| habanero distillates | |
| Use(s): flavoring agents | |
| haberlea rhodopensis leaf extract | |
| Use(s): cosmetic ingredient for skin conditioning | |
| habuba fragrance | |
| Use(s): fragranced products of all types | |
| haematococcus algae meal | |
| CAS: 977176-72-9 Use(s): coloring agents | |
| haematococcus pluvialis extract | |
| Use(s): antioxidants | |
| haematococcus pluvialis oil | |
| Use(s): antioxidants, skin conditioning | |
| haematococcus pluvialis powder | |
| Use(s): antioxidants | |
| haematoxylon brasiletto wood extract | |
| Use(s): astringent, skin protecting | |
| haematoxylon campechianum powder | |
| CAS: 8005-33-2 Use(s): antimicrobial, astringent agents | |
| haematoxylum campechianum wood | |
| CAS: 8005-33-2 Use(s): information only not used for fragrances or flavors | |
| haematoxylum campechianum wood extract | |
| CAS: 8005-33-2 Use(s): antimicrobial, astringent agents | |
| hair care fragrance | |
| Use(s): fragranced products of all types | |
| hair extract | |
| Use(s): cosmetic agents | |
| halauxifen | |
| CAS: 943832-60-8 Use(s): herbicides / pesticides | |
| halauxifen-methyl | |
| CAS: 943831-98-9 Use(s): herbicides / pesticides | |
| halazuchrome B | |
| CAS: 18296-44-1 Use(s): natural substances and extractives | |
| halidrys siliquosa extract | |
| Use(s): cosmetic ingredient for skin conditioning | |
| halimeda bikiniensis callus culture extract | |
| Use(s): cosmetic ingredient for skin conditioning | |
| halimeda opuntia extract | |
| Use(s): emollients | |
| haliptilon attenuatum callus culture extract | |
| Use(s): cosmetic ingredient for skin conditioning | |
| halobacterium ferment lysate extract | |
| Use(s): film forming, skin conditioning agents | |
| halopteris scoparia extract | |
| Use(s): cosmetic ingredient for skin conditioning | |
| haloxyfop-P | |
| CAS: 95977-29-0 Use(s): herbicides / pesticides | |
| ham enhancers | |
| Use(s): flavor enhancers | |
| ham flavor | |
| Use(s): flavored products of all types | |
| hamamelis virginiana bark | |
| CAS: 84696-19-5 Use(s): information only not used for fragrances or flavors | |
| hamamelis virginiana bark tincture | |
| CAS: 84696-19-5 Use(s): information only not used for fragrances or flavors | |
| hamamelis virginiana bark/leaf extract | |
| CAS: 84696-19-5 Use(s): astringent, skin conditioning | |
| hamamelis virginiana bark/leaf/twig extract | |
| CAS: 84696-19-5 Use(s): cosmetic ingredient for skin conditioning | |
| hamamelis virginiana bark/twig extract | |
| CAS: 84696-19-5 Use(s): astringent, skin conditioning | |
| hamamelis virginiana flower water | |
| CAS: 84696-19-5 Use(s): cosmetic agents | |
| hamamelis virginiana leaf | |
| CAS: 84696-19-5 Use(s): information only not used for fragrances or flavors | |
| hamamelis virginiana leaf extract | |
| CAS: 84696-19-5 Use(s): cosmetic and fragrance agents | |
| hamamelis virginiana leaf tincture | |
| CAS: 84696-19-5 Use(s): information only not used for fragrances or flavors | |
| hamamelis virginiana leaf water | |
| CAS: 84696-19-5 Use(s): astringent, skin conditioning | |
| hamamelis virginiana water | |
| CAS: 84696-19-5 Use(s): cosmetic agents | |
| hamamelitannin | |
| CAS: 469-32-9 Use(s): natural substances and extractives | |
| hamburger flavor | |
| Use(s): flavored products of all types | |
| hancornia specialty | |
| Use(s): fragrance agents | |
| haplopappus baylahuen extract | |
| CAS: 91723-41-0 Use(s): information only not used for fragrances or flavors | |
| harissa flavor | |
| Use(s): flavored products of all types | |
| harmaline | |
| CAS: 304-21-2 Use(s): natural substances and extractives | |
| harmaline hydrochloride dihydrate | |
| CAS: 6027-98-1 Use(s): natural substances and extractives | |
| harmalol | |
| CAS: 525-57-5 Use(s): natural substances and extractives | |
| harmalol hydrochloride | |
| CAS: 6028-07-5 Use(s): information only not used for fragrances or flavors | |
| harman | |
| CAS: 486-84-0 Use(s): pharmaceuticals / chemical synthisis | |
| nor | harman |
| CAS: 244-63-3 Use(s): information only not used for fragrances or flavors | |
| harman hydrochloride | |
| CAS: 21655-84-5 Use(s): pharmaceuticals / chemical synthisis | |
| harmine | |
| CAS: 442-51-3 Use(s): natural substances and extractives | |
| harmine hydrochloride hydrate | |
| CAS: 343-27-1 Use(s): pharmaceuticals / chemical synthisis | |
| harmol | |
| CAS: 487-03-6 Use(s): natural substances and extractives | |
| harmol hydrochloride | |
| CAS: 40580-83-4 Use(s): pharmaceuticals / chemical synthisis | |
| harpagide | |
| CAS: 6926-08-5 Use(s): natural substances and extractives | |
| harpagophytum procumbens root | |
| CAS: 84988-65-8 Use(s): information only not used for fragrances or flavors | |
| harpagophytum procumbens root extract | |
| CAS: 84988-65-8 Use(s): cosmetic ingredient for skin conditioning | |
| harpagophytum procumbens root tincture | |
| CAS: 84988-65-8 Use(s): information only not used for fragrances or flavors | |
| harpagoside | |
| CAS: 19210-12-9 Use(s): natural substances and extractives | |
| harungana madagascariensis extract | |
| CAS: 90045-51-5 Use(s): cosmetic ingredient for skin conditioning | |
| haslea ostrearia extract | |
| Use(s): cosmetic ingredient for skin conditioning | |
| hastatoside | |
| CAS: 50816-24-5 Use(s): natural substances and extractives | |
| hawthorn acetate | |
| CAS: 7306-12-9 Use(s): fragrance agents | |
| hawthorn carbinol | |
| CAS: 536-50-5 FEMA: 3139 JECFA: 805 FLAVIS: 02.080 Use(s): flavor and fragrance agents | |
| (R)- | hawthorn carbinol |
| CAS: 42070-92-8 Use(s): information only not used for fragrances or flavors | |
| (S)- | hawthorn carbinol |
| CAS: 51154-54-2 Use(s): information only not used for fragrances or flavors | |
| hawthorn ethanol | |
| CAS: 1875-89-4 Use(s): fragrance agents | |
| hawthorn fragrance | |
| Use(s): fragranced products of all types | |
| hawthorn specialty | |
| Use(s): fragrance agents | |
| hay absolute | |
| CAS: 8031-00-3 Use(s): fragrance agents | |
| hay concrete | |
| CAS: 8031-00-3 Use(s): fragrance agents | |
| hay distillates | |
| Use(s): flavored products of all types | |
| hay flower extract | |
| CAS: 90063-63-1 Use(s): cosmetic and fragrance agents | |
| hay leaf oil | |
| CAS: 90063-63-1 Use(s): fragrance agents | |
| hay oil | |
| CAS: 8031-00-3 Use(s): cosmetic and fragrance agents | |
| hay water | |
| CAS: 100209-32-3 Use(s): masking agents | |
| hayflower extract | |
| CAS: 100209-32-3 Use(s): cosmetic ingredient for skin conditioning | |
| hazel seed oil decyl esters | |
| Use(s): cosmetic ingredient for skin conditioning | |
| hazel seed oil peg-8 esters | |
| Use(s): cosmetic ingredient for skin conditioning | |
| hazel seed oil polyglyceryl-6 esters | |
| Use(s): cosmetic ingredient for skin conditioning | |
| european | hazelnut absolute |
| CAS: 84012-21-5 Use(s): flavor and fragrance agents | |
| hazelnut belgium café flavor | |
| Use(s): flavored products of all types | |
| hazelnut cappuccino flavor | |
| Use(s): flavored products of all types | |
| hazelnut coffee fragrance | |
| Use(s): fragranced products of all types | |
| hazelnut cream flavor | |
| Use(s): flavored products of all types | |
| toasted | hazelnut cream flavor |
| Use(s): flavored products of all types | |
| hazelnut cream fragrance | |
| Use(s): fragranced products of all types | |
| european | hazelnut distillates |
| Use(s): flavoring agents | |
| hazelnut flavor | |
| Use(s): flavored products of all types | |
| hazelnut fragrance | |
| Use(s): fragranced products of all types | |
| roasted | hazelnut infusions |
| Use(s): flavor and fragrance agents | |
| european | hazelnut oil |
| CAS: 185630-72-2 Use(s): cosmetic agents | |
| hydrogenated | hazelnut oil |
| Use(s): emollients, hair conditioning, skin conditioning | |
| european | hazelnut oil CO2 extract |
| CAS: 185630-72-2 Use(s): flavor and fragrance agents | |
| european | hazelnut oleoresin |
| CAS: 84012-21-5 Use(s): flavoring agents and adjuvants | |
| hazelnut paste | |
| Use(s): flavoring agents, food additives | |
| hazelnut praline flavor | |
| Use(s): flavored products of all types | |
| hazelnut pyrazine | |
| CAS: 18138-04-0 FEMA: 3336 JECFA: 777 FLAVIS: 14.056 Use(s): flavor and fragrance agents | |
| hazelnut vanilla flavor | |
| Use(s): flavored products of all types | |
| HC blue no. 18 | |
| CAS: 852356-91-3 Use(s): hair dyeing agents | |
| HC blue no. 2 | |
| CAS: 33229-34-4 Use(s): hair dyeing agents | |
| HC blue no. 7 | |
| CAS: 83732-72-3 Use(s): hair dyeing agents | |
| HC orange no. 1 | |
| CAS: 54381-08-7 Use(s): hair dyeing agents | |
| HC orange no. 2 | |
| CAS: 85765-48-6 Use(s): hair dyeing agents | |
| HC orange no. 5 | |
| CAS: 97404-13-2 Use(s): hair dyeing agents | |
| HC red no 16 | |
| CAS: 160219-76-1 Use(s): hair dyeing agents | |
| HC red no. 1 | |
| CAS: 2784-89-6 Use(s): hair dyeing agents | |
| HC red no. 10 | |
| CAS: 95576-89-9 Use(s): hair dyeing agents | |
| HC red no. 11 | |
| CAS: 95576-92-4 Use(s): hair dyeing agents | |
| HC red no. 13 | |
| CAS: 94158-13-1 Use(s): hair dyeing agents | |
| HC red no. 14 | |
| Use(s): hair dyeing agents | |
| HC red no. 18 | |
| Use(s): hair dyeing agents | |
| HC red no. 15 | |
| CAS: 90648-73-0 Use(s): hair dyeing agents | |
| HC red no. 3 | |
| CAS: 2871-01-4 Use(s): hair dyeing agents | |
| HC red no. 7 | |
| CAS: 24905-87-1 Use(s): hair dyeing agents | |
| HC violet no. 1 | |
| CAS: 82576-75-8 Use(s): hair dyeing agents | |
| HC violet no. 2 | |
| CAS: 104226-19-9 Use(s): hair dyeing agents | |
| HC yellow no 13 | |
| CAS: 10442-83-8 Use(s): hair dyeing agents | |
| HC yellow no 2 | |
| CAS: 4926-55-0 Use(s): hair dyeing agents | |
| HC yellow no 4 | |
| CAS: 59820-43-8 Use(s): hair dyeing agents | |
| HC yellow no. 10 | |
| CAS: 109023-83-8 Use(s): hair dyeing agents | |
| HC yellow no. 14 | |
| CAS: 90349-40-9 Use(s): hair dyeing agents | |
| HC yellow no. 15 | |
| CAS: 138377-66-9 Use(s): hair dyeing agents | |
| HC yellow no. 16 | |
| CAS: 1184721-10-5 Use(s): hair dyeing agents | |
| HC yellow no. 7 | |
| CAS: 104226-21-3 Use(s): hair dyeing agents | |
| HC yellow no. 9 | |
| CAS: 86419-69-4 Use(s): hair dyeing agents | |
| HDI/di-C12-14 alkyl tartrate/hydrogenated dilinoleyl alcohol copolymer | |
| CAS: 1268856-56-9 Use(s): film forming agents | |
| HDI/PEI-45/SMDI crosspolymer | |
| Use(s): absorbents | |
| HDI/ppg/polycaprolactone crosspolymer | |
| CAS: 302791-95-3 Use(s): anticaking agents | |
| HDI/trimethylol hexyllactone crosspolymer | |
| Use(s): anticaking agents | |
| bis- | HEA poly(1,4-butanediol)-9/IPDI copolymer |
| Use(s): cosmetic agents | |
| bis- | HEA polydiethyleneglycol adipate/IPDI copolymer |
| Use(s): cosmetic agents | |
| heart extract | |
| CAS: 84540-00-1 Use(s): cosmetic ingredient for skin conditioning | |
| heart hydrolysate | |
| CAS: 91079-92-4 Use(s): cosmetic ingredient for hair conditioning | |
| heath bar flavor | |
| Use(s): flavored products of all types | |
| heather absolute | |
| Use(s): fragrance agents | |
| heather fragrance | |
| Use(s): fragranced products of all types | |
| hedeoma pulegioides herb extract america | |
| CAS: 90045-53-7 Use(s): fragrance agents | |
| hedera helix distillates | |
| Use(s): cosmetic agents | |
| hedera helix extract | |
| CAS: 84082-54-2 Use(s): cosmetic agents | |
| hedera helix leaf | |
| CAS: 84082-54-2 Use(s): information only not used for fragrances or flavors | |
| hedera helix leaf extract | |
| CAS: 84082-54-2 Use(s): cosmetic ingredient for skin conditioning | |
| hedera helix leaf water | |
| CAS: 84082-54-2 Use(s): cosmetic ingredient for skin conditioning | |
| hedera helix leaf/stem | |
| CAS: 84082-54-2 Use(s): anticaking, antimicrobial agents | |
| hedera helix leaf/stem extract | |
| CAS: 84082-54-2 Use(s): cosmetic agents | |
| hedera helix stem extract | |
| CAS: 84082-54-2 Use(s): antidandruff agents | |
| hederagenin | |
| CAS: 465-99-6 Use(s): pharmaceuticals / chemical synthisis | |
| alpha- | hederin hydrate |
| CAS: 27013-91-8 Use(s): natural substances and extractives | |
| hedycaryol | |
| CAS: 21657-90-9 Use(s): natural substances and extractives | |
| hedychium coronarium flower/leaf/stem extract | |
| CAS: 94334-08-4 Use(s): cosmetic ingredient for skin conditioning | |
| hedychium coronarium koenig root extract | |
| CAS: 94334-08-4 Use(s): cosmetic agents | |
| hedychium flavescens root extract | |
| CAS: 94334-08-4 Use(s): emollients | |
| hedychium spicatum extract | |
| CAS: 93455-95-9 Use(s): cosmetic ingredient for skin conditioning | |
| hedychium spicatum flower absolute | |
| CAS: 93455-95-9 Use(s): fragrance agents | |
| hedychium spicatum herb | |
| CAS: 93455-95-9 Use(s): information only not used for fragrances or flavors | |
| hedychium spicatum powder | |
| Use(s): cosmetic ingredient for skin conditioning | |
| hedychium spicatum root oil | |
| CAS: 93455-95-9 Use(s): fragrance agents | |
| hedysarum alhagi leaf/stem extract | |
| Use(s): cosmetic ingredient for skin conditioning | |
| heilmoor clay | |
| Use(s): cosmetic ingredient for skin conditioning | |
| heimia salicifolia leaf | |
| Use(s): information only not used for fragrances or flavors | |
| helenalin | |
| CAS: 6754-13-8 Use(s): natural substances and extractives | |
| heleniamarin | |
| CAS: 66607-74-7 Use(s): natural substances and extractives | |
| heliangin | |
| CAS: 13323-48-3 Use(s): natural substances and extractives | |
| heliangolide | |
| CAS: 65556-51-6 Use(s): natural substances and extractives | |
| heliannone A | |
| CAS: 193411-10-8 Use(s): natural substances and extractives | |
| heliannuol A | |
| CAS: 148054-17-5 Use(s): natural substances and extractives | |
| heliannuol B | |
| CAS: 161730-07-0 Use(s): natural substances and extractives | |
| heliannuol C | |
| CAS: 161730-08-1 Use(s): natural substances and extractives | |
| heliannuol D | |
| CAS: 161730-09-2 Use(s): natural substances and extractives | |
| heliannuol E | |
| CAS: 241139-49-1 Use(s): natural substances and extractives | |
| helianol | |
| CAS: 178330-51-3 Use(s): natural substances and extractives | |
| iso | helianol |
| CAS: 203570-12-1 Use(s): natural substances and extractives | |
| helianthoside A | |
| CAS: 139164-70-8 Use(s): natural substances and extractives | |
| helianthoside B | |
| CAS: 29108-67-6 Use(s): natural substances and extractives | |
| helianthoside C | |
| CAS: 25503-42-8 Use(s): natural substances and extractives | |
| helianthus annuus extract | |
| CAS: 84776-03-4 Use(s): emollients, skin conditioning | |
| helianthus annuus flower | |
| CAS: 84776-03-4 Use(s): information only not used for fragrances or flavors | |
| helianthus annuus flower extract | |
| CAS: 84776-03-4 Use(s): cosmetic ingredient for skin conditioning | |
| helianthus annuus hybrid oil | |
| CAS: 164250-88-8 Use(s): emollients | |
| helianthus annuus seed butter | |
| CAS: 84776-03-4 Use(s): emollients, skin conditioning | |
