrate | FL/FR |
| raspberry ketone methyl ether | FL/FR |
bitter |
| dibenzyl ketone | FL/FR |
(E,Z,Z)-2,4,7- | tridecatrienal | FL/FR |
burnt |
| ethyl 2-furoate | FL |
citrus |
| bergamot oil bergaptene reduced italy | FL/FR |
beta- | bisabolol | FL/FR |
| lemongrass oil | FL/FR |
| linalool | FL/FR |
laevo- | linalool | FL/FR |
| petitgrain lemon oil | FL/FR |
| petitgrain oil paraguay | FL/FR |
ketoiso | phorone | FL/FR |
| verbena absolute france | FL/FR |
cocoa |
iso | butyl phenyl acetate | FL/FR |
coconut |
| butyl heptanoate | FL/FR |
coffee |
2,4- | dimethyl thiazole | FL |
creamy |
| althaea officinalis root extract | FL |
para- | anisaldehyde | FL/FR |
gamma- | undecalactone (aldehyde C-14 (so-called)) | FL/FR |
earthy |
alpha- | amyl cinnamyl acetate | FL/FR |
ethereal |
| methyl isobutyrate | FL/FR |
fatty |
| coconut absolute | FL/FR |
| dimethyl octanol | FL/FR |
| ethyl (E)-4-decenoate | FL/FR |
4- | ethyl octanoic acid | FL/FR |
2- | ethyl-1-hexanol | FL/FR |
| heptyl formate | FL/FR |
| methyl decanoate | FL/FR |
(E)-7- | methyl-3-octen-2-one | FL/FR |
10- | undecenal (aldehyde C-11 undecylenic) | FL/FR |
floral |
iso | amyl phenyl acetate | FL/FR |
| bois de rose oil brazil | FL/FR |
| cinnamyl propionate | FL/FR |
| citronellol | FL/FR |
| citronellyl acetate | FL/FR |
| citronellyl hexanoate | FL/FR |
| citronellyl phenyl acetate | FL/FR |
| citronellyl propionate | FL/FR |
| dihydrojasmone | FL/FR |
| dihydrolinalool | FL/FR |
| dimethyl benzyl carbinyl acetate | FL/FR |
| dimethyl benzyl carbinyl butyrate | FL/FR |
3,7- | dimethyl-6-octenoic acid | FL/FR |
| geraniol | FL/FR |
| geranyl acetone | FL/FR |
(E)- | geranyl acetone | FL/FR |
| geranyl phenyl acetate | FL/FR |
| geranyl tiglate | FL/FR |
| jasmin absolute (from pommade) | FL/FR |
| jasmin absolute egypt (from concrete) | FL/FR |
| jasmin absolute india (from concrete) | FL/FR |
| jasmin absolute italy (from concrete) | FL/FR |
| jasmin absolute sambac | FL/FR |
| jasmin acetate | FL/FR |
| linalyl anthranilate | FL/FR |
| methyl citronellate | FL/FR |
| methyl dihydrojasmonate | FL/FR |
| methyl jasmonate | FL/FR |
| muguet carbinol | FL/FR |
| neryl acetate | FL/FR |
| ocean propanal | FL/FR |
| orange leaf absolute | FL/FR |
| orris rhizome concrete butter (iris pallida) | FL/FR |
| orris rhizome resinoid (iris pallida) | FL/FR |
| rhodinol | FL/FR |
| rose absolute (rosa centifolia) | FL/FR |
| rose absolute (rosa centifolia) morocco | FL/FR |
| rose oil (rosa centifolia) egypt | FL/FR |
| rose oil (rosa damascena) iran | FL/FR |
| rose oil (rosa damascena) turkey | FL/FR |
| tetrahydrolinalool | FL/FR |
| tropical ionone | FL/FR |
| ylang ylang flower oil | FL/FR |
fruity |
| allyl cyclohexyl propionate | FL/FR |