| helianthus annuus seed cera | |
| CAS: 68937-99-5 Use(s): emollients | |
| helianthus annuus seed extract | |
| CAS: 84776-03-4 Use(s): cosmetic ingredient for skin conditioning | |
| helianthus annuus seed flour | |
| CAS: 8001-21-6 Use(s): abrasives, absorbents | |
| ground | helianthus annuus seed hulls |
| CAS: 68937-99-5 Use(s): indirect food additives: adhesives and components of coatings | |
| helianthus annuus seed oil unsaponifiables | |
| CAS: 8001-21-6 Use(s): emollients | |
| helianthus annuus seedcake | |
| CAS: 68937-99-5 Use(s): abrasives, bulking agents | |
| helianthus annuus sprout extract | |
| CAS: 84776-03-4 Use(s): cosmetic ingredient for skin conditioning | |
| helianthus tuberosus extract | |
| CAS: 90045-97-9 Use(s): cosmetic ingredient for skin conditioning | |
| helianthus tuberosus root extract | |
| CAS: 90045-97-9 Use(s): cosmetic ingredient for skin conditioning | |
| helianthus tuberosus root juice | |
| CAS: 90045-97-9 Use(s): food additive | |
| helianthus tuberosus root juice concentrate | |
| CAS: 90045-97-9 Use(s): food additive | |
| helianthus tuberosus root powder | |
| CAS: 90045-97-9 Use(s): food additive | |
| helianthus tuberosus root puree | |
| CAS: 90045-97-9 Use(s): food additive | |
| heliantriol A1 | |
| CAS: 26540-64-7 Use(s): natural substances and extractives | |
| heliantriol B1 | |
| CAS: 74715-48-3 Use(s): natural substances and extractives | |
| heliantriol B2 | |
| CAS: 61229-18-3 Use(s): natural substances and extractives | |
| heliantriol C | |
| CAS: 71876-60-3 Use(s): natural substances and extractives | |
| heliantriol F | |
| CAS: 71876-59-0 Use(s): natural substances and extractives | |
| helianyl octanoate | |
| CAS: 290305-83-8 Use(s): natural substances and extractives | |
| helichrysetin | |
| CAS: 62014-87-3 Use(s): natural substances and extractives | |
| helichrysoside | |
| CAS: 56343-26-1 Use(s): natural substances and extractives | |
| helichrysum angustifolium cera | |
| CAS: 90045-56-0 Use(s): emollients, skin conditioning | |
| helichrysum arenarium extract | |
| CAS: 85665-35-6 Use(s): cosmetic and fragrance agents | |
| helichrysum arenarium flower extract | |
| CAS: 85665-35-6 Use(s): cosmetic ingredient for skin conditioning | |
| helichrysum arenarium l. moench oil hungary | |
| Use(s): information only not used for fragrances or flavors | |
| helichrysum bracteatum flower oil | |
| Use(s): fragrance agents | |
| helichrysum faradifani oil | |
| Use(s): fragrance agents | |
| helichrysum gymnocephalum flower oil | |
| Use(s): cosmetic agents | |
| helichrysum italicum | |
| Use(s): spices, other natural seasonings and flavorings | |
| helichrysum italicum extract | |
| CAS: 90045-56-0 Use(s): antiseborrhoeic agents | |
| helichrysum italicum flower absolute | |
| CAS: 90045-56-0 FEMA: 2592 Use(s): flavor and fragrance agents | |
| helichrysum italicum flower extract | |
| CAS: 90045-56-0 FEMA: 2592 Use(s): flavor and fragrance agents | |
| helichrysum italicum flower water | |
| CAS: 90045-56-0 Use(s): cosmetic, flavor and fragrance agents | |
| helichrysum italicum leaf cell extract | |
| CAS: 90045-56-0 Use(s): absorbents | |
| helichrysum kilimanjari extract | |
| CAS: 92457-09-5 Use(s): information only not used for fragrances or flavors | |
| helichrysum odoratissimum | |
| Use(s): information only not used for fragrances or flavors | |
| helichrysum odoratissimum flower oil | |
| Use(s): fragrance agents | |
| helichrysum saxatile extract | |
| CAS: 92457-10-8 Use(s): information only not used for fragrances or flavors | |
| helichrysum stoechas extract | |
| CAS: 91845-22-6 Use(s): tonic agents | |
| helichrysum stoechas flower absolute | |
| CAS: 91845-22-6 Use(s): fragrance agents | |
| helichrysum stoechas flower extract | |
| CAS: 91845-22-6 Use(s): cosmetic and fragrance agents | |
| helichrysum stoechas flower oil | |
| CAS: 91845-22-6 Use(s): fragrance agents | |
| helicide | |
| CAS: 80154-34-3 Use(s): information only not used for fragrances or flavors | |
| helicin | |
| CAS: 618-65-5 Use(s): natural substances and extractives | |
| heliconia rostrata leaf extract | |
| Use(s): humectants | |
| heliespirone A | |
| CAS: 202533-71-9 Use(s): natural substances and extractives | |
| heliopsis longipes extract | |
| CAS: 792933-14-3 FEMA: 4220 Use(s): flavoring agents and adjuvants | |
| heliopsis longipes root powder | |
| Use(s): antimicrobial agents | |
| heliotric acid | |
| CAS: 25039-18-3 Use(s): natural substances and extractives | |
| heliotrine | |
| CAS: 303-33-3 Use(s): natural substances and extractives | |
| heliotrine-N-oxide | |
| CAS: 6209-65-0 Use(s): natural substances and extractives | |
| heliotrope absolute | |
| Use(s): fragrance agents | |
| heliotrope fragrance | |
| Use(s): fragranced products of all types | |
| heliotrope specialty | |
| Use(s): fragrance agents | |
| heliotropic acid | |
| CAS: 94-53-1 Use(s): natural substances and extractives | |
| heliotropin | |
| CAS: 120-57-0 FEMA: 2911 JECFA: 896 FLAVIS: 05.016 Use(s): cosmetic, flavor and fragrance agents | |
| heliotropin replacer | |
| Use(s): fragrance agents | |
| heliotropium europaeum extract | |
| CAS: 90045-57-1 Use(s): information only not used for fragrances or flavors | |
| heliotropium peruvianum extract | |
| CAS: 90045-58-2 Use(s): information only not used for fragrances or flavors | |
| heliotropyl acetate | |
| CAS: 326-61-4 FEMA: 2912 JECFA: 894 FLAVIS: 09.220 Use(s): flavor and fragrance agents | |
| heliotropyl acetone | |
| CAS: 55418-52-5 FEMA: 2701 JECFA: 2048 FLAVIS: 07.031 Use(s): flavor and fragrance agents | |
| heliotropyl alcohol | |
| CAS: 495-76-1 FLAVIS: 02.205 Use(s): flavor and fragrance agents | |
| heliotropyl butane-2,3-diol acetal | |
| CAS: 6412-69-7 Use(s): information only not used for fragrances or flavors | |
| heliotropyl butyrate | |
| CAS: 6890-27-3 Use(s): information only not used for fragrances or flavors | |
| heliotropyl isobutyrate | |
| CAS: 5461-08-5 FEMA: 2913 JECFA: 895 FLAVIS: 09.430 Use(s): flavor and fragrance agents | |
| heliotropyl diethyl acetal | |
| CAS: 40527-42-2 Use(s): fragrance agents | |
| heliotropyl dimethyl acetal | |
| CAS: 59259-90-4 Use(s): fragrance agents | |
| heliotropyl formate | |
| CAS: 85262-96-0 Use(s): information only not used for fragrances or flavors | |
| heliotropyl 2-methyl butyrate | |
| CAS: 84604-43-3 Use(s): information only not used for fragrances or flavors | |
| heliotropyl phenyl acetate | |
| CAS: 5457-86-3 Use(s): information only not used for fragrances or flavors | |
| heliotropyl pivalate | |
| CAS: 6471-96-1 Use(s): information only not used for fragrances or flavors | |
| heliotropyl propionate | |
| CAS: 6890-26-2 Use(s): information only not used for fragrances or flavors | |
| heliotropyl propylene glycol acetal | |
| CAS: 61683-99-6 FEMA: 4622 Use(s): flavor and fragrance agents | |
| heliotropyl isovalerate | |
| CAS: 84604-42-2 Use(s): information only not used for fragrances or flavors | |
| helipyrone | |
| CAS: 29902-01-0 Use(s): natural substances and extractives | |
| helium | |
| CAS: 7440-59-7 Use(s): processing aids | |
| helminthogermacrene | |
| CAS: 75023-40-4 Use(s): natural substances and extractives | |
| helveticoside | |
| CAS: 630-64-8 Use(s): natural substances and extractives | |
| helychrysum arenarium extract | |
| CAS: 85665-35-6 Use(s): information only not used for fragrances or flavors | |
| hematein | |
| CAS: 475-25-2 Use(s): coloring agents | |
| hematite extract | |
| Use(s): cosmetic ingredient for skin protecting | |
| hematite powder | |
| CAS: 1317-60-8 Use(s): coloring agents (for surface only) | |
| hematoxylin, certified (c.i. 75290) | |
| CAS: 517-28-2 Use(s): information only not used for fragrances or flavors | |
| hemerocallis fulva extract | |
| Use(s): cosmetic ingredient for skin conditioning | |
| hemerocallis fulva flower extract | |
| Use(s): cosmetic ingredient for skin conditioning | |
| hemiariensin | |
| CAS: 112448-60-9 Use(s): natural substances and extractives | |
| hemicellulase from aspergillus niger | |
| CAS: 9025-56-3 Use(s): enzyme preparations and microorganisms | |
| hemidesmus indicus root extract | |
| CAS: 90045-62-8 Use(s): cosmetic ingredient for skin conditioning | |
| hemidesmus indicus root oil CO2 extract | |
| CAS: 90045-62-8 Use(s): fragrance agents | |
| hemidesmus indicus root powder | |
| CAS: 90045-62-8 Use(s): cosmetic ingredient for skin conditioning | |
| hemimellitene | |
| CAS: 526-73-8 Use(s): natural substances and extractives | |
| hemistepa lyrata extract | |
| Use(s): humectants, skin conditioning, skin protecting | |
| hemizonia corymbosa extract | |
| Use(s): cosmetic agents | |
| hemlock needle and twig oil | |
| CAS: 8008-10-4 Use(s): flavor and fragrance agents | |
| hemlock needles and twigs | |
| CAS: 977074-62-6 Use(s): spices, other natural seasonings and flavorings | |
| hemlock western oil (tsuga heterophylla) canada | |
| CAS: 92347-09-6 Use(s): fragrance agents | |
| hemolymph extract | |
| Use(s): cosmetic ingredient for skin conditioning | |
| hydrolyzed | hemp seed extract |
| Use(s): cosmetic ingredient for skin and hair conditioning | |
| hydrogenated | hemp seed oil |
| Use(s): emollients, skin conditioning | |
| hydrolyzed | hemp seed protein |
| Use(s): cosmetic ingredient for skin and hair conditioning | |
| hydrolyzed | hemp seed protein hydroxypropyltrimonium chloride |
| Use(s): emollients, film forming | |
| iso | heneicosane |
| CAS: 52845-08-6 Use(s): information only not used for fragrances or flavors | |
| heneicosanol | |
| CAS: 51227-32-8 Use(s): natural substances and extractives | |
| 11- | heneicosanol |
| CAS: 3381-26-8 Use(s): information only not used for fragrances or flavors | |
| (Z)-6- | heneicosen-11-one |
| CAS: 54844-65-4 Use(s): information only not used for fragrances or flavors | |
| (Z)-7- | heneicosene |
| CAS: 121230-25-9 Use(s): natural substances and extractives | |
| (Z)-9- | heneicosene |
| CAS: 39836-21-0 Use(s): natural substances and extractives | |
| heneicosyl cyclopentane | |
| CAS: 6703-82-8 Use(s): natural substances and extractives | |
| 5- | heneicosyl-1,3-benzenediol |
| CAS: 70110-59-7 Use(s): natural substances and extractives | |
| henicosane | |
| CAS: 629-94-7 Use(s): fragrance agents | |
| henicosanoic acid | |
| CAS: 2363-71-5 Use(s): natural substances and extractives | |
| henicosene | |
| CAS: 27400-79-9 Use(s): natural substances and extractives | |
| hentriacontane | |
| CAS: 630-04-6 Use(s): natural substances and extractives | |
| hentriacontane-14,16-dione | |
| CAS: 24724-84-3 Use(s): natural substances and extractives | |
| 16- | hentriacontanol |
| CAS: 1070-54-8 Use(s): natural substances and extractives | |
| 15- | hentriacontanol |
| CAS: 27759-56-4 Use(s): natural substances and extractives | |
| 9- | hentriacontanone |
| CAS: 34136-52-2 Use(s): natural substances and extractives | |
| 1- | hentriacontene |
| CAS: 18435-54-6 Use(s): natural substances and extractives | |
| heptacosane | |
| CAS: 593-49-7 Use(s): natural substances and extractives | |
| heptacosane dioic acid | |
| CAS: 5638-06-2 Use(s): natural substances and extractives | |
| 10,12- | heptacosanedione |
| CAS: 95605-27-9 Use(s): natural substances and extractives | |
| 1- | heptacosanol |
| CAS: 2004-39-9 Use(s): natural substances and extractives | |
| 14- | heptacosanol |
| CAS: 32116-10-2 Use(s): natural substances and extractives | |
| 2- | heptacosanone |
| CAS: 7796-19-2 Use(s): natural substances and extractives | |
| 1- | heptacosene |
| CAS: 15306-27-1 Use(s): natural substances and extractives | |
| (Z,Z)- | heptadeca-1,8,11-triene |
| CAS: 56134-03-3 Use(s): natural substances and extractives | |
| (Z,Z)-8,11- | heptadecadienal |
| CAS: 56797-42-3 Use(s): natural substances and extractives | |
| heptadecadiene | |
| CAS: 54264-04-9 Use(s): natural substances and extractives | |
| 1,8- | heptadecadiene-4,6-diyne-3,10-diol |
| CAS: 63910-76-9 Use(s): natural substances and extractives | |
| heptadecanal | |
| CAS: 629-90-3 Use(s): natural substances and extractives | |
| heptadecane | |
| CAS: 629-78-7 FLAVIS: 01.075 Use(s): fragrance agents | |
| 1,17- | heptadecanediol |
| CAS: 66577-59-1 Use(s): natural substances and extractives | |
| 2,4- | heptadecanedione |
| CAS: 64042-18-8 Use(s): natural substances and extractives | |
| heptadecanoic acid | |
| CAS: 506-12-7 Use(s): natural substances and extractives | |
| 1- | heptadecanol |
| CAS: 1454-85-9 FLAVIS: 02.154 Use(s): natural substances and extractives | |
| 2- | heptadecanol |
| CAS: 16813-18-6 Use(s): natural substances and extractives | |
| 3- | heptadecanol |
| CAS: 84534-30-5 Use(s): natural substances and extractives | |
| 4- | heptadecanol |
| CAS: 103385-34-8 Use(s): information only not used for fragrances or flavors | |
| 6- | heptadecanol |
| CAS: 112283-13-3 Use(s): information only not used for fragrances or flavors | |
| 7- | heptadecanol |
| CAS: 93658-33-4 Use(s): information only not used for fragrances or flavors | |
| 8- | heptadecanol |
| CAS: 2541-75-5 Use(s): natural substances and extractives | |
| 9- | heptadecanol |
| CAS: 624-08-8 Use(s): natural substances and extractives | |
| heptadecanolide | |
| CAS: 5637-97-8 Use(s): natural substances and extractives | |
| 2- | heptadecanone |
| CAS: 2922-51-2 FLAVIS: 07.160 Use(s): natural substances and extractives | |
| 3- | heptadecanone |
| CAS: 84534-29-2 Use(s): natural substances and extractives | |
| 4- | heptadecanone |
| CAS: 53685-77-1 Use(s): information only not used for fragrances or flavors | |
| 6- | heptadecanone |
| CAS: 22026-13-7 Use(s): information only not used for fragrances or flavors | |
| 7- | heptadecanone |
| CAS: 6064-42-2 Use(s): information only not used for fragrances or flavors | |
| 8- | heptadecanone |
| CAS: 14476-38-1 Use(s): information only not used for fragrances or flavors | |
| 9- | heptadecanone |
| CAS: 540-08-9 Use(s): natural substances and extractives | |
| (Z,Z,Z)-8,11,14- | heptadecatrienal |
| CAS: 56797-44-5 Use(s): natural substances and extractives | |
| (all-E)-1,7,9- | heptadecatriene-11,13,15-triyne |
| CAS: 41688-30-6 Use(s): natural substances and extractives | |
| (Z)-8- | heptadecenal |
| CAS: 56797-41-2 Use(s): natural substances and extractives | |
| 1- | heptadecene |
| CAS: 6765-39-5 Use(s): natural substances and extractives | |
| 5- | heptadecene |
| CAS: 138472-85-2 Use(s): natural substances and extractives | |
| 7- | heptadecene |
| CAS: 54290-12-9 Use(s): natural substances and extractives | |
| 8- | heptadecene |
| CAS: 2579-04-6 Use(s): natural substances and extractives | |
| (Z)-8- | heptadecene |
| CAS: 16369-12-3 Use(s): natural substances and extractives | |
| (Z)-8- | heptadecene dioic acid |
| CAS: 253687-28-4 Use(s): information only not used for fragrances or flavors | |
| 1- | heptadecene-4,6-diyne-3,9-diol |
| CAS: 77084-19-6 Use(s): natural substances and extractives | |
| (Z)-9- | heptadecenoic acid |
| CAS: 1981-50-6 Use(s): natural substances and extractives | |
| 5-(12- | heptadecenyl)-1,3-benzenediol |
| CAS: 103462-06-2 Use(s): natural substances and extractives | |
| 3-(10- | heptadecenyl)phenol |
| CAS: 111047-33-7 Use(s): natural substances and extractives | |
| heptadecyl acetate | |
| CAS: 822-20-8 Use(s): natural substances and extractives | |
| heptadecyl cyclohexane | |
| CAS: 19781-73-8 Use(s): natural substances and extractives | |
| 2- | heptadecylfuran |
| CAS: 208329-97-9 Use(s): natural substances and extractives | |
| 1- | heptadecyne |
| CAS: 26186-00-5 Use(s): natural substances and extractives | |
| 2,5- | heptadien-1-ol |
| CAS: 62237-90-5 Use(s): natural substances and extractives | |
| (E,E)-3,5- | heptadien-2-one |
| CAS: 18402-90-9 Use(s): natural substances and extractives | |
| 2,4- | heptadienal |
| CAS: 5910-85-0 Use(s): flavoring agents | |
| (E,E)-2,4- | heptadienal |
| CAS: 4313-03-5 FEMA: 3164 JECFA: 1179 FLAVIS: 05.084 Use(s): flavoring agents | |
| (E,Z)-2,4- | heptadienal |
| CAS: 4313-02-4 Use(s): natural substances and extractives | |
| (Z,E)-2,4- | heptadienal |
| CAS: 59121-26-5 Use(s): natural substances and extractives | |
| 1,5- | heptadiene |
| CAS: 1541-23-7 Use(s): natural substances and extractives | |
| (E,E)-2,4- | heptadiene |
| CAS: 628-72-8 Use(s): natural substances and extractives | |
| 1,5- | heptadiene-3,4-diol |
| CAS: 51945-98-3 Use(s): natural substances and extractives | |
| 2,4- | heptadienoic acid |
| CAS: 17175-86-9 Use(s): information only not used for fragrances or flavors | |
| (E,E)-2,4- | heptadienoic acid |
| CAS: 65518-46-9 Use(s): natural substances and extractives | |
| (E,Z)-2,4- | heptadienoic acid |
| CAS: 50915-66-7 Use(s): information only not used for fragrances or flavors | |
| (Z,E)-2,4- | heptadienoic acid |
| CAS: 600716-76-5 Use(s): information only not used for fragrances or flavors | |
| 2,6- | heptadienoic acid |
| CAS: 38867-17-3 Use(s): natural substances and extractives | |
| 1,6- | heptadien-4-ol |
| CAS: 2883-45-6 Use(s): natural substances and extractives | |
| 2,4- | heptadien-1-ol |
| CAS: 62488-55-5 Use(s): flavoring agents | |
| (E,E)-2,4- | heptadien-1-ol |
| CAS: 33467-79-7 FEMA: 4127 JECFA: 1784 FLAVIS: 02.153 Use(s): flavoring agents | |
| (E,Z)-2,4- | heptadien-1-ol |
| CAS: 70979-88-3 Use(s): natural substances and extractives | |
| (E,E)-2,5- | heptadien-1-ol |
| CAS: 66618-63-1 Use(s): information only not used for fragrances or flavors | |
| 3,5- | heptadienone |
| CAS: 3916-64-1 Use(s): information only not used for fragrances or flavors | |
| 2,3,3,4,4,5,5- | heptafluoro-1-pentene |
| CAS: 1547-26-8 Use(s): indirect food additives: adhesives and components of coatings | |
| delta- | heptalactone |
| CAS: 3301-90-4 FLAVIS: 10.045 Use(s): flavor and fragrance agents | |
| gamma- | heptalactone |
| CAS: 105-21-5 FEMA: 2539 JECFA: 225 FLAVIS: 10.020 Use(s): flavor and fragrance agents | |
| (R)-gamma- | heptalactone |
| CAS: 88270-38-6 Use(s): information only not used for fragrances or flavors | |
| (S)-gamma- | heptalactone |
| CAS: 31323-51-0 Use(s): information only not used for fragrances or flavors | |
| 1,3,3,4,5,6,7- | heptamethyl bicyclo(2.2.2)-5-octen-2-one |
| Use(s): information only not used for fragrances or flavors | |
| 1,3,3,4,5,6,8- | heptamethyl bicyclo(2.2.2)-5-octen-2-one |
| Use(s): information only not used for fragrances or flavors | |
| 1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol |
| CAS: 60362-71-2 Use(s): information only not used for fragrances or flavors | |
| 1,3,3,4,5,6,7- | heptamethyl(2.2.2)bicyclooct-5-en-2-ol |
| Use(s): information only not used for fragrances or flavors | |
| 1,3,3,4,5,6,8- | heptamethyl(2.2.2)bicyclooct-5-en-2-ol |
| Use(s): information only not used for fragrances or flavors | |
| heptanal (aldehyde C-7) | |
| CAS: 111-71-7 FEMA: 2540 JECFA: 95 FLAVIS: 05.031 Use(s): flavor and fragrance agents | |
| heptanal 2,3-butane diol acetal | |
| CAS: 6454-22-4 FEMA: 4048 JECFA: 1712 FLAVIS: 06.089 Use(s): flavoring agents | |
| heptanal butene-1,4-glycol acetal | |
| CAS: 61732-96-5 Use(s): information only not used for fragrances or flavors | |
| heptanal cyclic acetal with glycerol | |
| CAS: 72854-42-3 FEMA: 2542 FLAVIS: 06.029 Use(s): flavor and fragrance agents | |
| heptanal cyclic ethylene acetal | |
| CAS: 1708-34-5 Use(s): fragrance agents | |
| heptanal cyclic propylene acetal | |
| CAS: 4351-10-4 FEMA: 4368 JECFA: 1739 Use(s): flavor and fragrance agents | |
| heptanal cyclic trimethylene acetal | |
| CAS: 3080-69-1 Use(s): information only not used for fragrances or flavors | |
| heptanal diethyl acetal | |
| CAS: 688-82-4 FLAVIS: 06.021 Use(s): flavor and fragrance agents | |
| heptanal dimethyl acetal | |
| CAS: 10032-05-0 FEMA: 2541 JECFA: 947 FLAVIS: 06.028 Use(s): flavor and fragrance agents | |
| heptanal glyceryl acetal | |
| CAS: 1708-35-6 FEMA: 2542 JECFA: 912 Use(s): flavor and fragrance agents | |
| heptanal oligomeric reaction products with aniline | |
| CAS: 9003-50-3 Use(s): indirect food additives: polymers | |
| heptane | |
| CAS: 142-82-5 Use(s): extraction solvents | |
| 1,2- | heptane diol |
| CAS: 3710-31-4 Use(s): natural substances and extractives | |
| 2,3- | heptane dione |
| CAS: 96-04-8 FEMA: 2543 JECFA: 415 FLAVIS: 07.064 Use(s): flavor and fragrance agents | |
| 3,4- | heptane dione |
| CAS: 13706-89-3 Use(s): information only not used for fragrances or flavors | |
| heptane nitrile | |
| CAS: 629-08-3 Use(s): natural substances and extractives | |
| 2- | heptane thiol |
| CAS: 628-00-2 FEMA: 4128 JECFA: 1664 FLAVIS: 12.288 Use(s): flavoring agents | |
| heptanoic acid | |
| CAS: 111-14-8 FEMA: 3348 JECFA: 96 FLAVIS: 08.028 Use(s): flavor and fragrance agents | |
| heptanol | |
| CAS: 53535-33-4 Use(s): flavor and fragrance agents | |
| 1- | heptanol |
| CAS: 111-70-6 FEMA: 2548 JECFA: 94 FLAVIS: 02.021 Use(s): flavor and fragrance agents | |
| 2- | heptanol |
| CAS: 543-49-7 FEMA: 3288 JECFA: 284 FLAVIS: 02.045 Use(s): flavor and fragrance agents | |
| (R)-(-)-2- | heptanol |
| CAS: 6033-24-5 Use(s): flavor and fragrance agents | |
| (S)-(+)-2- | heptanol |
| CAS: 6033-23-4 Use(s): flavor and fragrance agents | |
| 3- | heptanol |
| CAS: 589-82-2 FEMA: 3547 JECFA: 286 FLAVIS: 02.044 Use(s): flavor and fragrance agents | |
| (R)-3- | heptanol |
| CAS: 62701-49-9 Use(s): information only not used for fragrances or flavors | |
| (S)-3- | heptanol |
| CAS: 26549-25-7 Use(s): information only not used for fragrances or flavors | |
| 4- | heptanol |
| CAS: 589-55-9 Use(s): information only not used for fragrances or flavors | |
| 2- | heptanone |
| CAS: 110-43-0 FEMA: 2544 JECFA: 283 FLAVIS: 07.002 Use(s): flavor and fragrance agents | |
| 3- | heptanone |
| CAS: 106-35-4 FEMA: 2545 JECFA: 285 FLAVIS: 07.003 Use(s): flavor and fragrance agents | |
| 4- | heptanone |
| CAS: 123-19-3 FEMA: 2546 JECFA: 287 FLAVIS: 07.058 Use(s): flavor and fragrance agents | |
| 2- | heptanoyl thiophene |
| CAS: 30711-40-1 Use(s): natural substances and extractives | |
| N-( | heptan-4-yl)benzo(D)(1,3)dioxole-5-carboxamide |
| CAS: 745047-51-2 FEMA: 4232 JECFA: 1767 FLAVIS: 16.098 Use(s): flavoring agents | |
| heptaphylline | |
| CAS: 17750-35-5 Use(s): natural substances and extractives | |
| alpha- | heptasaccharide |
| CAS: 76472-96-3 Use(s): natural substances and extractives | |
| heptatriacontane | |
| CAS: 7194-84-5 Use(s): natural substances and extractives | |
| heptelidic acid | |
| CAS: 57710-57-3 Use(s): natural substances and extractives | |
| (Z)-2- | hepten-1-yl acetate |
| CAS: 83540-70-9 Use(s): natural substances and extractives | |
| (E)-4- | hepten-2-yl salicylate |
| CAS: 873888-85-8 Use(s): fragrance agents | |
| (Z)-4- | hepten-2-yl salicylate |
| CAS: 873888-84-7 Use(s): fragrance agents | |
| 2- | heptenal |
| CAS: 2463-63-0 FLAVIS: 05.070 Use(s): flavor and fragrance agents | |
| (E)-2- | heptenal |
| CAS: 18829-55-5 FEMA: 3165 JECFA: 1360 FLAVIS: 05.150 Use(s): flavoring agents | |
| (Z)-2- | heptenal |
| CAS: 57266-86-1 Use(s): natural substances and extractives | |
| 3- | heptenal |
| CAS: 89896-73-1 Use(s): natural substances and extractives | |
| (E)-3- | heptenal |
| CAS: 21662-20-4 Use(s): natural substances and extractives | |
| (Z)-3- | heptenal |
| CAS: 21662-18-0 Use(s): natural substances and extractives | |
| 4- | heptenal |
| CAS: 62238-34-0 FEMA: 3289 Use(s): natural substances and extractives | |
| (E)-4- | heptenal |
| CAS: 929-22-6 FEMA: 3289 Use(s): natural substances and extractives | |
| (Z)-4- | heptenal diethyl acetal |
| CAS: 18492-65-4 FEMA: 3349 JECFA: 949 FLAVIS: 06.037 Use(s): flavor and fragrance agents | |
| (Z)-4- | heptenal |
| CAS: 6728-31-0 FEMA: 3289 JECFA: 320 FLAVIS: 05.085 Use(s): flavor and fragrance agents | |
| 4-oxo-2- | heptenal |
| CAS: 55764-42-6 Use(s): information only not used for fragrances or flavors | |
| 4- | heptenal diethyl acetal |
| CAS: 1192738-48-9 FEMA: 3349 JECFA: 949 FLAVIS: 06.037 Use(s): flavor and fragrance agents | |
| (E)-4- | heptenal diethyl acetal |
| CAS: 18492-66-5 JECFA: 949 FLAVIS: 06.037 Use(s): flavor and fragrance agents | |
| (E)- | heptene |
| CAS: 14686-14-7 Use(s): natural substances and extractives | |
| 2- | heptene |
| CAS: 592-77-8 Use(s): natural substances and extractives | |
| (E)-2- | heptene |
| CAS: 14686-13-6 Use(s): information only not used for fragrances or flavors | |
| (Z)-2- | heptene |
| CAS: 6443-92-1 Use(s): information only not used for fragrances or flavors | |
| 3- | heptene |
| CAS: 592-78-9 Use(s): natural substances and extractives | |
| 2- | heptenoic acid |
| CAS: 18999-28-5 FEMA: 3920 FLAVIS: 08.083 Use(s): flavoring agents | |
| (E)-2- | heptenoic acid |
| CAS: 10352-88-2 FEMA: 3920 JECFA: 1373 FLAVIS: 08.123 Use(s): flavoring agents | |
| (Z)-2- | heptenoic acid |
| CAS: 1577-31-7 Use(s): natural substances and extractives | |
| 3- | heptenoic acid |
| CAS: 29901-85-7 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | heptenoic acid |
| CAS: 28163-84-0 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | heptenoic acid |
| CAS: 68676-74-4 Use(s): natural substances and extractives | |
| 4- | heptenoic acid |
| CAS: 35194-37-7 Use(s): natural substances and extractives | |
| (E)-4- | heptenoic acid |
| CAS: 51193-78-3 Use(s): information only not used for fragrances or flavors | |
| (Z)-4- | heptenoic acid |
| CAS: 41653-95-6 Use(s): natural substances and extractives | |
| 6- | heptenoic acid |
| CAS: 1119-60-4 Use(s): information only not used for fragrances or flavors | |
| 1- | hepten-4-ol |
| CAS: 3521-91-3 Use(s): flavor and fragrance agents | |
| 2- | hepten-1-ol |
| CAS: 22104-77-4 Use(s): flavor and fragrance agents | |
| 2- | hepten-4-ol |
| CAS: 4798-59-8 Use(s): information only not used for fragrances or flavors | |
| (E)-2- | hepten-1-ol |
| CAS: 33467-76-4 FLAVIS: 02.151 Use(s): flavor and fragrance agents | |
| (Z)-2- | hepten-1-ol |
| CAS: 55454-22-3 Use(s): flavor and fragrance agents | |
| 3- | hepten-1-ol |
| CAS: 10606-47-0 FLAVIS: 02.152 Use(s): flavoring agents | |
| (E)-3- | hepten-1-ol |
| CAS: 2108-05-6 Use(s): flavoring agents | |
| (Z)-3- | hepten-1-ol |
| CAS: 1708-81-2 Use(s): flavor and fragrance agents | |
| 4- | hepten-1-ol |
| CAS: 20851-55-2 Use(s): natural substances and extractives | |
| 4- | hepten-2-ol |
| CAS: 66642-85-1 Use(s): flavoring agents | |
| (E)-4- | hepten-1-ol |
| CAS: 24469-79-2 Use(s): flavor and fragrance agents | |
| (E)-4- | hepten-2-ol |
| CAS: 58927-81-4 Use(s): flavor and fragrance agents | |
| (Z)-4- | hepten-1-ol |
| CAS: 6191-71-5 FEMA: 3841 JECFA: 1280 FLAVIS: 02.249 Use(s): flavor and fragrance agents | |
| (Z)-4- | hepten-2-ol |
| CAS: 34146-55-9 FLAVIS: 02.255 Use(s): flavoring agents | |
| 6- | hepten-3-ol |
| CAS: 19781-77-2 Use(s): natural substances and extractives | |
| 1- | hepten-3-ol |
| CAS: 4938-52-7 FEMA: 4129 JECFA: 1842 FLAVIS: 02.155 Use(s): flavor and fragrance agents | |
| 1- | hepten-3-one |
| CAS: 2918-13-0 Use(s): natural substances and extractives | |
| 2- | hepten-4-one |
| CAS: 4643-25-8 FEMA: 3399 JECFA: 1126 FLAVIS: 07.104 Use(s): flavoring agents | |
| (E)-2- | hepten-4-one |
| CAS: 32397-56-1 Use(s): information only not used for fragrances or flavors | |
| 3- | hepten-2-one |
| CAS: 1119-44-4 FEMA: 3400 JECFA: 1127 FLAVIS: 07.105 Use(s): flavor and fragrance agents | |
| (E)-3- | hepten-2-one |
| CAS: 5609-09-6 Use(s): natural substances and extractives | |
| 4- | hepten-3-one |
| CAS: 762-40-3 Use(s): information only not used for fragrances or flavors | |
| (E)-4- | hepten-2-one |
| CAS: 24332-22-7 Use(s): natural substances and extractives | |
| (E)-4- | hepten-3-one |
| CAS: 65113-42-0 Use(s): information only not used for fragrances or flavors | |
| (Z)-4- | hepten-2-one |
| CAS: 38397-37-4 Use(s): natural substances and extractives | |
| 5- | hepten-2-one |
| CAS: 6714-00-7 Use(s): natural substances and extractives | |
| (Z)-5- | hepten-2-one |
| CAS: 4535-61-9 Use(s): information only not used for fragrances or flavors | |
| 6- | hepten-1-yl 2-butenoate |
| Use(s): information only not used for fragrances or flavors | |
| 1- | heptenyl acetate |
| CAS: 35468-97-4 Use(s): natural substances and extractives | |
| 1- | hepten-3-yl acetate |
| CAS: 35926-06-8 Use(s): natural substances and extractives | |
| 2- | hepten-1-yl acetate |
| CAS: 1576-79-0 Use(s): information only not used for fragrances or flavors | |
| (E)-2- | hepten-1-yl acetate |
| CAS: 16939-73-4 FEMA: 4125 JECFA: 1798 FLAVIS: 09.385 Use(s): flavor and fragrance agents | |
| 3- | heptenyl acetate |
| CAS: 34942-91-1 Use(s): natural substances and extractives | |
| (E)-3- | hepten-1-yl acetate |
| CAS: 1576-77-8 FEMA: 3493 JECFA: 135 FLAVIS: 09.275 Use(s): flavor and fragrance agents | |
| (Z)-3- | hepten-1-yl acetate |
| CAS: 1576-78-9 Use(s): flavor and fragrance agents | |
| (Z)-4- | hepten-2-yl acetate |
| CAS: 94088-33-2 FLAVIS: 09.386 Use(s): flavoring agents | |
| (E)-3- | hepten-1-yl isobutyrate |
| CAS: 207801-32-9 FEMA: 3494 JECFA: 191 FLAVIS: 09.528 Use(s): flavor and fragrance agents | |
| 3- | heptenyl isobutyrate |
| CAS: 67801-45-0 FEMA: 3494 Use(s): flavor and fragrance agents | |
| (Z)-4- | hepten-2-yl butyrate |
| CAS: 94088-12-7 FLAVIS: 09.880 Use(s): flavoring agents | |
| 5-(6- | hepten-1-yl)dihydro-2(3H)-furanone |
| CAS: 854737-08-9 Use(s): fragrance agents | |
| 6- | heptenyl isothiocyanate |
| CAS: 49776-82-1 Use(s): natural substances and extractives | |
| (E)-2- | hepten-1-yl isovalerate |
| CAS: 94109-97-4 FEMA: 4126 Use(s): flavor and fragrance agents | |
| 2- | hepten-1-yl isovalerate |
| CAS: 253596-70-2 FEMA: 4126 JECFA: 1799 FLAVIS: 09.303 Use(s): flavor and fragrance agents | |
| heptyl acetate | |
| CAS: 112-06-1 FEMA: 2547 JECFA: 129 FLAVIS: 09.022 Use(s): flavor and fragrance agents | |
| 3- | heptyl acetate |
| CAS: 5921-83-5 FEMA: 3980 JECFA: 1143 FLAVIS: 09.924 Use(s): flavoring agents | |