| allyl heptanoate | FL/FR |
iso | amyl isobutyrate | FL/FR |
| benzyl acetate | FL/FR |
| benzyl acetone | FL/FR |
| benzyl butyrate | FL/FR |
| benzyl formate | FL/FR |
| benzyl propionate | FL/FR |
3- | benzyl-4-heptanone | FL/FR |
| buchu mercaptan acetate | FL/FR |
iso | butyl anthranilate | FL/FR |
| citronellyl butyrate | FL/FR |
| citronellyl isobutyrate | FL/FR |
gamma- | decalactone | FL/FR |
(E)-2- | decenoic acid | FL |
| decyl butyrate | FL/FR |
| dimethyl anthranilate | FL/FR |
| ethyl (E)-2-decenoate | FL/FR |
| ethyl levulinate | FL/FR |
| geranyl hexanoate | FL/FR |
| geranyl methyl tiglate | |
2- | heptanol | FL/FR |
3- | hexanone | FL/FR |
2- | hexyl-4-acetoxytetrahydrofuran | FL |
| linalyl octanoate | FL/FR |
1-para- | menthen-9-yl acetate | FL/FR |
| methoxymelonal | FL/FR |
| methyl (E)-2-octenoate | FL/FR |
| methyl (Z)-3-hexenoate | FL/FR |
| methyl 4-phenyl butyrate | FL |
2- | methyl butyl isovalerate | FL/FR |
5- | methyl-3-heptanone | FL/FR |
3- | nonanon-1-yl acetate | FL/FR |
| phenethyl isovalerate | FL/FR |
2- | phenyl-4-pentenal | FL |
| prenyl acetate | FL/FR |
| propyl isobutyrate | FL/FR |
| rose butanoate | FL/FR |
| strawberry glycidate 1 (aldehyde C-16 (so-called)) | FL/FR |
| styralyl butyrate | FL/FR |
| tagete oil CO2 extract | FL/FR |
| tagete oil rwanda | FL/FR |
| tagete oil turkey | FL/FR |
| tagete oil zambia | FL/FR |
| terpinyl valerate | FL/FR |
4-(para- | tolyl)-2-butanone | FL/FR |
iso | valeraldehyde propylene glycol acetal | FL/FR |
green |
iso | amyl salicylate | FL/FR |
iso | butyl methyl ketone | FL/FR |
| cassis pentanone | FL/FR |
| clary sage absolute | FL/FR |
| cyclamen aldehyde | FL/FR |
(E)-beta- | damascone | FL/FR |
| ethyl (E,Z)-2,4-decadienoate | FL/FR |
| geranyl formate | FL/FR |
| heptanal dimethyl acetal | FL/FR |
| heptyl butyrate | FL/FR |
(E)-2- | hexen-1-yl acetate | FL/FR |
(Z)-3- | hexen-1-yl hexanoate | FL/FR |
(Z)-3- | hexen-1-yl isovalerate | FL/FR |
(Z)-3- | hexen-1-yl propionate | FL/FR |
| hexyl tiglate | FL/FR |
iso | jasmone | FL/FR |
iso | jasmone | FL/FR |
| linalool oxide | FL/FR |
| nerolidol | FL/FR |
| neryl propionate | FL/FR |
(Z)-beta- | ocimene | FL/FR |
3- | octyl acetate | FL/FR |
| papaya isobutyrate | FL/FR |
| violet leaf absolute | FL/FR |
hay |
| genet absolute | FL/FR |
herbal |
iso | amyl heptanoate | FL/FR |
| anthemis nobilis flower oil roman | FL/FR |
| butyl levulinate | FL/FR |
| clary sage oil france | FL/FR |
3,6- | dimethyl-3-octanol | FL/FR |
abrialis | lavandin oil | FL/FR |
| lavender absolute bulgaria | FL/FR |
| lavender oil france | FL/FR |
| lavender oil greece | FL/FR |
para- | menth-1-ene-9-ol | FL/FR |
| orris capronate | FL/FR |
| prenyl salicylate | FL/FR |