| iso | heptyl acetate |
| CAS: 180348-60-1 FEMA: 4346 Use(s): flavoring agents | |
| sec- | heptyl acetate |
| CAS: 5921-82-4 FLAVIS: 09.388 Use(s): flavor and fragrance agents | |
| heptyl acetoacetate | |
| CAS: 42598-96-9 Use(s): information only not used for fragrances or flavors | |
| heptyl amine | |
| CAS: 111-68-2 Use(s): information only not used for fragrances or flavors | |
| heptyl benzoate | |
| CAS: 7155-12-6 Use(s): flavor and fragrance agents | |
| 2- | heptyl benzothiazole |
| CAS: 69938-51-8 Use(s): natural substances and extractives | |
| heptyl butyrate | |
| CAS: 5870-93-9 FEMA: 2549 JECFA: 154 FLAVIS: 09.166 Use(s): flavor and fragrance agents | |
| 2- | heptyl butyrate |
| CAS: 39026-94-3 FEMA: 3981 JECFA: 1144 FLAVIS: 09.923 Use(s): flavor and fragrance agents | |
| heptyl isobutyrate | |
| CAS: 2349-13-5 FEMA: 2550 JECFA: 190 FLAVIS: 09.420 Use(s): flavor and fragrance agents | |
| alpha- | heptyl cinnamaldehyde |
| CAS: 20175-19-3 Use(s): information only not used for fragrances or flavors | |
| heptyl cinnamate | |
| CAS: 10032-08-3 FEMA: 2551 JECFA: 666 FLAVIS: 09.782 Use(s): flavor and fragrance agents | |
| heptyl crotonate | |
| CAS: 16930-99-7 Use(s): flavoring agents | |
| heptyl (E)-crotonate | |
| CAS: 83783-78-2 Use(s): flavoring agents | |
| (E)-2- | heptyl cyclopropane carboxylic acid |
| CAS: 697290-77-0 FEMA: 4130 Use(s): flavoring agents | |
| 2- | heptyl cyclopropane carboxylic acid |
| CAS: 1225070-56-3 FEMA: 4130 JECFA: 1907 Use(s): flavoring agents | |
| (Z)-2- | heptyl cyclopropane carboxylic acid |
| CAS: 697290-76-9 FLAVIS: 08.131 Use(s): flavoring agents | |
| heptyl decanoate | |
| CAS: 60160-17-0 Use(s): flavor and fragrance agents | |
| 3- | heptyl dihydro-5-methyl-2(3H)-furanone |
| CAS: 40923-64-6 FEMA: 3350 JECFA: 244 FLAVIS: 10.026 Use(s): flavor and fragrance agents | |
| 2- | heptyl-4,5-dimethyl thiazole |
| CAS: 87262-50-8 Use(s): natural substances and extractives | |
| heptyl formate | |
| CAS: 112-23-2 FEMA: 2552 JECFA: 121 FLAVIS: 09.074 Use(s): flavor and fragrance agents | |
| 2- | heptyl furan |
| CAS: 3777-71-7 FEMA: 3401 JECFA: 1492 FLAVIS: 13.069 Use(s): flavor and fragrance agents | |
| heptyl heptanoate | |
| CAS: 624-09-9 FEMA: 4341 JECFA: 1875 Use(s): flavor and fragrance agents | |
| heptyl hexanoate | |
| CAS: 6976-72-3 FLAVIS: 09.390 Use(s): flavor and fragrance agents | |
| sec- | heptyl hexanoate |
| CAS: 6624-58-4 FLAVIS: 09.391 Use(s): flavoring agents | |
| sec- | heptyl isovalerate |
| CAS: 238757-71-6 FLAVIS: 09.304 Use(s): flavoring agents | |
| heptyl mercaptan | |
| CAS: 1639-09-4 FEMA: 4259 JECFA: 1663 FLAVIS: 12.130 Use(s): flavoring agents | |
| heptyl 2-methyl butyrate | |
| CAS: 50862-12-9 FLAVIS: 09.387 Use(s): flavoring agents | |
| heptyl 2-methyl pentanoate | |
| CAS: 6640-74-0 Use(s): natural substances and extractives | |
| heptyl 4-methyl pentanoate | |
| CAS: 35852-52-9 Use(s): natural substances and extractives | |
| heptyl methyl sulfide | |
| CAS: 20291-61-6 Use(s): information only not used for fragrances or flavors | |
| heptyl nonanoate | |
| CAS: 71605-85-1 Use(s): flavor and fragrance agents | |
| heptyl octanoate | |
| CAS: 4265-97-8 FEMA: 2553 JECFA: 176 FLAVIS: 09.118 Use(s): flavor and fragrance agents | |
| heptyl oleate | |
| CAS: 42254-63-7 Use(s): information only not used for fragrances or flavors | |
| heptyl palmitate | |
| CAS: 26718-83-2 Use(s): information only not used for fragrances or flavors | |
| heptyl paraben | |
| CAS: 1085-12-7 Use(s): inhibit microbiological spoilage | |
| 2- | heptyl phenol |
| CAS: 5284-22-0 Use(s): information only not used for fragrances or flavors | |
| 4- | heptyl phenol |
| CAS: 1987-50-4 Use(s): information only not used for fragrances or flavors | |
| heptyl phenyl acetate | |
| CAS: 39736-25-9 Use(s): information only not used for fragrances or flavors | |
| heptyl propionate | |
| CAS: 2216-81-1 Use(s): flavor and fragrance agents | |
| 2- | heptyl pyridine |
| CAS: 20815-27-4 Use(s): information only not used for fragrances or flavors | |
| 6- | heptyl-alpha-pyrone |
| Use(s): natural substances and extractives | |
| heptyl resorcinol | |
| CAS: 18979-65-2 Use(s): information only not used for fragrances or flavors | |
| heptyl salicylate | |
| CAS: 6259-77-4 Use(s): flavor and fragrance agents | |
| heptyl stearate | |
| CAS: 24466-84-0 Use(s): information only not used for fragrances or flavors | |
| 2- | heptyl tetrahydrofuran |
| CAS: 2435-16-7 Use(s): fragrance agents | |
| 2- | heptyl thiazolidine |
| CAS: 706-19-4 Use(s): natural substances and extractives | |
| heptyl isothiocyanate | |
| CAS: 4426-83-9 Use(s): flavoring agents | |
| 2- | heptyl thiophene |
| CAS: 18794-78-0 Use(s): natural substances and extractives | |
| 3- | heptyl thiophene |
| CAS: 65016-61-7 Use(s): flavoring agents | |
| heptyl undecylenate | |
| CAS: 68141-27-5 Use(s): cosmetic and fragrance agents | |
| heptyl valerate | |
| CAS: 5451-80-9 Use(s): fragrance agents | |
| heptyl isovalerate | |
| CAS: 56423-43-9 FLAVIS: 09.392 Use(s): flavor and fragrance agents | |
| N- | heptylaminoundecanoic acid |
| CAS: 68564-88-5 Use(s): indirect food additives: adhesives and components of coatings | |
| heptylene oxide | |
| CAS: 5063-65-0 Use(s): information only not used for fragrances or flavors | |
| 2- | heptylidene cyclopentanone |
| CAS: 39189-74-7 Use(s): fragrance agents | |
| heptylidene diacetate | |
| CAS: 56438-09-6 Use(s): fragrance agents | |
| heptylundecyl hydroxystearate | |
| CAS: 74659-69-1 Use(s): emollients | |
| 1- | heptyne |
| CAS: 628-71-7 Use(s): natural substances and extractives | |
| heraclenin | |
| CAS: 2880-49-1 Use(s): natural substances and extractives | |
| heraclenol | |
| CAS: 31575-93-6 Use(s): natural substances and extractives | |
| heracleum candicans root | |
| Use(s): information only not used for fragrances or flavors | |
| heracleum candolleanum rhizome oil india | |
| Use(s): information only not used for fragrances or flavors | |
| heracleum paphlagonicum czeczott fruit oil turkey | |
| Use(s): information only not used for fragrances or flavors | |
| heracleum sphondylium extract | |
| CAS: 90045-67-3 Use(s): cosmetic ingredient for skin conditioning | |
| herb dijon marinade | |
| Use(s): spices, other natural seasonings and flavorings | |
| herbacetin | |
| CAS: 527-95-7 Use(s): natural food | |
| herbal acetal | |
| CAS: 54546-26-8 Use(s): fragrance agents | |
| herbal carbonate | |
| CAS: 61699-38-5 Use(s): fragrance agents | |
| herbal carene | |
| CAS: 3608-11-5 Use(s): fragrance agents | |
| herbal cyclohexane | |
| CAS: 67583-77-1 Use(s): fragrance agents | |
| cis- | herbal cyclohexane |
| CAS: 24691-15-4 Use(s): fragrance agents | |
| trans- | herbal cyclohexane |
| CAS: 24691-17-6 Use(s): fragrance agents | |
| herbal cyclohexane acetyl anthranilate | |
| CAS: 73486-91-6 Use(s): information only not used for fragrances or flavors | |
| herbal cyclohexane butyrate | |
| CAS: 94200-12-1 Use(s): information only not used for fragrances or flavors | |
| herbal cyclohexane dipropylene glycol | |
| CAS: 73987-16-3 Use(s): information only not used for fragrances or flavors | |
| herbal cyclohexane formate | |
| CAS: 24442-68-0 Use(s): information only not used for fragrances or flavors | |
| herbal cyclohexane phenyl acetate | |
| CAS: 67859-97-6 Use(s): information only not used for fragrances or flavors | |
| herbal dioxane | |
| CAS: 3583-00-4 Use(s): fragrance agents | |
| herbal ethanone | |
| CAS: 42370-07-0 Use(s): fragrance agents | |
| herbal flavor | |
| Use(s): flavored products of all types | |
| herbal fragrance | |
| Use(s): fragranced products of all types | |
| herbal green specialty | |
| Use(s): fragranced products of all types | |
| herbal heptane | |
| CAS: 122795-41-9 Use(s): fragrance agents | |
| herbal ketone | |
| CAS: 67801-33-6 Use(s): fragrance agents | |
| herbal norbornane | |
| CAS: 66062-78-0 Use(s): fragrance agents | |
| herbal pyran | |
| CAS: 18871-14-2 Use(s): fragrance agents | |
| herbal specialty | |
| Use(s): fragrance agents | |
| herbal undecane | |
| CAS: 6413-26-9 Use(s): fragrance agents | |
| herbal undecanol | |
| CAS: 68228-06-8 Use(s): fragrance agents | |
| herbal undecanone | |
| CAS: 41724-19-0 Use(s): fragrance agents | |
| herbanate (Givaudan) | |
| CAS: 116126-82-0 Use(s): fragrance agents | |
| herbane | |
| CAS: 5421-99-8 Use(s): information only not used for fragrances or flavors | |
| herbarin | |
| CAS: 36379-67-6 Use(s): natural substances and extractives | |
| herboxidiene | |
| CAS: 142861-00-5 Use(s): information only not used for fragrances or flavors | |
| (E)- | herclavine |
| CAS: 539-18-4 Use(s): natural substances and extractives | |
| hericene A | |
| CAS: 157207-54-0 Use(s): natural substances and extractives | |
| hericene B | |
| CAS: 157207-55-1 Use(s): natural substances and extractives | |
| hericene C | |
| CAS: 157207-56-2 Use(s): natural substances and extractives | |
| hericenone A | |
| CAS: 126654-52-2 Use(s): natural substances and extractives | |
| hericenone B | |
| CAS: 126654-53-3 Use(s): natural substances and extractives | |
| hericenone C | |
| CAS: 137592-03-1 Use(s): natural substances and extractives | |
| hericenone D | |
| CAS: 137592-04-2 Use(s): natural substances and extractives | |
| hericenone E | |
| CAS: 137592-05-3 Use(s): natural substances and extractives | |
| hericenone F | |
| CAS: 141996-36-3 Use(s): natural substances and extractives | |
| hericenone G | |
| CAS: 141973-36-6 Use(s): natural substances and extractives | |
| hericenone H | |
| CAS: 141973-37-7 Use(s): natural substances and extractives | |
| hericerin | |
| CAS: 140381-53-9 Use(s): natural substances and extractives | |
| hericium erinaceus extract | |
| Use(s): food additive and cosmetic agents | |
| hericium erinaceus | |
| Use(s): information only not used for fragrances or flavors | |
| herierin III | |
| CAS: 131123-56-3 Use(s): natural substances and extractives | |
| heritonin | |
| CAS: 123914-48-7 Use(s): natural substances and extractives | |
| hernandulcin | |
| CAS: 95602-94-1 Use(s): natural substances and extractives | |
| (±)-epi | hernandulcin |
| CAS: 95672-95-0 Use(s): natural substances and extractives | |
| herniaria glabra extract | |
| CAS: 84775-60-0 Use(s): cosmetic ingredient for skin conditioning | |
| herniaria glabra herb | |
| CAS: 84775-60-0 Use(s): information only not used for fragrances or flavors | |
| herniaria hirsuta extract | |
| CAS: 90045-68-4 Use(s): information only not used for fragrances or flavors | |
| herniaria incana lam. oil greece | |
| Use(s): information only not used for fragrances or flavors | |
| herring oils | |
| CAS: 68153-06-0 Use(s): solvents/deluents for cosmetic and fragrance agents | |
| hesperaline | |
| CAS: 15797-38-3 Use(s): natural substances and extractives | |
| hesperetin | |
| CAS: 520-33-2 JECFA: 2024 FLAVIS: 16.097 Use(s): cosmetic and flavor agents | |
| (R,S)- | hesperetin |
| CAS: 69097-99-0 FEMA: 4313 Use(s): flavoring agents | |
| hesperetin dihydrochalcone | |
| CAS: 35400-60-3 FEMA: 4872 JECFA: 2262 Use(s): flavoring agents | |
| hesperidin | |
| CAS: 520-26-3 Use(s): cosmetic and flavor agents | |
| (R)- | hesperidin |
| CAS: 369593-42-0 Use(s): natural substances and extractives | |
| neo | hesperidin |
| CAS: 13241-33-3 Use(s): natural substances and extractives | |
| neo | hesperidin dihydrochalcone |
| CAS: 20702-77-6 FEMA: 3811 FLAVIS: 16.061 Use(s): cosmetic and flavor agents | |
| hesperidinase | |
| CAS: 37213-47-1 Use(s): cosmetic ingredient for skin conditioning | |
| neo | hesperidose |
| CAS: 17074-02-1 Use(s): information only not used for fragrances or flavors | |
| neo | hesperidose heptaacetate |
| CAS: 19949-47-4 Use(s): information only not used for fragrances or flavors | |
| hesperis matronalis extract | |
| CAS: 90045-69-5 Use(s): information only not used for fragrances or flavors | |
| heteroartonin A | |
| CAS: 170894-23-2 Use(s): natural substances and extractives | |
| heterobetulin | |
| CAS: 74715-49-4 Use(s): natural substances and extractives | |
| heterodendrin | |
| CAS: 66465-22-3 Use(s): natural substances and extractives | |
| epi | heterodendrin |
| CAS: 57103-47-6 Use(s): natural substances and extractives | |
| heteroflavanone A | |
| CAS: 151171-28-7 Use(s): natural substances and extractives | |
| heteroflavanone B | |
| CAS: 151171-29-8 Use(s): natural substances and extractives | |
| heteroflavanone C | |
| CAS: 156127-36-5 Use(s): natural substances and extractives | |
| heteronemin | |
| CAS: 62008-04-2 Use(s): natural substances and extractives | |
| heteropanax fragrans leaf extract | |
| Use(s): humectants | |
| heterophylliin A | |
| CAS: 87687-52-3 Use(s): natural substances and extractives | |
| heterophylol | |
| CAS: 152841-81-1 Use(s): natural substances and extractives | |
| heterosigma akashiwo cell extract | |
| Use(s): antimicrobial, antioxidants agents | |
| heterosigma akashiwo extract | |
| Use(s): antimicrobial, antioxidants agents | |
| heterotheca inuloides extract | |
| CAS: 90045-70-8 Use(s): information only not used for fragrances or flavors | |
| heterotheca inuloides flower extract | |
| CAS: 90045-70-8 Use(s): masking agents | |
| heterotheca inuloides root extract | |
| CAS: 90045-70-8 Use(s): cosmetic ingredient for skin and hair conditioning | |
| hevea brasiliensis leaf extract | |
| CAS: 93685-77-9 Use(s): cosmetic ingredient for skin conditioning | |
| hexa(ethylene glycol) | |
| CAS: 2615-15-8 Use(s): indirect food additives: paper and paperboard components | |
| hexacosanal | |
| CAS: 26627-85-0 Use(s): natural substances and extractives | |
| hexacosane | |
| CAS: 630-01-3 Use(s): natural substances and extractives | |
| 1,26- | hexacosanediol |
| CAS: 15541-01-2 Use(s): natural substances and extractives | |
| 1- | hexacosanol |
| CAS: 506-52-5 Use(s): flavor and fragrance agents | |
| 1- | hexacosene |
| CAS: 18835-33-1 Use(s): natural substances and extractives | |
| (Z,Z)-11,13- | hexadecadienal |
| CAS: 71317-73-2 Use(s): natural substances and extractives | |
| 7,10- | hexadecadienoic acid |
| CAS: 2936-83-6 Use(s): natural substances and extractives | |
| (E,E)-10,12- | hexadecadien-1-ol |
| CAS: 765-19-5 Use(s): natural substances and extractives | |
| (E,Z)-10,12- | hexadecadien-1-ol |
| CAS: 1002-94-4 Use(s): natural substances and extractives | |
| (Z,E)-10,12- | hexadecadien-1-ol |
| CAS: 765-17-3 Use(s): natural substances and extractives | |
| (Z,Z)-11,13- | hexadecadien-1-ol |
| CAS: 71720-83-7 Use(s): natural substances and extractives | |
| (Z,Z)/(Z,E)-7-11- | hexadecadien-1-yl acetate |
| CAS: 50933-33-0 Use(s): natural substances and extractives | |
| hexadecanal | |
| CAS: 629-80-1 FLAVIS: 05.152 Use(s): natural substances and extractives | |
| iso | hexadecanal |
| CAS: 62028-96-0 Use(s): natural substances and extractives | |
| hexadecanal diethyl acetal | |
| CAS: 761-60-4 Use(s): information only not used for fragrances or flavors | |
| hexadecanal dimethyl acetal | |
| CAS: 2791-29-9 Use(s): information only not used for fragrances or flavors | |
| hexadecane | |
| CAS: 544-76-3 FLAVIS: 01.072 Use(s): fragrance agents | |
| iso | hexadecane |
| CAS: 4390-04-9 Use(s): emollients, skin conditioning, solvents | |
| hexadecane dioic acid | |
| CAS: 505-54-4 Use(s): natural substances and extractives | |
| iso | hexadecanoic acid |
| CAS: 32844-67-0 Use(s): information only not used for fragrances or flavors | |
| 3-oxo | hexadecanoic acid glyceride (palm oil glycerides mono- and di- hydrogenated) |
| CAS: 91052-71-0 FEMA: 3769 JECFA: 917 FLAVIS: 09.554 Use(s): emulsifiers, flavoring agents | |
| 3-oxo | hexadecanoic acid glyceride |
| CAS: 128331-46-4 Use(s): emulsifiers, flavoring agents | |
| hexadecanol | |
| CAS: 36653-82-4 FEMA: 2554 JECFA: 114 FLAVIS: 02.009 Use(s): cosmetic, flavor and fragrance agents | |
| 2- | hexadecanol |
| CAS: 14852-31-4 Use(s): flavor and fragrance agents | |
| 15- | hexadecanolide |
| CAS: 69297-56-9 Use(s): natural substances and extractives | |
| 2- | hexadecanone |
| CAS: 18787-63-8 Use(s): natural substances and extractives | |
| 3- | hexadecanone |
| CAS: 18787-64-9 Use(s): natural substances and extractives | |
| 4- | hexadecanone |
| CAS: 18787-65-0 Use(s): information only not used for fragrances or flavors | |
| 5- | hexadecanone |
| CAS: 41903-81-5 Use(s): information only not used for fragrances or flavors | |
| 6- | hexadecanone |
| CAS: 57661-23-1 Use(s): information only not used for fragrances or flavors | |
| 7- | hexadecanone |
| CAS: 45206-91-5 Use(s): information only not used for fragrances or flavors | |
| 8- | hexadecanone |
| CAS: 18277-02-6 Use(s): information only not used for fragrances or flavors | |
| hexadecanophenone | |
| CAS: 6697-12-7 Use(s): information only not used for fragrances or flavors | |
| N- | hexadecanoylpyrrolidine |
| CAS: 70974-48-0 Use(s): natural substances and extractives | |
| (Z,Z,Z)-7,10,13- | hexadecatrienal |
| CAS: 56797-43-4 Use(s): natural substances and extractives | |
| (E)-11- | hexadecenal |
| CAS: 57491-33-5 Use(s): natural substances and extractives | |
| (E)-2- | hexadecenal |
| CAS: 22644-96-8 Use(s): natural substances and extractives | |
| (Z)-7- | hexadecenal |
| CAS: 56797-40-1 Use(s): natural substances and extractives | |
| (Z)-9- | hexadecenal |
| CAS: 56219-04-6 Use(s): natural substances and extractives | |
| (Z)-11- | hexadecenal |
| CAS: 53939-28-9 Use(s): natural substances and extractives | |
| hexadecene | |
| CAS: 26952-14-7 Use(s): solvents | |
| 1- | hexadecene |
| CAS: 629-73-2 Use(s): natural substances and extractives | |
| 2- | hexadecene |
| CAS: 26741-29-7 Use(s): natural substances and extractives | |
| 5- | hexadecene |
| CAS: 53137-47-6 Use(s): natural substances and extractives | |
| 7- | hexadecene |
| CAS: 18899-19-9 Use(s): natural substances and extractives | |
| iso | hexadecene |
| CAS: 85909-49-5 Use(s): information only not used for fragrances or flavors | |
| (Z)-7- | hexadecene dioic acid |
| CAS: 253687-18-2 Use(s): information only not used for fragrances or flavors | |
| (E)-2- | hexadecenoic acid |
| CAS: 629-56-1 Use(s): information only not used for fragrances or flavors | |
| (Z)-2- | hexadecenoic acid |
| CAS: 28039-99-8 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | hexadecenoic acid |
| CAS: 2457-70-7 Use(s): information only not used for fragrances or flavors | |
| cis-6- | hexadecenoic acid |
| CAS: 17004-51-2 Use(s): emollients, skin conditioning | |
| trans-6- | hexadecenoic acid |
| CAS: 28290-76-8 Use(s): natural substances and extractives | |
| (Z)-7- | hexadecenoic acid |
| CAS: 2416-19-5 Use(s): natural substances and extractives | |
| (E)-9- | hexadecenoic acid |
| CAS: 10030-73-6 Use(s): information only not used for fragrances or flavors | |
| (Z)-9- | hexadecenoic acid |
| CAS: 373-49-9 Use(s): indirect food additives: adhesives and components of coatings | |
| (E)-11- | hexadecenoic acid |
| CAS: 2271-34-3 Use(s): natural substances and extractives | |
| (Z)-11- | hexadecenoic acid |
| CAS: 2416-20-8 Use(s): natural substances and extractives | |
| 15- | hexadecenoic acid |
| CAS: 4675-57-4 Use(s): information only not used for fragrances or flavors | |
| (E)-11- | hexadecen-1-ol |
| CAS: 61301-56-2 Use(s): information only not used for fragrances or flavors | |
| (Z)-11- | hexadecen-1-ol |
| CAS: 56683-54-6 Use(s): natural substances and extractives | |
| (E)-11- | hexadecen-1-yl acetate |
| CAS: 56218-72-5 Use(s): information only not used for fragrances or flavors | |
| (Z)-11- | hexadecen-1-yl acetate |
| CAS: 34010-21-4 Use(s): natural substances and extractives | |
| (Z)-13- | hexadecen-11-yn-1-yl acetate |
| CAS: 78617-58-0 Use(s): herbicides / pesticides | |
| hexadecyl 5-methyl-2-furoate | |
| CAS: 1687726-81-3 Use(s): information only not used for fragrances or flavors | |
| hexadecyl ferulate | |
| CAS: 64190-80-3 Use(s): natural substances and extractives | |
| hexadecyl hexadecenoate | |
| CAS: 71788-99-3 Use(s): natural substances and extractives | |
| hexadecyl neodecanoate | |
| CAS: 67749-11-5 Use(s): information only not used for fragrances or flavors | |
| 1- | hexadecyne |
| CAS: 629-74-3 Use(s): natural substances and extractives | |
| 1,5- | hexadien-3-ol |
| CAS: 924-41-4 Use(s): natural substances and extractives | |
| 2,4- | hexadienal |
| CAS: 80466-34-8 Use(s): flavoring agents | |
| (E,E)-2,4- | hexadienal |
| CAS: 142-83-6 FEMA: 3429 JECFA: 1175 FLAVIS: 05.057 Use(s): cosmetic and flavor agents | |
| (E,Z)-2,4- | hexadienal |
| CAS: 53398-76-8 Use(s): natural substances and extractives | |
| hexadienal diethyl acetal | |
| CAS: 27310-22-1 Use(s): fragrance agents | |
| (Z+E)-1,4- | hexadiene |
| CAS: 592-45-0 Use(s): indirect food additives: polymers | |
| (E)-1,3- | hexadiene |
| CAS: 20237-34-7 Use(s): information only not used for fragrances or flavors | |
| (Z)-1,3- | hexadiene |
| CAS: 14596-92-0 Use(s): natural substances and extractives | |
| (E)-1,4- | hexadiene |
| CAS: 7319-00-8 Use(s): natural substances and extractives | |
| (Z)-1,4- | hexadiene |
| CAS: 7318-67-4 Use(s): information only not used for fragrances or flavors | |
| 2,4- | hexadien-1-ol |
| CAS: 111-28-4 FEMA: 3922 JECFA: 1174 FLAVIS: 02.162 Use(s): flavoring agents and cosmetic fragrance agents | |
| (E,E)-2,4- | hexadien-1-ol |
| CAS: 17102-64-6 Use(s): flavoring agents | |
| (E)-2-(3,5- | hexadienyl)-5-methyl furan |
| CAS: 5159-44-4 Use(s): information only not used for fragrances or flavors | |
| hexadienylidene acetone | |
| CAS: 17609-32-4 Use(s): information only not used for fragrances or flavors | |
| 1,5- | hexadiyne |
| CAS: 628-16-0 Use(s): natural substances and extractives | |
| 2-(2,4- | hexadiynylidene)-1,6-dioxaspiro(4.4)non-3-ene |
| CAS: 16863-61-9 Use(s): natural substances and extractives | |
| (E)-2-(2,4- | hexadiynylidene)-1,6-dioxaspiro[4.5]dec-3-ene |
| CAS: 3306-40-9 Use(s): natural substances and extractives | |
| hexafluoropropene | |
| CAS: 116-15-4 Use(s): indirect food additives: adhesives and components of coatings | |
| 2,3,5,6,8,8a- | hexahydro-2,5,5,8a-tetramethyl-7H-1-benzopyran-7-one |
| CAS: 20194-67-6 Use(s): natural substances and extractives | |
| hexahydro-2',4-dimethylspiro[1,3-dithiolo[4,5-c]furan-2,3'(2'H)-furan] | |
| CAS: 38325-26-7 Use(s): information only not used for fragrances or flavors | |
| 4,4a,5,6,7,8- | hexahydro-4a,8-dimethyl naphthalen-2(3H)-one |
| CAS: 4071-63-0 Use(s): information only not used for fragrances or flavors | |
| 1,2,3,4,5,6- | hexahydro-5-methyl-7H-cyclopenta[b]pyridin-7-one |
| CAS: 104704-29-2 Use(s): information only not used for fragrances or flavors | |
| 1,2,3,4,5,6- | hexahydro-6-methyl-7H-cyclopenta[b]pyridin-7-one |
| CAS: 104704-38-3 Use(s): information only not used for fragrances or flavors | |
| hexahydro-6,7-dihydroxy-5-(hydroxymethyl)-3-(2-hydroxyphenyl)-2H-pyrano[2,3-d]oxazol-2-one | |
| CAS: 396714-67-3 Use(s): natural substances and extractives | |
| 2,3,4,5,6,7- | hexahydro-7-methylcyclopent[b]azepin-8(1H)-one |
| CAS: 97826-66-9 Use(s): information only not used for fragrances or flavors | |
| 1,2,3,4,5,6- | hexahydro-7H-cyclopenta[b]pyridin-7-one |
| CAS: 104704-30-5 Use(s): information only not used for fragrances or flavors | |
| hexahydrobenzofuranone | |
| CAS: 6051-03-2 Use(s): flavor and fragrance agents | |
| hexahydrocoumarin | |
| CAS: 700-82-3 Use(s): information only not used for fragrances or flavors | |
| 2,3,4,5,6,7- | hexahydrocyclopent[b]azepin-8(1H)-one |
| CAS: 81978-77-0 Use(s): information only not used for fragrances or flavors | |
| 3a,4,5,6,7,7a- | hexahydrodimethyl-4,7-methano-1H-inden-5-ol |
| CAS: 79771-15-6 Use(s): fragrance agents | |
| 3',6- | hexahydrodimethyl spiromethanonaphthalene oxirane |
| CAS: 41723-98-2 Use(s): fragrance agents | |
| hexahydrofarnesol | |
| CAS: 6750-34-1 Use(s): flavor and fragrance agents | |
| hexahydrofarnesyl acetone | |
| CAS: 502-69-2 FLAVIS: 07.205 Use(s): flavor and fragrance agents | |
| 3a,5,6,7,8,8b- | hexahydro-2,2,6,6,7,8,8-heptamethyl-4H-indeno(4,5-d)-1,3-dioxole |
| CAS: 823178-41-2 Use(s): fragrance agents | |
| 3a,3b,5,6,7,8a- | hexahydro-2,2,3a,3b,7,7-hexamethyl-4H-indeno[1,2-D]-1,3-dioxole |
| Use(s): fragrance agents | |
| hexahydro-beta-ionone methyl derivative | |
| CAS: 69834-09-9 Use(s): information only not used for fragrances or flavors | |
| (15Z,9'Z)-7,7',8,8',11,12- | hexahydrolycopene |
| CAS: 72746-34-0 Use(s): natural substances and extractives | |
| hexahydromethanoinden-5-yl pivalate | |
| CAS: 68039-45-2 Use(s): fragrance agents | |
| hexahydromethanoinden-5-yl propionate | |
| CAS: 67634-24-6 Use(s): fragrance agents | |
| ((3a,4,5,6,7,7a- | hexahydro-4,7-methano-1H-inden-5(or 6)-yl)oxy) acetaldehyde |
| CAS: 94248-38-1 Use(s): fragrance agents | |
| hexahydromethanoinden-6-ol | |
| CAS: 3385-61-3 Use(s): fragrance agents | |
| hexahydromethanoinden-6-yl isopentenol | |
| CAS: 126646-06-8 Use(s): fragrance agents | |
| ((3a,4,5,6,7,7a- | hexahydro-4,7-methano-1H-inden-6-yl)oxy) acetaldehyde |
| CAS: 72927-85-6 Use(s): fragrance agents | |
| hexahydromethanoindene | |
| CAS: 4488-57-7 Use(s): fragrance agents | |
| 3a,4,5,6,7,7a- | hexahydro-,4,7-methano-1H-indenecarboxaldehyde reaction products with Me Et ketone, acid-isomerized, reduced |
| CAS: 727414-17-7 Use(s): fragrance agents | |
| hexahydromethanoindene-5-ylidene-2-butanol | |
| CAS: 105304-56-1 Use(s): fragrance agents | |
| hexahydromethanoindenyl formate | |
| CAS: 68683-22-7 Use(s): fragrance agents | |
| hexahydromethanoindenyl isobutyrate | |
| CAS: 93941-73-2 Use(s): fragrance agents | |
| 4,4a,6,7,8,8a- | hexahydro-1,4-methanonaphthalen-5(1H)-one |
| CAS: 51519-65-4 Use(s): fragrance agents | |
| hexahydromethoxymethanoindenes | |
| CAS: 27135-90-6 Use(s): fragrance agents | |
| 3- | hexahydromethyl methylene methanohinden-6-yl acetate |
| CAS: 81836-13-7 Use(s): fragrance agents | |
| 1,2,3,4,5,8- | hexahydronaphthalene |
| CAS: 36231-13-7 Use(s): information only not used for fragrances or flavors | |
| 2,3,4,5,6,7- | hexahydro-1,1,2,3,3-pentamethyl-1H-indene |
| CAS: 33704-59-5 Use(s): information only not used for fragrances or flavors | |
| 5,5a,6,7,8,8a- | hexahydro-6,6,7,8,8-pentamethyl-4H-indeno[5,4-D]isoxazole |
| Use(s): information only not used for fragrances or flavors | |
| (cis+trans)-6,6a,7,8,9,9a- | hexahydro-7,7,8,9,9-pentamethyl-5H-cyclopenta[H]quinazoline |
| Use(s): fragrance agents | |
| hexahydrophthalic anhydride | |
| CAS: 85-42-7 Use(s): information only not used for fragrances or flavors | |
| hexahydrotetramethyl epoxymethanoazulene | |
| CAS: 67710-71-8 Use(s): fragrance agents | |
| hexahydrotetramethyl methanoazulen-5-yl methyl ketone | |
| CAS: 68039-35-0 Use(s): fragrance agents | |
| hexahydro-1,1,5,5-tetramethyl-2H-2,4a-methanonaphthalen-6(5H)-one | |
| CAS: 67952-58-3 Use(s): information only not used for fragrances or flavors | |
| 1,2,3,4,5,6- | hexahydro-1,1,5,5-tetramethyl-7H-2,4a-methanonaphthalen-7-one |
| CAS: 23747-14-0 Use(s): information only not used for fragrances or flavors | |
| 1,3,4,5,6,7- | hexahydro-1,1,5,5-tetramethyl-2H-2,4a-methanonaphthalen-7-yl acetate |
| CAS: 32213-88-0 Use(s): information only not used for fragrances or flavors | |
| 1,3,4,5,6,7- | hexahydro-1,1,5,5-tetramethyl-2H-2,4a-methanonaphthalen-7-yl formate |
| CAS: 67874-82-2 Use(s): information only not used for fragrances or flavors | |
| hexahydrotetramethyl methanonaphthalen-8-one | |
| CAS: 29461-13-0 Use(s): fragrance agents | |
| (2S)-1,3,4,5,6,7- | hexahydro-1,1,5,5-tetramethyl-2H-2,4a-methanonaphthalene-8-carbaldehyde |
| CAS: 61826-54-8 Use(s): information only not used for fragrances or flavors | |
| hexahydrotetramethyl methanonaphthalene-8-methanol | |
| CAS: 61826-53-7 Use(s): fragrance agents | |
| hexahydrotetramethyl methanonaphthalene-8-methyl acetate | |
| CAS: 61826-56-0 Use(s): fragrance agents | |
| hexahydrotetramethyl methanonaphthalene-8-methyl formate | |
| CAS: 61826-52-6 Use(s): fragrance agents | |
| hexahydro-1',1',5',5'-tetramethyl-spiro(1,3-dioxolane-2,8'(5'H)-(2H-2,4a)methanonaphthalene) | |
| CAS: 154171-76-3 Use(s): fragrance agents | |
| 1-(1,3,4,5,6,7- | hexahydro-1,1,5,5-tetramethyl-2H-2,4a-methanonaphthalen-8-yl) ethan-1-one |
| CAS: 59056-71-2 Use(s): information only not used for fragrances or flavors | |
| hexahydrotrimethyl ethanonaphthalen-8-yl methyl ketone | |
| CAS: 32388-56-0 Use(s): fragrance agents | |
| 1-(2,3,3a,4,5,6- | hexahydro-1,1,3-trimethyl-1H-inden-5-yl) ethan-1-one |
| CAS: 77628-62-7 Use(s): information only not used for fragrances or flavors | |
| 3,4- | hexahydroxydiphenoylarabinose |
| CAS: 19833-16-0 Use(s): natural substances and extractives | |
| 3,3',4',5,5',8- | hexahydroxyflavone |
| CAS: 90332-28-8 Use(s): natural substances and extractives | |
| delta- | hexalactone |
| CAS: 823-22-3 FEMA: 3167 JECFA: 224 FLAVIS: 10.010 Use(s): flavor and fragrance agents | |
| (R)-delta- | hexalactone |
| CAS: 43112-32-9 Use(s): information only not used for fragrances or flavors | |
| (S)-delta- | hexalactone |
| CAS: 16320-13-1 Use(s): information only not used for fragrances or flavors | |
| gamma- | hexalactone |
| CAS: 695-06-7 FEMA: 2556 JECFA: 223 FLAVIS: 10.021 Use(s): flavor and fragrance agents | |
| (R)-gamma- | hexalactone |
| CAS: 63357-95-9 Use(s): information only not used for fragrances or flavors | |
| (S)-gamma- | hexalactone |
| CAS: 41035-07-8 Use(s): information only not used for fragrances or flavors | |
| 5,6,7,3',4',5'- | hexamethoxyflavone |
| CAS: 29043-07-0 Use(s): natural substances and extractives | |
| 1,3,3,4,5,6- | hexamethyl bicyclo(2.2.2)oct-5-en-2-one |
| Use(s): information only not used for fragrances or flavors | |
| 2,3,4,5,6,6- | hexamethyl-2,4-cyclohexadien-1-one |
| CAS: 3854-96-4 Use(s): information only not used for fragrances or flavors | |