| rue oil | FL/FR |
| rue oil cuba | FL/FR |
| tagete oil egypt | FL/FR |
honey |
| benzyl phenyl acetate | FL/FR |
| butyl phenyl acetate | FL/FR |
| ethyl phenyl acetate | FL/FR |
| phenethyl acetate | FL/FR |
| phenethyl isobutyrate | FL/FR |
jammy |
| maltyl isobutyrate | FL/FR |
leafy |
(E)- | citronellyl tiglate | FL/FR |
| methyl butyl phenyl acetate | FL/FR |
licorice |
sweet | basil oleoresin | FL/FR |
melon |
| propyl 2,4-decadienoate | FL/FR |
oily |
iso | phytol | FL/FR |
phenolic |
| guaiacyl phenyl acetate | FL/FR |
spicy |
alpha- | amyl cinnamyl alcohol | FL/FR |
para- | anisyl formate | FL/FR |
| benzyl cinnamate | FL/FR |
| cassia bark oil china | FL/FR |
| cassie absolute | FL/FR |
| cinnamyl formate | FL/FR |
| cubeb oil | FL/FR |
(-)- | cubenol | FL/FR |
iso | eugenol | FL/FR |
iso | eugenyl acetate | FL/FR |
| myrtle oil | FL/FR |
| pimenta acris leaf oil | FL/FR |
| spicy acetoacetate | FL/FR |
sulfurous |
| buchu mercaptan | FL/FR |
| methyl 2-(methyl thio) butyrate | FL |
| methyl thiomethyl butyrate | FL |
sweet |
| vanilla bean absolute (vanilla planifolia) | FL/FR |
tropical |
3- | mercaptohexyl acetate | FL/FR |
| passiflora acetate | FL/FR |
waxy |
| butyl undecylenate | FL/FR |
para- | cresyl laurate | FL/FR |
| decanol | FL/FR |
| ethyl laurate | FL/FR |
| geranyl propionate | FL/FR |
alpha- | hexyl cinnamaldehyde | FL/FR |
| hydroxycitronellal | FL/FR |
| hydroxycitronellal dimethyl acetal | FL/FR |
alpha- | methyl ionone | FL/FR |
| phenethyl hexanoate | FL/FR |
| phenoxyethyl propionate | FL/FR |
4- | phenyl-3-buten-2-ol | FL/FR |
winey |
iso | amyl nonanoate | FL/FR |
woody |
| amyris wood oil | FL/FR |
| guaiacwood oil | FL/FR |
| methyl cedryl ketone | FL/FR |
| methyl ionyl acetate | FL/FR |
| vetiver oil haiti | FL/FR |
|
Potential Uses:
Occurrence (nature, food, other): note
Synonyms:
| amyl cinnamal | | amyl cinnamaldehyde | 2- | amyl cinnamaldehyde | alpha- | amyl cinnamaldehyde natural | | amyl cinnamic acid aldehyde | | amyl cinnamic aldehyde | alpha- | amyl cinnamic aldehyde | | amyl cinnamic aldehyde alpha | | amyl cinnamic aldehyde natural | a- | amyl cinnamic aldehyde | | amyl cinnamic aldehyde, natural | alpha- | amyl-beta-phenyl acrolein | a- | amylcinnamaldehyde | alpha- | amylcinnamaldehyde | alpha- | amylcinnamic aldehyde | 2- | benzylidene heptanal | 2- | benzylideneheptanal | | buxine | | flomine | | flosal | | floxine | | heptanal, 2-(phenylmethylene)- | | jasmin aldehyde | | jasminal | | jasminaldehyde | | jasmine aldehyde | | jasmona | 2- | pentyl cinnamaldehyde | alpha- | pentyl cinnamaldehyde | alpha- | pentyl-beta-phenyl acrolein | a- | pentylcinnamaldehyde | alpha- | pentylcinnamaldehyde | 2-( | phenyl methylene) heptanal |
Articles:
|