| 1,3,3,4,5,6- | hexamethyl-2-ethyl bicyclo(2.2.2)-5-octen-2-ol |
| Use(s): information only not used for fragrances or flavors | |
| 1,1,2,3,3,5- | hexamethyl-2,3,3a,4,5,9b-hexahydro-1H-7,9-diazacyclopenta[a]naphthalene |
| Use(s): information only not used for fragrances or flavors | |
| 6-oxa-1,1,2,3,3,8- | hexamethyl-2,3,5,6,7,8-hexahydro-1H-benz(f)indene |
| Use(s): information only not used for fragrances or flavors | |
| 2,6,6,7,8,8- | hexamethyl-5,5a,6,7,8,8a-hexahydro-4H-3-thia-1-aza-as-indacene |
| Use(s): information only not used for fragrances or flavors | |
| 5,7,7,8,10,10- | hexamethyl-5,6,7,8,9,10-hexahydrobenzo[h]quinazoline |
| Use(s): information only not used for fragrances or flavors | |
| 6-oxa-1,1,2,3,3,8- | hexamethyl-2,3,5,6,7,8-hexamethyl-2,3,5,6,7,8-hexahydro-1H-benz[f]indene |
| Use(s): information only not used for fragrances or flavors | |
| beta,1,1,2,3,3- | hexamethyl indan-5-ethanol |
| CAS: 1217-08-9 Use(s): fragrance agents | |
| 5,7,7,8,10,10- | hexamethyl-5,6,6a,7,8,9,10,10a-octahydrobenzo[h]quinazoline |
| Use(s): information only not used for fragrances or flavors | |
| (1aR,4S,7aS)-1a,3,3,4,6,6- | hexamethyl-1a,2,3,4,5,6,7,7a-octahydronaphtho[2,3-b]oxirene |
| CAS: NF0127 Use(s): fragrance agents | |
| 1,1,2,3,3,5- | hexamethyl-2,3,4,5-tetrahydro-1H-7,9-diazacyclopenta[a]naphthalene |
| Use(s): information only not used for fragrances or flavors | |
| 2,6,6,7,8,8- | hexamethyl-5,6,7,8-tetrahydro-4H-3-thia-1-aza-as-indacene |
| Use(s): information only not used for fragrances or flavors | |
| 1,3,3,4,5,6- | hexamethyl(2.2.2)bicyclooct-5-en-2-ol |
| Use(s): information only not used for fragrances or flavors | |
| 1,4,5,5,8,9- | hexamethylbicyclo[4.3.0]non-8-en-7-one |
| Use(s): information only not used for fragrances or flavors | |
| hexamethyldisilazane | |
| CAS: 999-97-3 Use(s): indirect food additives: adhesives and components of coatings | |
| hexamethylene bis(3,5-di-tert-butyl-4-hydroxyhydrocinnamate) | |
| CAS: 35074-77-2 Use(s): indirect food additives: adhesives and components of coatings | |
| hexamethylene diamine | |
| CAS: 124-09-4 Use(s): indirect food additives: adhesives and components of coatings | |
| hexamethylene tetramine | |
| CAS: 100-97-0 Use(s): antimicrobial agents | |
| 1,6- | hexamethylene-bis(3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionamide) |
| CAS: 23128-74-7 Use(s): indirect food additives: adhesives and components of coatings | |
| hexamethylgossypetin | |
| CAS: 7741-47-1 Use(s): natural substances and extractives | |
| hexanal (aldehyde C-6) | |
| CAS: 66-25-1 FEMA: 2557 JECFA: 92 FLAVIS: 05.008 Use(s): flavor and fragrance agents | |
| iso | hexanal |
| CAS: 1119-16-0 FLAVIS: 05.166 Use(s): flavoring agents | |
| hexanal butane-2,3-diol acetal | |
| CAS: 155639-75-1 FEMA: 4384 JECFA: 1737 Use(s): flavoring agents | |
| hexanal 1,3-butylene glycol acetal | |
| CAS: 5455-66-3 Use(s): information only not used for fragrances or flavors | |
| hexanal dibutyl acetal | |
| CAS: 93892-07-0 Use(s): fragrance agents | |
| hexanal diethyl acetal | |
| CAS: 3658-93-3 FLAVIS: 06.023 Use(s): flavor and fragrance agents | |
| hexanal dihexyl acetal | |
| CAS: 33673-65-3 FEMA: 4370 JECFA: 1738 Use(s): flavor and fragrance agents | |
| hexanal diisoamyl acetal | |
| CAS: 93892-09-2 Use(s): information only not used for fragrances or flavors | |
| hexanal dimethyl acetal | |
| CAS: 1599-47-9 FLAVIS: 06.073 Use(s): flavor and fragrance agents | |
| hexanal 1,3-dithiane | |
| CAS: 21777-32-2 Use(s): information only not used for fragrances or flavors | |
| hexanal hexyl isoamyl acetal | |
| CAS: 896447-13-5 FEMA: 4369 JECFA: 1735 Use(s): flavor and fragrance agents | |
| hexanal octane-1,3-diol acetal | |
| CAS: 202188-46-3 FEMA: 4377 JECFA: 1736 Use(s): flavoring agents | |
| hexanal propylene glycol acetal | |
| CAS: 1599-49-1 FEMA: 3630 JECFA: 928 FLAVIS: 06.094 Use(s): flavor and fragrance agents | |
| cis- | hexanal propylene glycol acetal |
| CAS: 26563-74-6 FEMA: 3630 Use(s): flavor and fragrance agents | |
| trans- | hexanal propylene glycol acetal |
| CAS: 26563-75-7 Use(s): natural substances and extractives | |
| hexanal sulfided | |
| Use(s): flavoring agents | |
| hexane | |
| CAS: 110-54-3 Use(s): extraction solvents | |
| hexane branched and linear | |
| CAS: 92112-69-1 Use(s): information only not used for fragrances or flavors | |
| (S,S)-2,5- | hexane diol |
| CAS: 34338-96-0 Use(s): information only not used for fragrances or flavors | |
| 1,6- | hexane diol |
| CAS: 629-11-8 Use(s): solvents | |
| 2,5- | hexane diol |
| CAS: 2935-44-6 Use(s): solvents | |
| 2,4- | hexane dione |
| CAS: 3002-24-2 Use(s): information only not used for fragrances or flavors | |
| 3,4- | hexane dione |
| CAS: 4437-51-8 FEMA: 3168 JECFA: 413 FLAVIS: 07.077 Use(s): flavor and fragrance agents | |
| 1,6- | hexane dithiol |
| CAS: 1191-43-1 FEMA: 3495 JECFA: 540 FLAVIS: 12.067 Use(s): flavoring agents | |
| 3,4- | hexane dithiol |
| CAS: NF0083 Use(s): information only not used for fragrances or flavors | |
| hexane nitrile | |
| CAS: 628-73-9 Use(s): fragrance agents | |
| 1,2,6- | hexane triol |
| CAS: 106-69-4 Use(s): cosmetic agents | |
| hexane triol (mixed isomers) | |
| CAS: 25323-24-4 Use(s): indirect food additives: adhesives and components of coatings | |
| hexanedioic acid, polymer with 1,3-butanediol and 1,2-propanediol, 2-ethylhexyl ester | |
| CAS: 73018-26-5 Use(s): indirect food additives: adhesives and components of coatings | |
| 1,2- | hexanediyl dicaprate |
| Use(s): bleaching agents | |
| 2(3)- | hexanethiol |
| CAS: 1679-06-7 FEMA: 4782 Use(s): flavoring agents | |
| hexanoic acid | |
| CAS: 142-62-1 FEMA: 2559 JECFA: 93 FLAVIS: 08.009 Use(s): flavor and fragrance agents | |
| 2-oxo | hexanoic acid |
| CAS: 2492-75-3 Use(s): information only not used for fragrances or flavors | |
| 3-oxo | hexanoic acid glyceride |
| CAS: 91052-72-1 FEMA: 3770 JECFA: 910 FLAVIS: 09.555 Use(s): emulsifiers, flavoring agents | |
| hexanoic anhydride | |
| CAS: 2051-49-2 Use(s): natural substances and extractives | |
| hexanol | |
| CAS: 111-27-3 FEMA: 2567 JECFA: 91 FLAVIS: 02.005 Use(s): cosmetic, flavor and fragrance agents | |
| 2- | hexanol |
| CAS: 626-93-7 FLAVIS: 02.163 Use(s): flavor and fragrance agents | |
| (R)-(-)-2- | hexanol |
| CAS: 26549-24-6 Use(s): flavoring agents | |
| (S)-(+)-2- | hexanol |
| CAS: 52019-78-0 Use(s): flavoring agents | |
| 3- | hexanol |
| CAS: 623-37-0 FEMA: 3351 JECFA: 282 FLAVIS: 02.089 Use(s): flavor and fragrance agents | |
| (R)-3- | hexanol |
| CAS: 13471-42-6 Use(s): information only not used for fragrances or flavors | |
| (S)-3- | hexanol |
| CAS: 6210-51-1 Use(s): information only not used for fragrances or flavors | |
| 3- | hexanone |
| CAS: 589-38-8 FEMA: 3290 JECFA: 281 FLAVIS: 07.096 Use(s): flavor and fragrance agents | |
| hexanophenone | |
| CAS: 942-92-7 Use(s): information only not used for fragrances or flavors | |
| 4- | hexanoyl resorcinol |
| CAS: 3144-54-5 Use(s): information only not used for fragrances or flavors | |
| hexatetracontane | |
| CAS: 7098-24-0 Use(s): information only not used for fragrances or flavors | |
| 1,2,3,4,5,6- | hexathiepane |
| CAS: 17233-71-5 Use(s): natural substances and extractives | |
| 1,2,3,5,6,8- | hexathionane |
| CAS: 103439-80-1 Use(s): natural substances and extractives | |
| 1,2,4,5,7,8- | hexathionane |
| CAS: 81531-38-6 Use(s): natural substances and extractives | |
| hexatriacontane | |
| CAS: 630-06-8 Use(s): natural substances and extractives | |
| 2- | hexenal |
| CAS: 505-57-7 FEMA: 2560 FLAVIS: 05.189 Use(s): flavoring agents | |
| (E)-2- | hexenal |
| CAS: 85761-70-2 Use(s): flavoring agents | |
| (E)-2- | hexenal |
| CAS: 6728-26-3 FEMA: 2560 JECFA: 1353 FLAVIS: 05.073 Use(s): flavor and fragrance agents | |
| (Z)-2- | hexenal |
| CAS: 16635-54-4 Use(s): flavoring agents | |
| 3- | hexenal |
| CAS: 4440-65-7 JECFA: 1271 FLAVIS: 05.192 Use(s): flavor and fragrance agents | |
| (E)-3- | hexenal |
| CAS: 69112-21-6 Use(s): flavoring agents | |
| (Z)-3- | hexenal |
| CAS: 6789-80-6 FEMA: 2561 JECFA: 316 FLAVIS: 05.075 Use(s): flavor and fragrance agents | |
| 4- | hexenal |
| CAS: 2100-19-8 Use(s): natural substances and extractives | |
| (E)-4- | hexenal |
| CAS: 25166-87-4 FEMA: 4046 JECFA: 1622 FLAVIS: 05.224 Use(s): flavoring agents | |
| (E)-4-oxo-2- | hexenal |
| CAS: 2492-43-5 Use(s): natural substances and extractives | |
| (Z)-4- | hexenal |
| CAS: 4634-89-3 FEMA: 3496 JECFA: 319 FLAVIS: 05.113 Use(s): flavoring agents | |
| 5- | hexenal |
| CAS: 764-59-0 Use(s): natural substances and extractives | |
| 2- | hexenal diethyl acetal |
| CAS: 54306-00-2 FLAVIS: 06.031 Use(s): flavoring agents | |
| (E)-2- | hexenal diethyl acetal |
| CAS: 67746-30-9 FEMA: 4047 JECFA: 1383 FLAVIS: 06.031 Use(s): flavoring agents | |
| (Z)-2- | hexenal diethyl acetal |
| CAS: NF0177 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | hexenal diethyl acetal |
| CAS: NF0178 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexenal diethyl acetal |
| CAS: 73545-18-3 FLAVIS: 06.063 Use(s): flavor and fragrance agents | |
| (E)-2- | hexenal dimethyl acetal |
| CAS: 18318-83-7 FEMA: 4098 JECFA: 1728 FLAVIS: 06.072 Use(s): flavoring agents | |
| (Z)-3- | hexenal dimethyl acetal |
| CAS: 55444-65-0 Use(s): information only not used for fragrances or flavors | |
| (E)-2- | hexenal glyceryl acetal |
| CAS: 214220-85-6 FEMA: 4273 JECFA: 1800 Use(s): flavoring agents | |
| (Z)-2- | hexenal glyceryl acetal |
| CAS: 897630-96-5 FEMA: 4273 Use(s): flavoring agents | |
| (E)-2- | hexenal propylene glycol acetal |
| CAS: 94089-21-1 FEMA: 4272 JECFA: 1801 Use(s): flavor and fragrance agents | |
| 1- | hexene |
| CAS: 592-41-6 Use(s): solvents | |
| (E)-2- | hexene |
| CAS: 4050-45-7 Use(s): information only not used for fragrances or flavors | |
| (Z)-2- | hexene |
| CAS: 7688-21-3 Use(s): information only not used for fragrances or flavors | |
| (Z+E)-2- | hexene |
| CAS: 592-43-8 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | hexene |
| CAS: 13269-52-8 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexene |
| CAS: 7642-09-3 Use(s): information only not used for fragrances or flavors | |
| (Z+E)-3- | hexene |
| CAS: 592-47-2 Use(s): information only not used for fragrances or flavors | |
| 2- | hexene dioic acid |
| CAS: 4440-68-0 Use(s): information only not used for fragrances or flavors | |
| 3- | hexene-2,5-dione |
| CAS: 4436-75-3 Use(s): information only not used for fragrances or flavors | |
| cis-3- | hexene-2,5-dione |
| CAS: 17559-81-8 Use(s): information only not used for fragrances or flavors | |
| trans-3- | hexene-2,5-dione |
| CAS: 820-69-9 Use(s): information only not used for fragrances or flavors | |
| 5- | hexene nitrile |
| CAS: 5048-19-1 Use(s): natural substances and extractives | |
| 3- | hexene, 1,1',1''-(ethylidyne tris(oxy)) tris-, (3Z,3'Z,3''Z)- |
| CAS: 215305-10-5 Use(s): fragrance agents | |
| hexenoic acid | |
| CAS: 1289-40-3 Use(s): information only not used for fragrances or flavors | |
| 2- | hexenoic acid |
| CAS: 1191-04-4 FLAVIS: 08.119 Use(s): flavoring agents | |
| (E)-2- | hexenoic acid |
| CAS: 13419-69-7 FEMA: 3169 JECFA: 1361 FLAVIS: 08.054 Use(s): flavoring agents | |
| (Z)-2- | hexenoic acid |
| CAS: 1577-28-2 Use(s): natural substances and extractives | |
| 3- | hexenoic acid |
| CAS: 4219-24-3 FEMA: 3170 JECFA: 317 FLAVIS: 08.050 Use(s): flavoring agents | |
| (E)-3- | hexenoic acid |
| CAS: 1577-18-0 FEMA: 3170 Use(s): flavoring agents | |
| (Z)-3- | hexenoic acid |
| CAS: 1775-43-5 FEMA: 4493 JECFA: 2181 Use(s): flavoring agents | |
| 4- | hexenoic acid |
| CAS: 35194-36-6 Use(s): natural substances and extractives | |
| (E)-4- | hexenoic acid |
| CAS: 1577-20-4 Use(s): natural substances and extractives | |
| (Z)-4- | hexenoic acid |
| CAS: 13855-41-9 Use(s): natural substances and extractives | |
| 5- | hexenoic acid |
| CAS: 1577-22-6 Use(s): natural substances and extractives | |
| (R)-1- | hexen-3-ol |
| CAS: 139164-92-4 Use(s): information only not used for fragrances or flavors | |
| (S)-1- | hexen-3-ol |
| CAS: 4798-44-1 Use(s): natural substances and extractives | |
| 2- | hexen-1-ol |
| CAS: 2305-21-7 FEMA: 2562 JECFA: 1354 FLAVIS: 02.020 Use(s): flavor and fragrance agents | |
| (E)-2- | hexen-1-ol |
| CAS: 928-95-0 FEMA: 2562 FLAVIS: 02.157 Use(s): flavor and fragrance agents | |
| (Z)-2- | hexen-1-ol |
| CAS: 928-94-9 FEMA: 3924 JECFA: 1374 FLAVIS: 02.156 Use(s): flavor and fragrance agents | |
| 3- | hexen-1-ol |
| CAS: 544-12-7 FLAVIS: 02.159 Use(s): flavor and fragrance agents | |
| (E)-3- | hexen-1-ol |
| CAS: 928-97-2 FEMA: 4356 JECFA: 1621 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-ol |
| CAS: 928-96-1 FEMA: 2563 JECFA: 315 FLAVIS: 02.056 Use(s): flavor and fragrance agents | |
| 4- | hexenol |
| CAS: 6126-50-7 FEMA: 3430 JECFA: 318 FLAVIS: 02.074 Use(s): flavor and fragrance agents | |
| (E)-4- | hexen-1-ol |
| CAS: 928-92-7 FLAVIS: 02.161 Use(s): natural substances and extractives | |
| (Z)-4- | hexen-1-ol |
| CAS: 928-91-6 FEMA: 3430 FLAVIS: 02.160 Use(s): flavor and fragrance agents | |
| 5- | hexenol |
| CAS: 821-41-0 FEMA: 4351 JECFA: 1623 Use(s): flavoring agents | |
| 5- | hexen-2-ol |
| CAS: 626-94-8 Use(s): natural substances and extractives | |
| 5- | hexen-3-ol |
| CAS: 688-99-3 Use(s): information only not used for fragrances or flavors | |
| (R)-5- | hexen-2-ol |
| CAS: 17397-29-4 Use(s): information only not used for fragrances or flavors | |
| (S)-5- | hexen-2-ol |
| CAS: 17397-24-9 Use(s): information only not used for fragrances or flavors | |
| 1- | hexen-3-ol |
| CAS: 4798-44-1 FEMA: 3608 JECFA: 1151 FLAVIS: 02.104 Use(s): flavor and fragrance agents | |
| 2- | hexen-4-olide |
| CAS: 2407-43-4 FLAVIS: 10.046 Use(s): flavoring agents | |
| 1- | hexen-3-one |
| CAS: 1629-60-3 FLAVIS: 07.161 Use(s): flavoring agents | |
| 3- | hexen-2-one |
| CAS: 763-93-9 Use(s): natural substances and extractives | |
| (E)-3- | hexen-2-one |
| CAS: 4376-23-2 Use(s): natural substances and extractives | |
| 4- | hexen-3-one |
| CAS: 2497-21-4 FEMA: 3352 JECFA: 1125 FLAVIS: 07.048 Use(s): flavoring agents | |
| 4- | hexen-2-one |
| CAS: 25659-22-7 Use(s): information only not used for fragrances or flavors | |
| (E)-4- | hexen-3-one |
| CAS: 50396-87-7 Use(s): flavoring agents | |
| (Z)-4- | hexen-3-one |
| CAS: 50396-96-8 Use(s): flavoring agents | |
| 5- | hexen-3-one |
| CAS: 24253-30-3 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexenyl 3-hydroxybutanoate |
| CAS: 85762-21-6 Use(s): natural substances and extractives | |
| 1- | hexenyl acetate |
| CAS: 32797-50-5 Use(s): fragrance agents | |
| 2- | hexenyl acetate |
| CAS: 10094-40-3 Use(s): flavor and fragrance agents | |
| (E)-2- | hexen-1-yl acetate |
| CAS: 2497-18-9 FEMA: 2564 JECFA: 1355 FLAVIS: 09.394 Use(s): flavor and fragrance agents | |
| (Z)-2- | hexen-1-yl acetate |
| CAS: 56922-75-9 Use(s): natural substances and extractives | |
| 3- | hexenyl acetate |
| CAS: 1708-82-3 Use(s): flavor and fragrance agents | |
| (E)-3- | hexen-1-yl acetate |
| CAS: 3681-82-1 FEMA: 4413 JECFA: 2180 FLAVIS: 09.928 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-yl acetate |
| CAS: 3681-71-8 FEMA: 3171 JECFA: 134 FLAVIS: 09.197 Use(s): flavor and fragrance agents | |
| (E)-4- | hexen-1-yl acetate |
| CAS: 42125-17-7 FLAVIS: 09.572 Use(s): flavoring agents | |
| (Z)-4- | hexen-1-yl acetate |
| CAS: 42125-34-8 FLAVIS: 09.572 Use(s): flavoring agents | |
| 5- | hexenyl acetate |
| CAS: 5048-26-0 Use(s): natural substances and extractives | |
| 1- | hexen-3-yl acetate |
| CAS: 35926-04-6 Use(s): flavoring agents | |
| 3- | hexenyl acetoacetate |
| CAS: 72928-36-0 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl acetoacetate |
| CAS: 84434-20-8 FEMA: 4489 JECFA: 1974 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-yl acetyl anthranilate |
| CAS: 94333-66-1 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl angelate |
| CAS: 84060-80-0 Use(s): fragrance agents | |
| (Z)-3- | hexen-1-yl anisate |
| CAS: 121432-33-5 FLAVIS: 09.560 Use(s): flavor and fragrance agents | |
| (E)-3- | hexen-1-yl anthranilate |
| CAS: NF0173 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl anthranilate |
| CAS: 65405-76-7 FEMA: 3925 JECFA: 1538 FLAVIS: 09.561 Use(s): flavor and fragrance agents | |
| 3- | hexenyl benzoate |
| CAS: 72200-74-9 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | hexen-1-yl benzoate |
| CAS: 76841-70-8 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-yl benzoate |
| CAS: 25152-85-6 FEMA: 3688 JECFA: 858 FLAVIS: 09.806 Use(s): flavor and fragrance agents | |
| (E)-2- | hexen-1-yl butyrate |
| CAS: 53398-83-7 FEMA: 3926 JECFA: 1375 FLAVIS: 09.396 Use(s): flavor and fragrance agents | |
| (E)-2- | hexen-1-yl isobutyrate |
| CAS: NF007 Use(s): flavoring agents | |
| (Z)-2- | hexen-1-yl butyrate |
| CAS: 56922-77-1 Use(s): natural substances and extractives | |
| 3- | hexenyl butyrate |
| CAS: 2142-93-0 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | hexen-1-yl butyrate |
| CAS: 53398-84-8 Use(s): flavor and fragrance agents | |
| (E)-3- | hexen-1-yl isobutyrate |
| CAS: 84682-20-2 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-yl butyrate |
| CAS: 16491-36-4 FEMA: 3402 JECFA: 157 FLAVIS: 09.270 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-yl isobutyrate |
| CAS: 41519-23-7 FEMA: 3929 JECFA: 1275 FLAVIS: 09.563 Use(s): flavor and fragrance agents | |
| 3- | hexenyl isobutyrate |
| CAS: 57859-47-9 Use(s): natural substances and extractives | |
| (E)-4- | hexen-1-yl butyrate |
| CAS: 809271-90-7 Use(s): information only not used for fragrances or flavors | |
| (Z)-4- | hexen-1-yl butyrate |
| CAS: 69727-41-9 Use(s): natural substances and extractives | |
| 5- | hexenyl butyrate |
| CAS: 108058-75-9 Use(s): natural substances and extractives | |
| (Z)-3- | hexen-1-yl cinnamate |
| CAS: 68133-75-5 Use(s): fragrance agents | |
| (E)-3- | hexen-1-yl crotonate |
| CAS: 68938-58-9 Use(s): flavoring agents | |
| (Z)-3- | hexen-1-yl (E)-crotonate |
| CAS: 65405-80-3 FEMA: 3982 JECFA: 1276 FLAVIS: 09.566 Use(s): flavor and fragrance agents | |
| (Z)-1-(3- | hexen-1-yl) cyclohexan-1-ol |
| CAS: 93963-11-2 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl 2-oxocyclopentane carboxylate |
| CAS: 94087-84-0 Use(s): information only not used for fragrances or flavors | |
| hexenyl cyclopentanone | |
| CAS: 34687-46-2 Use(s): fragrance agents | |
| 3- | hexenyl cyclopentanone |
| CAS: 68133-74-4 Use(s): fragrance agents | |
| 2- | hexenyl cyclopentanyl acetate |
| CAS: 149982-46-7 Use(s): fragrance agents | |
| (Z)-3- | hexen-1-yl-2-cyclopenten-1-one |
| CAS: 53253-09-1 Use(s): fragrance agents | |
| (E)-3- | hexen-1-yl (Z,Z)-2,4-decadienoate |
| CAS: 94109-96-3 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | hexen-1-yl decanoate |
| CAS: NF0172 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl decanoate |
| CAS: 85554-69-4 FLAVIS: 09.567 Use(s): flavor and fragrance agents | |
| (E)-5-(3- | hexen-1-yl) dihydrofuran-2(3H)-one |
| CAS: 97416-87-0 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | hexen-1-yl dihydro-5-methyl furan-2(3H)-one |
| CAS: 14252-84-7 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | hexen-1-yl 2-ethyl butyrate |
| CAS: NF0176 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl 2-ethyl butyrate |
| CAS: 94071-12-2 Use(s): flavor and fragrance agents | |
| 3- | hexenyl 2-ethyl butyrate |
| CAS: 233666-04-1 FLAVIS: 09.884 Use(s): flavor and fragrance agents | |
| (E)-2- | hexen-1-yl formate |
| CAS: 53398-78-0 FEMA: 3927 JECFA: 1376 FLAVIS: 09.397 Use(s): flavor and fragrance agents | |
| 3- | hexenyl formate |
| CAS: 2315-09-5 JECFA: 1272 FLAVIS: 09.846 Use(s): flavor and fragrance agents | |
| (E)-3- | hexen-1-yl formate |
| CAS: 56922-80-6 FLAVIS: 09.562 Use(s): flavoring agents | |
| (Z)-3- | hexen-1-yl formate |
| CAS: 33467-73-1 FEMA: 3353 JECFA: 123 FLAVIS: 09.240 Use(s): flavor and fragrance agents | |
| (E)-2- | hexen-1-yl heptanoate |
| CAS: 125680-98-0 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | hexen-1-yl heptanoate |
| CAS: NF0171 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl heptanoate |
| CAS: 61444-39-1 FLAVIS: 09.575 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-yl heptine carbonate |
| CAS: 68698-58-8 Use(s): information only not used for fragrances or flavors | |
| 2- | hexenyl hexanoate |
| CAS: 10448-24-5 Use(s): natural substances and extractives | |
| (E)-2- | hexen-1-yl hexanoate |
| CAS: 53398-86-0 FEMA: 3983 JECFA: 1381 FLAVIS: 09.398 Use(s): flavor and fragrance agents | |
| (Z)-2- | hexen-1-yl hexanoate |
| CAS: 56922-79-3 Use(s): natural substances and extractives | |
| 3- | hexenyl hexanoate |
| CAS: 84434-19-5 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | hexen-1-yl hexanoate |
| CAS: 56922-82-8 FLAVIS: 09.855 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-yl hexanoate |
| CAS: 31501-11-8 FEMA: 3403 JECFA: 165 FLAVIS: 09.271 Use(s): flavor and fragrance agents | |
| (E)-4- | hexen-1-yl hexanoate |
| CAS: NF0170 Use(s): natural substances and extractives | |
| (Z)-4- | hexen-1-yl hexanoate |
| CAS: 88552-98-1 Use(s): natural substances and extractives | |
| 5- | hexenyl hexanoate |
| CAS: 108058-81-7 Use(s): natural substances and extractives | |
| (E)-3- | hexen-1-yl (E)-3-hexenoate |
| CAS: 61444-37-9 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | hexen-1-yl (Z)-3-hexenoate |
| CAS: 53398-88-2 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl (E)-2-hexenoate |
| CAS: 53398-87-1 FEMA: 3928 JECFA: 1279 FLAVIS: 09.568 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-yl (E)-3-hexenoate |
| CAS: 74638-19-0 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl (Z)-3-hexenoate |
| CAS: 61444-38-0 FEMA: 3689 JECFA: 336 FLAVIS: 09.291 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-yl 5-hexenoate |
| CAS: 106917-24-2 Use(s): natural substances and extractives | |
| 5- | hexenyl 5-hexenoate |
| CAS: 77131-17-0 Use(s): natural substances and extractives | |
| (Z)-2- | hexen-1-yl isobutyrate |
| CAS: NF0169 Use(s): information only not used for fragrances or flavors | |
| (Z)-2- | hexen-1-yl isovalerate |
| CAS: 54675-77-3 Use(s): natural substances and extractives | |
| (E)-3- | hexen-1-yl isovalerate |
| CAS: 88296-26-8 Use(s): natural substances and extractives | |
| (E)-2- | hexen-1-yl lactate |
| CAS: 85554-71-8 Use(s): information only not used for fragrances or flavors | |
| (Z)-2- | hexen-1-yl lactate |
| CAS: 102832-13-3 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | hexen-1-yl lactate |
| CAS: NF0167 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl lactate |
| CAS: 61931-81-5 FEMA: 3690 JECFA: 934 FLAVIS: 09.545 Use(s): flavor and fragrance agents | |
| (E)-3- | hexen-1-yl levulinate |
| CAS: NF0166 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl levulinate |
| CAS: 85554-70-7 Use(s): flavoring agents | |
| (E)-2- | hexen-1-yl 2-methyl butyrate |
| CAS: 94089-01-7 FEMA: 4274 JECFA: 1797 Use(s): flavor and fragrance agents | |
| (Z)-2- | hexen-1-yl 2-methyl butyrate |
| CAS: NF0174 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | hexen-1-yl 2-methyl butyrate |
| CAS: NF0175 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl 2-methyl butyrate |
| CAS: 53398-85-9 FEMA: 3497 FLAVIS: 09.854 Use(s): flavor and fragrance agents | |
| 3- | hexenyl 2-methyl butyrate |
| CAS: 10094-41-4 FEMA: 3497 JECFA: 211 FLAVIS: 09.506 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-yl methyl carbonate |
| CAS: 67633-96-9 FLAVIS: 09.838 Use(s): flavor and fragrance agents | |
| (E)-3- | hexenyl methyl ether |
| CAS: 121441-40-5 Use(s): fragrance agents | |
| (Z)-3- | hexenyl methyl ether |
| CAS: 70220-06-3 Use(s): fragrance agents | |
| (Z)-2-(3- | hexen-1-yl)-5-methyl furan |
| CAS: 4868-20-6 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl 2-methyl-2-pentenoate |
| CAS: 76649-17-7 Use(s): fragrance agents | |
| (E)-3- | hexen-1-yl nicotinate |
| CAS: NF0165 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl nicotinate |
| CAS: 85098-91-5 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl nonanoate |
| CAS: 88191-46-2 Use(s): natural substances and extractives | |
| (E)-2- | hexen-1-yl octanoate |
| CAS: 85554-72-9 FEMA: 4135 JECFA: 1796 FLAVIS: 09.841 Use(s): flavor and fragrance agents | |
| (E)-3- | hexen-1-yl octanoate |
| CAS: 87619-90-7 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl octanoate |
| CAS: 61444-41-5 FLAVIS: 09.569 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-yl octine carbonate |
| CAS: 68480-29-5 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl oxyacetaldehyde |
| CAS: 68133-72-2 Use(s): fragrance agents | |
| (E)-2-(3- | hexen-1-yl oxy)-1,3-dioxolane |
| CAS: 93919-13-2 Use(s): information only not used for fragrances or flavors | |
| (Z)-2-(3- | hexen-1-yl oxy) ethanol |
| CAS: 94088-27-4 Use(s): information only not used for fragrances or flavors | |
| (Z)-2-(3- | hexenyl oxy)-3-methyl pyrazine |
| CAS: 94159-29-2 Use(s): information only not used for fragrances or flavors | |
| hexen-1-yl oxypropane nitrile | |
| CAS: 142653-61-0 Use(s): fragrance agents | |
| (Z)-2-(3- | hexen-1-yl oxy) tetrahydro-2H-pyran |
| CAS: 90879-06-4 Use(s): information only not used for fragrances or flavors | |
| 3- | hexenyl palmitate |
| CAS: 233666-03-0 FLAVIS: 09.885 Use(s): flavoring agents | |
| (Z)-3- | hexen-1-yl palmitate |
| CAS: 117210-57-8 Use(s): natural substances and extractives | |
| 2- | hexenyl phenyl acetate |
| CAS: 71605-86-2 Use(s): information only not used for fragrances or flavors | |
| (E)-2- | hexen-1-yl phenyl acetate |
| CAS: 68133-78-8 FLAVIS: 09.400 Use(s): flavor and fragrance agents | |
| (E)-3- | hexen-1-yl phenyl acetate |
| CAS: 1824720-88-8 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl phenyl acetate |
| CAS: 42436-07-7 FEMA: 3633 JECFA: 1016 FLAVIS: 09.805 Use(s): flavor and fragrance agents | |
| (E)-3- | hexen-1-yl pivalate |
| CAS: 653002-72-3 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl pivalate |
| CAS: 84604-59-1 Use(s): information only not used for fragrances or flavors | |
| (E)-2- | hexen-1-yl propionate |
| CAS: 53398-80-4 FEMA: 3932 JECFA: 1378 FLAVIS: 09.395 Use(s): flavor and fragrance agents | |
| (Z)-2- | hexen-1-yl propionate |
| CAS: 56922-76-0 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | hexen-1-yl propionate |
| CAS: 53398-81-5 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-yl propionate |
| CAS: 33467-74-2 FEMA: 3933 JECFA: 1274 FLAVIS: 09.564 Use(s): flavor and fragrance agents | |
| (E)-4- | hexen-1-yl propionate |
| CAS: 33467-75-3 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | hexen-1-yl pyruvate |
| CAS: NF031 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl pyruvate |
| CAS: 68133-76-6 FEMA: 3934 JECFA: 1846 FLAVIS: 09.565 Use(s): flavor and fragrance agents | |
| (E)-2- | hexen-1-yl salicylate |
| CAS: 68133-77-7 Use(s): fragrance agents | |
| (E)-3- | hexen-1-yl salicylate |
| CAS: 68141-22-0 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl salicylate |
| CAS: 65405-77-8 FEMA: 4750 FLAVIS: 09.570 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-yl senecioate |
| CAS: 65416-28-6 Use(s): flavoring agents | |
| N- | hexenyl succinic anhydride |
| CAS: 10500-34-2 Use(s): information only not used for fragrances or flavors | |
| 5- | hexenyl isothiocyanate |
| CAS: 49776-81-0 FEMA: 4421 JECFA: 1894 Use(s): flavoring agents | |
| 2-(5- | hexenyl thio) ethanol |
| CAS: 82010-85-3 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl tiglate |
| CAS: 67883-79-8 FEMA: 3931 JECFA: 1277 FLAVIS: 09.559 Use(s): flavor and fragrance agents | |
| (E)-2- | hexen-1-yl valerate |
| CAS: 56922-74-8 FEMA: 3935 JECFA: 1379 Use(s): flavor and fragrance agents | |
| (E)-2- | hexen-1-yl isovalerate |
| CAS: 68698-59-9 FEMA: 3930 JECFA: 1377 FLAVIS: 09.399 Use(s): flavor and fragrance agents | |
| (E)-3- | hexen-1-yl valerate |
| CAS: 56922-81-7 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-yl valerate |
| CAS: 35852-46-1 FEMA: 3936 JECFA: 1278 FLAVIS: 09.571 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-yl isovalerate |
| CAS: 35154-45-1 FEMA: 3498 Use(s): flavor and fragrance agents | |
| (E)-4- | hexen-1-yl valerate |
| CAS: 903552-55-6 Use(s): information only not used for fragrances or flavors | |
| 3- | hexenyl isovalerate |
| CAS: 10032-11-8 FEMA: 3498 JECFA: 202 FLAVIS: 09.505 Use(s): flavor and fragrance agents | |
| hexose oxidase from chondrus crispus expressed in hansenula polymorpha | |
| CAS: 9028-75-5 Use(s): enzyme preparations and microorganisms | |
| hexoxyacetaldehyde dimethyl acetal | |
| CAS: 17597-95-4 Use(s): fragrance agents | |
| 2- | hexoxyacetaldehyde dipropylene glycol acetal |
| CAS: 71832-77-4 Use(s): information only not used for fragrances or flavors | |
| hexoxyethyl pivalate | |
| CAS: 68757-58-4 Use(s): information only not used for fragrances or flavors | |
| 2- | hexoxy-5-pentyl tetrahydrofuran |
| CAS: 78054-02-1 Use(s): natural substances and extractives | |
| hexyl 2-glyceryl ascorbate | |
| Use(s): cosmetic agents | |
| hexyl 3-glyceryl ascorbate | |
| Use(s): cosmetic agents | |
| N- | hexyl acetamide |
| CAS: 7501-79-3 Use(s): natural substances and extractives | |
| hexyl acetate | |
| CAS: 142-92-7 FEMA: 2565 JECFA: 128 FLAVIS: 09.006 Use(s): flavor and fragrance agents | |
| 2- | hexyl acetate |
| CAS: 5953-49-1 Use(s): flavoring agents | |
| hexyl acetoacetate | |
| CAS: 13562-84-0 Use(s): information only not used for fragrances or flavors | |
| 2- | hexyl-4-acetoxytetrahydrofuran |
| CAS: 10039-39-1 FEMA: 2566 JECFA: 1440 Use(s): flavoring agents | |
| hexyl acrylate | |
| CAS: 2499-95-8 Use(s): information only not used for fragrances or flavors | |
| sec- | hexyl alcohol |
| CAS: 97-95-0 FLAVIS: 02.043 Use(s): flavor and fragrance agents | |
| 1- | hexyl allyl formate |
| CAS: 84681-89-0 Use(s): information only not used for fragrances or flavors | |
| hexyl amine | |
| CAS: 111-26-2 FEMA: 4243 JECFA: 1588 FLAVIS: 11.016 Use(s): flavoring agents | |
| hexyl ortho-anisate | |
| CAS: 71605-88-4 Use(s): information only not used for fragrances or flavors | |
| hexyl para-anisate | |
| CAS: 71607-26-6 Use(s): information only not used for fragrances or flavors | |
| hexyl anthranilate | |
| CAS: 18189-05-4 Use(s): flavor and fragrance agents | |
| 4- | hexyl benzaldehyde |
| CAS: 49763-69-1 Use(s): information only not used for fragrances or flavors | |
| hexyl benzoate | |
| CAS: 6789-88-4 FEMA: 3691 JECFA: 854 FLAVIS: 09.768 Use(s): flavor and fragrance agents | |
| 4- | hexyl benzoic acid |
| CAS: 21643-38-9 Use(s): information only not used for fragrances or flavors | |
| 2- | hexyl benzothiazole |
| CAS: 65718-88-9 Use(s): natural substances and extractives | |
| hexyl butyrate | |
| CAS: 2639-63-6 FEMA: 2568 JECFA: 153 FLAVIS: 09.045 Use(s): flavor and fragrance agents | |
| 2- | hexyl butyrate |
| CAS: 6963-52-6 Use(s): natural substances and extractives | |
| hexyl isobutyrate | |
| CAS: 2349-07-7 FEMA: 3172 JECFA: 189 FLAVIS: 09.478 Use(s): flavor and fragrance agents | |
| iso | hexyl caprate |
| CAS: 138208-67-0 Use(s): emollients | |
| hexyl carbitol | |
| CAS: 112-59-4 Use(s): information only not used for fragrances or flavors | |
| hexyl carbonate tetrahydrofurfuryl lactate | |
| CAS: 64058-40-8 Use(s): information only not used for fragrances or flavors | |
| (E)-alpha- | hexyl cinnamaldehyde |
| CAS: 165184-98-5 FEMA: 2569 Use(s): flavor and fragrance agents | |
| (Z)-alpha- | hexyl cinnamaldehyde |
| CAS: 101-86-0 Use(s): flavor and fragrance agents | |
| alpha- | hexyl cinnamaldehyde |
| CAS: 101-86-0 FEMA: 2569 JECFA: 686 FLAVIS: 05.041 Use(s): flavor and fragrance agents | |
| alpha- | hexyl cinnamaldehyde diethyl acetal |
| CAS: 67845-59-4 Use(s): fragrance agents | |
| alpha- | hexyl cinnamaldehyde dimethyl acetal |
| CAS: 29896-45-5 Use(s): fragrance agents | |
| hexyl cinnamate | |
| CAS: 3488-00-4 Use(s): fragrance agents | |
| 6- | hexyl-meta-cresol |
| CAS: 39236-85-6 Use(s): information only not used for fragrances or flavors | |
| (E)- | hexyl crotonate |
| CAS: 1617-25-0 FLAVIS: 09.578 Use(s): flavoring agents | |
| hexyl cyclohexane | |
| CAS: 4292-75-5 Use(s): natural substances and extractives | |
| hexyl cyclohexane carboxylate | |
| CAS: 27948-10-3 Use(s): information only not used for fragrances or flavors | |
| hexyl cyclopentane | |
| CAS: 4457-00-5 Use(s): natural substances and extractives | |
| 1- | hexyl cyclopentene |
| CAS: 4291-99-0 Use(s): natural substances and extractives | |
| hexyl (E,Z)-2,4-decadienoate | |
| CAS: 28380-11-2 Use(s): natural substances and extractives | |
| hexyl decanoate | |
| CAS: 10448-26-7 FEMA: 4342 JECFA: 1874 Use(s): flavor and fragrance agents | |
| 2- | hexyl decan-1-ol |
| CAS: 2425-77-6 Use(s): cosmetic agents | |
| 2- | hexyl-2-decenal |
| CAS: 13893-39-5 FEMA: 4786 Use(s): flavoring agents | |
| 2- | hexyl decyl isononanoate |
| CAS: 93843-29-9 Use(s): information only not used for fragrances or flavors | |
| 2- | hexyl decyl octanoate |
| CAS: 93777-70-9 Use(s): information only not used for fragrances or flavors | |
| hexyl dihydrocinnamate | |
| CAS: 220766-75-6 Use(s): natural substances and extractives | |
| 5- | hexyl dihydromethyl furan-2(3H)-one |
| CAS: 93980-90-6 Use(s): information only not used for fragrances or flavors | |
| 2- | hexyl-4,5-dimethyl oxazole |
| CAS: 20662-87-7 Use(s): natural substances and extractives | |
| 4- | hexyl-2,5-dimethyl oxazole |
| CAS: 20662-86-6 Use(s): natural substances and extractives | |
| 5- | hexyl-2,4-dimethyl oxazole |
| CAS: 20662-85-5 Use(s): information only not used for fragrances or flavors | |
| 2- | hexyl-4,5-dimethyl thiazole |
| CAS: 87262-49-5 Use(s): natural substances and extractives | |
| 2- | hexyl-1,3-dioxane |
| CAS: 6290-20-6 Use(s): information only not used for fragrances or flavors | |
| 4- | hexyl-1,3-dioxane |
| CAS: 2244-85-1 Use(s): information only not used for fragrances or flavors | |
| hexyl docosanoate | |
| CAS: 26720-37-6 Use(s): natural substances and extractives | |
| hexyl (Z)-13-docosenoate | |
| CAS: 19773-56-9 Use(s): information only not used for fragrances or flavors | |
| hexyl 2-ethyl hexanoate | |
| CAS: 20748-87-2 Use(s): information only not used for fragrances or flavors | |
| hexyl ethylidene aminobenzoate | |
| CAS: 72968-69-5 Use(s): fragrance agents | |
| hexyl formate | |
| CAS: 629-33-4 FEMA: 2570 JECFA: 120 FLAVIS: 09.161 Use(s): flavor and fragrance agents | |
| 2- | hexyl furan |
| CAS: 3777-70-6 Use(s): natural substances and extractives | |
| hexyl 2-furoate | |
| CAS: 39251-86-0 FEMA: 2571 JECFA: 749 FLAVIS: 13.005 Use(s): flavor and fragrance agents | |
| hexyl heptanoate | |
| CAS: 1119-06-8 FEMA: 4337 JECFA: 1872 Use(s): flavor and fragrance agents | |
| hexyl heptyl ether | |
| CAS: 7289-40-9 Use(s): information only not used for fragrances or flavors | |
| hexyl hexanoate | |
| CAS: 6378-65-0 FEMA: 2572 JECFA: 164 FLAVIS: 09.066 Use(s): flavor and fragrance agents | |
| hexyl 2-hexenoate | |
| CAS: 16930-97-5 Use(s): information only not used for fragrances or flavors | |
| hexyl 3-hexenoate | |
| CAS: 41599-57-9 Use(s): information only not used for fragrances or flavors | |
| hexyl 5-hexenoate | |
| CAS: 106917-23-1 Use(s): natural substances and extractives | |
| hexyl (E)-2-hexenoate | |
| CAS: 33855-57-1 FEMA: 3692 JECFA: 1810 FLAVIS: 09.292 Use(s): flavoring agents | |
| hexyl (Z)-3-hexenoate | |
| CAS: 89352-68-1 Use(s): natural substances and extractives | |
| hexyl 4-hydroxybenzoate | |
| CAS: 1083-27-8 Use(s): information only not used for fragrances or flavors | |
| hexyl 3-hydroxybutanoate | |
| CAS: 87128-51-6 Use(s): natural substances and extractives | |
| 2- | hexyl-5-hydroxy-1,3-dioxane |
| CAS: 1708-36-7 FLAVIS: 06.102 Use(s): flavor and fragrance agents | |
| cis-2- | hexyl-5-hydroxy-1,3-dioxane |
| CAS: 18445-22-2 Use(s): information only not used for fragrances or flavors | |
| trans-2- | hexyl-5-hydroxy-1,3-dioxane |
| CAS: 18550-94-2 Use(s): information only not used for fragrances or flavors | |
| hexyl (R)-12-hydroxyoleate | |
| CAS: 6030-14-4 Use(s): information only not used for fragrances or flavors | |
| hexyl isononanoate | |
| CAS: 84878-29-5 Use(s): information only not used for fragrances or flavors | |
| hexyl isooctanoate | |
| CAS: 84878-24-0 Use(s): information only not used for fragrances or flavors | |
| 2- | hexyl-5 or 6-keto-1,4-dioxane |
| CAS: 65504-97-4 FEMA: 2574 JECFA: 1486 Use(s): flavoring agents | |
| hexyl lactate | |
| CAS: 20279-51-0 FLAVIS: 09.580 Use(s): flavor and fragrance agents | |
| hexyl laurate | |
| CAS: 34316-64-8 FLAVIS: 09.579 Use(s): flavor and fragrance agents | |
| iso | hexyl laurate |
| CAS: 55194-05-3 Use(s): emollients | |
| hexyl levulinate | |
| CAS: 24431-34-3 Use(s): information only not used for fragrances or flavors | |
| hexyl mandelate | |
| CAS: 5431-31-2 Use(s): information only not used for fragrances or flavors | |
| hexyl mercaptan | |
| CAS: 111-31-9 FEMA: 3842 JECFA: 518 FLAVIS: 12.132 Use(s): flavoring agents | |
| hexyl 3-mercaptobutanoate | |
| CAS: 796857-79-9 FEMA: 4136 JECFA: 1704 FLAVIS: 12.292 Use(s): flavoring agents | |
| hexyl methanesulfinate | |
| Use(s): information only not used for fragrances or flavors | |
| 2-iso | hexyl-3-methoxypyrazine |
| CAS: 68844-95-1 Use(s): fragrance agents | |
| hexyl 2-methyl butyrate | |
| CAS: 10032-15-2 FEMA: 3499 JECFA: 208 FLAVIS: 09.507 Use(s): flavor and fragrance agents | |
| 2- | hexyl-5-methyl furan |
| CAS: 5312-82-3 Use(s): information only not used for fragrances or flavors | |
| 2- | hexyl-5-methyl-3(2H)-furanone |
| CAS: 33922-66-6 Use(s): natural substances and extractives | |
| hexyl 2-methyl-3-pentenoate | |
| CAS: 85508-08-3 FEMA: 3693 Use(s): flavor and fragrance agents | |
| hexyl (E)-2-methyl-3-pentenoate | |
| CAS: 58625-95-9 FEMA: 3693 JECFA: 352 FLAVIS: 09.546 Use(s): flavor and fragrance agents | |
| hexyl 2-methyl-4-pentenoate | |
| CAS: 58031-03-1 FEMA: 3693 Use(s): flavor and fragrance agents | |
| 5- | hexyl-2-methyl pyridine |
| CAS: 710-40-7 Use(s): fragrance agents | |
| 2- | hexyl-2-methyl thiazolidine |
| CAS: 702-87-4 Use(s): natural substances and extractives | |
| 2- | hexyl-2-methyl-1,3-dioxolane |
| CAS: 937-94-0 Use(s): information only not used for fragrances or flavors | |
| hexyl 2-methyl-2-pentenoate | |
| Use(s): information only not used for fragrances or flavors | |
| hexyl myristate | |
| CAS: 42231-99-2 FLAVIS: 09.582 Use(s): flavor and fragrance agents | |
| hexyl nicotinate | |
| CAS: 23597-82-2 Use(s): cosmetic agents | |
| hexyl nonanoate | |
| CAS: 6561-39-3 FEMA: 4339 JECFA: 1873 Use(s): flavor and fragrance agents | |
| 2- | hexyl nonanoic acid |
| CAS: 37165-63-2 Use(s): information only not used for fragrances or flavors | |
| hexyl octanoate | |
| CAS: 1117-55-1 FEMA: 2575 JECFA: 175 FLAVIS: 09.113 Use(s): flavor and fragrance agents | |
| 2- | hexyl octanoic acid |
| CAS: 60948-91-6 Use(s): cosmetic agents | |
| hexyl 7-octenoate | |
| CAS: 108058-84-0 Use(s): natural substances and extractives | |
| hexyl (E)-2-octenoate | |
| CAS: 85554-64-9 Use(s): flavor and fragrance agents | |
| 2- | hexyl octyl cyclopentane |
| CAS: 55044-77-4 Use(s): natural substances and extractives | |
| hexyl (Z)-oleate | |
| CAS: 20290-84-0 FLAVIS: 09.865 Use(s): cosmetic and fragrance agents | |
| hexyl oxyacetonitrile | |
| CAS: 66912-24-1 Use(s): information only not used for fragrances or flavors | |
| 3' | hexyl oxyacetophenone |
| CAS: 37062-71-8 Use(s): natural substances and extractives | |
| hexyl palmitate | |
| CAS: 42232-25-7 Use(s): information only not used for fragrances or flavors | |
| 8- | hexyl pentadecane |
| CAS: 13475-75-7 Use(s): natural substances and extractives | |
| hexyl phenyl acetate | |
| CAS: 5421-17-0 FEMA: 3457 JECFA: 1015 FLAVIS: 09.804 Use(s): flavor and fragrance agents | |
| hexyl pivalate | |
| CAS: 5434-57-1 Use(s): fragrance agents | |
| hexyl propionate | |
| CAS: 2445-76-3 FEMA: 2576 JECFA: 144 FLAVIS: 09.139 Use(s): flavor and fragrance agents | |
| hexyl propyl disulfide | |
| CAS: 64580-54-7 FEMA: 4900 Use(s): flavoring agents | |
| 2- | hexyl pyrazine |
| CAS: 28217-91-6 Use(s): information only not used for fragrances or flavors | |
| 2- | hexyl pyridine |
| CAS: 1129-69-7 FLAVIS: 14.117 Use(s): flavoring agents | |
| 3- | hexyl pyridine |
| CAS: 6311-92-8 Use(s): flavoring agents | |
| 4- | hexyl pyridine |
| CAS: 27876-24-0 Use(s): information only not used for fragrances or flavors | |
| 4- | hexyl resorcinol |
| CAS: 136-77-6 Use(s): antioxidants | |
| hexyl salicylate | |
| CAS: 6259-76-3 FLAVIS: 09.581 Use(s): flavor and fragrance agents | |
| hexyl senecioate | |
| CAS: 17627-41-7 Use(s): natural substances and extractives | |
| 1- | hexyl senecioate |
| CAS: 16931-10-5 Use(s): natural substances and extractives | |
| hexyl stearate | |
| CAS: 3460-37-5 Use(s): information only not used for fragrances or flavors | |
| hexyl sulfide | |
| CAS: 6294-31-1 Use(s): information only not used for fragrances or flavors | |
| hexyl thiocyanate | |
| CAS: 6803-40-3 Use(s): information only not used for fragrances or flavors | |
| hexyl isothiocyanate | |
| CAS: 4404-45-9 FEMA: 4422 JECFA: 1895 Use(s): flavoring agents | |
| 2-( | hexyl thio)-3-methyl pyrazine |
| CAS: 73972-65-3 Use(s): information only not used for fragrances or flavors | |
| 2- | hexyl thiophene |
| CAS: 18794-77-9 FEMA: 4137 JECFA: 1764 FLAVIS: 15.076 Use(s): flavoring agents | |
| hexyl tiglate | |
| CAS: 16930-96-4 Use(s): flavor and fragrance agents | |
| hexyl (E)-tiglate | |
| CAS: 19089-92-0 FEMA: 3354 JECFA: 1807 FLAVIS: 09.266 Use(s): flavor and fragrance agents | |
| hexyl (Z)-tiglate | |
| CAS: 65652-33-7 Use(s): flavor and fragrance agents | |
| 2- | hexyl-2-undecenal |
| CAS: 24823-56-1 Use(s): information only not used for fragrances or flavors | |
| hexyl valerate | |
| CAS: 1117-59-5 FLAVIS: 09.583 Use(s): flavor and fragrance agents | |
| hexyl isovalerate | |
| CAS: 10032-13-0 FEMA: 3500 JECFA: 199 FLAVIS: 09.529 Use(s): flavor and fragrance agents | |
| hexyl vanillate | |
| CAS: 84375-71-3 Use(s): information only not used for fragrances or flavors | |
| hexyl vanillate-2-ethoxybenzoic acid | |
| CAS: 126294-32-4 Use(s): information only not used for fragrances or flavors | |
| hexyl vinyl carbinyl acetate | |
| CAS: 31795-37-6 Use(s): fragrance agents | |
| 2- | hexyl-5-[2-(4-hydroxy-3-methoxyphenyl)ethyl]furan |
| CAS: 143114-91-4 Use(s): natural substances and extractives | |
| cis-2- | hexylcyclopropaneacetic acid |
| CAS: 4707-61-3 FEMA: 4892 Use(s): flavoring agents | |
| hexyldecyl laurate | |
| CAS: 34362-27-1 Use(s): emollients, skin conditioning | |
| hexyldecyl myristoyl methylaminopropionate | |
| CAS: 645337-39-9 Use(s): emollients, skin conditioning | |
| hexyldecyl palmitate | |
| CAS: 69275-02-1 Use(s): cosmetic ingredient for skin conditioning | |
| hexyldecyl stearate | |
| CAS: 17618-45-0 Use(s): emollients, skin conditioning | |
| bis-( | hexyldecyl/octyldodecyl) lauroyl glutamate |
| Use(s): emollients | |
| hexyldecyloctadecanol | |
| Use(s): emollients, skin conditioning | |
| bis- | hexyldioxodecyl methyl lysinate |
| CAS: 943454-44-2 Use(s): cosmetic ingredient for skin protecting | |
| hexyldioxodecyl methyl tyrosinate | |
| CAS: 943454-45-3 Use(s): cosmetic ingredient for skin protecting | |
| hexyldodecyl salicylate | |
| CAS: 220778-06-3 Use(s): cosmetic agents | |
| hexylene glycol | |
| CAS: 107-41-5 Use(s): cosmetic ingredient for skin and hair care | |
| (R)- | hexylene glycol |
| CAS: 99210-90-9 Use(s): information only not used for fragrances or flavors | |
| (S)- | hexylene glycol |
| CAS: 99113-75-4 Use(s): information only not used for fragrances or flavors | |
| hexylene glycol diacetate | |
| CAS: 1637-24-7 Use(s): information only not used for fragrances or flavors | |
| hexylene oxide | |
| CAS: 1436-34-6 Use(s): information only not used for fragrances or flavors | |
| 2- | hexylidene cyclohexan-1-one |
| CAS: 16429-07-5 Use(s): fragrance agents | |
| 2- | hexylidene cyclopentanone |
| CAS: 17373-89-6 FEMA: 2573 JECFA: 1106 FLAVIS: 07.034 Use(s): flavor and fragrance agents | |
| hexyloxodecanamide MEA | |
| CAS: 884905-11-7 Use(s): cosmetic ingredient for skin protecting | |
| hexyloxodecanamide MEA phosphate | |
| CAS: 934175-85-6 Use(s): cosmetic ingredient for skin protecting | |
| hexyloxy trimethylphenol | |
| CAS: 148081-72-5 Use(s): antioxidants | |
| 5- | hexyltetrahydro-2-furanoctanoic acid |
| CAS: 61781-98-4 Use(s): information only not used for fragrances or flavors | |
| heyderiol | |
| CAS: 96447-67-5 Use(s): natural substances and extractives |